diff --git a/src/ipa/ipu3/algorithms/af.cpp b/src/ipa/ipu3/algorithms/af.cpp index d07521a090ac..fcbf8e557b10 100644 --- a/src/ipa/ipu3/algorithms/af.cpp +++ b/src/ipa/ipu3/algorithms/af.cpp @@ -420,7 +420,8 @@ bool Af::afIsOutOfFocus(IPAContext context) * * [1] Hill Climbing Algorithm, https://en.wikipedia.org/wiki/Hill_climbing */ -void Af::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext, +void Af::process(IPAContext &context, + [[maybe_unused]] IPU3FrameContext &frameContext, const ipu3_uapi_stats_3a *stats) { /* Evaluate the AF buffer length */ diff --git a/src/ipa/ipu3/algorithms/af.h b/src/ipa/ipu3/algorithms/af.h index ccf015f3f8f5..7a5aeb1b6bf4 100644 --- a/src/ipa/ipu3/algorithms/af.h +++ b/src/ipa/ipu3/algorithms/af.h @@ -32,7 +32,7 @@ public: void prepare(IPAContext &context, ipu3_uapi_params *params) override; int configure(IPAContext &context, const IPAConfigInfo &configInfo) override; - void process(IPAContext &context, IPAFrameContext *frameContext, + void process(IPAContext &context, IPU3FrameContext &frameContext, const ipu3_uapi_stats_3a *stats) override; private: diff --git a/src/ipa/ipu3/algorithms/agc.cpp b/src/ipa/ipu3/algorithms/agc.cpp index 5bc64ae52214..92ea6249798d 100644 --- a/src/ipa/ipu3/algorithms/agc.cpp +++ b/src/ipa/ipu3/algorithms/agc.cpp @@ -183,13 +183,13 @@ utils::Duration Agc::filterExposure(utils::Duration exposureValue) * \param[in] yGain The gain calculated based on the relative luminance target * \param[in] iqMeanGain The gain calculated based on the relative luminance target */ -void Agc::computeExposure(IPAContext &context, IPAFrameContext *frameContext, +void Agc::computeExposure(IPAContext &context, IPU3FrameContext &frameContext, double yGain, double iqMeanGain) { const IPASessionConfiguration &configuration = context.configuration; /* Get the effective exposure and gain applied on the sensor. */ - uint32_t exposure = frameContext->sensor.exposure; - double analogueGain = frameContext->sensor.gain; + uint32_t exposure = frameContext.sensor.exposure; + double analogueGain = frameContext.sensor.gain; /* Use the highest of the two gain estimates. */ double evGain = std::max(yGain, iqMeanGain); @@ -323,7 +323,8 @@ double Agc::estimateLuminance(IPAActiveState &activeState, * Identify the current image brightness, and use that to estimate the optimal * new exposure and gain for the scene. */ -void Agc::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext, +void Agc::process(IPAContext &context, + IPU3FrameContext &frameContext, const ipu3_uapi_stats_3a *stats) { /* diff --git a/src/ipa/ipu3/algorithms/agc.h b/src/ipa/ipu3/algorithms/agc.h index 105ae0f2aac6..96585f48933f 100644 --- a/src/ipa/ipu3/algorithms/agc.h +++ b/src/ipa/ipu3/algorithms/agc.h @@ -28,14 +28,14 @@ public: ~Agc() = default; int configure(IPAContext &context, const IPAConfigInfo &configInfo) override; - void process(IPAContext &context, IPAFrameContext *frameContext, + void process(IPAContext &context, IPU3FrameContext &frameContext, const ipu3_uapi_stats_3a *stats) override; private: double measureBrightness(const ipu3_uapi_stats_3a *stats, const ipu3_uapi_grid_config &grid) const; utils::Duration filterExposure(utils::Duration currentExposure); - void computeExposure(IPAContext &context, IPAFrameContext *frameContext, + void computeExposure(IPAContext &context, IPU3FrameContext &frameContext, double yGain, double iqMeanGain); double estimateLuminance(IPAActiveState &activeState, const ipu3_uapi_grid_config &grid, diff --git a/src/ipa/ipu3/algorithms/awb.cpp b/src/ipa/ipu3/algorithms/awb.cpp index 704267222a31..45f8e5f29119 100644 --- a/src/ipa/ipu3/algorithms/awb.cpp +++ b/src/ipa/ipu3/algorithms/awb.cpp @@ -387,7 +387,8 @@ void Awb::calculateWBGains(const ipu3_uapi_stats_3a *stats) /** * \copydoc