[{"id":16186,"web_url":"https://patchwork.libcamera.org/comment/16186/","msgid":"<cf9265a7-56a4-0771-2600-de9befff4736@ideasonboard.com>","date":"2021-04-12T16:56:15","subject":"Re: [libcamera-devel] [PATCH v4 4/4] ipa: ipu3: Add support for\n\tIPU3 AEC/AGC algorithm","submitter":{"id":4,"url":"https://patchwork.libcamera.org/api/people/4/","name":"Kieran Bingham","email":"kieran.bingham@ideasonboard.com"},"content":"Hi JM,\n\nOn 30/03/2021 22:12, Jean-Michel Hautbois wrote:\n> Inherit from the Algorithm class to implement basic auto-exposure and\n> auto-gain functions.\n\nI don't think we need to explain that we inherit from the Algorithm class.\n\nJust that we implement a basic AE/AGC ;-)\n\n> Extract computeTargetExposure() and computeGain() and adapt those to the\n> IPU3 structure.\n> Filtering was added too as it avoids big steps when exposure changes a\n> lot.\n\nThis sounds like a changelog not a commit message\n\n\"\"\"\nImplement a basic auto-exposure and auto-gain algorithm for the IPU3.\n\nThe functions computeTargetExposure() and computeGain() are adapted from\nthe Raspberry Pi AGC implementation to suit the IPU3 structures, and\nfiltering is added to reduce visible stepsize when there are large\nexposure changes.\n\"\"\"\n\nBut adapt as required of course ;-)\n\n\n\n> \n> Signed-off-by: Jean-Michel Hautbois <jeanmichel.hautbois@ideasonboard.com>\n> ---\n>  src/ipa/ipu3/ipu3.cpp     |  12 +-\n>  src/ipa/ipu3/ipu3_agc.cpp | 228 ++++++++++++++++++++++++++++++++++++++\n>  src/ipa/ipu3/ipu3_agc.h   |  67 +++++++++++\n>  src/ipa/ipu3/meson.build  |   1 +\n>  4 files changed, 307 insertions(+), 1 deletion(-)\n>  create mode 100644 src/ipa/ipu3/ipu3_agc.cpp\n>  create mode 100644 src/ipa/ipu3/ipu3_agc.h\n> \n> diff --git a/src/ipa/ipu3/ipu3.cpp b/src/ipa/ipu3/ipu3.cpp\n> index 1cce11c9..848437b5 100644\n> --- a/src/ipa/ipu3/ipu3.cpp\n> +++ b/src/ipa/ipu3/ipu3.cpp\n> @@ -21,6 +21,7 @@\n>  #include \"libcamera/internal/buffer.h\"\n>  #include \"libcamera/internal/log.h\"\n>  \n> +#include \"ipu3_agc.h\"\n>  #include \"ipu3_awb.h\"\n>  \n>  static constexpr uint32_t kMaxCellWidthPerSet = 160;\n> @@ -70,6 +71,8 @@ private:\n>  \n>  \t/* Interface to the AWB algorithm */\n>  \tstd::unique_ptr<ipa::IPU3Awb> awbAlgo_;\n> +\t/* Interface to the AEC/AGC algorithm */\n> +\tstd::unique_ptr<ipa::IPU3Agc> agcAlgo_;\n\nI'm curious that these are pointers and allocated.\n\nDo we need to store them as pointers and call make_unique?\nOr can we just store an instance of each in the class...\n\nDo we destroy and recreate them anytime?