From patchwork Thu Feb 4 16:29:33 2021 Content-Type: text/plain; charset="utf-8" MIME-Version: 1.0 Content-Transfer-Encoding: 8bit X-Patchwork-Submitter: =?utf-8?q?Niklas_S=C3=B6derlund?= X-Patchwork-Id: 11151 Return-Path: X-Original-To: parsemail@patchwork.libcamera.org Delivered-To: parsemail@patchwork.libcamera.org Received: from lancelot.ideasonboard.com (lancelot.ideasonboard.com [92.243.16.209]) by patchwork.libcamera.org (Postfix) with ESMTPS id 233FCBD162 for ; Thu, 4 Feb 2021 16:30:03 +0000 (UTC) Received: from lancelot.ideasonboard.com (localhost [IPv6:::1]) by lancelot.ideasonboard.com (Postfix) with ESMTP id F32646143D; Thu, 4 Feb 2021 17:30:02 +0100 (CET) Received: from bin-mail-out-05.binero.net (bin-mail-out-05.binero.net [195.74.38.228]) by lancelot.ideasonboard.com (Postfix) with ESMTPS id CECEB6141A for ; Thu, 4 Feb 2021 17:30:01 +0100 (CET) X-Halon-ID: 37af0e05-6706-11eb-b73f-0050569116f7 Authorized-sender: niklas.soderlund@fsdn.se Received: from bismarck.berto.se (p4fca2458.dip0.t-ipconnect.de [79.202.36.88]) by bin-vsp-out-03.atm.binero.net (Halon) with ESMTPA id 37af0e05-6706-11eb-b73f-0050569116f7; Thu, 04 Feb 2021 17:29:57 +0100 (CET) From: =?utf-8?q?Niklas_S=C3=B6derlund?= To: libcamera-devel@lists.libcamera.org Date: Thu, 4 Feb 2021 17:29:33 +0100 Message-Id: <20210204162943.268517-2-niklas.soderlund@ragnatech.se> X-Mailer: git-send-email 2.30.0 In-Reply-To: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> References: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> MIME-Version: 1.0 Subject: [libcamera-devel] [PATCH v3 01/11] include: linux: Add ipu3 kernel header and format definitions X-BeenThere: libcamera-devel@lists.libcamera.org X-Mailman-Version: 2.1.29 Precedence: list List-Id: List-Unsubscribe: , List-Archive: List-Post: List-Help: List-Subscribe: , Errors-To: libcamera-devel-bounces@lists.libcamera.org Sender: "libcamera-devel" Add kernel header and format definitions for the Intel IPU3. The header has been exported from a v5.9 kernel using scripts/headers_install.sh. Signed-off-by: Niklas Söderlund Acked-by: Kieran Bingham Reviewed-by: Jacopo Mondi Reviewed-by: Laurent Pinchart --- * Changes since v1 - s/The headers have/The header has/ in commit message. --- include/linux/intel-ipu3.h | 2785 ++++++++++++++++++++++++++++++++++++ 1 file changed, 2785 insertions(+) create mode 100644 include/linux/intel-ipu3.h diff --git a/include/linux/intel-ipu3.h b/include/linux/intel-ipu3.h new file mode 100644 index 0000000000000000..8ed1632164fddf44 --- /dev/null +++ b/include/linux/intel-ipu3.h @@ -0,0 +1,2785 @@ +/* SPDX-License-Identifier: GPL-2.0 */ +/* Copyright (C) 2017 - 2018 Intel Corporation */ + +#ifndef __IPU3_UAPI_H +#define __IPU3_UAPI_H + +#include + +/* from /drivers/staging/media/ipu3/include/videodev2.h */ + +/* Vendor specific - used for IPU3 camera sub-system */ +#define V4L2_META_FMT_IPU3_PARAMS v4l2_fourcc('i', 'p', '3', 'p') /* IPU3 processing parameters */ +#define V4L2_META_FMT_IPU3_STAT_3A v4l2_fourcc('i', 'p', '3', 's') /* IPU3 3A statistics */ + +/* from include/uapi/linux/v4l2-controls.h */ +#define V4L2_CID_INTEL_IPU3_BASE (V4L2_CID_USER_BASE + 0x10c0) +#define V4L2_CID_INTEL_IPU3_MODE (V4L2_CID_INTEL_IPU3_BASE + 1) + +/******************* ipu3_uapi_stats_3a *******************/ + +#define IPU3_UAPI_MAX_STRIPES 2 +#define IPU3_UAPI_MAX_BUBBLE_SIZE 10 + +#define IPU3_UAPI_GRID_START_MASK ((1 << 12) - 1) +#define IPU3_UAPI_GRID_Y_START_EN (1 << 15) + +/* controls generation of meta_data (like FF enable/disable) */ +#define IPU3_UAPI_AWB_RGBS_THR_B_EN (1 << 14) +#define IPU3_UAPI_AWB_RGBS_THR_B_INCL_SAT (1 << 15) + +/** + * struct ipu3_uapi_grid_config - Grid plane config + * + * @width: Grid horizontal dimensions, in number of grid blocks(cells). + * @height: Grid vertical dimensions, in number of grid cells. + * @block_width_log2: Log2 of the width of each cell in pixels. + * for (2^3, 2^4, 2^5, 2^6, 2^7), values [3, 7]. + * @block_height_log2: Log2 of the height of each cell in pixels. + * for (2^3, 2^4, 2^5, 2^6, 2^7), values [3, 7]. + * @height_per_slice: The number of blocks in vertical axis per slice. + * Default 2. + * @x_start: X value of top left corner of Region of Interest(ROI). + * @y_start: Y value of top left corner of ROI + * @x_end: X value of bottom right corner of ROI + * @y_end: Y value of bottom right corner of ROI + * + * Due to the size of total amount of collected data, most statistics + * create a grid-based output, and the data is then divided into "slices". + */ +struct ipu3_uapi_grid_config { + __u8 width; + __u8 height; + __u16 block_width_log2:3; + __u16 block_height_log2:3; + __u16 height_per_slice:8; + __u16 x_start; + __u16 y_start; + __u16 x_end; + __u16 y_end; +} __attribute__((packed)); + +/* + * The grid based data is divided into "slices" called set, each slice of setX + * refers to ipu3_uapi_grid_config width * height_per_slice. + */ +#define IPU3_UAPI_AWB_MAX_SETS 60 +/* Based on grid size 80 * 60 and cell size 16 x 16 */ +#define IPU3_UAPI_AWB_SET_SIZE 1280 +#define IPU3_UAPI_AWB_MD_ITEM_SIZE 8 +#define IPU3_UAPI_AWB_SPARE_FOR_BUBBLES \ + (IPU3_UAPI_MAX_BUBBLE_SIZE * IPU3_UAPI_MAX_STRIPES * \ + IPU3_UAPI_AWB_MD_ITEM_SIZE) +#define IPU3_UAPI_AWB_MAX_BUFFER_SIZE \ + (IPU3_UAPI_AWB_MAX_SETS * \ + (IPU3_UAPI_AWB_SET_SIZE + IPU3_UAPI_AWB_SPARE_FOR_BUBBLES)) + + +/** + * struct ipu3_uapi_awb_raw_buffer - AWB raw buffer + * + * @meta_data: buffer to hold auto white balance meta data which is + * the average values for each color channel. + */ +struct ipu3_uapi_awb_raw_buffer { + __u8 meta_data[IPU3_UAPI_AWB_MAX_BUFFER_SIZE] + __attribute__((aligned(32))); +} __attribute__((packed)); + +/** + * struct ipu3_uapi_awb_config_s - AWB config + * + * @rgbs_thr_gr: gr threshold value. + * @rgbs_thr_r: Red threshold value. + * @rgbs_thr_gb: gb threshold value. + * @rgbs_thr_b: Blue threshold value. + * @grid: &ipu3_uapi_grid_config, the default grid resolution is 16x16 cells. + * + * The threshold is a saturation measure range [0, 8191], 8191 is default. + * Values over threshold may be optionally rejected for averaging. + */ +struct ipu3_uapi_awb_config_s { + __u16 rgbs_thr_gr; + __u16 rgbs_thr_r; + __u16 rgbs_thr_gb; + __u16 rgbs_thr_b; + struct ipu3_uapi_grid_config grid; +} __attribute__((aligned(32))) __attribute__((packed)); + +/** + * struct ipu3_uapi_awb_config - AWB config wrapper + * + * @config: config for auto white balance as defined by &ipu3_uapi_awb_config_s + */ +struct ipu3_uapi_awb_config { + struct ipu3_uapi_awb_config_s config __attribute__((aligned(32))); +} __attribute__((packed)); + +#define IPU3_UAPI_AE_COLORS 4 /* R, G, B, Y */ +#define IPU3_UAPI_AE_BINS 256 +#define IPU3_UAPI_AE_WEIGHTS 96 + +/** + + * struct ipu3_uapi_ae_raw_buffer - AE global weighted histogram + + * + + * @vals: Sum of IPU3_UAPI_AE_COLORS in cell + + * + + * Each histogram contains IPU3_UAPI_AE_BINS bins. Each bin has 24 bit unsigned + + * for counting the number of the pixel. + + */ +struct ipu3_uapi_ae_raw_buffer { + __u32 vals[IPU3_UAPI_AE_BINS * IPU3_UAPI_AE_COLORS]; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_ae_raw_buffer_aligned - AE raw buffer + * + * @buff: &ipu3_uapi_ae_raw_buffer to hold full frame meta data. + */ +struct ipu3_uapi_ae_raw_buffer_aligned { + struct ipu3_uapi_ae_raw_buffer buff __attribute__((aligned(32))); +} __attribute__((packed)); + +/** + * struct ipu3_uapi_ae_grid_config - AE weight grid + * + * @width: Grid horizontal dimensions. Value: [16, 32], default 16. + * @height: Grid vertical dimensions. Value: [16, 24], default 16. + * @block_width_log2: Log2 of the width of the grid cell, value: [3, 7]. + * @block_height_log2: Log2 of the height of the grid cell, value: [3, 7]. + * default is 3 (cell size 8x8), 4 cell per grid. + * @reserved0: reserved + * @ae_en: 0: does not write to &ipu3_uapi_ae_raw_buffer_aligned array, + * 1: write normally. + * @rst_hist_array: write 1 to trigger histogram array reset. + * @done_rst_hist_array: flag for histogram array reset done. + * @x_start: X value of top left corner of ROI, default 0. + * @y_start: Y value of top left corner of ROI, default 0. + * @x_end: X value of bottom right corner of ROI + * @y_end: Y value of bottom right corner of ROI + * + * The AE block accumulates 4 global weighted histograms(R, G, B, Y) over + * a defined ROI within the frame. The contribution of each pixel into the + * histogram, defined by &ipu3_uapi_ae_weight_elem LUT, is indexed by a grid. + */ +struct ipu3_uapi_ae_grid_config { + __u8 width; + __u8 height; + __u8 block_width_log2:4; + __u8 block_height_log2:4; + __u8 reserved0:5; + __u8 ae_en:1; + __u8 rst_hist_array:1; + __u8 done_rst_hist_array:1; + __u16 x_start; + __u16 y_start; + __u16 x_end; + __u16 y_end; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_ae_weight_elem - AE weights LUT + * + * @cell0: weighted histogram grid value. + * @cell1: weighted histogram grid value. + * @cell2: weighted histogram grid value. + * @cell3: weighted histogram grid value. + * @cell4: weighted histogram grid value. + * @cell5: weighted histogram grid value. + * @cell6: weighted histogram grid value. + * @cell7: weighted histogram grid value. + * + * Use weighted grid value to give a different contribution factor to each cell. + * Precision u4, range [0, 15]. + */ +struct ipu3_uapi_ae_weight_elem { + __u32 cell0:4; + __u32 cell1:4; + __u32 cell2:4; + __u32 cell3:4; + __u32 cell4:4; + __u32 cell5:4; + __u32 cell6:4; + __u32 cell7:4; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_ae_ccm - AE coefficients for WB and CCM + * + * @gain_gr: WB gain factor for the gr channels. Default 256. + * @gain_r: WB gain factor for the r channel. Default 256. + * @gain_b: WB gain factor for the b channel. Default 256. + * @gain_gb: WB gain factor for the gb channels. Default 256. + * @mat: 4x4 matrix that transforms Bayer quad output from WB to RGB+Y. + * + * Default: + * 128, 0, 0, 0, + * 0, 128, 0, 0, + * 0, 0, 128, 0, + * 0, 0, 0, 128, + * + * As part of the raw frame pre-process stage, the WB and color conversion need + * to be applied to expose the impact of these gain operations. + */ +struct ipu3_uapi_ae_ccm { + __u16 gain_gr; + __u16 gain_r; + __u16 gain_b; + __u16 gain_gb; + __s16 mat[16]; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_ae_config - AE config + * + * @grid_cfg: config for auto exposure statistics grid. See struct + * &ipu3_uapi_ae_grid_config + * @weights: &IPU3_UAPI_AE_WEIGHTS is based on 32x24 blocks in the grid. + * Each grid cell has a corresponding value in weights LUT called + * grid value, global histogram is updated based on grid value and + * pixel value. + * @ae_ccm: Color convert matrix pre-processing block. + * + * Calculate AE grid from image resolution, resample ae weights. + */ +struct ipu3_uapi_ae_config { + struct ipu3_uapi_ae_grid_config grid_cfg __attribute__((aligned(32))); + struct ipu3_uapi_ae_weight_elem weights[ + IPU3_UAPI_AE_WEIGHTS] __attribute__((aligned(32))); + struct ipu3_uapi_ae_ccm ae_ccm __attribute__((aligned(32))); +} __attribute__((packed)); + +/** + * struct ipu3_uapi_af_filter_config - AF 2D filter for contrast measurements + * + * @y1_coeff_0: filter Y1, structure: 3x11, support both symmetry and + * anti-symmetry type. A12 is center, A1-A11 are neighbours. + * for analyzing low frequency content, used to calculate sum + * of gradients in x direction. + * @y1_coeff_0.a1: filter1 coefficients A1, u8, default 0. + * @y1_coeff_0.a2: filter1 coefficients A2, u8, default 0. + * @y1_coeff_0.a3: filter1 coefficients A3, u8, default 0. + * @y1_coeff_0.a4: filter1 coefficients A4, u8, default 0. + * @y1_coeff_1: Struct + * @y1_coeff_1.a5: filter1 coefficients A5, u8, default 0. + * @y1_coeff_1.a6: filter1 coefficients A6, u8, default 0. + * @y1_coeff_1.a7: filter1 coefficients A7, u8, default 0. + * @y1_coeff_1.a8: filter1 coefficients A8, u8, default 0. + * @y1_coeff_2: Struct + * @y1_coeff_2.a9: filter1 coefficients A9, u8, default 0. + * @y1_coeff_2.a10: filter1 coefficients A10, u8, default 0. + * @y1_coeff_2.a11: filter1 coefficients A11, u8, default 0. + * @y1_coeff_2.a12: filter1 coefficients A12, u8, default 128. + * @y1_sign_vec: Each bit corresponds to one coefficient sign bit, + * 0: positive, 1: negative, default 0. + * @y2_coeff_0: Y2, same structure as Y1. For analyzing high frequency content. + * @y2_coeff_0.a1: filter2 coefficients A1, u8, default 0. + * @y2_coeff_0.a2: filter2 coefficients A2, u8, default 0. + * @y2_coeff_0.a3: filter2 coefficients A3, u8, default 0. + * @y2_coeff_0.a4: filter2 coefficients A4, u8, default 0. + * @y2_coeff_1: Struct + * @y2_coeff_1.a5: filter2 coefficients A5, u8, default 0. + * @y2_coeff_1.a6: filter2 coefficients A6, u8, default 0. + * @y2_coeff_1.a7: filter2 coefficients A7, u8, default 0. + * @y2_coeff_1.a8: filter2 coefficients A8, u8, default 0. + * @y2_coeff_2: Struct + * @y2_coeff_2.a9: filter1 coefficients A9, u8, default 0. + * @y2_coeff_2.a10: filter1 coefficients A10, u8, default 0. + * @y2_coeff_2.a11: filter1 coefficients A11, u8, default 0. + * @y2_coeff_2.a12: filter1 coefficients A12, u8, default 128. + * @y2_sign_vec: Each bit corresponds to one coefficient sign bit, + * 0: positive, 1: negative, default 0. + * @y_calc: Pre-processing that converts Bayer quad to RGB+Y values to be + * used for building histogram. Range [0, 32], default 8. + * Rule: + * y_gen_rate_gr + y_gen_rate_r + y_gen_rate_b + y_gen_rate_gb = 32 + * A single Y is calculated based on sum of Gr/R/B/Gb based on + * their contribution ratio. + * @y_calc.y_gen_rate_gr: Contribution ratio Gr for Y + * @y_calc.y_gen_rate_r: Contribution ratio R for Y + * @y_calc.y_gen_rate_b: Contribution ratio B for Y + * @y_calc.y_gen_rate_gb: Contribution ratio Gb for Y + * @nf: The shift right value that should be applied during the Y1/Y2 filter to + * make sure the total memory needed is 2 bytes per grid cell. + * @nf.reserved0: reserved + * @nf.y1_nf: Normalization factor for the convolution coeffs of y1, + * should be log2 of the sum of the abs values of the filter + * coeffs, default 7 (2^7 = 128). + * @nf.reserved1: reserved + * @nf.y2_nf: Normalization factor for y2, should be log2 of the sum of the + * abs values of the filter coeffs. + * @nf.reserved2: reserved + */ +struct ipu3_uapi_af_filter_config { + struct { + __u8 a1; + __u8 a2; + __u8 a3; + __u8 a4; + } y1_coeff_0; + struct { + __u8 a5; + __u8 a6; + __u8 a7; + __u8 a8; + } y1_coeff_1; + struct { + __u8 a9; + __u8 a10; + __u8 a11; + __u8 a12; + } y1_coeff_2; + + __u32 y1_sign_vec; + + struct { + __u8 a1; + __u8 a2; + __u8 a3; + __u8 a4; + } y2_coeff_0; + struct { + __u8 a5; + __u8 a6; + __u8 a7; + __u8 a8; + } y2_coeff_1; + struct { + __u8 a9; + __u8 a10; + __u8 a11; + __u8 a12; + } y2_coeff_2; + + __u32 y2_sign_vec; + + struct { + __u8 y_gen_rate_gr; + __u8 y_gen_rate_r; + __u8 y_gen_rate_b; + __u8 y_gen_rate_gb; + } y_calc; + + struct { + __u32 reserved0:8; + __u32 y1_nf:4; + __u32 reserved1:4; + __u32 y2_nf:4; + __u32 reserved2:12; + } nf; +} __attribute__((packed)); + +#define IPU3_UAPI_AF_MAX_SETS 24 +#define IPU3_UAPI_AF_MD_ITEM_SIZE 4 +#define IPU3_UAPI_AF_SPARE_FOR_BUBBLES \ + (IPU3_UAPI_MAX_BUBBLE_SIZE * IPU3_UAPI_MAX_STRIPES * \ + IPU3_UAPI_AF_MD_ITEM_SIZE) +#define IPU3_UAPI_AF_Y_TABLE_SET_SIZE 128 +#define IPU3_UAPI_AF_Y_TABLE_MAX_SIZE \ + (IPU3_UAPI_AF_MAX_SETS * \ + (IPU3_UAPI_AF_Y_TABLE_SET_SIZE + IPU3_UAPI_AF_SPARE_FOR_BUBBLES) * \ + IPU3_UAPI_MAX_STRIPES) + +/** + * struct ipu3_uapi_af_raw_buffer - AF meta data + * + * @y_table: Each color component will be convolved separately with filter1 + * and filter2 and the result will be summed out and averaged for + * each cell. + */ +struct ipu3_uapi_af_raw_buffer { + __u8 y_table[IPU3_UAPI_AF_Y_TABLE_MAX_SIZE] __attribute__((aligned(32))); +} __attribute__((packed)); + +/** + * struct ipu3_uapi_af_config_s - AF config + * + * @filter_config: AF uses Y1 and Y2 filters as configured in + * &ipu3_uapi_af_filter_config + * @padding: paddings + * @grid_cfg: See &ipu3_uapi_grid_config, default resolution 16x16. Use large + * grid size for large image and vice versa. + */ +struct ipu3_uapi_af_config_s { + struct ipu3_uapi_af_filter_config filter_config __attribute__((aligned(32))); + __u8 padding[4]; + struct ipu3_uapi_grid_config grid_cfg __attribute__((aligned(32))); +} __attribute__((packed)); + +#define IPU3_UAPI_AWB_FR_MAX_SETS 24 +#define IPU3_UAPI_AWB_FR_MD_ITEM_SIZE 8 +#define IPU3_UAPI_AWB_FR_BAYER_TBL_SIZE 256 +#define IPU3_UAPI_AWB_FR_SPARE_FOR_BUBBLES \ + (IPU3_UAPI_MAX_BUBBLE_SIZE * IPU3_UAPI_MAX_STRIPES * \ + IPU3_UAPI_AWB_FR_MD_ITEM_SIZE) +#define IPU3_UAPI_AWB_FR_BAYER_TABLE_MAX_SIZE \ + (IPU3_UAPI_AWB_FR_MAX_SETS * \ + (IPU3_UAPI_AWB_FR_BAYER_TBL_SIZE + \ + IPU3_UAPI_AWB_FR_SPARE_FOR_BUBBLES) * IPU3_UAPI_MAX_STRIPES) + +/** + * struct ipu3_uapi_awb_fr_meta_data - AWB filter response meta data + * + * @meta_data: Statistics output on the grid after convolving with 1D filter. + */ +struct ipu3_uapi_awb_fr_raw_buffer { + __u8 meta_data[IPU3_UAPI_AWB_FR_BAYER_TABLE_MAX_SIZE] + __attribute__((aligned(32))); +} __attribute__((packed)); + +/** + * struct ipu3_uapi_awb_fr_config_s - AWB filter response config + * + * @grid_cfg: grid config, default 16x16. + * @bayer_coeff: 1D Filter 1x11 center symmetry/anti-symmetry. + * coefficients defaults { 0, 0, 0, 0, 0, 128 }. + * Applied on whole image for each Bayer channel separately + * by a weighted sum of its 11x1 neighbors. + * @reserved1: reserved + * @bayer_sign: sign of filter coefficients, default 0. + * @bayer_nf: normalization factor for the convolution coeffs, to make sure + * total memory needed is within pre-determined range. + * NF should be the log2 of the sum of the abs values of the + * filter coeffs, range [7, 14], default 7. + * @reserved2: reserved + */ +struct ipu3_uapi_awb_fr_config_s { + struct ipu3_uapi_grid_config grid_cfg; + __u8 bayer_coeff[6]; + __u16 reserved1; + __u32 bayer_sign; + __u8 bayer_nf; + __u8 reserved2[7]; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_4a_config - 4A config + * + * @awb_config: &ipu3_uapi_awb_config_s, default resolution 16x16 + * @ae_grd_config: auto exposure statistics &ipu3_uapi_ae_grid_config + * @padding: paddings + * @af_config: auto focus config &ipu3_uapi_af_config_s + * @awb_fr_config: &ipu3_uapi_awb_fr_config_s, default resolution 16x16 + */ +struct ipu3_uapi_4a_config { + struct ipu3_uapi_awb_config_s awb_config __attribute__((aligned(32))); + struct ipu3_uapi_ae_grid_config ae_grd_config; + __u8 padding[20]; + struct ipu3_uapi_af_config_s af_config; + struct ipu3_uapi_awb_fr_config_s awb_fr_config + __attribute__((aligned(32))); +} __attribute__((packed)); + +/** + * struct ipu3_uapi_bubble_info - Bubble info for host side debugging + * + * @num_of_stripes: A single frame is divided into several parts called stripes + * due to limitation on line buffer memory. + * The separation between the stripes is vertical. Each such + * stripe is processed as a single frame by the ISP pipe. + * @padding: padding bytes. + * @num_sets: number of sets. + * @padding1: padding bytes. + * @size_of_set: set size. + * @padding2: padding bytes. + * @bubble_size: is the amount of padding in the bubble expressed in "sets". + * @padding3: padding bytes. + */ +struct ipu3_uapi_bubble_info { + __u32 num_of_stripes __attribute__((aligned(32))); + __u8 padding[28]; + __u32 num_sets; + __u8 padding1[28]; + __u32 size_of_set; + __u8 padding2[28]; + __u32 bubble_size; + __u8 padding3[28]; +} __attribute__((packed)); + +/* + * struct ipu3_uapi_stats_3a_bubble_info_per_stripe + */ +struct ipu3_uapi_stats_3a_bubble_info_per_stripe { + struct ipu3_uapi_bubble_info awb[IPU3_UAPI_MAX_STRIPES]; + struct ipu3_uapi_bubble_info af[IPU3_UAPI_MAX_STRIPES]; + struct ipu3_uapi_bubble_info