@@ -315,13 +315,14 @@ double Agc::estimateLuminance(IPAFrameContext &frameContext,
/**
* \brief Process IPU3 statistics, and run AGC operations
+ * \param frame The frame number
* \param[in] context The shared IPA context
* \param[in] stats The IPU3 statistics and ISP results
*
* Identify the current image brightness, and use that to estimate the optimal
* new exposure and gain for the scene.
*/
-void Agc::process(IPAContext &context, const ipu3_uapi_stats_3a *stats)
+void Agc::process(const uint32_t frame, IPAContext &context, const ipu3_uapi_stats_3a *stats)
{
/*
* Estimate the gain needed to have the proportion of pixels in a given
@@ -28,7 +28,7 @@ public:
~Agc() = default;
int configure(IPAContext &context, const IPAConfigInfo &configInfo) override;
- void process(IPAContext &context, const ipu3_uapi_stats_3a *stats) override;
+ void process(const uint32_t frame, IPAContext &context, const ipu3_uapi_stats_3a *stats) override;
private:
double measureBrightness(const ipu3_uapi_stats_3a *stats,
@@ -387,7 +387,7 @@ void Awb::calculateWBGains(const ipu3_uapi_stats_3a *stats)
/**
* \copydoc libcamera::ipa::Algorithm::process
*/
-void Awb::process(IPAContext &context, const ipu3_uapi_stats_3a *stats)
+void Awb::process(const uint32_t frame, IPAContext &context, const ipu3_uapi_stats_3a *stats)
{
calculateWBGains(stats);
@@ -411,7 +411,7 @@ constexpr uint16_t Awb::threshold(float value)
/**
* \copydoc libcamera::ipa::Algorithm::prepare
*/
-void Awb::prepare(IPAContext &context, ipu3_uapi_params *params)
+void Awb::prepare([[maybe_unused]] const uint32_t frame, IPAContext &context, ipu3_uapi_params *params)
{
/*
* Green saturation thresholds are reduced because we are using the
@@ -39,8 +39,8 @@ public:
~Awb();
int configure(IPAContext &context, const IPAConfigInfo &configInfo) override;
- void prepare(IPAContext &context, ipu3_uapi_params *params) override;
- void process(IPAContext &context, const ipu3_uapi_stats_3a *stats) override;
+ void prepare(const uint32_t frame, IPAContext &context, ipu3_uapi_params *params) override;
+ void process(const uint32_t frame, IPAContext &context, const ipu3_uapi_stats_3a *stats) override;
private:
/* \todo Make these structs available to all the ISPs ? */
@@ -38,14 +38,16 @@ BlackLevelCorrection::BlackLevelCorrection()
/**
* \brief Fill in the parameter structure, and enable black level correction
+ * \param frame The frame number
* \param context The shared IPA context
* \param params The IPU3 parameters
*
* Populate the IPU3 parameter structure with the correction values for each
* channel and enable the corresponding ImgU block processing.
*/
-void BlackLevelCorrection::prepare([[maybe_unused]] IPAContext &context,
- ipu3_uapi_params *params)
+void BlackLevelCorrection::prepare([[maybe_unused]] const uint32_t frame,
+ [[maybe_unused]] IPAContext &context,
+ ipu3_uapi_params *params)
{
/*
* The Optical Black Level correction values
@@ -18,7 +18,7 @@ class BlackLevelCorrection : public Algorithm
public:
BlackLevelCorrection();
- void prepare(IPAContext &context, ipu3_uapi_params *params) override;
+ void prepare(const uint32_t frame, IPAContext &context, ipu3_uapi_params *params) override;
};
} /* namespace ipa::ipu3::algorithms */
@@ -49,13 +49,15 @@ int ToneMapping::configure(IPAContext &context,
/**
* \brief Fill in the parameter structure, and enable gamma control
+ * \param frame The frame number
* \param context The shared IPA context
* \param params The IPU3 parameters
*
* Populate the IPU3 parameter structure with our tone mapping look up table and
* enable the gamma control module in the processing blocks.