\n\n\n>  \t/* Local parameter storage */\n>  \tstruct ipu3_uapi_params params_;\n> @@ -169,6 +172,9 @@ void IPAIPU3::configure(const std::map<uint32_t, ControlInfoMap> &entityControls\n>  \n>  \tawbAlgo_ = std::make_unique<ipa::IPU3Awb>();\n>  \tawbAlgo_->initialise(params_, bdsOutputSize, bdsGrid_);\n> +\n> +\tagcAlgo_ = std::make_unique<ipa::IPU3Agc>();\n> +\tagcAlgo_->initialise(bdsGrid_);\n>  }\n>  \n>  void IPAIPU3::mapBuffers(const std::vector<IPABuffer> &buffers)\n> @@ -240,7 +246,8 @@ void IPAIPU3::processControls([[maybe_unused]] unsigned int frame,\n>  \n>  void IPAIPU3::fillParams(unsigned int frame, ipu3_uapi_params *params)\n>  {\n> -\tawbAlgo_->updateWbParameters(params_, 1.0);\n> +\tif (agcAlgo_->updateControls())\n> +\t\tawbAlgo_->updateWbParameters(params_, agcAlgo_->gamma());\n>  \n>  \t*params = params_;\n>  \n> @@ -255,7 +262,10 @@ void IPAIPU3::parseStatistics(unsigned int frame,\n>  {\n>  \tControlList ctrls(controls::controls);\n>  \n> +\tagcAlgo_->process(stats, exposure_, gain_);\n>  \tawbAlgo_->calculateWBGains(stats);\n\nNew line here ...\n\n> +\tif (agcAlgo_->updateControls())\n> +\t\tsetControls(frame);\n>  \n>  \tipa::ipu3::IPU3Action op;\n>  \top.op = ipa::ipu3::ActionMetadataReady;\n> diff --git a/src/ipa/ipu3/ipu3_agc.cpp b/src/ipa/ipu3/ipu3_agc.cpp\n> new file mode 100644\n> index 00000000..6cb657b3\n> --- /dev/null\n> +++ b/src/ipa/ipu3/ipu3_agc.cpp\n> @@ -0,0 +1,228 @@\n> +/* SPDX-License-Identifier: LGPL-2.1-or-later */\n> +/*\n> + * Copyright (C) 2021, Ideas On Board\n> + *\n> + * ipu3_agc.cpp - AGC/AEC control algorithm\n> + */\n> +\n> +#include \"ipu3_agc.h\"\n> +\n> +#include <algorithm>\n> +#include <cmath>\n> +#include <numeric>\n> +\n> +#include \"libcamera/internal/log.h\"\n> +\n> +#include \"libipa/histogram.h\"\n> +\n> +namespace libcamera {\n> +\n> +namespace ipa {\n> +\n> +LOG_DEFINE_CATEGORY(IPU3Agc)\n> +\n> +/* Number of frames to wait before calculating stats on minimum exposure */\n> +static const uint32_t kInitialFrameMinAECount = 4;\n> +/* Number of frames to wait between new gain/exposure estimations */\n> +static const uint32_t kFrameSkipCount = 6;\n> +\n> +/* Maximum ISO value for analogue gain */\n> +static const uint32_t kMinISO = 100;\n> +static const uint32_t kMaxISO = 1500;\n> +/* Maximum analogue gain value\n> + * \\todo grab it from a camera helper */\n> +static const uint32_t kMinGain = kMinISO / 100;\n> +static const uint32_t kMaxGain = kMaxISO / 100;\n> +/* \\todo use calculated value based on sensor */\n> +static const uint32_t kMinExposure = 1;\n> +static const uint32_t kMaxExposure = 1976;\n\nIs 1976 arbitrary?\n\nIndeed these should come from the sensor info. Is that available to us\nhere yet? Or do we need to do something to get these in where you need them?\n\n\n> +/* \\todo those should be get from pipeline handler ! */\n> +/* line duration in microseconds */\n> +static const double kLineDuration = 16.8;\n> +static const double kMaxExposureTime = kMaxExposure * kLineDuration;\n\nI know some people disagree, but a new line between these distinct\nconstant blocks makes it easier for me to parse.