awb_fr[IPU3_UAPI_MAX_STRIPES]; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_ff_status - Enable bits for each 3A fixed function + * + * @awb_en: auto white balance enable + * @padding: padding config + * @ae_en: auto exposure enable + * @padding1: padding config + * @af_en: auto focus enable + * @padding2: padding config + * @awb_fr_en: awb filter response enable bit + * @padding3: padding config + */ +struct ipu3_uapi_ff_status { + __u32 awb_en __attribute__((aligned(32))); + __u8 padding[28]; + __u32 ae_en; + __u8 padding1[28]; + __u32 af_en; + __u8 padding2[28]; + __u32 awb_fr_en; + __u8 padding3[28]; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_stats_3a - 3A statistics + * + * @awb_raw_buffer: auto white balance meta data &ipu3_uapi_awb_raw_buffer + * @ae_raw_buffer: auto exposure raw data &ipu3_uapi_ae_raw_buffer_aligned + * @af_raw_buffer: &ipu3_uapi_af_raw_buffer for auto focus meta data + * @awb_fr_raw_buffer: value as specified by &ipu3_uapi_awb_fr_raw_buffer + * @stats_4a_config: 4a statistics config as defined by &ipu3_uapi_4a_config. + * @ae_join_buffers: 1 to use ae_raw_buffer. + * @padding: padding config + * @stats_3a_bubble_per_stripe: a &ipu3_uapi_stats_3a_bubble_info_per_stripe + * @stats_3a_status: 3a statistics status set in &ipu3_uapi_ff_status + */ +struct ipu3_uapi_stats_3a { + struct ipu3_uapi_awb_raw_buffer awb_raw_buffer; + struct ipu3_uapi_ae_raw_buffer_aligned + ae_raw_buffer[IPU3_UAPI_MAX_STRIPES]; + struct ipu3_uapi_af_raw_buffer af_raw_buffer; + struct ipu3_uapi_awb_fr_raw_buffer awb_fr_raw_buffer; + struct ipu3_uapi_4a_config stats_4a_config; + __u32 ae_join_buffers; + __u8 padding[28]; + struct ipu3_uapi_stats_3a_bubble_info_per_stripe + stats_3a_bubble_per_stripe; + struct ipu3_uapi_ff_status stats_3a_status; +} __attribute__((packed)); + +/******************* ipu3_uapi_acc_param *******************/ + +#define IPU3_UAPI_ISP_VEC_ELEMS 64 +#define IPU3_UAPI_ISP_TNR3_VMEM_LEN 9 + +#define IPU3_UAPI_BNR_LUT_SIZE 32 + +/* number of elements in gamma correction LUT */ +#define IPU3_UAPI_GAMMA_CORR_LUT_ENTRIES 256 + +/* largest grid is 73x56, for grid_height_per_slice of 2, 73x2 = 146 */ +#define IPU3_UAPI_SHD_MAX_CELLS_PER_SET 146 +#define IPU3_UAPI_SHD_MAX_CFG_SETS 28 +/* Normalization shift aka nf */ +#define IPU3_UAPI_SHD_BLGR_NF_SHIFT 13 +#define IPU3_UAPI_SHD_BLGR_NF_MASK 7 + +#define IPU3_UAPI_YUVP2_TCC_MACC_TABLE_ELEMENTS 16 +#define IPU3_UAPI_YUVP2_TCC_INV_Y_LUT_ELEMENTS 14 +#define IPU3_UAPI_YUVP2_TCC_GAIN_PCWL_LUT_ELEMENTS 258 +#define IPU3_UAPI_YUVP2_TCC_R_SQR_LUT_ELEMENTS 24 + +#define IPU3_UAPI_ANR_LUT_SIZE 26 +#define IPU3_UAPI_ANR_PYRAMID_SIZE 22 + +#define IPU3_UAPI_LIN_LUT_SIZE 64 + +/* Bayer Noise Reduction related structs */ + +/** + * struct ipu3_uapi_bnr_static_config_wb_gains_config - White balance gains + * + * @gr: white balance gain for Gr channel. + * @r: white balance gain for R channel. + * @b: white balance gain for B channel. + * @gb: white balance gain for Gb channel. + * + * Precision u3.13, range [0, 8). White balance correction is done by applying + * a multiplicative gain to each color channels prior to BNR. + */ +struct ipu3_uapi_bnr_static_config_wb_gains_config { + __u16 gr; + __u16 r; + __u16 b; + __u16 gb; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_bnr_static_config_wb_gains_thr_config - Threshold config + * + * @gr: white balance threshold gain for Gr channel. + * @r: white balance threshold gain for R channel. + * @b: white balance threshold gain for B channel. + * @gb: white balance threshold gain for Gb channel. + * + * Defines the threshold that specifies how different a defect pixel can be from + * its neighbors.(used by dynamic defect pixel correction sub block) + * Precision u4.4 range [0, 8]. + */ +struct ipu3_uapi_bnr_static_config_wb_gains_thr_config { + __u8 gr; + __u8 r; + __u8 b; + __u8 gb; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_bnr_static_config_thr_coeffs_config - Noise model + * coefficients that controls noise threshold + * + * @cf: Free coefficient for threshold calculation, range [0, 8191], default 0. + * @reserved0: reserved + * @cg: Gain coefficient for threshold calculation, [0, 31], default 8. + * @ci: Intensity coefficient for threshold calculation. range [0, 0x1f] + * default 6. + * format: u3.2 (3 most significant bits represent whole number, + * 2 least significant bits represent the fractional part + * with each count representing 0.25) + * e.g. 6 in binary format is 00110, that translates to 1.5 + * @reserved1: reserved + * @r_nf: Normalization shift value for r^2 calculation, range [12, 20] + * where r is a radius of pixel [row, col] from centor of sensor. + * default 14. + * + * Threshold used to distinguish between noise and details. + */ +struct ipu3_uapi_bnr_static_config_thr_coeffs_config { + __u32 cf:13; + __u32 reserved0:3; + __u32 cg:5; + __u32 ci:5; + __u32 reserved1:1; + __u32 r_nf:5; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_bnr_static_config_thr_ctrl_shd_config - Shading config + * + * @gr: Coefficient defines lens shading gain approximation for gr channel + * @r: Coefficient defines lens shading gain approximation for r channel + * @b: Coefficient defines lens shading gain approximation for b channel + * @gb: Coefficient defines lens shading gain approximation for gb channel + * + * Parameters for noise model (NM) adaptation of BNR due to shading correction. + * All above have precision of u3.3, default to 0. + */ +struct ipu3_uapi_bnr_static_config_thr_ctrl_shd_config { + __u8 gr; + __u8 r; + __u8 b; + __u8 gb; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_bnr_static_config_opt_center_config - Optical center config + * + * @x_reset: Reset value of X (col start - X center). Precision s12.0. + * @reserved0: reserved + * @y_reset: Reset value of Y (row start - Y center). Precision s12.0. + * @reserved2: reserved + * + * Distance from corner to optical center for NM adaptation due to shading + * correction (should be calculated based on shading tables) + */ +struct ipu3_uapi_bnr_static_config_opt_center_config { + __s32 x_reset:13; + __u32 reserved0:3; + __s32 y_reset:13; + __u32 reserved2:3; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_bnr_static_config_lut_config - BNR square root lookup table + * + * @values: pre-calculated values of square root function. + * + * LUT implementation of square root operation. + */ +struct ipu3_uapi_bnr_static_config_lut_config { + __u8 values[IPU3_UAPI_BNR_LUT_SIZE]; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_bnr_static_config_bp_ctrl_config - Detect bad pixels (bp) + * + * @bp_thr_gain: Defines the threshold that specifies how different a + * defect pixel can be from its neighbors. Threshold is + * dependent on de-noise threshold calculated by algorithm. + * Range [4, 31], default 4. + * @reserved0: reserved + * @defect_mode: Mode of addressed defect pixels, + * 0 - single defect pixel is expected, + * 1 - 2 adjacent defect pixels are expected, default 1. + * @bp_gain: Defines how 2nd derivation that passes through a defect pixel + * is different from 2nd derivations that pass through + * neighbor pixels. u4.2, range [0, 256], default 8. + * @reserved1: reserved + * @w0_coeff: Blending coefficient of defect pixel correction. + * Precision u4, range [0, 8], default 8. + * @reserved2: reserved + * @w1_coeff: Enable influence of incorrect defect pixel correction to be + * avoided. Precision u4, range [1, 8], default 8. + * @reserved3: reserved + */ +struct ipu3_uapi_bnr_static_config_bp_ctrl_config { + __u32 bp_thr_gain:5; + __u32 reserved0:2; + __u32 defect_mode:1; + __u32 bp_gain:6; + __u32 reserved1:18; + __u32 w0_coeff:4; + __u32 reserved2:4; + __u32 w1_coeff:4; + __u32 reserved3:20; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_bnr_static_config_dn_detect_ctrl_config - Denoising config + * + * @alpha: Weight of central element of smoothing filter. + * @beta: Weight of peripheral elements of smoothing filter, default 4. + * @gamma: Weight of diagonal elements of smoothing filter, default 4. + * + * beta and gamma parameter define the strength of the noise removal filter. + * All above has precision u0.4, range [0, 0xf] + * format: u0.4 (no / zero bits represent whole number, + * 4 bits represent the fractional part + * with each count representing 0.0625) + * e.g. 0xf translates to 0.0625x15 = 0.9375 + * + * @reserved0: reserved + * @max_inf: Maximum increase of peripheral or diagonal element influence + * relative to the pre-defined value range: [0x5, 0xa] + * @reserved1: reserved + * @gd_enable: Green disparity enable control, 0 - disable, 1 - enable. + * @bpc_enable: Bad pixel correction enable control, 0 - disable, 1 - enable. + * @bnr_enable: Bayer noise removal enable control, 0 - disable, 1 - enable. + * @ff_enable: Fixed function enable, 0 - disable, 1 - enable. + * @reserved2: reserved + */ +struct ipu3_uapi_bnr_static_config_dn_detect_ctrl_config { + __u32 alpha:4; + __u32 beta:4; + __u32 gamma:4; + __u32 reserved0:4; + __u32 max_inf:4; + __u32 reserved1:7; + __u32 gd_enable:1; + __u32 bpc_enable:1; + __u32 bnr_enable:1; + __u32 ff_enable:1; + __u32 reserved2:1; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_bnr_static_config_opt_center_sqr_config - BNR optical square + * + * @x_sqr_reset: Reset value of X^2. + * @y_sqr_reset: Reset value of Y^2. + * + * Please note: + * + * #. X and Y ref to + * &ipu3_uapi_bnr_static_config_opt_center_config + * #. Both structs are used in threshold formula to calculate r^2, where r + * is a radius of pixel [row, col] from centor of sensor. + */ +struct ipu3_uapi_bnr_static_config_opt_center_sqr_config { + __u32 x_sqr_reset; + __u32 y_sqr_reset; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_bnr_static_config - BNR static config + * + * @wb_gains: white balance gains &ipu3_uapi_bnr_static_config_wb_gains_config + * @wb_gains_thr: white balance gains threshold as defined by + * &ipu3_uapi_bnr_static_config_wb_gains_thr_config + * @thr_coeffs: coefficients of threshold + * &ipu3_uapi_bnr_static_config_thr_coeffs_config + * @thr_ctrl_shd: control of shading threshold + * &ipu3_uapi_bnr_static_config_thr_ctrl_shd_config + * @opt_center: optical center &ipu3_uapi_bnr_static_config_opt_center_config + * + * Above parameters and opt_center_sqr are used for white balance and shading. + * + * @lut: lookup table &ipu3_uapi_bnr_static_config_lut_config + * @bp_ctrl: detect and remove bad pixels as defined in struct + * &ipu3_uapi_bnr_static_config_bp_ctrl_config + * @dn_detect_ctrl: detect and remove noise. + * &ipu3_uapi_bnr_static_config_dn_detect_ctrl_config + * @column_size: The number of pixels in column. + * @opt_center_sqr: Reset value of r^2 to optical center, see + * &ipu3_uapi_bnr_static_config_opt_center_sqr_config. + */ +struct ipu3_uapi_bnr_static_config { + struct ipu3_uapi_bnr_static_config_wb_gains_config wb_gains; + struct ipu3_uapi_bnr_static_config_wb_gains_thr_config wb_gains_thr; + struct ipu3_uapi_bnr_static_config_thr_coeffs_config thr_coeffs; + struct ipu3_uapi_bnr_static_config_thr_ctrl_shd_config thr_ctrl_shd; + struct ipu3_uapi_bnr_static_config_opt_center_config opt_center; + struct ipu3_uapi_bnr_static_config_lut_config lut; + struct ipu3_uapi_bnr_static_config_bp_ctrl_config bp_ctrl; + struct ipu3_uapi_bnr_static_config_dn_detect_ctrl_config dn_detect_ctrl; + __u32 column_size; + struct ipu3_uapi_bnr_static_config_opt_center_sqr_config opt_center_sqr; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_bnr_static_config_green_disparity - Correct green disparity + * + * @gd_red: Shading gain coeff for gr disparity level in bright red region. + * Precision u0.6, default 4(0.0625). + * @reserved0: reserved + * @gd_green: Shading gain coeff for gr disparity level in bright green + * region. Precision u0.6, default 4(0.0625). + * @reserved1: reserved + * @gd_blue: Shading gain coeff for gr disparity level in bright blue region. + * Precision u0.6, default 4(0.0625). + * @reserved2: reserved + * @gd_black: Maximal green disparity level in dark region (stronger disparity + * assumed to be image detail). Precision u14, default 80. + * @reserved3: reserved + * @gd_shading: Change maximal green disparity level according to square + * distance from image center. + * @reserved4: reserved + * @gd_support: Lower bound for the number of second green color pixels in + * current pixel neighborhood with less than threshold difference + * from it. + * + * The shading gain coeff of red, green, blue and black are used to calculate + * threshold given a pixel's color value and its coordinates in the image. + * + * @reserved5: reserved + * @gd_clip: Turn green disparity clip on/off, [0, 1], default 1. + * @gd_central_weight: Central pixel weight in 9 pixels weighted sum. + */ +struct ipu3_uapi_bnr_static_config_green_disparity { + __u32 gd_red:6; + __u32 reserved0:2; + __u32 gd_green:6; + __u32 reserved1:2; + __u32 gd_blue:6; + __u32 reserved2:10; + __u32 gd_black:14; + __u32 reserved3:2; + __u32 gd_shading:7; + __u32 reserved4:1; + __u32 gd_support:2; + __u32 reserved5:1; + __u32 gd_clip:1; + __u32 gd_central_weight:4; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_dm_config - De-mosaic parameters + * + * @dm_en: de-mosaic enable. + * @ch_ar_en: Checker artifacts removal enable flag. Default 0. + * @fcc_en: False color correction (FCC) enable flag. Default 0. + * @reserved0: reserved + * @frame_width: do not care + * @gamma_sc: Sharpening coefficient (coefficient of 2-d derivation of + * complementary color in Hamilton-Adams interpolation). + * u5, range [0, 31], default 8. + * @reserved1: reserved + * @lc_ctrl: Parameter that controls weights of Chroma Homogeneity metric + * in calculation of final homogeneity metric. + * u5, range [0, 31], default 7. + * @reserved2: reserved + * @cr_param1: First parameter that defines Checker artifact removal + * feature gain. Precision u5, range [0, 31], default 8. + * @reserved3: reserved + * @cr_param2: Second parameter that defines Checker artifact removal + * feature gain. Precision u5, range [0, 31], default 8. + * @reserved4: reserved + * @coring_param: Defines power of false color correction operation. + * low for preserving edge colors, high for preserving gray + * edge artifacts. + * Precision u1.4, range [0, 1.9375], default 4 (0.25). + * @reserved5: reserved + * + * The demosaic fixed function block is responsible to covert Bayer(mosaiced) + * images into color images based on demosaicing algorithm. + */ +struct ipu3_uapi_dm_config { + __u32 dm_en:1; + __u32 ch_ar_en:1; + __u32 fcc_en:1; + __u32 reserved0:13; + __u32 frame_width:16; + + __u32 gamma_sc:5; + __u32 reserved1:3; + __u32 lc_ctrl:5; + __u32 reserved2:3; + __u32 cr_param1:5; + __u32 reserved3:3; + __u32 cr_param2:5; + __u32 reserved4:3; + + __u32 coring_param:5; + __u32 reserved5:27; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_ccm_mat_config - Color correction matrix + * + * @coeff_m11: CCM 3x3 coefficient, range [-65536, 65535] + * @coeff_m12: CCM 3x3 coefficient, range [-8192, 8191] + * @coeff_m13: CCM 3x3 coefficient, range [-32768, 32767] + * @coeff_o_r: Bias 3x1 coefficient, range [-8191, 8181] + * @coeff_m21: CCM 3x3 coefficient, range [-32767, 32767] + * @coeff_m22: CCM 3x3 coefficient, range [-8192, 8191] + * @coeff_m23: CCM 3x3 coefficient, range [-32768, 32767] + * @coeff_o_g: Bias 3x1 coefficient, range [-8191, 8181] + * @coeff_m31: CCM 3x3 coefficient, range [-32768, 32767] + * @coeff_m32: CCM 3x3 coefficient, range [-8192, 8191] + * @coeff_m33: CCM 3x3 coefficient, range [-32768, 32767] + * @coeff_o_b: Bias 3x1 coefficient, range [-8191, 8181] + * + * Transform sensor specific color space to standard sRGB by applying 3x3 matrix + * and adding a bias vector O. The transformation is basically a rotation and + * translation in the 3-dimensional color spaces. Here are the defaults: + * + * 9775, -2671, 1087, 0 + * -1071, 8303, 815, 0 + * -23, -7887, 16103, 0 + */ +struct ipu3_uapi_ccm_mat_config { + __s16 coeff_m11; + __s16 coeff_m12; + __s16 coeff_m13; + __s16 coeff_o_r; + __s16 coeff_m21; + __s16 coeff_m22; + __s16 coeff_m23; + __s16 coeff_o_g; + __s16 coeff_m31; + __s16 coeff_m32; + __s16 coeff_m33; + __s16 coeff_o_b; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_gamma_corr_ctrl - Gamma correction + * + * @enable: gamma correction enable. + * @reserved: reserved + */ +struct ipu3_uapi_gamma_corr_ctrl { + __u32 enable:1; + __u32 reserved:31; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_gamma_corr_lut - Per-pixel tone mapping implemented as LUT. + * + * @lut: 256 tabulated values of the gamma function. LUT[1].. LUT[256] + * format u13.0, range [0, 8191]. + * + * The tone mapping operation is done by a Piece wise linear graph + * that is implemented as a lookup table(LUT). The pixel component input + * intensity is the X-axis of the graph which is the table entry. + */ +struct ipu3_uapi_gamma_corr_lut { + __u16 lut[IPU3_UAPI_GAMMA_CORR_LUT_ENTRIES]; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_gamma_config - Gamma config + * + * @gc_ctrl: control of gamma correction &ipu3_uapi_gamma_corr_ctrl + * @gc_lut: lookup table of gamma correction &ipu3_uapi_gamma_corr_lut + */ +struct ipu3_uapi_gamma_config { + struct ipu3_uapi_gamma_corr_ctrl gc_ctrl __attribute__((aligned(32))); + struct ipu3_uapi_gamma_corr_lut gc_lut __attribute__((aligned(32))); +} __attribute__((packed)); + +/** + * struct ipu3_uapi_csc_mat_config - Color space conversion matrix config + * + * @coeff_c11: Conversion matrix value, format s0.14, range [-16384, 16383]. + * @coeff_c12: Conversion matrix value, format s0.14, range [-8192, 8191]. + * @coeff_c13: Conversion matrix value, format s0.14, range [-16384, 16383]. + * @coeff_b1: Bias 3x1 coefficient, s13.0 range [-8192, 8191]. + * @coeff_c21: Conversion matrix value, format s0.14, range [-16384, 16383]. + * @coeff_c22: Conversion matrix value, format s0.14, range [-8192, 8191]. + * @coeff_c23: Conversion matrix value, format s0.14, range [-16384, 16383]. + * @coeff_b2: Bias 3x1 coefficient, s13.0 range [-8192, 8191]. + * @coeff_c31: Conversion matrix value, format s0.14, range [-16384, 16383]. + * @coeff_c32: Conversion matrix value, format s0.14, range [-8192, 8191]. + * @coeff_c33: Conversion matrix value, format s0.14, range [-16384, 16383]. + * @coeff_b3: Bias 3x1 coefficient, s13.0 range [-8192, 8191]. + * + * To transform each pixel from RGB to YUV (Y - brightness/luminance, + * UV -chroma) by applying the pixel's values by a 3x3 matrix and adding an + * optional bias 3x1 vector. Here are the default values for the matrix: + * + * 4898, 9617, 1867, 0, + * -2410, -4732, 7143, 0, + * 10076, -8437, -1638, 0, + * + * (i.e. for real number 0.299, 0.299 * 2^14 becomes 4898.) + */ +struct ipu3_uapi_csc_mat_config { + __s16 coeff_c11; + __s16 coeff_c12; + __s16 coeff_c13; + __s16 coeff_b1; + __s16 coeff_c21; + __s16 coeff_c22; + __s16 coeff_c23; + __s16 coeff_b2; + __s16 coeff_c31; + __s16 coeff_c32; + __s16 coeff_c33; + __s16 coeff_b3; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_cds_params - Chroma down-scaling + * + * @ds_c00: range [0, 3] + * @ds_c01: range [0, 3] + * @ds_c02: range [0, 3] + * @ds_c03: range [0, 3] + * @ds_c10: range [0, 3] + * @ds_c11: range [0, 3] + * @ds_c12: range [0, 3] + * @ds_c13: range [0, 3] + * + * In case user does not provide, above 4x2 filter will use following defaults: + * 1, 3, 3, 1, + * 1, 3, 3, 1, + * + * @ds_nf: Normalization factor for Chroma output downscaling filter, + * range 0,4, default 2. + * @reserved0: reserved + * @csc_en: Color space conversion enable + * @uv_bin_output: 0: output YUV 4.2.0, 1: output YUV 4.2.2(default). + * @reserved1: reserved + */ +struct ipu3_uapi_cds_params { + __u32 ds_c00:2; + __u32 ds_c01:2; + __u32 ds_c02:2; + __u32 ds_c03:2; + __u32 ds_c10:2; + __u32 