*/
-void ToneMapping::prepare([[maybe_unused]] IPAContext &context,
+void ToneMapping::prepare([[maybe_unused]] const uint32_t frame,
+ [[maybe_unused]] IPAContext &context,
ipu3_uapi_params *params)
{
/* Copy the calculated LUT into the parameters buffer. */
@@ -71,13 +73,14 @@ void ToneMapping::prepare([[maybe_unused]] IPAContext &context,
/**
* \brief Calculate the tone mapping look up table
+ * \param frame The frame number
* \param context The shared IPA context
* \param stats The IPU3 statistics and ISP results
*
* The tone mapping look up table is generated as an inverse power curve from
* our gamma setting.
*/
-void ToneMapping::process(IPAContext &context,
+void ToneMapping::process(const uint32_t frame, IPAContext &context,
[[maybe_unused]] const ipu3_uapi_stats_3a *stats)
{
/*
@@ -19,8 +19,8 @@ public:
ToneMapping();
int configure(IPAContext &context, const IPAConfigInfo &configInfo) override;
- void prepare(IPAContext &context, ipu3_uapi_params *params) override;
- void process(IPAContext &context, const ipu3_uapi_stats_3a *stats) override;
+ void prepare(const uint32_t frame, IPAContext &context, ipu3_uapi_params *params) override;
+ void process(const uint32_t frame, IPAContext &context, const ipu3_uapi_stats_3a *stats) override;
private:
double gamma_;
@@ -573,7 +573,7 @@ void IPAIPU3::fillParams(unsigned int frame, ipu3_uapi_params *params)
params->use = {};
for (auto const &algo : algorithms_)
- algo->prepare(context_, params);
+ algo->prepare(frame, context_, params);
paramsBufferReady.emit(frame);
}
@@ -597,7 +597,7 @@ void IPAIPU3::parseStatistics(unsigned int frame,
ControlList ctrls(controls::controls);
for (auto const &algo : algorithms_)
- algo->process(context_, stats);
+ algo->process(frame, context_, stats);
setControls(frame);
@@ -48,6 +48,7 @@ namespace ipa {
/**
* \fn Algorithm::prepare()
* \brief Fill the \a params buffer with ISP processing parameters for a frame
+ * \param[in] frame The frame number
* \param[in] context The shared IPA context
* \param[out] params The ISP specific parameters.
*
@@ -63,6 +64,7 @@ namespace ipa {
/**
* \fn Algorithm::process()
* \brief Process ISP statistics, and run algorithm operations
+ * \param[in] frame The frame number
* \param[in] context The shared IPA context
* \param[in] stats The IPA statistics and ISP results
*
@@ -22,12 +22,14 @@ public:
return 0;
}
- virtual void prepare([[maybe_unused]] Context &context,
+ virtual void prepare([[maybe_unused]] const uint32_t frame,
+ [[maybe_unused]] Context &context,
[[maybe_unused]] Params *params)
{
}
- virtual void process([[maybe_unused]] Context &context,
+ virtual void process([[maybe_unused]] const uint32_t frame,
+ [[maybe_unused]] Context &context,
[[maybe_unused]] const Stats *stats)
{
}
The frame number will be used to retrieve their respective IPAFrameContext from a container in subsequent commits. Signed-off-by: Umang Jain <umang.jain@ideasonboard.com> --- src/ipa/ipu3/algorithms/agc.cpp | 3 ++- src/ipa/ipu3/algorithms/agc.h | 2 +- src/ipa/ipu3/algorithms/awb.cpp | 4 ++-- src/ipa/ipu3/algorithms/awb.h | 4 ++-- src/ipa/ipu3/algorithms/blc.cpp | 6 ++++-- src/ipa/ipu3/algorithms/blc.h | 2 +- src/ipa/ipu3/algorithms/tone_mapping.cpp | 7 +++++-- src/ipa/ipu3/algorithms/tone_mapping.h | 4 ++-- src/ipa/ipu3/ipu3.cpp | 4 ++-- src/ipa/libipa/algorithm.cpp | 2 ++ src/ipa/libipa/algorithm.h | 6 ++++-- 11 files changed, 27 insertions(+), 17 deletions(-)