\n\n> +/* Histogram constants */\n> +static const uint32_t knumHistogramBins = 256;\n> +static const double kEvGainTarget = 0.5;\n\nAnd I know you've told me not to say s/const/constexpr/ already ;)\n\n> +\n> +IPU3Agc::IPU3Agc()\n> +\t: frameCount_(0), lastFrame_(0),\n> +\t  converged_(false), updateControls_(false)\n> +{\n> +\tiqMean_ = 0.0;\n> +\tgamma_ = 1.0;\n> +\thistLow_ = 0;\n> +\thistHigh_ = 255;\n> +\tprevTotalExposure_ = 0.0;\n> +\tprevTotalExposureNoDg_ = 0.0;\n> +\tcurrentTotalExposure_ = 0.0;\n> +\tcurrentTotalExposureNoDg_ = 0.0;\n\nShould these all go in the constructor initialiser list?\nCould the Prev/current total types be wrapped to simplify them?\n (If it doesn't make sense to do that then its' a no)\n\n\n> +}\n> +\n> +IPU3Agc::~IPU3Agc()\n> +{\n> +}\n\nDoes this need to be defined if it doesn't do anything?\nOr is it a placeholder?\n\n> +\n> +void IPU3Agc::initialise(struct ipu3_uapi_grid_config &bdsGrid)\n> +{\n> +\taeGrid_ = bdsGrid;\n> +}\n\nNewline missing here.\n\n\n> +void IPU3Agc::processBrightness(const ipu3_uapi_stats_3a *stats)\n> +{\n> +\tconst struct ipu3_uapi_grid_config statsAeGrid = stats->stats_4a_config.awb_config.grid;\n> +\tRectangle aeRegion = { statsAeGrid.x_start,\n> +\t\t\t       statsAeGrid.y_start,\n> +\t\t\t       static_cast<unsigned int>(statsAeGrid.x_end - statsAeGrid.x_start) + 1,\n> +\t\t\t       static_cast<unsigned int>(statsAeGrid.y_end - statsAeGrid.y_start) + 1 };\n> +\tPoint topleft = aeRegion.topLeft();\n> +\tuint32_t startY = (topleft.y >> aeGrid_.block_height_log2) * aeGrid_.width << aeGrid_.block_width_log2;\n> +\tuint32_t startX = (topleft.x >> aeGrid_.block_width_log2) << aeGrid_.block_width_log2;\n\nX before Y ?\n\n> +\tuint32_t endX = (startX + (aeRegion.size().width >> aeGrid_.block_width_log2)) << aeGrid_.block_width_log2;\n\nWe don't need endY I guess?\n\n> +\tuint32_t i, j;\n> +\tuint32_t count = 0;\n> +\n> +\tcellsBrightness_.clear();\n> +\n> +\tfor (j = (topleft.y >> aeGrid_.block_height_log2);\n> +\t     j < (topleft.y >> aeGrid_.block_height_log2) + (aeRegion.size().height >> aeGrid_.block_height_log2);\n\ntopleft.{x,y} >> block_{width,height}... is used a lot here.\nWould it help readability to cache it in a descriptive local variable?\n\n\n\n> +\t     j++) {\n> +\t\tfor (i = startX + startY; i < endX + startY; i += 8) {\n\nis += 8 a hardcode of the block/grid size? If so - should it be stored\nin the class as a constant so it will be updated when it is variable?\n\n\n> +\t\t\t/* grid width (and maybe height) is not reliable.\n> +\t\t\t * We observed a bit shift which makes the value 160 to be 32 in the stats grid.