ds_c11:2; + __u32 ds_c12:2; + __u32 ds_c13:2; + __u32 ds_nf:5; + __u32 reserved0:3; + __u32 csc_en:1; + __u32 uv_bin_output:1; + __u32 reserved1:6; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_shd_grid_config - Bayer shading(darkening) correction + * + * @width: Grid horizontal dimensions, u8, [8, 128], default 73 + * @height: Grid vertical dimensions, u8, [8, 128], default 56 + * @block_width_log2: Log2 of the width of the grid cell in pixel count + * u4, [0, 15], default value 5. + * @reserved0: reserved + * @block_height_log2: Log2 of the height of the grid cell in pixel count + * u4, [0, 15], default value 6. + * @reserved1: reserved + * @grid_height_per_slice: SHD_MAX_CELLS_PER_SET/width. + * (with SHD_MAX_CELLS_PER_SET = 146). + * @x_start: X value of top left corner of sensor relative to ROI + * s13, [-4096, 0], default 0, only negative values. + * @y_start: Y value of top left corner of sensor relative to ROI + * s13, [-4096, 0], default 0, only negative values. + */ +struct ipu3_uapi_shd_grid_config { + /* reg 0 */ + __u8 width; + __u8 height; + __u8 block_width_log2:3; + __u8 reserved0:1; + __u8 block_height_log2:3; + __u8 reserved1:1; + __u8 grid_height_per_slice; + /* reg 1 */ + __s16 x_start; + __s16 y_start; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_shd_general_config - Shading general config + * + * @init_set_vrt_offst_ul: set vertical offset, + * y_start >> block_height_log2 % grid_height_per_slice. + * @shd_enable: shading enable. + * @gain_factor: Gain factor. Shift calculated anti shading value. Precision u2. + * 0x0 - gain factor [1, 5], means no shift interpolated value. + * 0x1 - gain factor [1, 9], means shift interpolated by 1. + * 0x2 - gain factor [1, 17], means shift interpolated by 2. + * @reserved: reserved + * + * Correction is performed by multiplying a gain factor for each of the 4 Bayer + * channels as a function of the pixel location in the sensor. + */ +struct ipu3_uapi_shd_general_config { + __u32 init_set_vrt_offst_ul:8; + __u32 shd_enable:1; + __u32 gain_factor:2; + __u32 reserved:21; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_shd_black_level_config - Black level correction + * + * @bl_r: Bios values for green red. s11 range [-2048, 2047]. + * @bl_gr: Bios values for green blue. s11 range [-2048, 2047]. + * @bl_gb: Bios values for red. s11 range [-2048, 2047]. + * @bl_b: Bios values for blue. s11 range [-2048, 2047]. + */ +struct ipu3_uapi_shd_black_level_config { + __s16 bl_r; + __s16 bl_gr; + __s16 bl_gb; + __s16 bl_b; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_shd_config_static - Shading config static + * + * @grid: shading grid config &ipu3_uapi_shd_grid_config + * @general: shading general config &ipu3_uapi_shd_general_config + * @black_level: black level config for shading correction as defined by + * &ipu3_uapi_shd_black_level_config + */ +struct ipu3_uapi_shd_config_static { + struct ipu3_uapi_shd_grid_config grid; + struct ipu3_uapi_shd_general_config general; + struct ipu3_uapi_shd_black_level_config black_level; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_shd_lut - Shading gain factor lookup table. + * + * @sets: array + * @sets.r_and_gr: Red and GreenR Lookup table. + * @sets.r_and_gr.r: Red shading factor. + * @sets.r_and_gr.gr: GreenR shading factor. + * @sets.reserved1: reserved + * @sets.gb_and_b: GreenB and Blue Lookup table. + * @sets.gb_and_b.gb: GreenB shading factor. + * @sets.gb_and_b.b: Blue shading factor. + * @sets.reserved2: reserved + * + * Map to shading correction LUT register set. + */ +struct ipu3_uapi_shd_lut { + struct { + struct { + __u16 r; + __u16 gr; + } r_and_gr[IPU3_UAPI_SHD_MAX_CELLS_PER_SET]; + __u8 reserved1[24]; + struct { + __u16 gb; + __u16 b; + } gb_and_b[IPU3_UAPI_SHD_MAX_CELLS_PER_SET]; + __u8 reserved2[24]; + } sets[IPU3_UAPI_SHD_MAX_CFG_SETS]; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_shd_config - Shading config + * + * @shd: shading static config, see &ipu3_uapi_shd_config_static + * @shd_lut: shading lookup table &ipu3_uapi_shd_lut + */ +struct ipu3_uapi_shd_config { + struct ipu3_uapi_shd_config_static shd __attribute__((aligned(32))); + struct ipu3_uapi_shd_lut shd_lut __attribute__((aligned(32))); +} __attribute__((packed)); + +/* Image Enhancement Filter directed */ + +/** + * struct ipu3_uapi_iefd_cux2 - IEFd Config Unit 2 parameters + * + * @x0: X0 point of Config Unit, u9.0, default 0. + * @x1: X1 point of Config Unit, u9.0, default 0. + * @a01: Slope A of Config Unit, s4.4, default 0. + * @b01: Slope B, always 0. + * + * Calculate weight for blending directed and non-directed denoise elements + * + * Note: + * Each instance of Config Unit needs X coordinate of n points and + * slope A factor between points calculated by driver based on calibration + * parameters. + * + * All CU inputs are unsigned, they will be converted to signed when written + * to register, i.e. a01 will be written to 9 bit register in s4.4 format. + * The data precision s4.4 means 4 bits for integer parts and 4 bits for the + * fractional part, the first bit indicates positive or negative value. + * For userspace software (commonly the imaging library), the computation for + * the CU slope values should be based on the slope resolution 1/16 (binary + * 0.0001 - the minimal interval value), the slope value range is [-256, +255]. + * This applies to &ipu3_uapi_iefd_cux6_ed, &ipu3_uapi_iefd_cux2_1, + * &ipu3_uapi_iefd_cux2_1, &ipu3_uapi_iefd_cux4 and &ipu3_uapi_iefd_cux6_rad. + */ +struct ipu3_uapi_iefd_cux2 { + __u32 x0:9; + __u32 x1:9; + __u32 a01:9; + __u32 b01:5; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_iefd_cux6_ed - Calculate power of non-directed sharpening + * element, Config Unit 6 for edge detail (ED). + * + * @x0: X coordinate of point 0, u9.0, default 0. + * @x1: X coordinate of point 1, u9.0, default 0. + * @x2: X coordinate of point 2, u9.0, default 0. + * @reserved0: reserved + * @x3: X coordinate of point 3, u9.0, default 0. + * @x4: X coordinate of point 4, u9.0, default 0. + * @x5: X coordinate of point 5, u9.0, default 0. + * @reserved1: reserved + * @a01: slope A points 01, s4.4, default 0. + * @a12: slope A points 12, s4.4, default 0. + * @a23: slope A points 23, s4.4, default 0. + * @reserved2: reserved + * @a34: slope A points 34, s4.4, default 0. + * @a45: slope A points 45, s4.4, default 0. + * @reserved3: reserved + * @b01: slope B points 01, s4.4, default 0. + * @b12: slope B points 12, s4.4, default 0. + * @b23: slope B points 23, s4.4, default 0. + * @reserved4: reserved + * @b34: slope B points 34, s4.4, default 0. + * @b45: slope B points 45, s4.4, default 0. + * @reserved5: reserved. + */ +struct ipu3_uapi_iefd_cux6_ed { + __u32 x0:9; + __u32 x1:9; + __u32 x2:9; + __u32 reserved0:5; + + __u32 x3:9; + __u32 x4:9; + __u32 x5:9; + __u32 reserved1:5; + + __u32 a01:9; + __u32 a12:9; + __u32 a23:9; + __u32 reserved2:5; + + __u32 a34:9; + __u32 a45:9; + __u32 reserved3:14; + + __u32 b01:9; + __u32 b12:9; + __u32 b23:9; + __u32 reserved4:5; + + __u32 b34:9; + __u32 b45:9; + __u32 reserved5:14; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_iefd_cux2_1 - Calculate power of non-directed denoise + * element apply. + * @x0: X0 point of Config Unit, u9.0, default 0. + * @x1: X1 point of Config Unit, u9.0, default 0. + * @a01: Slope A of Config Unit, s4.4, default 0. + * @reserved1: reserved + * @b01: offset B0 of Config Unit, u7.0, default 0. + * @reserved2: reserved + */ +struct ipu3_uapi_iefd_cux2_1 { + __u32 x0:9; + __u32 x1:9; + __u32 a01:9; + __u32 reserved1:5; + + __u32 b01:8; + __u32 reserved2:24; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_iefd_cux4 - Calculate power of non-directed sharpening + * element. + * + * @x0: X0 point of Config Unit, u9.0, default 0. + * @x1: X1 point of Config Unit, u9.0, default 0. + * @x2: X2 point of Config Unit, u9.0, default 0. + * @reserved0: reserved + * @x3: X3 point of Config Unit, u9.0, default 0. + * @a01: Slope A0 of Config Unit, s4.4, default 0. + * @a12: Slope A1 of Config Unit, s4.4, default 0. + * @reserved1: reserved + * @a23: Slope A2 of Config Unit, s4.4, default 0. + * @b01: Offset B0 of Config Unit, s7.0, default 0. + * @b12: Offset B1 of Config Unit, s7.0, default 0. + * @reserved2: reserved + * @b23: Offset B2 of Config Unit, s7.0, default 0. + * @reserved3: reserved + */ +struct ipu3_uapi_iefd_cux4 { + __u32 x0:9; + __u32 x1:9; + __u32 x2:9; + __u32 reserved0:5; + + __u32 x3:9; + __u32 a01:9; + __u32 a12:9; + __u32 reserved1:5; + + __u32 a23:9; + __u32 b01:8; + __u32 b12:8; + __u32 reserved2:7; + + __u32 b23:8; + __u32 reserved3:24; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_iefd_cux6_rad - Radial Config Unit (CU) + * + * @x0: x0 points of Config Unit radial, u8.0 + * @x1: x1 points of Config Unit radial, u8.0 + * @x2: x2 points of Config Unit radial, u8.0 + * @x3: x3 points of Config Unit radial, u8.0 + * @x4: x4 points of Config Unit radial, u8.0 + * @x5: x5 points of Config Unit radial, u8.0 + * @reserved1: reserved + * @a01: Slope A of Config Unit radial, s7.8 + * @a12: Slope A of Config Unit radial, s7.8 + * @a23: Slope A of Config Unit radial, s7.8 + * @a34: Slope A of Config Unit radial, s7.8 + * @a45: Slope A of Config Unit radial, s7.8 + * @reserved2: reserved + * @b01: Slope B of Config Unit radial, s9.0 + * @b12: Slope B of Config Unit radial, s9.0 + * @b23: Slope B of Config Unit radial, s9.0 + * @reserved4: reserved + * @b34: Slope B of Config Unit radial, s9.0 + * @b45: Slope B of Config Unit radial, s9.0 + * @reserved5: reserved + */ +struct ipu3_uapi_iefd_cux6_rad { + __u32 x0:8; + __u32 x1:8; + __u32 x2:8; + __u32 x3:8; + + __u32 x4:8; + __u32 x5:8; + __u32 reserved1:16; + + __u32 a01:16; + __u32 a12:16; + + __u32 a23:16; + __u32 a34:16; + + __u32 a45:16; + __u32 reserved2:16; + + __u32 b01:10; + __u32 b12:10; + __u32 b23:10; + __u32 reserved4:2; + + __u32 b34:10; + __u32 b45:10; + __u32 reserved5:12; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_iefd_cfg_units - IEFd Config Units parameters + * + * @cu_1: calculate weight for blending directed and + * non-directed denoise elements. See &ipu3_uapi_iefd_cux2 + * @cu_ed: calculate power of non-directed sharpening element, see + * &ipu3_uapi_iefd_cux6_ed + * @cu_3: calculate weight for blending directed and + * non-directed denoise elements. A &ipu3_uapi_iefd_cux2 + * @cu_5: calculate power of non-directed denoise element apply, use + * &ipu3_uapi_iefd_cux2_1 + * @cu_6: calculate power of non-directed sharpening element. See + * &ipu3_uapi_iefd_cux4 + * @cu_7: calculate weight for blending directed and + * non-directed denoise elements. Use &ipu3_uapi_iefd_cux2 + * @cu_unsharp: Config Unit of unsharp &ipu3_uapi_iefd_cux4 + * @cu_radial: Config Unit of radial &ipu3_uapi_iefd_cux6_rad + * @cu_vssnlm: Config Unit of vssnlm &ipu3_uapi_iefd_cux2 + */ +struct ipu3_uapi_yuvp1_iefd_cfg_units { + struct ipu3_uapi_iefd_cux2 cu_1; + struct ipu3_uapi_iefd_cux6_ed cu_ed; + struct ipu3_uapi_iefd_cux2 cu_3; + struct ipu3_uapi_iefd_cux2_1 cu_5; + struct ipu3_uapi_iefd_cux4 cu_6; + struct ipu3_uapi_iefd_cux2 cu_7; + struct ipu3_uapi_iefd_cux4 cu_unsharp; + struct ipu3_uapi_iefd_cux6_rad cu_radial; + struct ipu3_uapi_iefd_cux2 cu_vssnlm; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_iefd_config_s - IEFd config + * + * @horver_diag_coeff: Gradient compensation. Compared with vertical / + * horizontal (0 / 90 degree), coefficient of diagonal (45 / + * 135 degree) direction should be corrected by approx. + * 1/sqrt(2). + * @reserved0: reserved + * @clamp_stitch: Slope to stitch between clamped and unclamped edge values + * @reserved1: reserved + * @direct_metric_update: Update coeff for direction metric + * @reserved2: reserved + * @ed_horver_diag_coeff: Radial Coefficient that compensates for + * different distance for vertical/horizontal and + * diagonal gradient calculation (approx. 1/sqrt(2)) + * @reserved3: reserved + */ +struct ipu3_uapi_yuvp1_iefd_config_s { + __u32 horver_diag_coeff:7; + __u32 reserved0:1; + __u32 clamp_stitch:6; + __u32 reserved1:2; + __u32 direct_metric_update:5; + __u32 reserved2:3; + __u32 ed_horver_diag_coeff:7; + __u32 reserved3:1; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_iefd_control - IEFd control + * + * @iefd_en: Enable IEFd + * @denoise_en: Enable denoise + * @direct_smooth_en: Enable directional smooth + * @rad_en: Enable radial update + * @vssnlm_en: Enable VSSNLM output filter + * @reserved: reserved + */ +struct ipu3_uapi_yuvp1_iefd_control { + __u32 iefd_en:1; + __u32 denoise_en:1; + __u32 direct_smooth_en:1; + __u32 rad_en:1; + __u32 vssnlm_en:1; + __u32 reserved:27; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_sharp_cfg - Sharpening config + * + * @nega_lmt_txt: Sharpening limit for negative overshoots for texture. + * @reserved0: reserved + * @posi_lmt_txt: Sharpening limit for positive overshoots for texture. + * @reserved1: reserved + * @nega_lmt_dir: Sharpening limit for negative overshoots for direction (edge). + * @reserved2: reserved + * @posi_lmt_dir: Sharpening limit for positive overshoots for direction (edge). + * @reserved3: reserved + * + * Fixed point type u13.0, range [0, 8191]. + */ +struct ipu3_uapi_sharp_cfg { + __u32 nega_lmt_txt:13; + __u32 reserved0:19; + __u32 posi_lmt_txt:13; + __u32 reserved1:19; + __u32 nega_lmt_dir:13; + __u32 reserved2:19; + __u32 posi_lmt_dir:13; + __u32 reserved3:19; +} __attribute__((packed)); + +/** + * struct struct ipu3_uapi_far_w - Sharpening config for far sub-group + * + * @dir_shrp: Weight of wide direct sharpening, u1.6, range [0, 64], default 64. + * @reserved0: reserved + * @dir_dns: Weight of wide direct denoising, u1.6, range [0, 64], default 0. + * @reserved1: reserved + * @ndir_dns_powr: Power of non-direct denoising, + * Precision u1.6, range [0, 64], default 64. + * @reserved2: reserved + */ +struct ipu3_uapi_far_w { + __u32 dir_shrp:7; + __u32 reserved0:1; + __u32 dir_dns:7; + __u32 reserved1:1; + __u32 ndir_dns_powr:7; + __u32 reserved2:9; +} __attribute__((packed)); + +/** + * struct struct ipu3_uapi_unsharp_cfg - Unsharp config + * + * @unsharp_weight: Unsharp mask blending weight. + * u1.6, range [0, 64], default 16. + * 0 - disabled, 64 - use only unsharp. + * @reserved0: reserved + * @unsharp_amount: Unsharp mask amount, u4.5, range [0, 511], default 0. + * @reserved1: reserved + */ +struct ipu3_uapi_unsharp_cfg { + __u32 unsharp_weight:7; + __u32 reserved0:1; + __u32 unsharp_amount:9; + __u32 reserved1:15; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_iefd_shrp_cfg - IEFd sharpness config + * + * @cfg: sharpness config &ipu3_uapi_sharp_cfg + * @far_w: wide range config, value as specified by &ipu3_uapi_far_w: + * The 5x5 environment is separated into 2 sub-groups, the 3x3 nearest + * neighbors (8 pixels called Near), and the second order neighborhood + * around them (16 pixels called Far). + * @unshrp_cfg: unsharpness config. &ipu3_uapi_unsharp_cfg + */ +struct ipu3_uapi_yuvp1_iefd_shrp_cfg { + struct ipu3_uapi_sharp_cfg cfg; + struct ipu3_uapi_far_w far_w; + struct ipu3_uapi_unsharp_cfg unshrp_cfg; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_unsharp_coef0 - Unsharp mask coefficients + * + * @c00: Coeff11, s0.8, range [-255, 255], default 1. + * @c01: Coeff12, s0.8, range [-255, 255], default 5. + * @c02: Coeff13, s0.8, range [-255, 255], default 9. + * @reserved: reserved + * + * Configurable registers for common sharpening support. + */ +struct ipu3_uapi_unsharp_coef0 { + __u32 c00:9; + __u32 c01:9; + __u32 c02:9; + __u32 reserved:5; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_unsharp_coef1 - Unsharp mask coefficients + * + * @c11: Coeff22, s0.8, range [-255, 255], default 29. + * @c12: Coeff23, s0.8, range [-255, 255], default 55. + * @c22: Coeff33, s0.8, range [-255, 255], default 96. + * @reserved: reserved + */ +struct ipu3_uapi_unsharp_coef1 { + __u32 c11:9; + __u32 c12:9; + __u32 c22:9; + __u32 reserved:5; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_iefd_unshrp_cfg - Unsharp mask config + * + * @unsharp_coef0: unsharp coefficient 0 config. See &ipu3_uapi_unsharp_coef0 + * @unsharp_coef1: unsharp coefficient 1 config. See &ipu3_uapi_unsharp_coef1 + */ +struct ipu3_uapi_yuvp1_iefd_unshrp_cfg { + struct ipu3_uapi_unsharp_coef0 unsharp_coef0; + struct ipu3_uapi_unsharp_coef1 unsharp_coef1; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_radial_reset_xy - Radial coordinate reset + * + * @x: Radial reset of x coordinate. Precision s12, [-4095, 4095], default 0. + * @reserved0: reserved + * @y: Radial center y coordinate. Precision s12, [-4095, 4095], default 0. + * @reserved1: reserved + */ +struct ipu3_uapi_radial_reset_xy { + __s32 x:13; + __u32 reserved0:3; + __s32 y:13; + __u32 reserved1:3; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_radial_reset_x2 - Radial X^2 reset + * + * @x2: Radial reset of x^2 coordinate. Precision u24, default 0. + * @reserved: reserved + */ +struct ipu3_uapi_radial_reset_x2 { + __u32 x2:24; + __u32 reserved:8; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_radial_reset_y2 - Radial Y^2 reset + * + * @y2: Radial reset of y^2 coordinate. Precision u24, default 0. + * @reserved: reserved + */ +struct ipu3_uapi_radial_reset_y2 { + __u32 y2:24; + __u32 reserved:8; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_radial_cfg - Radial config + * + * @rad_nf: Radial. R^2 normalization factor is scale down by 2^ - (15 + scale) + * @reserved0: reserved + * @rad_inv_r2: Radial R^-2 normelized to (0.5..1). + * Precision u7, range [0, 127]. + * @reserved1: reserved + */ +struct ipu3_uapi_radial_cfg { + __u32 rad_nf:4; + __u32 reserved0:4; + __u32 rad_inv_r2:7; + __u32 reserved1:17; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_rad_far_w - Radial FAR sub-group + * + * @rad_dir_far_sharp_w: Weight of wide direct sharpening, u1.6, range [0, 64], + * default 64. + * @rad_dir_far_dns_w: Weight of wide direct denoising, u1.6, range [0, 64], + * default 0. + * @rad_ndir_far_dns_power: power of non-direct sharpening, u1.6, range [0, 64], + * default 0. + * @reserved: reserved + */ +struct ipu3_uapi_rad_far_w { + __u32 rad_dir_far_sharp_w:8; + __u32 rad_dir_far_dns_w:8; + __u32 rad_ndir_far_dns_power:8; + __u32 reserved:8; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_cu_cfg0 - Radius Config Unit cfg0 register + * + * @cu6_pow: Power of CU6. Power of non-direct sharpening, u3.4. + * @reserved0: reserved + * @cu_unsharp_pow: Power of unsharp mask, u2.4. + * @reserved1: reserved + * @rad_cu6_pow: Radial/corner CU6. Directed sharpening power, u3.4. + * @reserved2: reserved + * @rad_cu_unsharp_pow: Radial power of unsharp mask, u2.4. + * @reserved3: reserved + */ +struct ipu3_uapi_cu_cfg0 { + __u32 cu6_pow:7; + __u32 reserved0:1; + __u32 cu_unsharp_pow:7; + __u32 reserved1:1; + __u32 rad_cu6_pow:7; + __u32 reserved2:1; + __u32 rad_cu_unsharp_pow:6; + __u32 reserved3:2; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_cu_cfg1 - Radius Config Unit cfg1 register + * + * @rad_cu6_x1: X1 point of Config Unit 6, precision u9.0. + * @reserved0: reserved + * @rad_cu_unsharp_x1: X1 point for Config Unit unsharp for radial/corner point + * precision u9.0. + * @reserved1: reserved + */ +struct ipu3_uapi_cu_cfg1 { + __u32 rad_cu6_x1:9; + __u32 reserved0:1; + __u32 rad_cu_unsharp_x1:9; + __u32 reserved1:13; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_iefd_rad_cfg - IEFd parameters changed radially over + * the picture plane. + * + * @reset_xy: reset xy value in radial calculation. &ipu3_uapi_radial_reset_xy + * @reset_x2: reset x square value in radial calculation. See struct + * &ipu3_uapi_radial_reset_x2 + * @reset_y2: reset y square value in radial calculation. See struct + * &ipu3_uapi_radial_reset_y2 + * @cfg: radial config defined in &ipu3_uapi_radial_cfg + * @rad_far_w: weight for wide range radial. &ipu3_uapi_rad_far_w + * @cu_cfg0: configuration unit 0. See &ipu3_uapi_cu_cfg0 + * @cu_cfg1: configuration unit 1. See &ipu3_uapi_cu_cfg1 + */ +struct ipu3_uapi_yuvp1_iefd_rad_cfg { + struct ipu3_uapi_radial_reset_xy reset_xy; + struct ipu3_uapi_radial_reset_x2 reset_x2; + struct ipu3_uapi_radial_reset_y2 reset_y2; + struct ipu3_uapi_radial_cfg cfg; + struct ipu3_uapi_rad_far_w rad_far_w; + struct ipu3_uapi_cu_cfg0 cu_cfg0; + struct ipu3_uapi_cu_cfg1 cu_cfg1; +} __attribute__((packed)); + +/* Vssnlm - Very small scale non-local mean algorithm */ + +/** + * struct ipu3_uapi_vss_lut_x - Vssnlm LUT x0/x1/x2 + * + * @vs_x0: Vssnlm LUT x0, precision u8, range [0, 255], default 16. + * @vs_x1: Vssnlm LUT x1, precision u8, range [0, 255], default 32. + * @vs_x2: Vssnlm LUT x2, precision u8, range [0, 255], default 64. + * @reserved2: reserved + */ +struct ipu3_uapi_vss_lut_x { + __u32 vs_x0:8; + __u32 vs_x1:8; + __u32 vs_x2:8; + __u32 reserved2:8; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_vss_lut_y - Vssnlm LUT y0/y1/y2 + * + * @vs_y1: Vssnlm LUT y1, precision u4, range [0, 8], default 1. + * @reserved0: reserved + * @vs_y2: Vssnlm LUT y2, precision u4, range [0, 8], default 3. + * @reserved1: reserved + * @vs_y3: Vssnlm LUT y3, precision u4, range [0, 8], default 8. + * @reserved2: reserved + */ +struct ipu3_uapi_vss_lut_y { + __u32 vs_y1:4; + __u32 reserved0:4; + __u32 vs_y2:4; + __u32 reserved1:4; + __u32 vs_y3:4; + __u32 reserved2:12; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_iefd_vssnlm_cf - IEFd Vssnlm Lookup table + * + * @vss_lut_x: vss lookup table. See &ipu3_uapi_vss_lut_x description + * @vss_lut_y: vss lookup table. See &ipu3_uapi_vss_lut_y description + */ +struct ipu3_uapi_yuvp1_iefd_vssnlm_cfg { + struct ipu3_uapi_vss_lut_x vss_lut_x; + struct ipu3_uapi_vss_lut_y vss_lut_y; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_iefd_config - IEFd config + * + * @units: configuration unit setting, &ipu3_uapi_yuvp1_iefd_cfg_units + * @config: configuration, as defined by &ipu3_uapi_yuvp1_iefd_config_s + * @control: control setting, as defined by &ipu3_uapi_yuvp1_iefd_control + * @sharp: sharpness setting, as defined by &ipu3_uapi_yuvp1_iefd_shrp_cfg + * @unsharp: unsharpness setting, as defined by &ipu3_uapi_yuvp1_iefd_unshrp_cfg + * @rad: radial setting, as defined by &ipu3_uapi_yuvp1_iefd_rad_cfg + * @vsslnm: vsslnm setting, as defined by &ipu3_uapi_yuvp1_iefd_vssnlm_cfg + */ +struct ipu3_uapi_yuvp1_iefd_config { + struct ipu3_uapi_yuvp1_iefd_cfg_units units; + struct ipu3_uapi_yuvp1_iefd_config_s config; + struct ipu3_uapi_yuvp1_iefd_control control; + struct ipu3_uapi_yuvp1_iefd_shrp_cfg sharp; + struct ipu3_uapi_yuvp1_iefd_unshrp_cfg unsharp; + struct ipu3_uapi_yuvp1_iefd_rad_cfg rad; + struct ipu3_uapi_yuvp1_iefd_vssnlm_cfg vsslnm; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_yds_config - Y Down-Sampling config + * + * @c00: range [0, 3], default 0x0 + * @c01: range [0, 3], default 0x1 + * @c02: range [0, 3], default 0x1 + * @c03: range [0, 3], default 0x0 + * @c10: range [0, 3], default 0x0 + * @c11: range [0, 3], default 0x1 + * @c12: range [0, 3], default 0x1 + * @c13: range [0, 3], default 0x0 + * + * Above are 4x2 filter coefficients for chroma output downscaling. + * + * @norm_factor: Normalization factor, range [0, 4], default 2 + * 0 - divide by 1 + * 1 - divide by 2 + * 2 - divide by 4 + * 3 - divide by 8 + * 4 - divide by 16 + * @reserved0: reserved + * @bin_output: Down sampling on Luma channel in two optional modes + * 0 - Bin output 4.2.0 (default), 1 output 4.2.2. + * @reserved1: reserved + */ +struct ipu3_uapi_yuvp1_yds_config { + __u32 c00:2; + __u32 c01:2; + __u32 c02:2; + __u32 c03:2; + __u32 c10:2; + __u32 c11:2; + __u32 c12:2; + __u32 c13:2; + __u32 norm_factor:5; + __u32 reserved0:4; + __u32 bin_output:1; + __u32 reserved1:6; +} __attribute__((packed)); + +/* Chroma Noise Reduction */ + +/** + * struct ipu3_uapi_yuvp1_chnr_enable_config - Chroma noise reduction enable + * + * @enable: enable/disable chroma noise reduction + * @yuv_mode: 0 - YUV420, 1 - YUV422 + * @reserved0: reserved + * @col_size: number of columns in the frame, max width is 2560 + * @reserved1: reserved + */ +struct ipu3_uapi_yuvp1_chnr_enable_config { + __u32 enable:1; + __u32 yuv_mode:1; + __u32 reserved0:14; + __u32 col_size:12; + __u32 reserved1:4; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_chnr_coring_config - Coring thresholds for UV + * + * @u: U coring level, u0.13, range [0.0, 1.0], default 0.0 + * @reserved0: reserved + * @v: V coring level, u0.13, range [0.0, 1.0], default 0.0 + * @reserved1: reserved + */ +struct ipu3_uapi_yuvp1_chnr_coring_config { + __u32 u:13; + __u32 reserved0:3; + __u32 v:13; + __u32 reserved1:3; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_chnr_sense_gain_config - Chroma noise reduction gains + * + * All sensitivity gain parameters have precision u13.0, range [0, 8191]. + * + * @vy: Sensitivity of horizontal edge of Y, default 100 + * @vu: Sensitivity of horizontal edge of U, default 100 + * @vv: Sensitivity of horizontal edge of V, default 100 + * @reserved0: reserved + * @hy: Sensitivity of vertical edge of Y, default 50 + * @hu: Sensitivity of vertical edge of U, default 50 + * @hv: Sensitivity of vertical edge of V, default 50 + * @reserved1: reserved + */ +struct ipu3_uapi_yuvp1_chnr_sense_gain_config { + __u32 vy:8; + __u32 vu:8; + __u32 vv:8; + __u32 reserved0:8; + + __u32 hy:8; + __u32 hu:8; + __u32 hv:8; + __u32 reserved1:8; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_chnr_iir_fir_config - Chroma IIR/FIR filter config + * + * @fir_0h: Value of center tap in horizontal FIR, range [0, 32], default 8. + * @reserved0: reserved + * @fir_1h: Value of distance 1 in horizontal FIR, range [0, 32], default 12. + * @reserved1: reserved + * @fir_2h: Value of distance 2 tap in horizontal FIR, range [0, 32], default 0. + * @dalpha_clip_val: weight for previous row in IIR, range [1, 256], default 0. + * @reserved2: reserved + */ +struct ipu3_uapi_yuvp1_chnr_iir_fir_config { + __u32 fir_0h:6; + __u32 reserved0:2; + __u32 fir_1h:6; + __u32 reserved1:2; + __u32 fir_2h:6; + __u32 dalpha_clip_val:9; + __u32 reserved2:1; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_chnr_config - Chroma noise reduction config + * + * @enable: chroma noise reduction enable, see + * &ipu3_uapi_yuvp1_chnr_enable_config + * @coring: coring config for chroma noise reduction, see + * &ipu3_uapi_yuvp1_chnr_coring_config + * @sense_gain: sensitivity config for chroma noise reduction, see + * ipu3_uapi_yuvp1_chnr_sense_gain_config + * @iir_fir: iir and fir config for chroma noise reduction, see + * ipu3_uapi_yuvp1_chnr_iir_fir_config + */ +struct ipu3_uapi_yuvp1_chnr_config { + struct ipu3_uapi_yuvp1_chnr_enable_config enable; + struct ipu3_uapi_yuvp1_chnr_coring_config coring; + struct ipu3_uapi_yuvp1_chnr_sense_gain_config sense_gain; + struct ipu3_uapi_yuvp1_chnr_iir_fir_config iir_fir; +} __attribute__((packed)); + +/* Edge Enhancement and Noise Reduction */ + +/** + * struct ipu3_uapi_yuvp1_y_ee_nr_lpf_config - Luma(Y) edge enhancement low-pass + * filter coefficients + * + * @a_diag: Smoothing diagonal coefficient, u5.0. + * @reserved0: reserved + * @a_periph: Image smoothing perpherial, u5.0. + * @reserved1: reserved + * @a_cent: Image Smoothing center coefficient, u5.0. + * @reserved2: reserved + * @enable: 0: Y_EE_NR disabled, output = input; 1: Y_EE_NR enabled. + */ +struct ipu3_uapi_yuvp1_y_ee_nr_lpf_config { + __u32 a_diag:5; + __u32 reserved0:3; + __u32 a_periph:5; + __u32 reserved1:3; + __u32 a_cent:5; + __u32 reserved2:9; + __u32 enable:1; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_y_ee_nr_sense_config - Luma(Y) edge enhancement + * noise reduction sensitivity gains + * + * @edge_sense_0: Sensitivity of edge in dark area. u13.0, default 8191. + * @reserved0: reserved + * @delta_edge_sense: Difference in the sensitivity of edges between + * the bright and dark areas. u13.0, default 0. + * @reserved1: reserved + * @corner_sense_0: Sensitivity of corner in dark area. u13.0, default 0. + * @reserved2: reserved + * @delta_corner_sense: Difference in the sensitivity of corners between + * the bright and dark areas. u13.0, default 8191. + * @reserved3: reserved + */ +struct ipu3_uapi_yuvp1_y_ee_nr_sense_config { + __u32 edge_sense_0:13; + __u32 reserved0:3; + __u32 delta_edge_sense:13; + __u32 reserved1:3; + __u32 corner_sense_0:13; + __u32 reserved2:3; + __u32 delta_corner_sense:13; + __u32 reserved3:3; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_y_ee_nr_gain_config - Luma(Y) edge enhancement + * noise reduction gain config + * + * @gain_pos_0: Gain for positive edge in dark area. u5.0, [0, 16], default 2. + * @reserved0: reserved + * @delta_gain_posi: Difference in the gain of edges between the bright and + * dark areas for positive edges. u5.0, [0, 16], default 0. + * @reserved1: reserved + * @gain_neg_0: Gain for negative edge in dark area. u5.0, [0, 16], default 8. + * @reserved2: reserved + * @delta_gain_neg: Difference in the gain of edges between the bright and + * dark areas for negative edges. u5.0, [0, 16], default 0. + * @reserved3: reserved + */ +struct ipu3_uapi_yuvp1_y_ee_nr_gain_config { + __u32 gain_pos_0:5; + __u32 reserved0:3; + __u32 delta_gain_posi:5; + __u32 reserved1:3; + __u32 gain_neg_0:5; + __u32 reserved2:3; + __u32 delta_gain_neg:5; + __u32 reserved3:3; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_y_ee_nr_clip_config - Luma(Y) edge enhancement + * noise reduction clipping config + * + * @clip_pos_0: Limit of positive edge in dark area + * u5, value [0, 16], default 8. + * @reserved0: reserved + * @delta_clip_posi: Difference in the limit of edges between the bright + * and dark areas for positive edges. + * u5, value [0, 16], default 8. + * @reserved1: reserved + * @clip_neg_0: Limit of negative edge in dark area + * u5, value [0, 16], default 8. + * @reserved2: reserved + * @delta_clip_neg: Difference in the limit of edges between the bright + * and dark areas for negative edges. + * u5, value [0, 16], default 8. + * @reserved3: reserved + */ +struct ipu3_uapi_yuvp1_y_ee_nr_clip_config { + __u32 clip_pos_0:5; + __u32 reserved0:3; + __u32 delta_clip_posi:5; + __u32 reserved1:3; + __u32 clip_neg_0:5; + __u32 reserved2:3; + __u32 delta_clip_neg:5; + __u32 reserved3:3; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_y_ee_nr_frng_config - Luma(Y) edge enhancement + * noise reduction fringe config + * + * @gain_exp: Common exponent of gains, u4, [0, 8], default 2. + * @reserved0: reserved + * @min_edge: Threshold for edge and smooth stitching, u13. + * @reserved1: reserved + * @lin_seg_param: Power of LinSeg, u4. + * @reserved2: reserved + * @t1: Parameter for enabling/disabling the edge enhancement, u1.0, [0, 1], + * default 1. + * @t2: Parameter for enabling/disabling the smoothing, u1.0, [0, 1], + * default 1. + * @reserved3: reserved + */ +struct ipu3_uapi_yuvp1_y_ee_nr_frng_config { + __u32 gain_exp:4; + __u32 reserved0:28; + __u32 min_edge:13; + __u32 reserved1:3; + __u32 lin_seg_param:4; + __u32 reserved2:4; + __u32 t1:1; + __u32 t2:1; + __u32 reserved3:6; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_y_ee_nr_diag_config - Luma(Y) edge enhancement + * noise reduction diagonal config + * + * @diag_disc_g: Coefficient that prioritize diagonal edge direction on + * horizontal or vertical for final enhancement. + * u4.0, [1, 15], default 1. + * @reserved0: reserved + * @hvw_hor: Weight of horizontal/vertical edge enhancement for hv edge. + * u2.2, [1, 15], default 4. + * @dw_hor: Weight of diagonal edge enhancement for hv edge. + * u2.2, [1, 15], default 1. + * @hvw_diag: Weight of horizontal/vertical edge enhancement for diagonal edge. + * u2.2, [1, 15], default 1. + * @dw_diag: Weight of diagonal edge enhancement for diagonal edge. + * u2.2, [1, 15], default 4. + * @reserved1: reserved + */ +struct ipu3_uapi_yuvp1_y_ee_nr_diag_config { + __u32 diag_disc_g:4; + __u32 reserved0:4; + __u32 hvw_hor:4; + __u32 dw_hor:4; + __u32 hvw_diag:4; + __u32 dw_diag:4; + __u32 reserved1:8; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_y_ee_nr_fc_coring_config - Luma(Y) edge enhancement + * noise reduction false color correction (FCC) coring config + * + * @pos_0: Gain for positive edge in dark, u13.0, [0, 16], default 0. + * @reserved0: reserved + * @pos_delta: Gain for positive edge in bright, value: pos_0 + pos_delta <=16 + * u13.0, default 0. + * @reserved1: reserved + * @neg_0: Gain for negative edge in dark area, u13.0, range [0, 16], default 0. + * @reserved2: reserved + * @neg_delta: Gain for negative edge in bright area. neg_0 + neg_delta <=16 + * u13.0, default 0. + * @reserved3: reserved + * + * Coring is a simple soft thresholding technique. + */ +struct ipu3_uapi_yuvp1_y_ee_nr_fc_coring_config { + __u32 pos_0:13; + __u32 reserved0:3; + __u32 pos_delta:13; + __u32 reserved1:3; + __u32 neg_0:13; + __u32 reserved2:3; + __u32 neg_delta:13; + __u32 reserved3:3; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp1_y_ee_nr_config - Edge enhancement and noise reduction + * + * @lpf: low-pass filter config. See &ipu3_uapi_yuvp1_y_ee_nr_lpf_config + * @sense: sensitivity config. See &ipu3_uapi_yuvp1_y_ee_nr_sense_config + * @gain: gain config as defined in &ipu3_uapi_yuvp1_y_ee_nr_gain_config + * @clip: clip config as defined in &ipu3_uapi_yuvp1_y_ee_nr_clip_config + * @frng: fringe config as defined in &ipu3_uapi_yuvp1_y_ee_nr_frng_config + * @diag: diagonal edge config. See &ipu3_uapi_yuvp1_y_ee_nr_diag_config + * @fc_coring: coring config for fringe control. See + * &ipu3_uapi_yuvp1_y_ee_nr_fc_coring_config + */ +struct ipu3_uapi_yuvp1_y_ee_nr_config { + struct ipu3_uapi_yuvp1_y_ee_nr_lpf_config lpf; + struct ipu3_uapi_yuvp1_y_ee_nr_sense_config sense; + struct ipu3_uapi_yuvp1_y_ee_nr_gain_config gain; + struct ipu3_uapi_yuvp1_y_ee_nr_clip_config clip; + struct ipu3_uapi_yuvp1_y_ee_nr_frng_config frng; + struct ipu3_uapi_yuvp1_y_ee_nr_diag_config diag; + struct ipu3_uapi_yuvp1_y_ee_nr_fc_coring_config fc_coring; +} __attribute__((packed)); + +/* Total Color Correction */ + +/** + * struct ipu3_uapi_yuvp2_tcc_gen_control_static_config - Total color correction + * general control config + * + * @en: 0 - TCC disabled. Output = input 1 - TCC enabled. + * @blend_shift: blend shift, Range[3, 4], default NA. + * @gain_according_to_y_only: 0: Gain is calculated according to YUV, + * 1: Gain is calculated according to Y only + * @reserved0: reserved + * @gamma: Final blending coefficients. Values[-16, 16], default NA. + * @reserved1: reserved + * @delta: Final blending coefficients. Values[-16, 16], default NA. + * @reserved2: reserved + */ +struct ipu3_uapi_yuvp2_tcc_gen_control_static_config { + __u32 en:1; + __u32 blend_shift:3; + __u32 gain_according_to_y_only:1; + __u32 reserved0:11; + __s32 gamma:5; + __u32 reserved1:3; + __s32 delta:5; + __u32 reserved2:3; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp2_tcc_macc_elem_static_config - Total color correction + * multi-axis color control (MACC) config + * + * @a: a coefficient for 2x2 MACC conversion matrix. + * @reserved0: reserved + * @b: b coefficient 2x2 MACC conversion matrix. + * @reserved1: reserved + * @c: c coefficient for 2x2 MACC conversion matrix. + * @reserved2: reserved + * @d: d coefficient for 2x2 MACC conversion matrix. + * @reserved3: reserved + */ +struct ipu3_uapi_yuvp2_tcc_macc_elem_static_config { + __s32 a:12; + __u32 reserved0:4; + __s32 b:12; + __u32 reserved1:4; + __s32 c:12; + __u32 reserved2:4; + __s32 d:12; + __u32 reserved3:4; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp2_tcc_macc_table_static_config - Total color correction + * multi-axis color control (MACC) table array + * + * @entries: config for multi axis color correction, as specified by + * &ipu3_uapi_yuvp2_tcc_macc_elem_static_config + */ +struct ipu3_uapi_yuvp2_tcc_macc_table_static_config { + struct ipu3_uapi_yuvp2_tcc_macc_elem_static_config + entries[IPU3_UAPI_YUVP2_TCC_MACC_TABLE_ELEMENTS]; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp2_tcc_inv_y_lut_static_config - Total color correction + * inverse y lookup table + * + * @entries: lookup table for inverse y estimation, and use it to estimate the + * ratio between luma and chroma. Chroma by approximate the absolute + * value of the radius on the chroma plane (R = sqrt(u^2+v^2) ) and + * luma by approximate by 1/Y. + */ +struct ipu3_uapi_yuvp2_tcc_inv_y_lut_static_config { + __u16 entries[IPU3_UAPI_YUVP2_TCC_INV_Y_LUT_ELEMENTS]; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp2_tcc_gain_pcwl_lut_static_config - Total color + * correction lookup table for PCWL + * + * @entries: lookup table for gain piece wise linear transformation (PCWL) + */ +struct ipu3_uapi_yuvp2_tcc_gain_pcwl_lut_static_config { + __u16 entries[IPU3_UAPI_YUVP2_TCC_GAIN_PCWL_LUT_ELEMENTS]; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp2_tcc_r_sqr_lut_static_config - Total color correction + * lookup table for r square root + * + * @entries: lookup table for r square root estimation + */ +struct ipu3_uapi_yuvp2_tcc_r_sqr_lut_static_config { + __s16 entries[IPU3_UAPI_YUVP2_TCC_R_SQR_LUT_ELEMENTS]; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_yuvp2_tcc_static_config- Total color correction static + * + * @gen_control: general config for Total Color Correction + * @macc_table: config for multi axis color correction + * @inv_y_lut: lookup table for inverse y estimation + * @gain_pcwl: lookup table for gain PCWL + * @r_sqr_lut: lookup table for r square root estimation. + */ +struct ipu3_uapi_yuvp2_tcc_static_config { + struct ipu3_uapi_yuvp2_tcc_gen_control_static_config gen_control; + struct ipu3_uapi_yuvp2_tcc_macc_table_static_config macc_table; + struct ipu3_uapi_yuvp2_tcc_inv_y_lut_static_config inv_y_lut; + struct ipu3_uapi_yuvp2_tcc_gain_pcwl_lut_static_config gain_pcwl; + struct ipu3_uapi_yuvp2_tcc_r_sqr_lut_static_config r_sqr_lut; +} __attribute__((packed)); + +/* Advanced Noise Reduction related structs */ + +/* + * struct ipu3_uapi_anr_alpha - Advanced noise reduction alpha + * + * Tunable parameters that are subject to modification according to the + * total gain used. + */ +struct ipu3_uapi_anr_alpha { + __u16 gr; + __u16 r; + __u16 b; + __u16 gb; + __u16 dc_gr; + __u16 dc_r; + __u16 dc_b; + __u16 dc_gb; +} __attribute__((packed)); + +/* + * struct ipu3_uapi_anr_beta - Advanced noise reduction beta + * + * Tunable parameters that are subject to modification according to the + * total gain used. + */ +struct ipu3_uapi_anr_beta { + __u16 beta_gr; + __u16 beta_r; + __u16 beta_b; + __u16 beta_gb; +} __attribute__((packed)); + +/* + * struct ipu3_uapi_anr_plane_color - Advanced noise reduction per plane R, Gr, + * Gb and B register settings + * + * Tunable parameters that are subject to modification according to the + * total gain used. + */ +struct ipu3_uapi_anr_plane_color { + __u16 reg_w_gr[16]; + __u16 reg_w_r[16]; + __u16 reg_w_b[16]; + __u16 reg_w_gb[16]; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_anr_transform_config - Advanced noise reduction transform + * + * @enable: advanced noise reduction enabled. + * @adaptive_treshhold_en: On IPU3, adaptive threshold is always enabled. + * @reserved1: reserved + * @reserved2: reserved + * @alpha: using following defaults: + * 13, 13, 13, 13, 0, 0, 0, 0 + * 11, 11, 11, 11, 0, 0, 0, 0 + * 14, 14, 14, 14, 0, 0, 0, 0 + * @beta: use following defaults: + * 24, 24, 24, 24 + * 21, 20, 20, 21 + * 25, 25, 25, 25 + * @color: use defaults defined in driver/media/pci/intel/ipu3-tables.c + * @sqrt_lut: 11 bits per element, values = + * [724 768 810 849 887 + * 923 958 991 1024 1056 + * 1116 1145 1173 1201 1086 + * 1228 1254 1280 