libcamera::ipa::Algorithm::process */ -void Awb::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext, +void Awb::process(IPAContext &context, + [[maybe_unused]] IPU3FrameContext &frameContext, const ipu3_uapi_stats_3a *stats) { calculateWBGains(stats); diff --git a/src/ipa/ipu3/algorithms/awb.h b/src/ipa/ipu3/algorithms/awb.h index 0acd21480845..28e39620fd59 100644 --- a/src/ipa/ipu3/algorithms/awb.h +++ b/src/ipa/ipu3/algorithms/awb.h @@ -40,7 +40,7 @@ public: int configure(IPAContext &context, const IPAConfigInfo &configInfo) override; void prepare(IPAContext &context, ipu3_uapi_params *params) override; - void process(IPAContext &context, IPAFrameContext *frameContext, + void process(IPAContext &context, IPU3FrameContext &frameContext, const ipu3_uapi_stats_3a *stats) override; private: diff --git a/src/ipa/ipu3/algorithms/tone_mapping.cpp b/src/ipa/ipu3/algorithms/tone_mapping.cpp index f86e79b24a67..977741c5a4d4 100644 --- a/src/ipa/ipu3/algorithms/tone_mapping.cpp +++ b/src/ipa/ipu3/algorithms/tone_mapping.cpp @@ -78,7 +78,8 @@ void ToneMapping::prepare([[maybe_unused]] IPAContext &context, * The tone mapping look up table is generated as an inverse power curve from * our gamma setting. */ -void ToneMapping::process(IPAContext &context, [[maybe_unused]] IPAFrameContext *frameContext, +void ToneMapping::process(IPAContext &context, + [[maybe_unused]] IPU3FrameContext &frameContext, [[maybe_unused]] const ipu3_uapi_stats_3a *stats) { /* diff --git a/src/ipa/ipu3/algorithms/tone_mapping.h b/src/ipa/ipu3/algorithms/tone_mapping.h index d7d4800628f2..8cce38c742a6 100644 --- a/src/ipa/ipu3/algorithms/tone_mapping.h +++ b/src/ipa/ipu3/algorithms/tone_mapping.h @@ -20,7 +20,7 @@ public: int configure(IPAContext &context, const IPAConfigInfo &configInfo) override; void prepare(IPAContext &context, ipu3_uapi_params *params) override; - void process(IPAContext &context, IPAFrameContext *frameContext, + void process(IPAContext &context, IPU3FrameContext &frameContext, const ipu3_uapi_stats_3a *stats) override; private: diff --git a/src/ipa/ipu3/ipa_context.cpp b/src/ipa/ipu3/ipa_context.cpp index dd139cb4c868..536d76ecd63b 100644 --- a/src/ipa/ipu3/ipa_context.cpp +++ b/src/ipa/ipu3/ipa_context.cpp @@ -35,22 +35,6 @@ namespace libcamera::ipa::ipu3 { * most recently computed by the IPA algorithms. */ -/** - * \struct IPAFrameContext - * \brief Context for a frame - * - * The frame context stores data specific to a single frame processed by the - * IPA. Each frame processed by the IPA has a context associated with it, - * accessible through the IPAContext structure. - * - * Fields in the frame context should reflect values and controls - * associated with the specific frame as requested by the application, and - * as configured by the hardware. Fields can be read by algorithms to - * determine if they should update any specific action for this frame, and - * finally to update the metadata control lists when the frame is fully - * completed. - */ - /** * \struct IPAContext * \brief Global IPA context data shared between all algorithms @@ -181,16 +165,16 @@ namespace libcamera::ipa::ipu3 { */ /** - * \var IPAFrameContext::frame - * \brief The frame number + * \struct IPU3FrameContext + * \copybrief libcamera::ipa::IPAFrameContext * - * \var IPAFrameContext::sensor + * \var IPU3FrameContext::sensor * \brief Effective sensor values that were applied for the frame * - * \var IPAFrameContext::sensor.exposure + * \var IPU3FrameContext::sensor.exposure * \brief Exposure time expressed as a number of lines * - * \var IPAFrameContext::sensor.gain + * \var IPU3FrameContext::sensor.gain * \brief Analogue gain multiplier */ diff --git a/src/ipa/ipu3/ipa_context.h b/src/ipa/ipu3/ipa_context.h index 193fc44a821a..c4aa4c3f4f6a 