\n> +\t\t\t * Use the one passed at init time. */\n\n/*\n * Multiline comment style has the start and end on their own lines\n * like this.\n */\n\n\n\n> +\t\t\tif (stats->awb_raw_buffer.meta_data[i + 4 + j * aeGrid_.width] == 0) {\n> +\t\t\t\tuint8_t Gr = stats->awb_raw_buffer.meta_data[i + j * aeGrid_.width];\n\nI'd be tempted to put a + 0 + j in here to keep alignment with the\nothers below...\n\n> +\t\t\t\tuint8_t R = stats->awb_raw_buffer.meta_data[i + 1 + j * aeGrid_.width];\n> +\t\t\t\tuint8_t B = stats->awb_raw_buffer.meta_data[i + 2 + j * aeGrid_.width];\n> +\t\t\t\tuint8_t Gb = stats->awb_raw_buffer.meta_data[i + 3 + j * aeGrid_.width];\n> +\n> +\t\t\t\tcellsBrightness_.push_back(static_cast<uint32_t>(0.2125 * R + 0.7154 * (Gr + Gb) / 2 + 0.0722 * B));\n\nWhere is this calculation from?\nis it a specific color space etc again?\n\n\n> +\t\t\t\tcount++;\n> +\t\t\t}\n> +\t\t}\n> +\t}\n> +\tstd::vector<uint32_t>::iterator maxIntensity = std::max_element(cellsBrightness_.begin(), cellsBrightness_.end());\n> +\tLOG(IPU3Agc, Debug) << \"Most frequent intensity is \" << *maxIntensity << \" at \" << std::distance(cellsBrightness_.begin(), maxIntensity);\n> +\n> +\t/* \\todo create a class to generate histograms ! */\n\nI presume this comment is distinct from the Histogram class you add in\nthis series?\n\nWould some of these operations below go into the Histogram class?\n\n\n> +\tuint32_t hist[knumHistogramBins] = { 0 };\n> +\tfor (uint32_t const &val : cellsBrightness_)\n> +\t\thist[val]++;\n> +\n> +\tdouble mean = 0.0;\n> +\tfor (i = 0; i < knumHistogramBins; i++) {\n> +\t\tmean += hist[i] * i;\n> +\t}\n> +\tmean /= count;\n> +\n> +\tdouble variance = 0.0;\n> +\tfor (i = 0; i < knumHistogramBins; i++) {\n> +\t\tvariance += ((i - mean) * (i - mean)) * hist[i];\n> +\t}\n\nsingle line statement with for doesn't need { }\n\n\n> +\tvariance /= count;\n> +\tvariance = std::sqrt(variance);\n> +\n> +\tLOG(IPU3Agc, Debug) << \"mean value is: \" << mean << \" and variance is \" << variance;\n\nNew line here ...\n\n> +\t/* Limit the gamma effect for now */\n> +\tgamma_ = 1.1;\n> +\n> +\tconst auto [minBrightness, maxBrightness] = std::minmax_element(cellsBrightness_.begin(), cellsBrightness_.end());\n> +\thistLow_ = *minBrightness;\n> +\thistHigh_ = *maxBrightness;\n> +\n> +\tiqMean_ = Histogram(Span<uint32_t>(hist)).interQuantileMean(0.98, 1.0);\n\nIs there a definition for using 0.98 ... 1.0 ?\n\n> +}\n> +\n> +void IPU3Agc::filterExposure(bool desaturate)\n> +{\n> +\tdouble speed = 0.2;\n> +\tif (prevTotalExposure_ == 0.0) {\n> +\t\tprevTotalExposure_ = currentTotalExposure_;\n> +\t\tprevTotalExposureNoDg_ = currentTotalExposureNoDg_;\n\nwhat is NoDg here?\n\n> +\t} else {\n> +\t\t/* If close to the result go faster, to save making so many\n> +\t\t * micro-adjustments on the way.