1305 1330 + * 1355 1379 1402 1425 1448] + * @xreset: Reset value of X for r^2 calculation Value: col_start-X_center + * Constraint: Xreset + FrameWdith=4095 Xreset= -4095, default -1632. + * @reserved3: reserved + * @yreset: Reset value of Y for r^2 calculation Value: row_start-Y_center + * Constraint: Yreset + FrameHeight=4095 Yreset= -4095, default -1224. + * @reserved4: reserved + * @x_sqr_reset: Reset value of X^2 for r^2 calculation Value = (Xreset)^2 + * @r_normfactor: Normalization factor for R. Default 14. + * @reserved5: reserved + * @y_sqr_reset: Reset value of Y^2 for r^2 calculation Value = (Yreset)^2 + * @gain_scale: Parameter describing shading gain as a function of distance + * from the image center. + * A single value per frame, loaded by the driver. Default 115. + */ +struct ipu3_uapi_anr_transform_config { + __u32 enable:1; /* 0 or 1, disabled or enabled */ + __u32 adaptive_treshhold_en:1; /* On IPU3, always enabled */ + + __u32 reserved1:30; + __u8 reserved2[44]; + + struct ipu3_uapi_anr_alpha alpha[3]; + struct ipu3_uapi_anr_beta beta[3]; + struct ipu3_uapi_anr_plane_color color[3]; + + __u16 sqrt_lut[IPU3_UAPI_ANR_LUT_SIZE]; /* 11 bits per element */ + + __s16 xreset:13; + __u16 reserved3:3; + __s16 yreset:13; + __u16 reserved4:3; + + __u32 x_sqr_reset:24; + __u32 r_normfactor:5; + __u32 reserved5:3; + + __u32 y_sqr_reset:24; + __u32 gain_scale:8; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_anr_stitch_pyramid - ANR stitch pyramid + * + * @entry0: pyramid LUT entry0, range [0x0, 0x3f] + * @entry1: pyramid LUT entry1, range [0x0, 0x3f] + * @entry2: pyramid LUT entry2, range [0x0, 0x3f] + * @reserved: reserved + */ +struct ipu3_uapi_anr_stitch_pyramid { + __u32 entry0:6; + __u32 entry1:6; + __u32 entry2:6; + __u32 reserved:14; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_anr_stitch_config - ANR stitch config + * + * @anr_stitch_en: enable stitch. Enabled with 1. + * @reserved: reserved + * @pyramid: pyramid table as defined by &ipu3_uapi_anr_stitch_pyramid + * default values: + * { 1, 3, 5 }, { 7, 7, 5 }, { 3, 1, 3 }, + * { 9, 15, 21 }, { 21, 15, 9 }, { 3, 5, 15 }, + * { 25, 35, 35 }, { 25, 15, 5 }, { 7, 21, 35 }, + * { 49, 49, 35 }, { 21, 7, 7 }, { 21, 35, 49 }, + * { 49, 35, 21 }, { 7, 5, 15 }, { 25, 35, 35 }, + * { 25, 15, 5 }, { 3, 9, 15 }, { 21, 21, 15 }, + * { 9, 3, 1 }, { 3, 5, 7 }, { 7, 5, 3}, { 1 } + */ +struct ipu3_uapi_anr_stitch_config { + __u32 anr_stitch_en; + __u8 reserved[44]; + struct ipu3_uapi_anr_stitch_pyramid pyramid[IPU3_UAPI_ANR_PYRAMID_SIZE]; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_anr_config - ANR config + * + * @transform: advanced noise reduction transform config as specified by + * &ipu3_uapi_anr_transform_config + * @stitch: create 4x4 patch from 4 surrounding 8x8 patches. + */ +struct ipu3_uapi_anr_config { + struct ipu3_uapi_anr_transform_config transform __attribute__((aligned(32))); + struct ipu3_uapi_anr_stitch_config stitch __attribute__((aligned(32))); +} __attribute__((packed)); + +/** + * struct ipu3_uapi_acc_param - Accelerator cluster parameters + * + * ACC refers to the HW cluster containing all Fixed Functions (FFs). Each FF + * implements a specific algorithm. + * + * @bnr: parameters for bayer noise reduction static config. See + * &ipu3_uapi_bnr_static_config + * @green_disparity: disparity static config between gr and gb channel. + * See &ipu3_uapi_bnr_static_config_green_disparity + * @dm: de-mosaic config. See &ipu3_uapi_dm_config + * @ccm: color correction matrix. See &ipu3_uapi_ccm_mat_config + * @gamma: gamma correction config. See &ipu3_uapi_gamma_config + * @csc: color space conversion matrix. See &ipu3_uapi_csc_mat_config + * @cds: color down sample config. See &ipu3_uapi_cds_params + * @shd: lens shading correction config. See &ipu3_uapi_shd_config + * @iefd: Image enhancement filter and denoise config. + * &ipu3_uapi_yuvp1_iefd_config + * @yds_c0: y down scaler config. &ipu3_uapi_yuvp1_yds_config + * @chnr_c0: chroma noise reduction config. &ipu3_uapi_yuvp1_chnr_config + * @y_ee_nr: y edge enhancement and noise reduction config. + * &ipu3_uapi_yuvp1_y_ee_nr_config + * @yds: y down scaler config. See &ipu3_uapi_yuvp1_yds_config + * @chnr: chroma noise reduction config. See &ipu3_uapi_yuvp1_chnr_config + * @reserved1: reserved + * @yds2: y channel down scaler config. See &ipu3_uapi_yuvp1_yds_config + * @tcc: total color correction config as defined in struct + * &ipu3_uapi_yuvp2_tcc_static_config + * @reserved2: reserved + * @anr: advanced noise reduction config.See &ipu3_uapi_anr_config + * @awb_fr: AWB filter response config. See ipu3_uapi_awb_fr_config + * @ae: auto exposure config As specified by &ipu3_uapi_ae_config + * @af: auto focus config. As specified by &ipu3_uapi_af_config + * @awb: auto white balance config. As specified by &ipu3_uapi_awb_config + */ +struct ipu3_uapi_acc_param { + struct ipu3_uapi_bnr_static_config bnr; + struct ipu3_uapi_bnr_static_config_green_disparity + green_disparity __attribute__((aligned(32))); + struct ipu3_uapi_dm_config dm __attribute__((aligned(32))); + struct ipu3_uapi_ccm_mat_config ccm __attribute__((aligned(32))); + struct ipu3_uapi_gamma_config gamma __attribute__((aligned(32))); + struct ipu3_uapi_csc_mat_config csc __attribute__((aligned(32))); + struct ipu3_uapi_cds_params cds __attribute__((aligned(32))); + struct ipu3_uapi_shd_config shd __attribute__((aligned(32))); + struct ipu3_uapi_yuvp1_iefd_config iefd __attribute__((aligned(32))); + struct ipu3_uapi_yuvp1_yds_config yds_c0 __attribute__((aligned(32))); + struct ipu3_uapi_yuvp1_chnr_config chnr_c0 __attribute__((aligned(32))); + struct ipu3_uapi_yuvp1_y_ee_nr_config y_ee_nr __attribute__((aligned(32))); + struct ipu3_uapi_yuvp1_yds_config yds __attribute__((aligned(32))); + struct ipu3_uapi_yuvp1_chnr_config chnr __attribute__((aligned(32))); + struct ipu3_uapi_yuvp1_yds_config yds2 __attribute__((aligned(32))); + struct ipu3_uapi_yuvp2_tcc_static_config tcc __attribute__((aligned(32))); + struct ipu3_uapi_anr_config anr; + struct ipu3_uapi_awb_fr_config_s awb_fr; + struct ipu3_uapi_ae_config ae; + struct ipu3_uapi_af_config_s af; + struct ipu3_uapi_awb_config awb; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_isp_lin_vmem_params - Linearization parameters + * + * @lin_lutlow_gr: linearization look-up table for GR channel interpolation. + * @lin_lutlow_r: linearization look-up table for R channel interpolation. + * @lin_lutlow_b: linearization look-up table for B channel interpolation. + * @lin_lutlow_gb: linearization look-up table for GB channel interpolation. + * lin_lutlow_gr / lin_lutlow_r / lin_lutlow_b / + * lin_lutlow_gb <= LIN_MAX_VALUE - 1. + * @lin_lutdif_gr: lin_lutlow_gr[i+1] - lin_lutlow_gr[i]. + * @lin_lutdif_r: lin_lutlow_r[i+1] - lin_lutlow_r[i]. + * @lin_lutdif_b: lin_lutlow_b[i+1] - lin_lutlow_b[i]. + * @lin_lutdif_gb: lin_lutlow_gb[i+1] - lin_lutlow_gb[i]. + */ +struct ipu3_uapi_isp_lin_vmem_params { + __s16 lin_lutlow_gr[IPU3_UAPI_LIN_LUT_SIZE]; + __s16 lin_lutlow_r[IPU3_UAPI_LIN_LUT_SIZE]; + __s16 lin_lutlow_b[IPU3_UAPI_LIN_LUT_SIZE]; + __s16 lin_lutlow_gb[IPU3_UAPI_LIN_LUT_SIZE]; + __s16 lin_lutdif_gr[IPU3_UAPI_LIN_LUT_SIZE]; + __s16 lin_lutdif_r[IPU3_UAPI_LIN_LUT_SIZE]; + __s16 lin_lutdif_b[IPU3_UAPI_LIN_LUT_SIZE]; + __s16 lin_lutdif_gb[IPU3_UAPI_LIN_LUT_SIZE]; +} __attribute__((packed)); + +/* Temporal Noise Reduction */ + +/** + * struct ipu3_uapi_isp_tnr3_vmem_params - Temporal noise reduction vector + * memory parameters + * + * @slope: slope setting in interpolation curve for temporal noise reduction. + * @reserved1: reserved + * @sigma: knee point setting in interpolation curve for temporal + * noise reduction. + * @reserved2: reserved + */ +struct ipu3_uapi_isp_tnr3_vmem_params { + __u16 slope[IPU3_UAPI_ISP_TNR3_VMEM_LEN]; + __u16 reserved1[IPU3_UAPI_ISP_VEC_ELEMS + - IPU3_UAPI_ISP_TNR3_VMEM_LEN]; + __u16 sigma[IPU3_UAPI_ISP_TNR3_VMEM_LEN]; + __u16 reserved2[IPU3_UAPI_ISP_VEC_ELEMS + - IPU3_UAPI_ISP_TNR3_VMEM_LEN]; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_isp_tnr3_params - Temporal noise reduction v3 parameters + * + * @knee_y1: Knee point TNR3 assumes standard deviation of Y,U and + * V at Y1 are TnrY1_Sigma_Y, U and V. + * @knee_y2: Knee point TNR3 assumes standard deviation of Y,U and + * V at Y2 are TnrY2_Sigma_Y, U and V. + * @maxfb_y: Max feedback gain for Y + * @maxfb_u: Max feedback gain for U + * @maxfb_v: Max feedback gain for V + * @round_adj_y: rounding Adjust for Y + * @round_adj_u: rounding Adjust for U + * @round_adj_v: rounding Adjust for V + * @ref_buf_select: selection of the reference frame buffer to be used. + */ +struct ipu3_uapi_isp_tnr3_params { + __u32 knee_y1; + __u32 knee_y2; + __u32 maxfb_y; + __u32 maxfb_u; + __u32 maxfb_v; + __u32 round_adj_y; + __u32 round_adj_u; + __u32 round_adj_v; + __u32 ref_buf_select; +} __attribute__((packed)); + +/* Extreme Noise Reduction version 3 */ + +/** + * struct ipu3_uapi_isp_xnr3_vmem_params - Extreme noise reduction v3 + * vector memory parameters + * + * @x: xnr3 parameters. + * @a: xnr3 parameters. + * @b: xnr3 parameters. + * @c: xnr3 parameters. + */ +struct ipu3_uapi_isp_xnr3_vmem_params { + __u16 x[IPU3_UAPI_ISP_VEC_ELEMS]; + __u16 a[IPU3_UAPI_ISP_VEC_ELEMS]; + __u16 b[IPU3_UAPI_ISP_VEC_ELEMS]; + __u16 c[IPU3_UAPI_ISP_VEC_ELEMS]; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_xnr3_alpha_params - Extreme noise reduction v3 + * alpha tuning parameters + * + * @y0: Sigma for Y range similarity in dark area. + * @u0: Sigma for U range similarity in dark area. + * @v0: Sigma for V range similarity in dark area. + * @ydiff: Sigma difference for Y between bright area and dark area. + * @udiff: Sigma difference for U between bright area and dark area. + * @vdiff: Sigma difference for V between bright area and dark area. + */ +struct ipu3_uapi_xnr3_alpha_params { + __u32 y0; + __u32 u0; + __u32 v0; + __u32 ydiff; + __u32 udiff; + __u32 vdiff; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_xnr3_coring_params - Extreme noise reduction v3 + * coring parameters + * + * @u0: Coring Threshold of U channel in dark area. + * @v0: Coring Threshold of V channel in dark area. + * @udiff: Threshold difference of U channel between bright and dark area. + * @vdiff: Threshold difference of V channel between bright and dark area. + */ +struct ipu3_uapi_xnr3_coring_params { + __u32 u0; + __u32 v0; + __u32 udiff; + __u32 vdiff; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_xnr3_blending_params - Blending factor + * + * @strength: The factor for blending output with input. This is tuning + * parameterHigher values lead to more aggressive XNR operation. + */ +struct ipu3_uapi_xnr3_blending_params { + __u32 strength; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_isp_xnr3_params - Extreme noise reduction v3 parameters + * + * @alpha: parameters for xnr3 alpha. See &ipu3_uapi_xnr3_alpha_params + * @coring: parameters for xnr3 coring. See &ipu3_uapi_xnr3_coring_params + * @blending: parameters for xnr3 blending. See &ipu3_uapi_xnr3_blending_params + */ +struct ipu3_uapi_isp_xnr3_params { + struct ipu3_uapi_xnr3_alpha_params alpha; + struct ipu3_uapi_xnr3_coring_params coring; + struct ipu3_uapi_xnr3_blending_params blending; +} __attribute__((packed)); + +/***** Obgrid (optical black level compensation) table entry *****/ + +/** + * struct ipu3_uapi_obgrid_param - Optical black level compensation parameters + * + * @gr: Grid table values for color GR + * @r: Grid table values for color R + * @b: Grid table values for color B + * @gb: Grid table values for color GB + * + * Black level is different for red, green, and blue channels. So black level + * compensation is different per channel. + */ +struct ipu3_uapi_obgrid_param { + __u16 gr; + __u16 r; + __u16 b; + __u16 gb; +} __attribute__((packed)); + +/******************* V4L2_META_FMT_IPU3_PARAMS *******************/ + +/** + * struct ipu3_uapi_flags - bits to indicate which pipeline needs update + * + * @gdc: 0 = no update, 1 = update. + * @obgrid: 0 = no update, 1 = update. + * @reserved1: Not used. + * @acc_bnr: 0 = no update, 1 = update. + * @acc_green_disparity: 0 = no update, 1 = update. + * @acc_dm: 0 = no update, 1 = update. + * @acc_ccm: 0 = no update, 1 = update. + * @acc_gamma: 0 = no update, 1 = update. + * @acc_csc: 0 = no update, 1 = update. + * @acc_cds: 0 = no update, 1 = update. + * @acc_shd: 0 = no update, 1 = update. + * @reserved2: Not used. + * @acc_iefd: 0 = no update, 1 = update. + * @acc_yds_c0: 0 = no update, 1 = update. + * @acc_chnr_c0: 0 = no update, 1 = update. + * @acc_y_ee_nr: 0 = no update, 1 = update. + * @acc_yds: 0 = no update, 1 = update. + * @acc_chnr: 0 = no update, 1 = update. + * @acc_ytm: 0 = no update, 1 = update. + * @acc_yds2: 0 = no update, 1 = update. + * @acc_tcc: 0 = no update, 1 = update. + * @acc_dpc: 0 = no update, 1 = update. + * @acc_bds: 0 = no update, 1 = update. + * @acc_anr: 0 = no update, 1 = update. + * @acc_awb_fr: 0 = no update, 1 = update. + * @acc_ae: 0 = no update, 1 = update. + * @acc_af: 0 = no update, 1 = update. + * @acc_awb: 0 = no update, 1 = update. + * @__acc_osys: 0 = no update, 1 = update. + * @reserved3: Not used. + * @lin_vmem_params: 0 = no update, 1 = update. + * @tnr3_vmem_params: 0 = no update, 1 = update. + * @xnr3_vmem_params: 0 = no update, 1 = update. + * @tnr3_dmem_params: 0 = no update, 1 = update. + * @xnr3_dmem_params: 0 = no update, 1 = update. + * @reserved4: Not used. + * @obgrid_param: 0 = no update, 1 = update. + * @reserved5: Not used. + */ +struct ipu3_uapi_flags { + __u32 gdc:1; + __u32 obgrid:1; + __u32 reserved1:30; + + __u32 acc_bnr:1; + __u32 acc_green_disparity:1; + __u32 acc_dm:1; + __u32 acc_ccm:1; + __u32 acc_gamma:1; + __u32 acc_csc:1; + __u32 acc_cds:1; + __u32 acc_shd:1; + __u32 reserved2:2; + __u32 acc_iefd:1; + __u32 acc_yds_c0:1; + __u32 acc_chnr_c0:1; + __u32 acc_y_ee_nr:1; + __u32 acc_yds:1; + __u32 acc_chnr:1; + __u32 acc_ytm:1; + __u32 acc_yds2:1; + __u32 acc_tcc:1; + __u32 acc_dpc:1; + __u32 acc_bds:1; + __u32 acc_anr:1; + __u32 acc_awb_fr:1; + __u32 acc_ae:1; + __u32 acc_af:1; + __u32 acc_awb:1; + __u32 reserved3:4; + + __u32 lin_vmem_params:1; + __u32 tnr3_vmem_params:1; + __u32 xnr3_vmem_params:1; + __u32 tnr3_dmem_params:1; + __u32 xnr3_dmem_params:1; + __u32 reserved4:1; + __u32 obgrid_param:1; + __u32 reserved5:25; +} __attribute__((packed)); + +/** + * struct ipu3_uapi_params - V4L2_META_FMT_IPU3_PARAMS + * + * @use: select which parameters to apply, see &ipu3_uapi_flags + * @acc_param: ACC parameters, as specified by &ipu3_uapi_acc_param + * @lin_vmem_params: linearization VMEM, as specified by + * &ipu3_uapi_isp_lin_vmem_params + * @tnr3_vmem_params: tnr3 VMEM as specified by + * &ipu3_uapi_isp_tnr3_vmem_params + * @xnr3_vmem_params: xnr3 VMEM as specified by + * &ipu3_uapi_isp_xnr3_vmem_params + * @tnr3_dmem_params: tnr3 DMEM as specified by &ipu3_uapi_isp_tnr3_params + * @xnr3_dmem_params: xnr3 DMEM as specified by &ipu3_uapi_isp_xnr3_params + * @obgrid_param: obgrid parameters as specified by + * &ipu3_uapi_obgrid_param + * + * The video queue "parameters" is of format V4L2_META_FMT_IPU3_PARAMS. + * This is a "single plane" v4l2_meta_format using V4L2_BUF_TYPE_META_OUTPUT. + * + * struct ipu3_uapi_params as defined below contains a lot of parameters and + * ipu3_uapi_flags selects which parameters to apply. + */ +struct ipu3_uapi_params { + /* Flags which of the settings below are to be applied */ + struct ipu3_uapi_flags use __attribute__((aligned(32))); + + /* Accelerator cluster parameters */ + struct ipu3_uapi_acc_param acc_param; + + /* ISP vector address space parameters */ + struct ipu3_uapi_isp_lin_vmem_params lin_vmem_params; + struct ipu3_uapi_isp_tnr3_vmem_params tnr3_vmem_params; + struct ipu3_uapi_isp_xnr3_vmem_params xnr3_vmem_params; + + /* ISP data memory (DMEM) parameters */ + struct ipu3_uapi_isp_tnr3_params tnr3_dmem_params; + struct ipu3_uapi_isp_xnr3_params xnr3_dmem_params; + + /* Optical black level compensation */ + struct ipu3_uapi_obgrid_param obgrid_param; +} __attribute__((packed)); + +#endif /* __IPU3_UAPI_H */ From patchwork Thu Feb 4 16:29:34 2021 Content-Type: text/plain; charset="utf-8" MIME-Version: 1.0 Content-Transfer-Encoding: 8bit X-Patchwork-Submitter: =?utf-8?q?Niklas_S=C3=B6derlund?= X-Patchwork-Id: 11152 Return-Path: X-Original-To: parsemail@patchwork.libcamera.org Delivered-To: parsemail@patchwork.libcamera.org Received: from lancelot.ideasonboard.com (lancelot.ideasonboard.com [92.243.16.209]) by patchwork.libcamera.org (Postfix) with ESMTPS id 9425FBD162 for ; Thu, 4 Feb 2021 16:30:05 +0000 (UTC) Received: from lancelot.ideasonboard.com (localhost [IPv6:::1]) by lancelot.ideasonboard.com (Postfix) with ESMTP id 6A07261442; Thu, 4 Feb 2021 17:30:05 +0100 (CET) Received: from bin-mail-out-06.binero.net (bin-mail-out-06.binero.net [195.74.38.229]) by lancelot.ideasonboard.com (Postfix) with ESMTPS id 371B261438 for ; Thu, 4 Feb 2021 17:30:04 +0100 (CET) X-Halon-ID: 3a95f7c4-6706-11eb-b73f-0050569116f7 Authorized-sender: niklas.soderlund@fsdn.se Received: from bismarck.berto.se (p4fca2458.dip0.t-ipconnect.de [79.202.36.88]) by bin-vsp-out-03.atm.binero.net (Halon) with ESMTPA id 3a95f7c4-6706-11eb-b73f-0050569116f7; Thu, 04 Feb 2021 17:30:03 +0100 (CET) From: =?utf-8?q?Niklas_S=C3=B6derlund?= To: libcamera-devel@lists.libcamera.org Date: Thu, 4 Feb 2021 17:29:34 +0100 Message-Id: <20210204162943.268517-3-niklas.soderlund@ragnatech.se> X-Mailer: git-send-email 2.30.0 In-Reply-To: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> References: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> MIME-Version: 1.0 Subject: [libcamera-devel] [PATCH v3 02/11] libcamera: ipu3: imgu: Configure the stat video device as part of configure() X-BeenThere: libcamera-devel@lists.libcamera.org X-Mailman-Version: 2.1.29 Precedence: list List-Id: List-Unsubscribe: , List-Archive: List-Post: List-Help: List-Subscribe: , Errors-To: libcamera-devel-bounces@lists.libcamera.org Sender: "libcamera-devel" There is no reason to expose and call a separate configureStat() when the statistics video device can be configured with the exact same parameters as part of configure(). Move the configuration internally to the ImgUDevice simplifying the interface, there is no functional change. Signed-off-by: Niklas Söderlund Reviewed-by: Kieran Bingham Reviewed-by: Laurent Pinchart Reviewed-by: Jacopo Mondi --- src/libcamera/pipeline/ipu3/imgu.cpp | 7 +++++++ src/libcamera/pipeline/ipu3/imgu.h | 7 ------- src/libcamera/pipeline/ipu3/ipu3.cpp | 11 ----------- 3 files changed, 7 insertions(+), 18 deletions(-) diff --git a/src/libcamera/pipeline/ipu3/imgu.cpp b/src/libcamera/pipeline/ipu3/imgu.cpp index 5b1c0318b42695b7..08f0fce9d740963f 100644 --- a/src/libcamera/pipeline/ipu3/imgu.cpp +++ b/src/libcamera/pipeline/ipu3/imgu.cpp @@ -475,6 +475,13 @@ int ImgUDevice::configure(const PipeConfig &pipeConfig, V4L2DeviceFormat *inputF LOG(IPU3, Debug) << "ImgU GDC format = " << gdcFormat.toString(); + StreamConfiguration statCfg = {}; + statCfg.size = inputFormat->size; + V4L2DeviceFormat statFormat; + ret = configureVideoDevice(stat_.get(), PAD_STAT, statCfg, &statFormat); + if (ret) + return ret; + return 0; } diff --git a/src/libcamera/pipeline/ipu3/imgu.h b/src/libcamera/pipeline/ipu3/imgu.h index c73ac5a5a37cfe0e..37f5ae77c99ff8fe 100644 --- a/src/libcamera/pipeline/ipu3/imgu.h +++ b/src/libcamera/pipeline/ipu3/imgu.h @@ -61,13 +61,6 @@ public: outputFormat); } - int configureStat(const StreamConfiguration &cfg, - V4L2DeviceFormat *outputFormat) - { - return configureVideoDevice(stat_.get(), PAD_STAT, cfg, - outputFormat); - } - int allocateBuffers(unsigned int bufferCount); void freeBuffers(); diff --git a/src/libcamera/pipeline/ipu3/ipu3.cpp b/src/libcamera/pipeline/ipu3/ipu3.cpp index db0d6b91be70b9f0..23845ff3dee5f8b0 100644 --- a/src/libcamera/pipeline/ipu3/ipu3.cpp +++ b/src/libcamera/pipeline/ipu3/ipu3.cpp @@ -522,17 +522,6 @@ int PipelineHandlerIPU3::configure(Camera *camera, CameraConfiguration *c) return ret; } - /* - * Apply the largest available format to the stat node. - * \todo Revise this when we'll actually use the stat node. - */ - StreamConfiguration statCfg = {}; - statCfg.size = cio2Format.size; - - ret = imgu->configureStat(statCfg, &outputFormat); - if (ret) - return ret; - /* Apply the "pipe_mode" control to the ImgU subdevice. */ ControlList ctrls(imgu->imgu_->controls()); ctrls.set(V4L2_CID_IPU3_PIPE_MODE, From patchwork Thu Feb 4 16:29:35 2021 Content-Type: text/plain; charset="utf-8" MIME-Version: 1.0 Content-Transfer-Encoding: 8bit X-Patchwork-Submitter: =?utf-8?q?Niklas_S=C3=B6derlund?