100644 --- a/src/ipa/ipu3/ipa_context.h +++ b/src/ipa/ipu3/ipa_context.h @@ -73,8 +73,7 @@ struct IPAActiveState { } toneMapping; }; -struct IPAFrameContext { - uint32_t frame; +struct IPU3FrameContext : public IPAFrameContext { struct { uint32_t exposure; @@ -86,7 +85,7 @@ struct IPAContext { IPASessionConfiguration configuration; IPAActiveState activeState; - FCQueue frameContexts; + FCQueue frameContexts; }; } /* namespace ipa::ipu3 */ diff --git a/src/ipa/ipu3/ipu3.cpp b/src/ipa/ipu3/ipu3.cpp index 55e82cd404f4..489e51bc6cf7 100644 --- a/src/ipa/ipu3/ipu3.cpp +++ b/src/ipa/ipu3/ipu3.cpp @@ -570,7 +570,7 @@ void IPAIPU3::processStatsBuffer(const uint32_t frame, const ipu3_uapi_stats_3a *stats = reinterpret_cast(mem.data()); - IPAFrameContext &frameContext = context_.frameContexts.get(frame); + IPU3FrameContext &frameContext = context_.frameContexts.get(frame); if (frameContext.frame != frame) LOG(IPAIPU3, Warning) << "Frame " << frame << " does not match its frame context"; @@ -583,7 +583,7 @@ void IPAIPU3::processStatsBuffer(const uint32_t frame, ControlList ctrls(controls::controls); for (auto const &algo : algorithms_) - algo->process(context_, &frameContext, stats); + algo->process(context_, frameContext, stats); setControls(frame); @@ -619,7 +619,7 @@ void IPAIPU3::processStatsBuffer(const uint32_t frame, void IPAIPU3::queueRequest(const uint32_t frame, const ControlList &controls) { /* \todo Start processing for 'frame' based on 'controls'. */ - IPAFrameContext &frameContext = context_.frameContexts.initialise(frame); + IPU3FrameContext &frameContext = context_.frameContexts.initialise(frame); /* \todo Implement queueRequest to each algorithm. */ (void)frameContext; diff --git a/src/ipa/ipu3/module.h b/src/ipa/ipu3/module.h index d94fc4594871..6d0d50f615d8 100644 --- a/src/ipa/ipu3/module.h +++ b/src/ipa/ipu3/module.h @@ -19,7 +19,7 @@ namespace libcamera { namespace ipa::ipu3 { -using Module = ipa::Module; } /* namespace ipa::ipu3 */ diff --git a/src/ipa/libipa/algorithm.h b/src/ipa/libipa/algorithm.h index 2a8871d831a3..adbcf69adb4f 100644 --- a/src/ipa/libipa/algorithm.h +++ b/src/ipa/libipa/algorithm.h @@ -41,7 +41,7 @@ public: } virtual void process([[maybe_unused]] typename Module::Context &context, - [[maybe_unused]] typename Module::FrameContext *frameContext, + [[maybe_unused]] typename Module::FrameContext &frameContext, [[maybe_unused]] const typename Module::Stats *stats) { } diff --git a/src/ipa/libipa/fc_queue.cpp b/src/ipa/libipa/fc_queue.cpp index ecb47f287350..627c2fa3301e 100644 --- a/src/ipa/libipa/fc_queue.cpp +++ b/src/ipa/libipa/fc_queue.cpp @@ -55,6 +55,27 @@ namespace ipa { * the Request when it completes. */ +/** + * \struct IPAFrameContext + * \brief Context for a frame + * + * The frame context stores data specific to a single frame processed by the + * IPA. Each frame processed by the IPA has a context associated with it, + * accessible through the Frame Context Queue. + * + * Fields in the frame context should reflect values and controls associated + * with the specific frame as requested by the application, and as configured by + * the hardware. Fields can be read by algorithms to determine if they should + * update any specific action for this frame, and finally to update the metadata + * control lists when the frame is fully completed. + * + * \var IPAFrameContext::frame + * \brief The frame number + * + * \var IPAFrameContext::error + * \brief The error flags associated with the frame + */ + /** * \fn FCQueue::clear() * \brief Reinitialise all data on the queue diff --git a/src/ipa/libipa/fc_queue.h b/src/ipa/libipa/fc_queue.h index 82ce36811926..6c7b8bf11ab2 100644 --- a/src/ipa/libipa/fc_queue.h +++ b/src/ipa/libipa/fc_queue.h @@ -13,6 +13,7 @@ #include #include +#include