\n> +\t\t * \\ todo: Make this customisable? */\n\nComment style should be fixed.\n\nAlso the comment doesn't make much sense at the minute I'm afraid.\nPerhaps:\n\n\"\"\"\nIf we are close to the desired result, go faster to avoid making\nmultiple micro-adjustments.\n\"\"\"\n\n> +\t\tif (prevTotalExposure_ < 1.2 * currentTotalExposure_ &&\n> +\t\t    prevTotalExposure_ > 0.8 * currentTotalExposure_)\n> +\t\t\tspeed = sqrt(speed);\n> +\t\tprevTotalExposure_ = speed * currentTotalExposure_ +\n> +\t\t\t\t     prevTotalExposure_ * (1.0 - speed);\n> +\t\t/* When desaturing, take a big jump down in exposure_no_dg,\n> +\t\t * which we'll hide with digital gain. */\n> +\t\tif (desaturate)\n> +\t\t\tprevTotalExposureNoDg_ =\n> +\t\t\t\tcurrentTotalExposureNoDg_;\n> +\t\telse\n> +\t\t\tprevTotalExposureNoDg_ =\n> +\t\t\t\tspeed * currentTotalExposureNoDg_ +\n> +\t\t\t\tprevTotalExposureNoDg_ * (1.0 - speed);\n> +\t}\n> +\t/* We can't let the no_dg exposure deviate too far below the\n> +\t * total exposure, as there might not be enough digital gain available\n> +\t * in the ISP to hide it (which will cause nasty oscillation). */\n> +\tdouble fastReduceThreshold = 0.4;\n> +\tif (prevTotalExposureNoDg_ <\n> +\t    prevTotalExposure_ * fastReduceThreshold)\n> +\t\tprevTotalExposureNoDg_ = prevTotalExposure_ * fastReduceThreshold;\n> +\tLOG(IPU3Agc, Debug) << \"After filtering, total_exposure \" << prevTotalExposure_;\n> +}\n> +\n> +void IPU3Agc::lockExposureGain(uint32_t &exposure, uint32_t &gain)> +{\n> +\tupdateControls_ = false;\n> +\n> +\t/* Algorithm initialization wait for first valid frames */\n\nDoes this comment mean \"should wait for the first valid frames\" or\nsomething else?\n\n> +\t/* \\todo - have a number of frames given by DelayedControls ?\n> +\t * - implement a function for IIR */\n\n\nYes, I suspect a Filter class would be helpful/useful in other places.\nBut perhaps it might be on top/later unless it's easy to abstract.\n\n\n\n> +\tif ((frameCount_ == kInitialFrameMinAECount) || (frameCount_ - lastFrame_ >= kFrameSkipCount)) {\n\nIf you invert this condition(s), and return early, the large code block\nbelow can be pulled in one indentation level...\n\n\n\n> +\t\t/* Are we correctly exposed ? */\n> +\t\tdouble newGain = kEvGainTarget * knumHistogramBins / iqMean_;\n\nnewGain only seems to be used in the else case below, should it be\ndetermined down there?