= X-Patchwork-Id: 11153 Return-Path: X-Original-To: parsemail@patchwork.libcamera.org Delivered-To: parsemail@patchwork.libcamera.org Received: from lancelot.ideasonboard.com (lancelot.ideasonboard.com [92.243.16.209]) by patchwork.libcamera.org (Postfix) with ESMTPS id AE7FCBD162 for ; Thu, 4 Feb 2021 16:30:08 +0000 (UTC) Received: from lancelot.ideasonboard.com (localhost [IPv6:::1]) by lancelot.ideasonboard.com (Postfix) with ESMTP id 8B7CB61447; Thu, 4 Feb 2021 17:30:08 +0100 (CET) Received: from bin-mail-out-06.binero.net (bin-mail-out-06.binero.net [195.74.38.229]) by lancelot.ideasonboard.com (Postfix) with ESMTPS id 86B8C61438 for ; Thu, 4 Feb 2021 17:30:06 +0100 (CET) X-Halon-ID: 3bfe416d-6706-11eb-b73f-0050569116f7 Authorized-sender: niklas.soderlund@fsdn.se Received: from bismarck.berto.se (p4fca2458.dip0.t-ipconnect.de [79.202.36.88]) by bin-vsp-out-03.atm.binero.net (Halon) with ESMTPA id 3bfe416d-6706-11eb-b73f-0050569116f7; Thu, 04 Feb 2021 17:30:05 +0100 (CET) From: =?utf-8?q?Niklas_S=C3=B6derlund?= To: libcamera-devel@lists.libcamera.org Date: Thu, 4 Feb 2021 17:29:35 +0100 Message-Id: <20210204162943.268517-4-niklas.soderlund@ragnatech.se> X-Mailer: git-send-email 2.30.0 In-Reply-To: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> References: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> MIME-Version: 1.0 Subject: [libcamera-devel] [PATCH v3 03/11] libcamera: ipu3: imgu: Add parameters video device X-BeenThere: libcamera-devel@lists.libcamera.org X-Mailman-Version: 2.1.29 Precedence: list List-Id: List-Unsubscribe: , List-Archive: List-Post: List-Help: List-Subscribe: , Errors-To: libcamera-devel-bounces@lists.libcamera.org Sender: "libcamera-devel" Add the parameters video device to the data structure of the ImgUDevice. Even if the video device is configured, prepared to import buffers and started no buffers are ever queued to it so it does not yet effect the capture. Nor is does this change hinder the current capture mode to function. This is done in preparation to attach an IPA to the IPU3 pipeline. Signed-off-by: Niklas Söderlund Reviewed-by: Kieran Bingham Reviewed-by: Jacopo Mondi Reviewed-by: Laurent Pinchart --- * Changes since v1 - Update commit message s/attache/attach/. - Utilise unique pointer returned from fromEntityName() that have been merged since v1. - Expand explanatory note in ImgUDevice::configureVideoDevice(). - Sort std::unique_ptr to match pad numbering. --- src/libcamera/pipeline/ipu3/imgu.cpp | 41 ++++++++++++++++++++++++++-- src/libcamera/pipeline/ipu3/imgu.h | 3 +- 2 files changed, 41 insertions(+), 3 deletions(-) diff --git a/src/libcamera/pipeline/ipu3/imgu.cpp b/src/libcamera/pipeline/ipu3/imgu.cpp index 08f0fce9d740963f..c861022060c82dde 100644 --- a/src/libcamera/pipeline/ipu3/imgu.cpp +++ b/src/libcamera/pipeline/ipu3/imgu.cpp @@ -363,6 +363,11 @@ int ImgUDevice::init(MediaDevice *media, unsigned int index) if (ret) return ret; + param_ = V4L2VideoDevice::fromEntityName(media, name_ + " parameters"); + ret = param_->open(); + if (ret) + return ret; + stat_ = V4L2VideoDevice::fromEntityName(media, name_ + " 3a stat"); ret = stat_->open(); if (ret) @@ -475,6 +480,13 @@ int ImgUDevice::configure(const PipeConfig &pipeConfig, V4L2DeviceFormat *inputF LOG(IPU3, Debug) << "ImgU GDC format = " << gdcFormat.toString(); + StreamConfiguration paramCfg = {}; + paramCfg.size = inputFormat->size; + V4L2DeviceFormat paramFormat; + ret = configureVideoDevice(param_.get(), PAD_PARAM, paramCfg, ¶mFormat); + if (ret) + return ret; + StreamConfiguration statCfg = {}; statCfg.size = inputFormat->size; V4L2DeviceFormat statFormat; @@ -505,8 +517,11 @@ int ImgUDevice::configureVideoDevice(V4L2VideoDevice *dev, unsigned int pad, if (ret) return ret; - /* No need to apply format to the stat node. */ - if (dev == stat_.get()) + /* + * No need to apply format to the param or stat video devices as the + * driver ignores the operation. + */ + if (dev == param_.get() || dev == stat_.get()) return 0; *outputFormat = {}; @@ -537,6 +552,12 @@ int ImgUDevice::allocateBuffers(unsigned int bufferCount) return ret; } + ret = param_->importBuffers(bufferCount); + if (ret < 0) { + LOG(IPU3, Error) << "Failed to allocate ImgU param buffers"; + goto error; + } + /* * The kernel fails to start if buffers are not either imported or * allocated for the statistics video device. As statistics buffers are @@ -586,6 +607,10 @@ void ImgUDevice::freeBuffers() if (ret) LOG(IPU3, Error) << "Failed to release ImgU output buffers"; + ret = param_->releaseBuffers(); + if (ret) + LOG(IPU3, Error) << "Failed to release ImgU param buffers"; + ret = stat_->releaseBuffers(); if (ret) LOG(IPU3, Error) << "Failed to release ImgU stat buffers"; @@ -616,6 +641,12 @@ int ImgUDevice::start() return ret; } + ret = param_->streamOn(); + if (ret) { + LOG(IPU3, Error) << "Failed to start ImgU param"; + return ret; + } + ret = stat_->streamOn(); if (ret) { LOG(IPU3, Error) << "Failed to start ImgU stat"; @@ -637,6 +668,7 @@ int ImgUDevice::stop() ret = output_->streamOff(); ret |= viewfinder_->streamOff(); + ret |= param_->streamOff(); ret |= stat_->streamOff(); ret |= input_->streamOff(); @@ -678,6 +710,7 @@ int ImgUDevice::linkSetup(const std::string &source, unsigned int sourcePad, int ImgUDevice::enableLinks(bool enable) { std::string viewfinderName = name_ + " viewfinder"; + std::string paramName = name_ + " parameters"; std::string outputName = name_ + " output"; std::string statName = name_ + " 3a stat"; std::string inputName = name_ + " input"; @@ -695,6 +728,10 @@ int ImgUDevice::enableLinks(bool enable) if (ret) return ret; + ret = linkSetup(paramName, 0, name_, PAD_PARAM, enable); + if (ret) + return ret; + return linkSetup(name_, PAD_STAT, statName, 0, enable); } diff --git a/src/libcamera/pipeline/ipu3/imgu.h b/src/libcamera/pipeline/ipu3/imgu.h index 37f5ae77c99ff8fe..4a1896e2bbb41842 100644 --- a/src/libcamera/pipeline/ipu3/imgu.h +++ b/src/libcamera/pipeline/ipu3/imgu.h @@ -71,13 +71,14 @@ public: std::unique_ptr imgu_; std::unique_ptr input_; + std::unique_ptr param_; std::unique_ptr output_; std::unique_ptr viewfinder_; std::unique_ptr stat_; - /* \todo Add param video device for 3A tuning */ private: static constexpr unsigned int PAD_INPUT = 0; + static constexpr unsigned int PAD_PARAM = 1; static constexpr unsigned int PAD_OUTPUT = 2; static constexpr unsigned int PAD_VF = 3; static constexpr unsigned int PAD_STAT = 4; From patchwork Thu Feb 4 16:29:36 2021 Content-Type: text/plain; charset="utf-8" MIME-Version: 1.0 Content-Transfer-Encoding: 8bit X-Patchwork-Submitter: =?utf-8?q?Niklas_S=C3=B6derlund?= X-Patchwork-Id: 11154 Return-Path: X-Original-To: parsemail@patchwork.libcamera.org Delivered-To: parsemail@patchwork.libcamera.org Received: from lancelot.ideasonboard.com (lancelot.ideasonboard.com [92.243.16.209]) by patchwork.libcamera.org (Postfix) with ESMTPS id D4D33BD162 for ; Thu, 4 Feb 2021 16:30:09 +0000 (UTC) Received: from lancelot.ideasonboard.com (localhost [IPv6:::1]) by lancelot.ideasonboard.com (Postfix) with ESMTP id B5D6161442; Thu, 4 Feb 2021 17:30:08 +0100 (CET) Received: from bin-mail-out-06.binero.net (bin-mail-out-06.binero.net [195.74.38.229]) by lancelot.ideasonboard.com (Postfix) with ESMTPS id 838C361437 for ; Thu, 4 Feb 2021 17:30:07 +0100 (CET) X-Halon-ID: 3d660bfa-6706-11eb-b73f-0050569116f7 Authorized-sender: niklas.soderlund@fsdn.se Received: from bismarck.berto.se (p4fca2458.dip0.t-ipconnect.de [79.202.36.88]) by bin-vsp-out-03.atm.binero.net (Halon) with ESMTPA id 3d660bfa-6706-11eb-b73f-0050569116f7; Thu, 04 Feb 2021 17:30:06 +0100 (CET) From: =?utf-8?q?Niklas_S=C3=B6derlund?= To: libcamera-devel@lists.libcamera.org Date: Thu, 4 Feb 2021 17:29:36 +0100 Message-Id: <20210204162943.268517-5-niklas.soderlund@ragnatech.se> X-Mailer: git-send-email 2.30.0 In-Reply-To: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> References: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> MIME-Version: 1.0 Subject: [libcamera-devel] [PATCH v3 04/11] libcamera: ipu3: cio2: Return the FrameBuffer pointer used X-BeenThere: libcamera-devel@lists.libcamera.org X-Mailman-Version: 2.1.29 Precedence: list List-Id: List-Unsubscribe: , List-Archive: List-Post: List-Help: List-Subscribe: , Errors-To: libcamera-devel-bounces@lists.libcamera.org Sender: "libcamera-devel" When adding IPA plumbing to the IPU3 pipeline handler it will be needed to track which raw buffer was queued to the CIO2 for a specific request. Currently if using an internally allocated raw buffer the FrameBuffer is not exposed outside the CIO2Device as it was not needed. Prepare for the IPA by exposing which internal raw buffer is picked for each request, later changes will associate this with a Request. Signed-off-by: Niklas Söderlund Reviewed-by: Jacopo Mondi Reviewed-by: Laurent Pinchart --- * Changes since v1 - Update commit message. --- src/libcamera/pipeline/ipu3/cio2.cpp | 10 +++++++--- src/libcamera/pipeline/ipu3/cio2.h | 2 +- src/libcamera/pipeline/ipu3/ipu3.cpp | 8 ++++---- 3 files changed, 12 insertions(+), 8 deletions(-) diff --git a/src/libcamera/pipeline/ipu3/cio2.cpp b/src/libcamera/pipeline/ipu3/cio2.cpp index 72e88067f55f29c6..c7fabb98cd6b3438 100644 --- a/src/libcamera/pipeline/ipu3/cio2.cpp +++ b/src/libcamera/pipeline/ipu3/cio2.cpp @@ -253,7 +253,7 @@ int CIO2Device::stop() return ret; } -int CIO2Device::queueBuffer(Request *request, FrameBuffer *rawBuffer) +FrameBuffer *CIO2Device::queueBuffer(Request *request, FrameBuffer *rawBuffer) { FrameBuffer *buffer = rawBuffer; @@ -261,7 +261,7 @@ int CIO2Device::queueBuffer(Request *request, FrameBuffer *rawBuffer) if (!buffer) { if (availableBuffers_.empty()) { LOG(IPU3, Error) << "CIO2 buffer underrun"; - return -EINVAL; + return nullptr; } buffer = availableBuffers_.front(); @@ -270,7 +270,11 @@ int CIO2Device::queueBuffer(Request *request, FrameBuffer *rawBuffer) buffer->setRequest(request); - return output_->queueBuffer(buffer); + int ret = output_->queueBuffer(buffer); + if (ret) + return nullptr; + + return buffer; } void CIO2Device::tryReturnBuffer(FrameBuffer *buffer) diff --git a/src/libcamera/pipeline/ipu3/cio2.h b/src/libcamera/pipeline/ipu3/cio2.h index 236ad287354a0bf6..dca4d40e4c32e8b2 100644 --- a/src/libcamera/pipeline/ipu3/cio2.h +++ b/src/libcamera/pipeline/ipu3/cio2.h @@ -51,7 +51,7 @@ public: CameraSensor *sensor() { return sensor_.get(); } const CameraSensor *sensor() const { return sensor_.get(); } - int queueBuffer(Request *request, FrameBuffer *rawBuffer); + FrameBuffer *queueBuffer(Request *request, FrameBuffer *rawBuffer); void tryReturnBuffer(FrameBuffer *buffer); Signal &bufferReady() { return output_->bufferReady; } diff --git a/src/libcamera/pipeline/ipu3/ipu3.cpp b/src/libcamera/pipeline/ipu3/ipu3.cpp index 23845ff3dee5f8b0..184986fc648b541a 100644 --- a/src/libcamera/pipeline/ipu3/ipu3.cpp +++ b/src/libcamera/pipeline/ipu3/ipu3.cpp @@ -646,10 +646,10 @@ int PipelineHandlerIPU3::queueRequestDevice(Camera *camera, Request *request) * Queue a buffer on the CIO2, using the raw stream buffer provided in * the request, if any, or a CIO2 internal buffer otherwise. */ - FrameBuffer *rawBuffer = request->findBuffer(&data->rawStream_); - error = data->cio2_.queueBuffer(request, rawBuffer); - if (error) - return error; + FrameBuffer *reqRawBuffer = request->findBuffer(&data->rawStream_); + FrameBuffer *rawBuffer = data->cio2_.queueBuffer(request, reqRawBuffer); + if (!rawBuffer) + return -ENOMEM; /* Queue all buffers from the request aimed for the ImgU. */ for (auto it : request->buffers()) { From patchwork Thu Feb 4 16:29:37 2021 Content-Type: text/plain; charset="utf-8" MIME-Version: 1.0 Content-Transfer-Encoding: 8bit X-Patchwork-Submitter: =?utf-8?q?Niklas_S=C3=B6derlund?= X-Patchwork-Id: 11155 Return-Path: X-Original-To: parsemail@patchwork.libcamera.org Delivered-To: parsemail@patchwork.libcamera.org Received: from lancelot.ideasonboard.com (lancelot.ideasonboard.com [92.243.16.209]) by patchwork.libcamera.org (Postfix) with ESMTPS id 1AD2EBD163 for ; Thu, 4 Feb 2021 16:30:10 +0000 (UTC) Received: from lancelot.ideasonboard.com (localhost [IPv6:::1]) by lancelot.ideasonboard.com (Postfix) with ESMTP id EAE676144D; Thu, 4 Feb 2021 17:30:09 +0100 (CET) Received: from vsp-unauthed02.binero.net (vsp-unauthed02.binero.net [195.74.38.227]) by lancelot.ideasonboard.com (Postfix) with ESMTPS id 9170F61448 for ; Thu, 4 Feb 2021 17:30:08 +0100 (CET) X-Halon-ID: 3dfd9de2-6706-11eb-b73f-0050569116f7 Authorized-sender: niklas.soderlund@fsdn.se Received: from bismarck.berto.se (p4fca2458.dip0.t-ipconnect.de [79.202.36.88]) by bin-vsp-out-03.atm.binero.net (Halon) with ESMTPA id 3dfd9de2-6706-11eb-b73f-0050569116f7; Thu, 04 Feb 2021 17:30:07 +0100 (CET) From: =?utf-8?q?Niklas_S=C3=B6derlund?= To: libcamera-devel@lists.libcamera.org Date: Thu, 4 Feb 2021 17:29:37 +0100 Message-Id: <20210204162943.268517-6-niklas.soderlund@ragnatech.se> X-Mailer: git-send-email 2.30.0 In-Reply-To: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> References: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> MIME-Version: 1.0 Subject: [libcamera-devel] [PATCH v3 05/11] libcamera: ipu3: cio2: Generate start of frame event X-BeenThere: libcamera-devel@lists.libcamera.org X-Mailman-Version: 2.1.29 Precedence: list List-Id: List-Unsubscribe: , List-Archive: List-Post: List-Help: List-Subscribe: , Errors-To: libcamera-devel-bounces@lists.libcamera.org Sender: "libcamera-devel" Propagate the frameStart event whenever the CSI-2 receiver in the CIO2 pipeline generates one. Signed-off-by: Niklas Söderlund Reviewed-by: Kieran Bingham Reviewed-by: Jacopo Mondi Reviewed-by: Laurent Pinchart --- * Changes since v1 - Move blank lines. --- src/libcamera/pipeline/ipu3/cio2.cpp | 18 +++++++++++++++--- src/libcamera/pipeline/ipu3/cio2.h | 3 ++- 2 files changed, 17 insertions(+), 4 deletions(-) diff --git a/src/libcamera/pipeline/ipu3/cio2.cpp b/src/libcamera/pipeline/ipu3/cio2.cpp index c7fabb98cd6b3438..0ef3bc04659b4d16 100644 --- a/src/libcamera/pipeline/ipu3/cio2.cpp +++ b/src/libcamera/pipeline/ipu3/cio2.cpp @@ -238,15 +238,27 @@ int CIO2Device::start() availableBuffers_.push(buffer.get()); ret = output_->streamOn(); - if (ret) + if (ret) { freeBuffers(); + return ret; + } - return ret; + ret = csi2_->setFrameStartEnabled(true); + if (ret) { + stop(); + return ret; + } + + return 0; } int CIO2Device::stop() { - int ret = output_->streamOff(); + int ret; + + csi2_->setFrameStartEnabled(false); + + ret = output_->streamOff(); freeBuffers(); diff --git a/src/libcamera/pipeline/ipu3/cio2.h b/src/libcamera/pipeline/ipu3/cio2.h index dca4d40e4c32e8b2..5ecc4f47bb3cdb3f 100644 --- a/src/libcamera/pipeline/ipu3/cio2.h +++ b/src/libcamera/pipeline/ipu3/cio2.h @@ -13,6 +13,7 @@ #include +#include "libcamera/internal/v4l2_subdevice.h" #include "libcamera/internal/v4l2_videodevice.h" namespace libcamera { @@ -24,7 +25,6 @@ class PixelFormat; class Request; class Size; class SizeRange; -class V4L2Subdevice; struct StreamConfiguration; class CIO2Device @@ -54,6 +54,7 @@ public: FrameBuffer *queueBuffer(Request *request, FrameBuffer *rawBuffer); void tryReturnBuffer(FrameBuffer *buffer); Signal &bufferReady() { return output_->bufferReady; } + Signal &frameStart() { return csi2_->frameStart; } private: void freeBuffers(); From patchwork Thu Feb 4 16:29:38 2021 Content-Type: text/plain; charset="utf-8" MIME-Version: 1.0 Content-Transfer-Encoding: 8bit X-Patchwork-Submitter: =?utf-8?q?Niklas_S=C3=B6derlund?= X-Patchwork-Id: 11156 Return-Path: X-Original-To: parsemail@patchwork.libcamera.org Delivered-To: parsemail@patchwork.libcamera.org Received: from lancelot.ideasonboard.com (lancelot.ideasonboard.com [92.243.16.209]) by patchwork.libcamera.org (Postfix) with ESMTPS id 4CE79BD162 for ; Thu, 4 Feb 2021 16:30:11 +0000 (UTC) Received: from lancelot.ideasonboard.com (localhost [IPv6:::1]) by lancelot.ideasonboard.com (Postfix) with ESMTP id 251CB61457; Thu, 4 Feb 2021 17:30:11 +0100 (CET) Received: from bin-mail-out-05.binero.net (bin-mail-out-05.binero.net [195.74.38.228]) by lancelot.ideasonboard.com (Postfix) with ESMTPS id 15B3D61440 for ; Thu, 4 Feb 2021 17:30:10 +0100 (CET) X-Halon-ID: 3e970448-6706-11eb-b73f-0050569116f7 Authorized-sender: niklas.soderlund@fsdn.se Received: from bismarck.berto.se (p4fca2458.dip0.t-ipconnect.de [79.202.36.88]) by bin-vsp-out-03.atm.binero.net (Halon) with ESMTPA id 3e970448-6706-11eb-b73f-0050569116f7; Thu, 04 Feb 2021 17:30:08 +0100 (CET) From: =?utf-8?q?Niklas_S=C3=B6derlund?