namespace libcamera { @@ -27,6 +28,11 @@ namespace ipa { */ static constexpr uint32_t kMaxFrameContexts = 16; +struct IPAFrameContext { + unsigned int frame; + Request::ErrorFlags error; +}; + template class FCQueue : public std::array { diff --git a/src/ipa/rkisp1/algorithms/agc.cpp b/src/ipa/rkisp1/algorithms/agc.cpp index 483e941fe427..40d27963ef68 100644 --- a/src/ipa/rkisp1/algorithms/agc.cpp +++ b/src/ipa/rkisp1/algorithms/agc.cpp @@ -281,7 +281,7 @@ double Agc::measureBrightness(const rkisp1_cif_isp_hist_stat *hist) const * new exposure and gain for the scene. */ void Agc::process(IPAContext &context, - [[maybe_unused]] IPAFrameContext *frameContext, + [[maybe_unused]] RKISP1FrameContext &frameContext, const rkisp1_stat_buffer *stats) { const rkisp1_cif_isp_stat *params = &stats->params; diff --git a/src/ipa/rkisp1/algorithms/agc.h b/src/ipa/rkisp1/algorithms/agc.h index 22c02779d311..1a291bdf3636 100644 --- a/src/ipa/rkisp1/algorithms/agc.h +++ b/src/ipa/rkisp1/algorithms/agc.h @@ -29,7 +29,7 @@ public: int configure(IPAContext &context, const IPACameraSensorInfo &configInfo) override; void prepare(IPAContext &context, rkisp1_params_cfg *params) override; - void process(IPAContext &context, IPAFrameContext *frameContext, + void process(IPAContext &context, RKISP1FrameContext &frameContext, const rkisp1_stat_buffer *stats) override; private: diff --git a/src/ipa/rkisp1/algorithms/awb.cpp b/src/ipa/rkisp1/algorithms/awb.cpp index 427aaeb1e955..3beafb73ca33 100644 --- a/src/ipa/rkisp1/algorithms/awb.cpp +++ b/src/ipa/rkisp1/algorithms/awb.cpp @@ -120,7 +120,7 @@ void Awb::prepare(IPAContext &context, rkisp1_params_cfg *params) * \copydoc libcamera::ipa::Algorithm::process */ void Awb::process([[maybe_unused]] IPAContext &context, - [[maybe_unused]] IPAFrameContext *frameCtx, + [[maybe_unused]] RKISP1FrameContext &frameCtx, const rkisp1_stat_buffer *stats) { const rkisp1_cif_isp_stat *params = &stats->params; diff --git a/src/ipa/rkisp1/algorithms/awb.h b/src/ipa/rkisp1/algorithms/awb.h index 7647842f6609..259b85eebdb4 100644 --- a/src/ipa/rkisp1/algorithms/awb.h +++ b/src/ipa/rkisp1/algorithms/awb.h @@ -23,7 +23,7 @@ public: int configure(IPAContext &context, const IPACameraSensorInfo &configInfo) override; void prepare(IPAContext &context, rkisp1_params_cfg *params) override; - void process(IPAContext &context, IPAFrameContext *frameCtx, + void process(IPAContext &context, RKISP1FrameContext &frameCtx, const rkisp1_stat_buffer *stats) override; private: diff --git a/src/ipa/rkisp1/ipa_context.h b/src/ipa/rkisp1/ipa_context.h index 341fef2e68fe..a64dbc75fdd2 100644 --- a/src/ipa/rkisp1/ipa_context.h +++ b/src/ipa/rkisp1/ipa_context.h @@ -14,6 +14,8 @@ #include +#include + namespace libcamera { namespace ipa::rkisp1 { @@ -64,7 +66,7 @@ struct IPAActiveState { unsigned int frameCount; }; -struct IPAFrameContext { +struct RKISP1FrameContext : public IPAFrameContext { }; struct IPAContext { diff --git a/src/ipa/rkisp1/module.h b/src/ipa/rkisp1/module.h index 89f83208a75c..2568c624df0f 100644 --- a/src/ipa/rkisp1/module.h +++ b/src/ipa/rkisp1/module.h @@ -19,7 +19,7 @@ namespace libcamera { namespace ipa::rkisp1 { -using Module = ipa::Module; } /* namespace ipa::rkisp1 */ diff --git a/src/ipa/rkisp1/rkisp1.cpp b/src/ipa/rkisp1/rkisp1.cpp index 9629ccbf4247..7481e67e70f6 100644 --- a/src/ipa/rkisp1/rkisp1.cpp +++ b/src/ipa/rkisp1/rkisp1.cpp @@ -301,8 +301,11 @@ void IPARkISP1::processStatsBuffer(const uint32_t frame, const uint32_t bufferId unsigned int aeState = 0; + /* \todo Obtain the frame context to pass to process from the FCQueue */ + RKISP1FrameContext frameContext; + for (auto const &algo : algorithms()) - algo->process(context_, nullptr, stats); + algo->process(context_, frameContext, stats); setControls(frame);