\n\n> +\n> +\t\tif (std::abs(iqMean_ - kEvGainTarget * knumHistogramBins) <= 1) {\n> +\t\t\tLOG(IPU3Agc, Debug) << \"!!! Good exposure with iqMean = \" << iqMean_;\n> +\t\t\tconverged_ = true;\n> +\t\t} else {\n> +\t\t\t/* extracted from Rpi::Agc::computeTargetExposure */\n> +\t\t\tdouble currentShutter = exposure * kLineDuration;\n> +\t\t\tcurrentTotalExposureNoDg_ = currentShutter * gain;\n> +\t\t\tLOG(IPU3Agc, Debug) << \"Actual total exposure \" << currentTotalExposureNoDg_\n> +\t\t\t\t\t    << \" Shutter speed \" << currentShutter\n> +\t\t\t\t\t    << \" Gain \" << gain;\n> +\t\t\tcurrentTotalExposure_ = currentTotalExposureNoDg_ * newGain;\n> +\t\t\tdouble maxTotalExposure = kMaxExposureTime * kMaxGain;\n> +\t\t\tcurrentTotalExposure_ = std::min(currentTotalExposure_, maxTotalExposure);\n> +\t\t\tLOG(IPU3Agc, Debug) << \"Target total exposure \" << currentTotalExposure_;\n> +\n> +\t\t\t/* \\todo: estimate if we need to desaturate */\n> +\t\t\tfilterExposure(false);\n> +\n> +\t\t\tdouble newExposure = 0.0;\n> +\t\t\tif (currentShutter < kMaxExposureTime) {\n> +\t\t\t\texposure = std::clamp(static_cast<uint32_t>(exposure * currentTotalExposure_ / currentTotalExposureNoDg_), kMinExposure, kMaxExposure);\n> +\t\t\t\tnewExposure = currentTotalExposure_ / exposure;\n> +\t\t\t\tgain = std::clamp(static_cast<uint32_t>(gain * currentTotalExposure_ / newExposure), kMinGain, kMaxGain);\n> +\t\t\t\tupdateControls_ = true;\n> +\t\t\t} else if (currentShutter >= kMaxExposureTime) {\n> +\t\t\t\tgain = std::clamp(static_cast<uint32_t>(gain * currentTotalExposure_ / currentTotalExposureNoDg_), kMinGain, kMaxGain);\n> +\t\t\t\tnewExposure = currentTotalExposure_ / gain;\n> +\t\t\t\texposure = std::clamp(static_cast<uint32_t>(exposure * currentTotalExposure_ / newExposure), kMinExposure, kMaxExposure);\n> +\t\t\t\tupdateControls_ = true;\n> +\t\t\t}\n> +\t\t\tLOG(IPU3Agc, Debug) << \"Adjust exposure \" << exposure * kLineDuration << \" and gain \" << gain;\n> +\t\t}\n> +\t\tlastFrame_ = frameCount_;\n> +\t} else {\n> +\t\tupdateControls_ = false;\n\nThis was already set at the entry to the function.\n\n> +\t}\n> +}\n> +\n> +void IPU3Agc::process(const ipu3_uapi_stats_3a *stats, uint32_t &exposure, uint32_t &gain)\n> +{\n> +\tprocessBrightness(stats);\n> +\tlockExposureGain(exposure, gain);\n> +\tframeCount_++;\n\ndo we need to keep a frameCount?\nI thought the IPA's were given the frame number ...\n\n\n> +}\n> +\n> +} /* namespace ipa */\n> +\n> +} /* namespace libcamera */\n> diff --git a/src/ipa/ipu3/ipu3_agc.h b/src/ipa/ipu3/ipu3_agc.h\n> new file mode 100644\n> index 00000000..d4657a81\n> --- /dev/null\n> +++ b/src/ipa/ipu3/ipu3_agc.h\n> @@ -0,0 +1,67 @@\n> +/* SPDX-License-Identifier: LGPL-2.1-or-later */\n> +/*\n> + * Copyright (C) 2021, Ideas On Board\n> + *\n> + * ipu3_agc.h - IPU3 AGC/AEC control algorithm\n> + */\n> +#ifndef __LIBCAMERA_IPU3_AGC_H__\n> +#define __LIBCAMERA_IPU3_AGC_H__\n> +\n> +#include <unordered_map>\n> +#include <vector>\n> +\n> +#include <linux/intel-ipu3.h>\n> +\n> +#include <libcamera/geometry.h>\n> +\n> +#include \"libipa/algorithm.h\"\n> +\n> +namespace libcamera {\n> +\n> +namespace ipa {\n> +\n> +class IPU3Agc : public Algorithm\n> +{\n> +public:\n> +\tIPU3Agc();\n> +\t~IPU3Agc();\n> +\n> +\tvoid initialise(struct ipu3_uapi_grid_config &bdsGrid);\n> +\tvoid process(const ipu3_uapi_stats_3a *stats, uint32_t &exposure, uint32_t &gain);\n> +\tbool converged() { return converged_; }\n> +\tbool updateControls() { return updateControls_; }\n> +\t/* \\todo Use a metadata exchange between IPAs */\n> +\tdouble gamma() { return gamma_; }\n\nHave you looked at how RPi exchange metadata between algorithms along\nthe pipeline?\n\n(src/ipa/raspberrypi/controller/metadata.hpp)\n\n\n> +\n> +private:\n> +\tvoid processBrightness(const ipu3_uapi_stats_3a *stats);\n> +\tvoid filterExposure(bool desaturate);\n> +\tvoid lockExposureGain(uint32_t &exposure, uint32_t &gain);\n> +\n> +\tstruct ipu3_uapi_grid_config aeGrid_;\n> +\n> +\tuint64_t frameCount_;\n> +\tuint64_t lastFrame_;\n> +\n> +\t/* Vector of calculated brightness for each cell */\n> +\tstd::vector<uint32_t> cellsBrightness_;\n> +\n> +\tbool converged_;\n> +\tbool updateControls_;\n> +\n> +\tdouble iqMean_;\n> +\tdouble gamma_;\n> +\tuint32_t histLow_;\n> +\tuint32_t histHigh_;\n> +\n> +\tdouble prevTotalExposure_;\n> +\tdouble prevTotalExposureNoDg_;\n> +\tdouble currentTotalExposure_;\n> +\tdouble currentTotalExposureNoDg_;\n> +};\n> +\n> +} /* namespace ipa */\n> +\n> +} /* namespace libcamera */\n> +\n> +#endif /* __LIBCAMERA_IPU3_AGC_H__ */\n> diff --git a/src/ipa/ipu3/meson.build b/src/ipa/ipu3/meson.build\n> index 1040698e..adeae28b 100644\n> --- a/src/ipa/ipu3/meson.build\n> +++ b/src/ipa/ipu3/meson.build\n> @@ -5,6 +5,7 @@ ipa_name = 'ipa_ipu3'\n>  ipu3_ipa_sources = files([\n>      'ipu3.cpp',\n>      'ipu3_awb.cpp',\n> +    'ipu3_agc.cpp',\n>  ])\n>  \n>  mod = shared_module(ipa_name,\n>","headers":{"Return-Path":"<libcamera-devel-bounces@lists.libcamera.org>","X-Original-To":"parsemail@patchwork.libcamera.org","Delivered-To":"parsemail@patchwork.libcamera.org","Received":["from lancelot.ideasonboard.com (lancelot.ideasonboard.com\n\t[92.243.16.209])\n\tby patchwork.libcamera.org (Postfix) with ESMTPS id AD847BD1F6\n\tfor <parsemail@patchwork.libcamera.org>;\n\tMon, 12 Apr 2021 16:56:20 +0000 (UTC)","from lancelot.ideasonboard.com (localhost [IPv6:::1])\n\tby lancelot.ideasonboard.com (Postfix) with ESMTP id 0B16E687F3;\n\tMon, 12 Apr 2021 18:56:20 +0200 (CEST)","from perceval.ideasonboard.com (perceval.ideasonboard.com\n\t[213.167.242.64])\n\tby lancelot.ideasonboard.com (Postfix) with ESMTPS id E6F72602C8\n\tfor <libcamera-devel@lists.libcamera.org>;\n\tMon, 12 Apr 2021 18:56:18 +0200 (CEST)","from [192.168.0.20]\n\t(cpc89244-aztw30-2-0-cust3082.18-1.cable.virginm.net [86.31.172.11])\n\tby