= To: libcamera-devel@lists.libcamera.org Date: Thu, 4 Feb 2021 17:29:38 +0100 Message-Id: <20210204162943.268517-7-niklas.soderlund@ragnatech.se> X-Mailer: git-send-email 2.30.0 In-Reply-To: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> References: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> MIME-Version: 1.0 Subject: [libcamera-devel] [PATCH v3 06/11] libcamera: ipa: ipu3: Add an IPA skeleton for the IPU3 pipeline X-BeenThere: libcamera-devel@lists.libcamera.org X-Mailman-Version: 2.1.29 Precedence: list List-Id: List-Unsubscribe: , List-Archive: List-Post: List-Help: List-Subscribe: , Errors-To: libcamera-devel-bounces@lists.libcamera.org Sender: "libcamera-devel" Add an empty IPA skeleton for the IPU3 pipeline. The skeleton IPA handles the flow of parameter and statistic buffers but does not read or write anything in the buffers. It also allows the IPA to set sensor controls but does not implement any logic to set optimal values and instead sets the V4L2 exposure and gain controls to max and keeps them at that setting. This IPA is meant as a base to allow the pipeline handler to be wired up to an IPA. The image algorithms can then later be added to the IPA independently from also having to add plumbing to the pipeline handler. Signed-off-by: Niklas Söderlund Acked-by: Kieran Bingham Reviewed-by: Laurent Pinchart Reviewed-by: Jacopo Mondi --- * Changes since v1 - Updated commit message. - Rename IPU3_IPA_EVENT_PARSE_STAT to IPU3_IPA_EVENT_PARSE_STAT. - Sort and drop unused headers. - Fix style issue in meson.build and add dependency on libatomic. - Switch to MappedFrameBuffer interface. - Add result of IPA configuration status. * Changes since v2 - Include stdint.h - s/std::max/std::max/ - Erase iterator instead of id in unmapBuffers() --- include/libcamera/ipa/ipu3.h | 22 ++++ src/ipa/ipu3/ipu3.cpp | 233 +++++++++++++++++++++++++++++++++++ src/ipa/ipu3/meson.build | 21 ++++ src/ipa/meson.build | 2 +- 4 files changed, 277 insertions(+), 1 deletion(-) create mode 100644 include/libcamera/ipa/ipu3.h create mode 100644 src/ipa/ipu3/ipu3.cpp create mode 100644 src/ipa/ipu3/meson.build diff --git a/include/libcamera/ipa/ipu3.h b/include/libcamera/ipa/ipu3.h new file mode 100644 index 0000000000000000..e712a4581e2febc4 --- /dev/null +++ b/include/libcamera/ipa/ipu3.h @@ -0,0 +1,22 @@ +/* SPDX-License-Identifier: LGPL-2.1-or-later */ +/* + * Copyright (C) 2020, Google Inc. + * + * ipu3.h - Image Processing Algorithm interface for IPU3 + */ +#ifndef __LIBCAMERA_IPA_INTERFACE_IPU3_H__ +#define __LIBCAMERA_IPA_INTERFACE_IPU3_H__ + +#ifndef __DOXYGEN__ + +enum IPU3Operations { + IPU3_IPA_ACTION_SET_SENSOR_CONTROLS = 1, + IPU3_IPA_ACTION_PARAM_FILLED = 2, + IPU3_IPA_ACTION_METADATA_READY = 3, + IPU3_IPA_EVENT_STAT_READY = 4, + IPU3_IPA_EVENT_FILL_PARAMS = 5, +}; + +#endif /* __DOXYGEN__ */ + +#endif /* __LIBCAMERA_IPA_INTERFACE_IPU3_H__ */ diff --git a/src/ipa/ipu3/ipu3.cpp b/src/ipa/ipu3/ipu3.cpp new file mode 100644 index 0000000000000000..382a7dfbca6511f8 --- /dev/null +++ b/src/ipa/ipu3/ipu3.cpp @@ -0,0 +1,233 @@ +/* SPDX-License-Identifier: LGPL-2.1-or-later */ +/* + * Copyright (C) 2020, Google Inc. + * + * ipu3.cpp - IPU3 Image Processing Algorithms + */ + +#include + +#include +#include + +#include +#include + +#include +#include +#include +#include +#include + +#include + +#include "libcamera/internal/buffer.h" +#include "libcamera/internal/log.h" + +namespace libcamera { + +LOG_DEFINE_CATEGORY(IPAIPU3) + +class IPAIPU3 : public IPAInterface +{ +public: + int init([[maybe_unused]] const IPASettings &settings) override + { + return 0; + } + int start([[maybe_unused]] const IPAOperationData &data, + [[maybe_unused]] IPAOperationData *result) override { return 0; } + void stop() override {} + + void configure(const CameraSensorInfo &info, + const std::map &streamConfig, + const std::map &entityControls, + const IPAOperationData &ipaConfig, + IPAOperationData *response) override; + void mapBuffers(const std::vector &buffers) override; + void unmapBuffers(const std::vector &ids) override; + void processEvent(const IPAOperationData &event) override; + +private: + void fillParams(unsigned int frame, ipu3_uapi_params *params, + const ControlList &controls); + + void parseStatistics(unsigned int frame, + const ipu3_uapi_stats_3a *stats); + + void setControls(unsigned int frame); + + std::map buffers_; + + ControlInfoMap ctrls_; + + /* Camera sensor controls. */ + uint32_t exposure_; + uint32_t minExposure_; + uint32_t maxExposure_; + uint32_t gain_; + uint32_t minGain_; + uint32_t maxGain_; +}; + +void IPAIPU3::configure([[maybe_unused]] const CameraSensorInfo &info, + [[maybe_unused]] const std::map &streamConfig, + const std::map &entityControls, + [[maybe_unused]] const IPAOperationData &ipaConfig, + [[maybe_unused]] IPAOperationData *result) +{ + if (entityControls.empty()) + return; + + ctrls_ = entityControls.at(0); + + const auto itExp = ctrls_.find(V4L2_CID_EXPOSURE); + if (itExp == ctrls_.end()) { + LOG(IPAIPU3, Error) << "Can't find exposure control"; + return; + } + + const auto itGain = ctrls_.find(V4L2_CID_ANALOGUE_GAIN); + if (itGain == ctrls_.end()) { + LOG(IPAIPU3, Error) << "Can't find gain control"; + return; + } + + minExposure_ = std::max(itExp->second.min().get(), 1); + maxExposure_ = itExp->second.max().get(); + exposure_ = maxExposure_; + + minGain_ = std::max(itGain->second.min().get(), 1); + maxGain_ = itGain->second.max().get(); + gain_ = maxGain_; + + setControls(0); +} + +void IPAIPU3::mapBuffers(const std::vector &buffers) +{ + for (const IPABuffer &buffer : buffers) { + const FrameBuffer fb(buffer.planes); + buffers_.emplace(buffer.id, + MappedFrameBuffer(&fb, PROT_READ | PROT_WRITE)); + } +} + +void IPAIPU3::unmapBuffers(const std::vector &ids) +{ + for (unsigned int id : ids) { + auto it = buffers_.find(id); + if (it == buffers_.end()) + continue; + + buffers_.erase(it); + } +} + +void IPAIPU3::processEvent(const IPAOperationData &event) +{ + switch (event.operation) { + case IPU3_IPA_EVENT_STAT_READY: { + unsigned int frame = event.data[0]; + unsigned int bufferId = event.data[1]; + + auto it = buffers_.find(bufferId); + if (it == buffers_.end()) { + LOG(IPAIPU3, Error) << "Could not find stats buffer!"; + return; + } + + Span mem = it->second.maps()[0]; + const ipu3_uapi_stats_3a *stats = + reinterpret_cast(mem.data()); + + parseStatistics(frame, stats); + break; + } + case IPU3_IPA_EVENT_FILL_PARAMS: { + unsigned int frame = event.data[0]; + unsigned int bufferId = event.data[1]; + + auto it = buffers_.find(bufferId); + if (it == buffers_.end()) { + LOG(IPAIPU3, Error) << "Could not find param buffer!"; + return; + } + + Span mem = it->second.maps()[0]; + ipu3_uapi_params *params = + reinterpret_cast(mem.data()); + + fillParams(frame, params, event.controls[0]); + break; + } + default: + LOG(IPAIPU3, Error) << "Unknown event " << event.operation; + break; + } +} + +void IPAIPU3::fillParams(unsigned int frame, ipu3_uapi_params *params, + [[maybe_unused]] const ControlList &controls) +{ + /* Prepare parameters buffer. */ + memset(params, 0, sizeof(*params)); + + /* \todo Fill in parameters buffer. */ + + IPAOperationData op; + op.operation = IPU3_IPA_ACTION_PARAM_FILLED; + + queueFrameAction.emit(frame, op); + + /* \todo Calculate new values for exposure_ and gain_. */ + setControls(frame); +} + +void IPAIPU3::parseStatistics(unsigned int frame, + [[maybe_unused]] const ipu3_uapi_stats_3a *stats) +{ + ControlList ctrls(controls::controls); + + /* \todo React to statistics and update internal state machine. */ + /* \todo Add meta-data information to ctrls. */ + + IPAOperationData op; + op.operation = IPU3_IPA_ACTION_METADATA_READY; + op.controls.push_back(ctrls); + + queueFrameAction.emit(frame, op); +} + +void IPAIPU3::setControls(unsigned int frame) +{ + IPAOperationData op; + op.operation = IPU3_IPA_ACTION_SET_SENSOR_CONTROLS; + + ControlList ctrls(ctrls_); + ctrls.set(V4L2_CID_EXPOSURE, static_cast(exposure_)); + ctrls.set(V4L2_CID_ANALOGUE_GAIN, static_cast(gain_)); + op.controls.push_back(ctrls); + + queueFrameAction.emit(frame, op); +} + +/* + * External IPA module interface + */ + +extern "C" { +const struct IPAModuleInfo ipaModuleInfo = { + IPA_MODULE_API_VERSION, + 1, + "PipelineHandlerIPU3", + "ipu3", +}; + +struct ipa_context *ipaCreate() +{ + return new IPAInterfaceWrapper(std::make_unique()); +} +} + +} /* namespace libcamera */ diff --git a/src/ipa/ipu3/meson.build b/src/ipa/ipu3/meson.build new file mode 100644 index 0000000000000000..444c82453eac42ff --- /dev/null +++ b/src/ipa/ipu3/meson.build @@ -0,0 +1,21 @@ +# SPDX-License-Identifier: CC0-1.0 + +ipa_name = 'ipa_ipu3' + +mod = shared_module(ipa_name, + 'ipu3.cpp', + name_prefix : '', + include_directories : [ ipa_includes, libipa_includes ], + dependencies : [ libatomic, libcamera_dep ], + link_with : libipa, + install : true, + install_dir : ipa_install_dir) + +if ipa_sign_module + custom_target(ipa_name + '.so.sign', + input : mod, + output : ipa_name + '.so.sign', + command : [ ipa_sign, ipa_priv_key, '@INPUT@', '@OUTPUT@' ], + install : false, + build_by_default : true) +endif diff --git a/src/ipa/meson.build b/src/ipa/meson.build index 5a5de267c1477d24..9d623f227a1f9feb 100644 --- a/src/ipa/meson.build +++ b/src/ipa/meson.build @@ -19,7 +19,7 @@ subdir('libipa') ipa_sign = files('ipa-sign.sh') -ipas = ['raspberrypi', 'rkisp1', 'vimc'] +ipas = ['ipu3', 'raspberrypi', 'rkisp1', 'vimc'] ipa_names = [] foreach pipeline : get_option('pipelines') From patchwork Thu Feb 4 16:29:39 2021 Content-Type: text/plain; charset="utf-8" MIME-Version: 1.0 Content-Transfer-Encoding: 8bit X-Patchwork-Submitter: =?utf-8?q?Niklas_S=C3=B6derlund?= X-Patchwork-Id: 11157 Return-Path: X-Original-To: parsemail@patchwork.libcamera.org Delivered-To: parsemail@patchwork.libcamera.org Received: from lancelot.ideasonboard.com (lancelot.ideasonboard.com [92.243.16.209]) by patchwork.libcamera.org (Postfix) with ESMTPS id 9F93EBD162 for ; Thu, 4 Feb 2021 16:30:12 +0000 (UTC) Received: from lancelot.ideasonboard.com (localhost [IPv6:::1]) by lancelot.ideasonboard.com (Postfix) with ESMTP id 7B3F661459; Thu, 4 Feb 2021 17:30:12 +0100 (CET) Received: from bin-mail-out-06.binero.net (bin-mail-out-06.binero.net [195.74.38.229]) by lancelot.ideasonboard.com (Postfix) with ESMTPS id 26D1B61459 for ; Thu, 4 Feb 2021 17:30:11 +0100 (CET) X-Halon-ID: 3f80b8d2-6706-11eb-b73f-0050569116f7 Authorized-sender: niklas.soderlund@fsdn.se Received: from bismarck.berto.se (p4fca2458.dip0.t-ipconnect.de [79.202.36.88]) by bin-vsp-out-03.atm.binero.net (Halon) with ESMTPA id 3f80b8d2-6706-11eb-b73f-0050569116f7; Thu, 04 Feb 2021 17:30:10 +0100 (CET) From: =?utf-8?q?Niklas_S=C3=B6derlund?= To: libcamera-devel@lists.libcamera.org Date: Thu, 4 Feb 2021 17:29:39 +0100 Message-Id: <20210204162943.268517-8-niklas.soderlund@ragnatech.se> X-Mailer: git-send-email 2.30.0 In-Reply-To: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> References: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> MIME-Version: 1.0 Subject: [libcamera-devel] [PATCH v3 07/11] libcamera: ipu3: Attach to an IPA and allow it to set sensor controls X-BeenThere: libcamera-devel@lists.libcamera.org X-Mailman-Version: 2.1.29 Precedence: list List-Id: List-Unsubscribe: , List-Archive: List-Post: List-Help: List-Subscribe: , Errors-To: libcamera-devel-bounces@lists.libcamera.org Sender: "libcamera-devel" Attach to the IPA and allow it to push V4L2 controls that apply to the camera sensor. The IPA is not fully integrated in the pipeline as statistics and parameters buffers are not yet allocated, processed by the IPA nor queued to the hardware. Signed-off-by: Niklas Söderlund Reviewed-by: Jacopo Mondi Reviewed-by: Laurent Pinchart --- * Changes since v1 - Rewrite to not use CameraSensor. - Fix mistake where configuration sen to IPA was overwritten. - Check that IPA configuration was successful before starting. - Update commit message. * Changes since v2 - Update comments - s/dealy/delay/ - s/generic values/'generic values'/ - Fix spelling in commit message. - Failure to retrive sensor information is now a hard fail. - s/actOnIpa/queueFrameAction/ --- src/libcamera/pipeline/ipu3/ipu3.cpp | 91 ++++++++++++++++++++++++++++ 1 file changed, 91 insertions(+) diff --git a/src/libcamera/pipeline/ipu3/ipu3.cpp b/src/libcamera/pipeline/ipu3/ipu3.cpp index 184986fc648b541a..13af86001b3ec403 100644 --- a/src/libcamera/pipeline/ipu3/ipu3.cpp +++ b/src/libcamera/pipeline/ipu3/ipu3.cpp @@ -14,11 +14,14 @@ #include #include #include +#include #include #include #include "libcamera/internal/camera_sensor.h" +#include "libcamera/internal/delayed_controls.h" #include "libcamera/internal/device_enumerator.h" +#include "libcamera/internal/ipa_manager.h" #include "libcamera/internal/log.h" #include "libcamera/internal/media_device.h" #include "libcamera/internal/pipeline_handler.h" @@ -54,6 +57,8 @@ public: { } + int loadIPA(); + void imguOutputBufferReady(FrameBuffer *buffer); void cio2BufferReady(FrameBuffer *buffer); @@ -65,6 +70,10 @@ public: Stream rawStream_; uint32_t exposureTime_; + std::unique_ptr delayedCtrls_; + +private: + void queueFrameAction(unsigned int id, const IPAOperationData &op); }; class IPU3CameraConfiguration : public CameraConfiguration @@ -594,6 +603,13 @@ int PipelineHandlerIPU3::start(Camera *camera, [[maybe_unused]] ControlList *con IPU3CameraData *data = cameraData(camera); CIO2Device *cio2 = &data->cio2_; ImgUDevice *imgu = data->imgu_; + + CameraSensorInfo sensorInfo = {}; + std::map streamConfig; + std::map entityControls; + IPAOperationData ipaConfig; + IPAOperationData result = {}; + int ret; /* Allocate buffers for internal pipeline usage. */ @@ -601,6 +617,11 @@ int PipelineHandlerIPU3::start(Camera *camera, [[maybe_unused]] ControlList *con if (ret) return ret; + IPAOperationData ipaData = {}; + ret = data->ipa_->start(ipaData, nullptr); + if (ret) + goto error; + /* * Start the ImgU video devices, buffers will be queued to the * ImgU output and viewfinder when requests will be queued. @@ -613,11 +634,31 @@ int PipelineHandlerIPU3::start(Camera *camera, [[maybe_unused]] ControlList *con if (ret) goto error; + /* Inform IPA of stream configuration and sensor controls. */ + ret = data->cio2_.sensor()->sensorInfo(&sensorInfo); + if (ret) + goto error; + + streamConfig[0] = { + .pixelFormat = data->outStream_.configuration().pixelFormat, + .size = data->outStream_.configuration().size, + }; + streamConfig[1] = { + .pixelFormat = data->vfStream_.configuration().pixelFormat, + .size = data->vfStream_.configuration().size, + }; + + entityControls.emplace(0, data->cio2_.sensor()->controls()); + + data->ipa_->configure(sensorInfo, streamConfig, entityControls, + ipaConfig, &result); + return 0; error: imgu->stop(); cio2->stop(); + data->ipa_->stop(); freeBuffers(camera); LOG(IPU3, Error) << "Failed to start camera " << camera->id(); @@ -634,6 +675,8 @@ void PipelineHandlerIPU3::stop(Camera *camera) if (ret) LOG(IPU3, Warning) << "Failed to stop camera " << camera->id(); + data->ipa_->stop(); + freeBuffers(camera); } @@ -883,6 +926,10 @@ int PipelineHandlerIPU3::registerCameras() if (ret) continue; + ret = data->loadIPA(); + if (ret) + continue; + /* Initialize the camera properties. */ data->properties_ = cio2->sensor()->properties(); @@ -890,6 +937,22 @@ int PipelineHandlerIPU3::registerCameras() if (ret) continue; + /* + * \todo Read delay values from the sensor itself or from a + * a sensor database. For now use generic values taken from + * the Raspberry Pi and listed as 'generic values'. + */ + std::unordered_map delays = { + { V4L2_CID_ANALOGUE_GAIN, 1 }, + { V4L2_CID_EXPOSURE, 2 }, + }; + + data->delayedCtrls_ = + std::make_unique(cio2->sensor()->device(), + delays); + data->cio2_.frameStart().connect(data->delayedCtrls_.get(), + &DelayedControls::applyControls); + /** * \todo Dynamically assign ImgU and output devices to each * stream and camera; as of now, limit support to two cameras @@ -933,6 +996,34 @@ int PipelineHandlerIPU3::registerCameras() return numCameras ? 0 : -ENODEV; } +int IPU3CameraData::loadIPA() +{ + ipa_ = IPAManager::createIPA(pipe_, 1, 1); + if (!ipa_) + return -ENOENT; + + ipa_->queueFrameAction.connect(this, &IPU3CameraData::queueFrameAction); + + ipa_->init(IPASettings{}); + + return 0; +} + +void IPU3CameraData::queueFrameAction([[maybe_unused]] unsigned int id, + const IPAOperationData &action) +{ + switch (action.operation) { + case IPU3_IPA_ACTION_SET_SENSOR_CONTROLS: { + const ControlList &controls = action.controls[0]; + delayedCtrls_->push(controls); + break; + } + default: + LOG(IPU3, Error) << "Unknown action " << action.operation; + break; + } +} + /* ----------------------------------------------------------------------------- * Buffer Ready slots */ From patchwork Thu Feb 4 16:29:40 2021 Content-Type: text/plain; charset="utf-8" MIME-Version: 1.0 Content-Transfer-Encoding: 8bit X-Patchwork-Submitter: =?utf-8?q?Niklas_S=C3=B6derlund?= X-Patchwork-Id: 11158 Return-Path: X-Original-To: parsemail@patchwork.libcamera.org Delivered-To: parsemail@patchwork.libcamera.org Received: from lancelot.ideasonboard.com (lancelot.ideasonboard.com [92.243.16.209]) by patchwork.libcamera.org (Postfix) with ESMTPS id D43D5BD162 for ; Thu, 4 Feb 2021 16:30:14 +0000 (UTC) Received: from lancelot.ideasonboard.com (localhost [IPv6:::1]) by lancelot.ideasonboard.com (Postfix) with ESMTP id AB1D261457; Thu, 4 Feb 2021 17:30:14 +0100 (CET) Received: from vsp-unauthed02.binero.net (vsp-unauthed02.binero.net [195.74.38.227]) by lancelot.ideasonboard.com (Postfix) with ESMTPS id 1301061440 for ; Thu, 4 Feb 2021 17:30:13 +0100 (CET) X-Halon-ID: 40259ca1-6706-11eb-b73f-0050569116f7 Authorized-sender: niklas.soderlund@fsdn.se Received: from bismarck.berto.se (p4fca2458.dip0.t-ipconnect.de [79.202.36.88]) by bin-vsp-out-03.atm.binero.net (Halon) with ESMTPA id 40259ca1-6706-11eb-b73f-0050569116f7; Thu, 04 Feb 2021 17:30:12 +0100 (CET) From: =?utf-8?q?Niklas_S=C3=B6derlund?= To: libcamera-devel@lists.libcamera.org Date: Thu, 4 Feb 2021 17:29:40 +0100 Message-Id: <20210204162943.268517-9-niklas.soderlund@ragnatech.se> X-Mailer: git-send-email 2.30.0 In-Reply-To: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> References: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> MIME-Version: 1.0 Subject: [libcamera-devel] [PATCH v3 08/11] libcamera: ipu3: imgu: Allocate buffers for stats and param X-BeenThere: libcamera-devel@lists.libcamera.org X-Mailman-Version: 2.1.29 Precedence: list List-Id: List-Unsubscribe: , List-Archive: List-Post: List-Help: List-Subscribe: , Errors-To: libcamera-devel-bounces@lists.libcamera.org Sender: "libcamera-devel" Instead of preparing for buffer importing allocate buffers that can be used by an IPA. Signed-off-by: Niklas Söderlund Reviewed-by: Jacopo Mondi Reviewed-by: Laurent Pinchart --- src/libcamera/pipeline/ipu3/imgu.cpp | 14 +++++--------- src/libcamera/pipeline/ipu3/imgu.h | 3 +++ 2 files changed, 8 insertions(+), 9 deletions(-) diff --git a/src/libcamera/pipeline/ipu3/imgu.cpp b/src/libcamera/pipeline/ipu3/imgu.cpp index c861022060c82dde..d5cf05b0c421e006 100644 --- a/src/libcamera/pipeline/ipu3/imgu.cpp +++ b/src/libcamera/pipeline/ipu3/imgu.cpp @@ -552,20 +552,13 @@ int ImgUDevice::allocateBuffers(unsigned int bufferCount) return ret; } - ret = param_->importBuffers(bufferCount); + ret = param_->allocateBuffers(bufferCount, ¶mBuffers_); if (ret < 0) { LOG(IPU3, Error) << "Failed to allocate ImgU param buffers"; goto error; } - /* - * The kernel fails to start if buffers are not either imported or - * allocated for the statistics video device. As statistics buffers are - * not yet used by the pipeline import buffers to save memory. - * - * \todo To be revised when we'll actually use the stat node. - */ - ret = stat_->importBuffers(bufferCount); + ret = stat_->allocateBuffers(bufferCount, &statBuffers_); if (ret < 0) { LOG(IPU3, Error) << "Failed to allocate ImgU stat buffers"; goto error; @@ -603,6 +596,9 @@ void ImgUDevice::freeBuffers() { int ret; + paramBuffers_.clear(); + statBuffers_.clear(); + ret = output_->releaseBuffers(); if (ret) LOG(IPU3, Error) << "Failed to release ImgU output buffers"; diff --git a/src/libcamera/pipeline/ipu3/imgu.h b/src/libcamera/pipeline/ipu3/imgu.h index 4a1896e2bbb41842..9d491511608730a9 100644 --- a/src/libcamera/pipeline/ipu3/imgu.h +++ b/src/libcamera/pipeline/ipu3/imgu.h @@ -76,6 +76,9 @@ public: std::unique_ptr viewfinder_; std::unique_ptr stat_; + std::vector> paramBuffers_; + std::vector> statBuffers_; + private: static constexpr unsigned int PAD_INPUT = 0; static constexpr unsigned int PAD_PARAM = 1; From patchwork Thu Feb 4 16:29:41 2021 Content-Type: text/plain; charset="utf-8" MIME-Version: 1.0 Content-Transfer-Encoding: 8bit X-Patchwork-Submitter: =?utf-8?q?Niklas_S=C3=B6derlund?= X-Patchwork-Id: 11159 Return-Path: X-Original-To: parsemail@patchwork.libcamera.org Delivered-To: parsemail@patchwork.libcamera.org Received: from lancelot.ideasonboard.com (lancelot.ideasonboard.com [92.243.16.209]) by patchwork.libcamera.org (Postfix) with ESMTPS id 1FE9BBD162 for ; Thu, 4 Feb 2021 16:30:16 +0000 (UTC) Received: from lancelot.ideasonboard.com (localhost [IPv6:::1]) by lancelot.ideasonboard.com (Postfix) with ESMTP id E7CF461455; Thu, 4 Feb 2021 17:30:15 +0100 (CET) Received: from bin-mail-out-06.binero.net (bin-mail-out-06.binero.net [195.74.38.229]) by lancelot.ideasonboard.com (Postfix) with ESMTPS id F2D416144C for ; Thu, 4 Feb 2021 17:30:13 +0100 (CET) X-Halon-ID: 414687d8-6706-11eb-b73f-0050569116f7 Authorized-sender: niklas.soderlund@fsdn.se Received: from bismarck.berto.se (p4fca2458.dip0.t-ipconnect.de [79.202.36.88]) by bin-vsp-out-03.atm.binero.net (Halon) with ESMTPA id 414687d8-6706-11eb-b73f-0050569116f7; Thu, 04 Feb 2021 17:30:13 +0100 (CET) From: =?utf-8?q?Niklas_S=C3=B6derlund?