@@ -71,7 +71,7 @@ static constexpr uint32_t kNumStartupFrames = 10;
static constexpr double kRelativeLuminanceTarget = 0.16;
Agc::Agc()
- : frameCount_(0), lineDuration_(0s), minShutterSpeed_(0s),
+ : frameCount_(0), minShutterSpeed_(0s),
maxShutterSpeed_(0s), filteredExposure_(0s)
{
}
@@ -85,11 +85,14 @@ Agc::Agc()
*/
int Agc::configure(IPAContext &context, const IPAConfigInfo &configInfo)
{
- stride_ = context.configuration.grid.stride;
+ IPASessionConfiguration &configuration = context.configuration;
+ IPAFrameContext &frameContext = context.frameContext;
+
+ stride_ = configuration.grid.stride;
/* \todo use the IPAContext to provide the limits */
- lineDuration_ = configInfo.sensorInfo.lineLength * 1.0s
- / configInfo.sensorInfo.pixelRate;
+ configuration.sensor.lineDuration = configInfo.sensorInfo.lineLength * 1.0s
+ / configInfo.sensorInfo.pixelRate;
minShutterSpeed_ = context.configuration.agc.minShutterSpeed;
maxShutterSpeed_ = std::min(context.configuration.agc.maxShutterSpeed,
@@ -99,8 +102,8 @@ int Agc::configure(IPAContext &context, const IPAConfigInfo &configInfo)
maxAnalogueGain_ = std::min(context.configuration.agc.maxAnalogueGain, kMaxAnalogueGain);
/* Configure the default exposure and gain. */
- context.frameContext.agc.gain = minAnalogueGain_;
- context.frameContext.agc.exposure = minShutterSpeed_ / lineDuration_;
+ frameContext.agc.gain = std::max(minAnalogueGain_, kMinAnalogueGain);
+ frameContext.agc.exposure = 10ms / configuration.sensor.lineDuration;
return 0;
}
@@ -182,9 +185,11 @@ utils::Duration Agc::filterExposure(utils::Duration exposureValue)
* \param[in] yGain The gain calculated based on the relative luminance target
* \param[in] iqMeanGain The gain calculated based on the relative luminance target
*/
-void Agc::computeExposure(IPAFrameContext &frameContext, double yGain,
+void Agc::computeExposure(IPAContext &context, double yGain,
double iqMeanGain)
{
+ const IPASessionConfiguration &configuration = context.configuration;
+ IPAFrameContext &frameContext = context.frameContext;
/* Get the effective exposure and gain applied on the sensor. */
uint32_t exposure = frameContext.sensor.exposure;
double analogueGain = frameContext.sensor.gain;
@@ -200,7 +205,7 @@ void Agc::computeExposure(IPAFrameContext &frameContext, double yGain,
/* extracted from Rpi::Agc::computeTargetExposure */
/* Calculate the shutter time in seconds */
- utils::Duration currentShutter = exposure * lineDuration_;
+ utils::Duration currentShutter = exposure * configuration.sensor.lineDuration;
/*
* Update the exposure value for the next computation using the values
@@ -247,7 +252,7 @@ void Agc::computeExposure(IPAFrameContext &frameContext, double yGain,
<< stepGain;
/* Update the estimated exposure and gain. */
- frameContext.agc.exposure = shutterTime / lineDuration_;
+ frameContext.agc.exposure = shutterTime / configuration.sensor.lineDuration;
frameContext.agc.gain = stepGain;
}
@@ -354,7 +359,7 @@ void Agc::process(IPAContext &context, const ipu3_uapi_stats_3a *stats)
break;
}
- computeExposure(context.frameContext, yGain, iqMeanGain);
+ computeExposure(context, yGain, iqMeanGain);
frameCount_++;
}
@@ -34,7 +34,7 @@ private:
double measureBrightness(const ipu3_uapi_stats_3a *stats,
const ipu3_uapi_grid_config &grid) const;
utils::Duration filterExposure(utils::Duration currentExposure);
- void computeExposure(IPAFrameContext &frameContext, double yGain,
+ void computeExposure(IPAContext &context, double yGain,
double iqMeanGain);
double estimateLuminance(IPAFrameContext &frameContext,
const ipu3_uapi_grid_config &grid,
@@ -43,7 +43,6 @@ private:
uint64_t frameCount_;
- utils::Duration lineDuration_;
utils::Duration minShutterSpeed_;
utils::Duration maxShutterSpeed_;
@@ -86,6 +86,14 @@ namespace libcamera::ipa::ipu3 {
* \brief Maximum analogue gain supported with the configured sensor
*/
+/**
+ * \var IPASessionConfiguration::sensor
+ * \brief Sensor-specific configuration of the IPA
+ *
+ * \var IPASessionConfiguration::sensor.lineDuration
+ * \brief Line duration in microseconds
+ */
+
/**
* \var IPAFrameContext::agc
* \brief Context for the Automatic Gain Control algorithm
@@ -31,6 +31,10 @@ struct IPASessionConfiguration {
double minAnalogueGain;
double maxAnalogueGain;
} agc;
+
+ struct {
+ utils::Duration lineDuration;
+ } sensor;
};
struct IPAFrameContext {
@@ -173,8 +173,6 @@ private:
uint32_t minGain_;
uint32_t maxGain_;
- utils::Duration lineDuration_;
-
/* Interface to the Camera Helper */
std::unique_ptr<CameraSensorHelper> camHelper_;
@@ -206,8 +204,8 @@ void IPAIPU3::updateSessionConfiguration(const ControlInfoMap &sensorControls)
*
* \todo take VBLANK into account for maximum shutter speed
*/
- context_.configuration.agc.minShutterSpeed = minExposure * lineDuration_;
- context_.configuration.agc.maxShutterSpeed = maxExposure * lineDuration_;
+ context_.configuration.agc.minShutterSpeed = minExposure * context_.configuration.sensor.lineDuration;
+ context_.configuration.agc.maxShutterSpeed = maxExposure * context_.configuration.sensor.lineDuration;
context_.configuration.agc.minAnalogueGain = camHelper_->gain(minGain);
context_.configuration.agc.maxAnalogueGain = camHelper_->gain(maxGain);
}
@@ -229,6 +227,7 @@ void IPAIPU3::updateControls(const IPACameraSensorInfo &sensorInfo,
ControlInfoMap *ipaControls)
{
ControlInfoMap::Map controls{};
+ double lineDuration = context_.configuration.sensor.lineDuration.get<std::micro>();
/*
* Compute exposure time limits by using line length and pixel rate
@@ -237,9 +236,9 @@ void IPAIPU3::updateControls(const IPACameraSensorInfo &sensorInfo,
* microseconds.
*/
const ControlInfo &v4l2Exposure = sensorControls.find(V4L2_CID_EXPOSURE)->second;
- int32_t minExposure = v4l2Exposure.min().get<int32_t>() * lineDuration_.get<std::micro>();
- int32_t maxExposure = v4l2Exposure.max().get<int32_t>() * lineDuration_.get<std::micro>();
- int32_t defExposure = v4l2Exposure.def().get<int32_t>() * lineDuration_.get<std::micro>();
+ int32_t minExposure = v4l2Exposure.min().get<int32_t>() * lineDuration;
+ int32_t maxExposure = v4l2Exposure.max().get<int32_t>() * lineDuration;
+ int32_t defExposure = v4l2Exposure.def().get<int32_t>() * lineDuration;
controls[&controls::ExposureTime] = ControlInfo(minExposure, maxExposure,
defExposure);
@@ -293,6 +292,11 @@ int IPAIPU3::init(const IPASettings &settings,
return -ENODEV;
}
+ /* Clean context */
+ context_ = {};
+ context_.configuration.sensor.lineDuration = sensorInfo.lineLength * 1.0s / sensorInfo.pixelRate;
+ LOG(IPAIPU3, Error) << "Line duration in init(): " << context_.configuration.sensor.lineDuration;
+
/* Construct our Algorithms */
algorithms_.push_back(std::make_unique<algorithms::Agc>());
algorithms_.push_back(std::make_unique<algorithms::Awb>());
@@ -454,12 +458,10 @@ int IPAIPU3::configure(const IPAConfigInfo &configInfo,
defVBlank_ = itVBlank->second.def().get<int32_t>();
- /* Clean context at configuration */
- context_ = {};
-
calculateBdsGrid(configInfo.bdsOutputSize);
- lineDuration_ = sensorInfo_.lineLength * 1.0s / sensorInfo_.pixelRate;
+ context_.configuration.sensor.lineDuration = sensorInfo_.lineLength * 1.0s / sensorInfo_.pixelRate;
+ LOG(IPAIPU3, Error) << "Line duration in configure(): " << context_.configuration.sensor.lineDuration;
/* Update the camera controls using the new sensor settings. */
updateControls(sensorInfo_, ctrls_, ipaControls);
@@ -620,6 +622,7 @@ void IPAIPU3::parseStatistics(unsigned int frame,
[[maybe_unused]] int64_t frameTimestamp,
const ipu3_uapi_stats_3a *stats)
{
+ double lineDuration = context_.configuration.sensor.lineDuration.get<std::micro>();
ControlList ctrls(controls::controls);
for (auto const &algo : algorithms_)
@@ -628,14 +631,14 @@ void IPAIPU3::parseStatistics(unsigned int frame,
setControls(frame);
/* \todo Use VBlank value calculated from each frame exposure. */
- int64_t frameDuration = (defVBlank_ + sensorInfo_.outputSize.height) * lineDuration_.get<std::micro>();
+ int64_t frameDuration = (defVBlank_ + sensorInfo_.outputSize.height) * lineDuration;
ctrls.set(controls::FrameDuration, frameDuration);
ctrls.set(controls::AnalogueGain, context_.frameContext.sensor.gain);
ctrls.set(controls::ColourTemperature, context_.frameContext.awb.temperatureK);
- ctrls.set(controls::ExposureTime, context_.frameContext.sensor.exposure * lineDuration_.get<std::micro>());
+ ctrls.set(controls::ExposureTime, context_.frameContext.sensor.exposure * lineDuration);
/*
* \todo The Metadata provides a path to getting extended data
Instead of having a local cached value for line duration, store it in the IPASessionConfiguration::sensor structure. While at it, configure the default analogue gain and shutter speed to controlled fixed values. The latter is set to be 10ms as it will in most cases be close to the one needed, making the AGC faster to converge. Signed-off-by: Jean-Michel Hautbois <jeanmichel.hautbois@ideasonboard.com> --- src/ipa/ipu3/algorithms/agc.cpp | 25 +++++++++++++++---------- src/ipa/ipu3/algorithms/agc.h | 3 +-- src/ipa/ipu3/ipa_context.cpp | 8 ++++++++ src/ipa/ipu3/ipa_context.h | 4 ++++ src/ipa/ipu3/ipu3.cpp | 29 ++++++++++++++++------------- 5 files changed, 44 insertions(+), 25 deletions(-)