= To: libcamera-devel@lists.libcamera.org Date: Thu, 4 Feb 2021 17:29:41 +0100 Message-Id: <20210204162943.268517-10-niklas.soderlund@ragnatech.se> X-Mailer: git-send-email 2.30.0 In-Reply-To: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> References: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> MIME-Version: 1.0 Subject: [libcamera-devel] [PATCH v3 09/11] libcamera: ipu3: Map buffers in IPA X-BeenThere: libcamera-devel@lists.libcamera.org X-Mailman-Version: 2.1.29 Precedence: list List-Id: List-Unsubscribe: , List-Archive: List-Post: List-Help: List-Subscribe: , Errors-To: libcamera-devel-bounces@lists.libcamera.org Sender: "libcamera-devel" Map and unmap the parameters and statistic buffers in the IPA when the pipeline handler allocates and frees the buffers. Signed-off-by: Niklas Söderlund Reviewed-by: Jacopo Mondi Reviewed-by: Laurent Pinchart --- * Changes since v2 - Reorder lines around argument to ipaBuffers_.push_back(). --- src/libcamera/pipeline/ipu3/ipu3.cpp | 30 ++++++++++++++++++++++++++++ 1 file changed, 30 insertions(+) diff --git a/src/libcamera/pipeline/ipu3/ipu3.cpp b/src/libcamera/pipeline/ipu3/ipu3.cpp index 13af86001b3ec403..092db6389833a481 100644 --- a/src/libcamera/pipeline/ipu3/ipu3.cpp +++ b/src/libcamera/pipeline/ipu3/ipu3.cpp @@ -141,6 +141,8 @@ private: ImgUDevice imgu1_; MediaDevice *cio2MediaDev_; MediaDevice *imguMediaDev_; + + std::vector ipaBuffers_; }; IPU3CameraConfiguration::IPU3CameraConfiguration(IPU3CameraData *data) @@ -586,6 +588,27 @@ int PipelineHandlerIPU3::allocateBuffers(Camera *camera) if (ret < 0) return ret; + /* Map buffers to the IPA. */ + unsigned int ipaBufferId = 1; + + for (const std::unique_ptr &buffer : imgu->paramBuffers_) { + buffer->setCookie(ipaBufferId++); + ipaBuffers_.push_back({ + .id = buffer->cookie(), + .planes = buffer->planes() + }); + } + + for (const std::unique_ptr &buffer : imgu->statBuffers_) { + buffer->setCookie(ipaBufferId++); + ipaBuffers_.push_back({ + .id = buffer->cookie(), + .planes = buffer->planes() + }); + } + + data->ipa_->mapBuffers(ipaBuffers_); + return 0; } @@ -593,6 +616,13 @@ int PipelineHandlerIPU3::freeBuffers(Camera *camera) { IPU3CameraData *data = cameraData(camera); + std::vector ids; + for (IPABuffer &ipabuf : ipaBuffers_) + ids.push_back(ipabuf.id); + + data->ipa_->unmapBuffers(ids); + ipaBuffers_.clear(); + data->imgu_->freeBuffers(); return 0; From patchwork Thu Feb 4 16:29:42 2021 Content-Type: text/plain; charset="utf-8" MIME-Version: 1.0 Content-Transfer-Encoding: 8bit X-Patchwork-Submitter: =?utf-8?q?Niklas_S=C3=B6derlund?= X-Patchwork-Id: 11160 Return-Path: X-Original-To: parsemail@patchwork.libcamera.org Delivered-To: parsemail@patchwork.libcamera.org Received: from lancelot.ideasonboard.com (lancelot.ideasonboard.com [92.243.16.209]) by patchwork.libcamera.org (Postfix) with ESMTPS id 68362BD162 for ; Thu, 4 Feb 2021 16:30:17 +0000 (UTC) Received: from lancelot.ideasonboard.com (localhost [IPv6:::1]) by lancelot.ideasonboard.com (Postfix) with ESMTP id 408D761469; Thu, 4 Feb 2021 17:30:17 +0100 (CET) Received: from bin-mail-out-06.binero.net (bin-mail-out-06.binero.net [195.74.38.229]) by lancelot.ideasonboard.com (Postfix) with ESMTPS id ECC2361448 for ; Thu, 4 Feb 2021 17:30:14 +0100 (CET) X-Halon-ID: 41d44f96-6706-11eb-b73f-0050569116f7 Authorized-sender: niklas.soderlund@fsdn.se Received: from bismarck.berto.se (p4fca2458.dip0.t-ipconnect.de [79.202.36.88]) by bin-vsp-out-03.atm.binero.net (Halon) with ESMTPA id 41d44f96-6706-11eb-b73f-0050569116f7; Thu, 04 Feb 2021 17:30:14 +0100 (CET) From: =?utf-8?q?Niklas_S=C3=B6derlund?= To: libcamera-devel@lists.libcamera.org Date: Thu, 4 Feb 2021 17:29:42 +0100 Message-Id: <20210204162943.268517-11-niklas.soderlund@ragnatech.se> X-Mailer: git-send-email 2.30.0 In-Reply-To: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> References: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> MIME-Version: 1.0 Subject: [libcamera-devel] [PATCH v3 10/11] libcamera: ipu3: Add helper for parameter and statistic buffers X-BeenThere: libcamera-devel@lists.libcamera.org X-Mailman-Version: 2.1.29 Precedence: list List-Id: List-Unsubscribe: , List-Archive: List-Post: List-Help: List-Subscribe: , Errors-To: libcamera-devel-bounces@lists.libcamera.org Sender: "libcamera-devel" Add a helper class to aid in associating a parameter and statistic buffer with each request queued to the pipeline. The helper helps with tracking the state of the extra buffers and in completing the request once all extra processing is done. This change only adds the helper more work is needed to integrate it with the pipeline and an IPA. Signed-off-by: Niklas Söderlund Reviewed-by: Jacopo Mondi Reviewed-by: Laurent Pinchart --- * Changes since v1 - Move mapping of buffers to IPA to the pipeline handler and a separate patch. - Move all pipeline interactions out of helper. * Changes since v2 - Add todo to remove dynamic memory allocation. - Remove unused find(Request *request). --- src/libcamera/pipeline/ipu3/frames.cpp | 129 ++++++++++++++++++++++++ src/libcamera/pipeline/ipu3/frames.h | 61 +++++++++++ src/libcamera/pipeline/ipu3/meson.build | 1 + 3 files changed, 191 insertions(+) create mode 100644 src/libcamera/pipeline/ipu3/frames.cpp create mode 100644 src/libcamera/pipeline/ipu3/frames.h diff --git a/src/libcamera/pipeline/ipu3/frames.cpp b/src/libcamera/pipeline/ipu3/frames.cpp new file mode 100644 index 0000000000000000..b7f7f0a6575714d9 --- /dev/null +++ b/src/libcamera/pipeline/ipu3/frames.cpp @@ -0,0 +1,129 @@ +/* SPDX-License-Identifier: LGPL-2.1-or-later */ +/* + * Copyright (C) 2020, Google Inc. + * + * frames.cpp - Intel IPU3 Frames helper + */ + +#include "frames.h" + +#include +#include + +#include "libcamera/internal/pipeline_handler.h" +#include "libcamera/internal/v4l2_videodevice.h" + +namespace libcamera { + +LOG_DECLARE_CATEGORY(IPU3) + +IPU3Frames::IPU3Frames() + : nextId_(0) +{ +} + +void IPU3Frames::init(const std::vector> ¶mBuffers, + const std::vector> &statBuffers) +{ + for (const std::unique_ptr &buffer : paramBuffers) + availableParamBuffers_.push(buffer.get()); + + for (const std::unique_ptr &buffer : statBuffers) + availableStatBuffers_.push(buffer.get()); + + nextId_ = 0; + frameInfo_.clear(); +} + +void IPU3Frames::clear() +{ + availableParamBuffers_ = {}; + availableStatBuffers_ = {}; +} + +IPU3Frames::Info *IPU3Frames::create(Request *request) +{ + unsigned int id = nextId_++; + + if (availableParamBuffers_.empty()) { + LOG(IPU3, Error) << "Parameters buffer underrun"; + return nullptr; + } + FrameBuffer *paramBuffer = availableParamBuffers_.front(); + + if (availableStatBuffers_.empty()) { + LOG(IPU3, Error) << "Statisitc buffer underrun"; + return nullptr; + } + FrameBuffer *statBuffer = availableStatBuffers_.front(); + + availableParamBuffers_.pop(); + availableStatBuffers_.pop(); + + /* \todo Remove the dynamic allocation of Info */ + std::unique_ptr info = std::make_unique(); + + info->id = id; + info->request = request; + info->rawBuffer = nullptr; + info->paramBuffer = paramBuffer; + info->statBuffer = statBuffer; + info->paramDequeued = false; + info->metadataProcessed = false; + + frameInfo_[id] = std::move(info); + + return frameInfo_[id].get(); +} + +bool IPU3Frames::tryComplete(IPU3Frames::Info *info) +{ + Request *request = info->request; + + if (request->hasPendingBuffers()) + return false; + + if (!info->metadataProcessed) + return false; + + if (!info->paramDequeued) + return false; + + /* Return params and stat buffer for reuse. */ + availableParamBuffers_.push(info->paramBuffer); + availableStatBuffers_.push(info->statBuffer); + + /* Delete the extended frame information. */ + frameInfo_.erase(info->id); + + return true; +} + +IPU3Frames::Info *IPU3Frames::find(unsigned int id) +{ + const auto &itInfo = frameInfo_.find(id); + + if (itInfo != frameInfo_.end()) + return itInfo->second.get(); + + return nullptr; +} + +IPU3Frames::Info *IPU3Frames::find(FrameBuffer *buffer) +{ + for (auto const &itInfo : frameInfo_) { + Info *info = itInfo.second.get(); + + for (auto const itBuffers : info->request->buffers()) + if (itBuffers.second == buffer) + return info; + + if (info->rawBuffer == buffer || info->paramBuffer == buffer || + info->statBuffer == buffer) + return info; + } + + return nullptr; +} + +} /* namespace libcamera */ diff --git a/src/libcamera/pipeline/ipu3/frames.h b/src/libcamera/pipeline/ipu3/frames.h new file mode 100644 index 0000000000000000..93379d20722d65fb --- /dev/null +++ b/src/libcamera/pipeline/ipu3/frames.h @@ -0,0 +1,61 @@ +/* SPDX-License-Identifier: LGPL-2.1-or-later */ +/* + * Copyright (C) 2020, Google Inc. + * + * frames.h - Intel IPU3 Frames helper + */ +#ifndef __LIBCAMERA_PIPELINE_IPU3_FRAMES_H__ +#define __LIBCAMERA_PIPELINE_IPU3_FRAMES_H__ + +#include +#include +#include +#include + +namespace libcamera { + +class FrameBuffer; +class IPAProxy; +class PipelineHandler; +class Request; +class V4L2VideoDevice; +struct IPABuffer; + +class IPU3Frames +{ +public: + struct Info { + unsigned int id; + Request *request; + + FrameBuffer *rawBuffer; + FrameBuffer *paramBuffer; + FrameBuffer *statBuffer; + + bool paramDequeued; + bool metadataProcessed; + }; + + IPU3Frames(); + + void init(const std::vector> ¶mBuffers, + const std::vector> &statBuffers); + void clear(); + + Info *create(Request *request); + bool tryComplete(IPU3Frames::Info *info); + + Info *find(unsigned int id); + Info *find(FrameBuffer *buffer); + +private: + std::queue availableParamBuffers_; + std::queue availableStatBuffers_; + + unsigned int nextId_; + std::map> frameInfo_; +}; + +} /* namespace libcamera */ + +#endif /* __LIBCAMERA_PIPELINE_IPU3_FRAMES_H__ */ diff --git a/src/libcamera/pipeline/ipu3/meson.build b/src/libcamera/pipeline/ipu3/meson.build index d60e07ae6ccac2bc..a1b0b31ac5bcf864 100644 --- a/src/libcamera/pipeline/ipu3/meson.build +++ b/src/libcamera/pipeline/ipu3/meson.build @@ -2,6 +2,7 @@ libcamera_sources += files([ 'cio2.cpp', + 'frames.cpp', 'imgu.cpp', 'ipu3.cpp', ]) From patchwork Thu Feb 4 16:29:43 2021 Content-Type: text/plain; charset="utf-8" MIME-Version: 1.0 Content-Transfer-Encoding: 8bit X-Patchwork-Submitter: =?utf-8?q?Niklas_S=C3=B6derlund?= X-Patchwork-Id: 11161 Return-Path: X-Original-To: parsemail@patchwork.libcamera.org Delivered-To: parsemail@patchwork.libcamera.org Received: from lancelot.ideasonboard.com (lancelot.ideasonboard.com [92.243.16.209]) by patchwork.libcamera.org (Postfix) with ESMTPS id BC21DBD163 for ; Thu, 4 Feb 2021 16:30:17 +0000 (UTC) Received: from lancelot.ideasonboard.com (localhost [IPv6:::1]) by lancelot.ideasonboard.com (Postfix) with ESMTP id 8959E6146C; Thu, 4 Feb 2021 17:30:17 +0100 (CET) Received: from vsp-unauthed02.binero.net (vsp-unauthed02.binero.net [195.74.38.227]) by lancelot.ideasonboard.com (Postfix) with ESMTPS id E624D61450 for ; Thu, 4 Feb 2021 17:30:15 +0100 (CET) X-Halon-ID: 426c6940-6706-11eb-b73f-0050569116f7 Authorized-sender: niklas.soderlund@fsdn.se Received: from bismarck.berto.se (p4fca2458.dip0.t-ipconnect.de [79.202.36.88]) by bin-vsp-out-03.atm.binero.net (Halon) with ESMTPA id 426c6940-6706-11eb-b73f-0050569116f7; Thu, 04 Feb 2021 17:30:14 +0100 (CET) From: =?utf-8?q?Niklas_S=C3=B6derlund?= To: libcamera-devel@lists.libcamera.org Date: Thu, 4 Feb 2021 17:29:43 +0100 Message-Id: <20210204162943.268517-12-niklas.soderlund@ragnatech.se> X-Mailer: git-send-email 2.30.0 In-Reply-To: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> References: <20210204162943.268517-1-niklas.soderlund@ragnatech.se> MIME-Version: 1.0 Subject: [libcamera-devel] [PATCH v3 11/11] libcamera: ipu3: Share parameter and statistic buffers with IPA X-BeenThere: libcamera-devel@lists.libcamera.org X-Mailman-Version: 2.1.29 Precedence: list List-Id: List-Unsubscribe: , List-Archive: List-Post: List-Help: List-Subscribe: , Errors-To: libcamera-devel-bounces@lists.libcamera.org Sender: "libcamera-devel" Use the IPU3Frames helper to share parameters and statistics buffers with the IPA. Track which parameter and statistic buffer is used for which request and make sure the parameter buffers is filled in by the IPA before it's needed and that the statistic buffer is consumed and meta data generated before completing the request. With this change the IPU3 pipeline is prepared to fully operate with an IPA component. Signed-off-by: Niklas Söderlund --- * Changes since v1 - Update commit message. - s/frameInfo_/frameInfos_/ - Refactor away isComplete variable. * Changes since v2 - Emedd the IPU3Frames instance instead of allocating it. - Use -ENOBUFS instead of _ENOENT in queueRequestDevice(). - Keep isComplete in cio2BufferReady() - Rework the queue logic. --- src/libcamera/pipeline/ipu3/ipu3.cpp | 149 ++++++++++++++++++++------- 1 file changed, 112 insertions(+), 37 deletions(-) diff --git a/src/libcamera/pipeline/ipu3/ipu3.cpp b/src/libcamera/pipeline/ipu3/ipu3.cpp index 092db6389833a481..b79db25050d2c1d6 100644 --- a/src/libcamera/pipeline/ipu3/ipu3.cpp +++ b/src/libcamera/pipeline/ipu3/ipu3.cpp @@ -29,6 +29,7 @@ #include "libcamera/internal/v4l2_controls.h" #include "cio2.h" +#include "frames.h" #include "imgu.h" namespace libcamera { @@ -61,6 +62,8 @@ public: void imguOutputBufferReady(FrameBuffer *buffer); void cio2BufferReady(FrameBuffer *buffer); + void paramBufferReady(FrameBuffer *buffer); + void statBufferReady(FrameBuffer *buffer); CIO2Device cio2_; ImgUDevice *imgu_; @@ -71,6 +74,7 @@ public: uint32_t exposureTime_; std::unique_ptr delayedCtrls_; + IPU3Frames frameInfos_; private: void queueFrameAction(unsigned int id, const IPAOperationData &op); @@ -609,6 +613,8 @@ int PipelineHandlerIPU3::allocateBuffers(Camera *camera) data->ipa_->mapBuffers(ipaBuffers_); + data->frameInfos_.init(imgu->paramBuffers_, imgu->statBuffers_); + return 0; } @@ -616,6 +622,8 @@ int PipelineHandlerIPU3::freeBuffers(Camera *camera) { IPU3CameraData *data = cameraData(camera); + data->frameInfos_.clear(); + std::vector ids; for (IPABuffer &ipabuf : ipaBuffers_) ids.push_back(ipabuf.id); @@ -713,7 +721,10 @@ void PipelineHandlerIPU3::stop(Camera *camera) int PipelineHandlerIPU3::queueRequestDevice(Camera *camera, Request *request) { IPU3CameraData *data = cameraData(camera); - int error = 0; + + IPU3Frames::Info *info = data->frameInfos_.create(request); + if (!info) + return -ENOBUFS; /* * Queue a buffer on the CIO2, using the raw stream buffer provided in @@ -724,24 +735,9 @@ int PipelineHandlerIPU3::queueRequestDevice(Camera *camera, Request *request) if (!rawBuffer) return -ENOMEM; - /* Queue all buffers from the request aimed for the ImgU. */ - for (auto it : request->buffers()) { - const Stream *stream = it.first; - FrameBuffer *buffer = it.second; - int ret; + info->rawBuffer = rawBuffer; - if (stream == &data->outStream_) - ret = data->imgu_->output_->queueBuffer(buffer); - else if (stream == &data->vfStream_) - ret = data->imgu_->viewfinder_->queueBuffer(buffer); - else - continue; - - if (ret < 0) - error = ret; - } - - return error; + return 0; } bool PipelineHandlerIPU3::match(DeviceEnumerator *enumerator) @@ -1007,6 +1003,10 @@ int PipelineHandlerIPU3::registerCameras() &IPU3CameraData::imguOutputBufferReady); data->imgu_->viewfinder_->bufferReady.connect(data.get(), &IPU3CameraData::imguOutputBufferReady); + data->imgu_->param_->bufferReady.connect(data.get(), + &IPU3CameraData::paramBufferReady); + data->imgu_->stat_->bufferReady.connect(data.get(), + &IPU3CameraData::statBufferReady); /* Create and register the Camera instance. */ std::string cameraId = cio2->sensor()->id(); @@ -1039,7 +1039,7 @@ int IPU3CameraData::loadIPA() return 0; } -void IPU3CameraData::queueFrameAction([[maybe_unused]] unsigned int id, +void IPU3CameraData::queueFrameAction(unsigned int id, const IPAOperationData &action) { switch (action.operation) { @@ -1048,6 +1048,41 @@ void IPU3CameraData::queueFrameAction([[maybe_unused]] unsigned int id, delayedCtrls_->push(controls); break; } + case IPU3_IPA_ACTION_PARAM_FILLED: { + IPU3Frames::Info *info = frameInfos_.find(id); + if (!info) + break; + + /* Queue all buffers from the request aimed for the ImgU. */ + for (auto it : info->request->buffers()) { + const Stream *stream = it.first; + FrameBuffer *outbuffer = it.second; + + if (stream == &outStream_) + imgu_->output_->queueBuffer(outbuffer); + else if (stream == &vfStream_) + imgu_->viewfinder_->queueBuffer(outbuffer); + } + + imgu_->param_->queueBuffer(info->paramBuffer); + imgu_->stat_->queueBuffer(info->statBuffer); + imgu_->input_->queueBuffer(info->rawBuffer); + + break; + } + case IPU3_IPA_ACTION_METADATA_READY: { + IPU3Frames::Info *info = frameInfos_.find(id); + if (!info) + break; + + Request *request = info->request; + request->metadata() = action.controls[0]; + info->metadataProcessed = true; + if (frameInfos_.tryComplete(info)) + pipe_->completeRequest(request); + + break; + } default: LOG(IPU3, Error) << "Unknown action " << action.operation; break; @@ -1068,11 +1103,12 @@ void IPU3CameraData::imguOutputBufferReady(FrameBuffer *buffer) { Request *request = buffer->request(); - if (!pipe_->completeBuffer(request, buffer)) - /* Request not completed yet, return here. */ + pipe_->completeBuffer(request, buffer); + + IPU3Frames::Info *info = frameInfos_.find(buffer); + if (!info) return; - /* Mark the request as complete. */ request->metadata().set(controls::draft::PipelineDepth, 3); /* \todo Move the ExposureTime control to the IPA. */ request->metadata().set(controls::ExposureTime, exposureTime_); @@ -1081,7 +1117,12 @@ void IPU3CameraData::imguOutputBufferReady(FrameBuffer *buffer) Rectangle cropRegion = request->controls().get(controls::ScalerCrop); request->metadata().set(controls::ScalerCrop, cropRegion); } - pipe_->completeRequest(request); + + if (buffer->metadata().status == FrameMetadata::FrameCancelled) + info->metadataProcessed = true; + + if (frameInfos_.tryComplete(info)) + pipe_->completeRequest(request); } /** @@ -1093,26 +1134,60 @@ void IPU3CameraData::imguOutputBufferReady(FrameBuffer *buffer) */ void IPU3CameraData::cio2BufferReady(FrameBuffer *buffer) { - /* \todo Handle buffer failures when state is set to BufferError. */ - if (buffer->metadata().status == FrameMetadata::FrameCancelled) + IPU3Frames::Info *info = frameInfos_.find(buffer); + if (!info) return; Request *request = buffer->request(); - /* - * If the request contains a buffer for the RAW stream only, complete it - * now as there's no need for ImgU processing. - */ - if (request->findBuffer(&rawStream_)) { - bool isComplete = pipe_->completeBuffer(request, buffer); - if (isComplete) { - request->metadata().set(controls::draft::PipelineDepth, 2); - pipe_->completeRequest(request); - return; - } + if (request->findBuffer(&rawStream_)) + pipe_->completeBuffer(request, buffer); + + /* If the buffer is cancelled force a complete of the whole request. */ + if (buffer->metadata().status == FrameMetadata::FrameCancelled) { + for (auto it : request->buffers()) + if (it.second != buffer) + pipe_->completeBuffer(request, it.second); + + info->paramDequeued = true; + info->metadataProcessed = true; + ASSERT(frameInfos_.tryComplete(info)); + pipe_->completeRequest(request); + + return; } - imgu_->input_->queueBuffer(buffer); + IPAOperationData op; + op.operation = IPU3_IPA_EVENT_FILL_PARAMS; + op.data = { info->id, info->paramBuffer->cookie() }; + op.controls = { request->controls() }; + ipa_->processEvent(op); +} + +void IPU3CameraData::paramBufferReady(FrameBuffer *buffer) +{ + IPU3Frames::Info *info = frameInfos_.find(buffer); + if (!info) + return; + + info->paramDequeued = true; + if (frameInfos_.tryComplete(info)) + pipe_->completeRequest(buffer->request()); +} + +void IPU3CameraData::statBufferReady(FrameBuffer *buffer) +{ + if (buffer->metadata().status == FrameMetadata::FrameCancelled) + return; + + IPU3Frames::Info *info = frameInfos_.find(buffer); + if (!info) + return; + + IPAOperationData op; + op.operation = IPU3_IPA_EVENT_STAT_READY; + op.data = { info->id, info->statBuffer->cookie() }; + ipa_->processEvent(op); } REGISTER_PIPELINE_HANDLER(PipelineHandlerIPU3)