perceval.ideasonboard.com (Postfix) with ESMTPSA id 48C693F0;\n\tMon, 12 Apr 2021 18:56:18 +0200 (CEST)"],"Authentication-Results":"lancelot.ideasonboard.com;\n\tdkim=fail reason=\"signature verification failed\" (1024-bit key;\n\tunprotected) header.d=ideasonboard.com header.i=@ideasonboard.com\n\theader.b=\"t8lVbwq4\"; dkim-atps=neutral","DKIM-Signature":"v=1; a=rsa-sha256; c=relaxed/simple; d=ideasonboard.com;\n\ts=mail; t=1618246578;\n\tbh=dwCRgKiFdZGln/szRxnquIgkC0AX7FuAHf+XXIYWEYw=;\n\th=Reply-To:Subject:To:References:From:Date:In-Reply-To:From;\n\tb=t8lVbwq40nsInIU78PHoDdfSRxHsqoz047TUqjIHjIqkIT4fL8o2d1xjWJhXUBY/q\n\ty7QtNxpCTbMxaPjx1PL4YAhH6djpJo/8ddrTrqZ4JsxgIQLXo9yuW6OYMlmbJefgC+\n\txwG7vyWOSHJX4mK8I1nrjEEng5P+NYNuNZYW8VPE=","To":"Jean-Michel Hautbois <jeanmichel.hautbois@ideasonboard.com>,\n\tlibcamera-devel@lists.libcamera.org","References":"<20210330211210.194806-1-jeanmichel.hautbois@ideasonboard.com>\n\t<20210330211210.194806-5-jeanmichel.hautbois@ideasonboard.com>","From":"Kieran Bingham <kieran.bingham@ideasonboard.com>","Autocrypt":"addr=kieran.bingham@ideasonboard.com; keydata=\n\tmQINBFYE/WYBEACs1PwjMD9rgCu1hlIiUA1AXR4rv2v+BCLUq//vrX5S5bjzxKAryRf0uHat\n\tV/zwz6hiDrZuHUACDB7X8OaQcwhLaVlq6byfoBr25+hbZG7G3+5EUl9cQ7dQEdvNj6V6y/SC\n\trRanWfelwQThCHckbobWiQJfK9n7rYNcPMq9B8e9F020LFH7Kj6YmO95ewJGgLm+idg1Kb3C\n\tpotzWkXc1xmPzcQ1fvQMOfMwdS+4SNw4rY9f07Xb2K99rjMwZVDgESKIzhsDB5GY465sCsiQ\n\tcSAZRxqE49RTBq2+EQsbrQpIc8XiffAB8qexh5/QPzCmR4kJgCGeHIXBtgRj+nIkCJPZvZtf\n\tKr2EAbc6tgg6DkAEHJb+1okosV09+0+TXywYvtEop/WUOWQ+zo+Y/OBd+8Ptgt1pDRyOBzL8\n\tRXa8ZqRf0Mwg75D+dKntZeJHzPRJyrlfQokngAAs4PaFt6UfS+ypMAF37T6CeDArQC41V3ko\n\tlPn1yMsVD0p+6i3DPvA/GPIksDC4owjnzVX9kM8Zc5Cx+XoAN0w5Eqo4t6qEVbuettxx55gq\n\t8K8FieAjgjMSxngo/HST8TpFeqI5nVeq0/lqtBRQKumuIqDg+Bkr4L1V/PSB6XgQcOdhtd36\n\tOe9X9dXB8YSNt7VjOcO7BTmFn/Z8r92mSAfHXpb07YJWJosQOQARAQABtDBLaWVyYW4gQmlu\n\tZ2hhbSA8a2llcmFuLmJpbmdoYW1AaWRlYXNvbmJvYXJkLmNvbT6JAlcEEwEKAEECGwMFCwkI\n\tBwIGFQgJCgsCBBYCAwECHgECF4ACGQEWIQSQLdeYP70o/eNy1HqhHkZyEKRh/QUCXWTtygUJ\n\tCyJXZAAKCRChHkZyEKRh/f8dEACTDsbLN2nioNZMwyLuQRUAFcXNolDX48xcUXsWS2QjxaPm\n\tVsJx8Uy8aYkS85mdPBh0C83OovQR/OVbr8AxhGvYqBs3nQvbWuTl/+4od7DfK2VZOoKBAu5S\n\tQK2FYuUcikDqYcFWJ8DQnubxfE8dvzojHEkXw0sA4igINHDDFX3HJGZtLio+WpEFQtCbfTAG\n\tYZslasz1YZRbwEdSsmO3/kqy5eMnczlm8a21A3fKUo3g8oAZEFM+f4DUNzqIltg31OAB/kZS\n\tenKZQ/SWC8PmLg/ZXBrReYakxXtkP6w3FwMlzOlhGxqhIRNiAJfXJBaRhuUWzPOpEDE9q5YJ\n\tBmqQL2WJm1VSNNVxbXJHpaWMH1sA2R00vmvRrPXGwyIO0IPYeUYQa3gsy6k+En/aMQJd27dp\n\taScf9am9PFICPY5T4ppneeJLif2lyLojo0mcHOV+uyrds9XkLpp14GfTkeKPdPMrLLTsHRfH\n\tfA4I4OBpRrEPiGIZB/0im98MkGY/Mu6qxeZmYLCcgD6qz4idOvfgVOrNh+aA8HzIVR+RMW8H\n\tQGBN9f0E3kfwxuhl3omo6V7lDw8XOdmuWZNC9zPq1UfryVHANYbLGz9KJ4Aw6M+OgBC2JpkD\n\thXMdHUkC+d20dwXrwHTlrJi1YNp6rBc+xald3wsUPOZ5z8moTHUX/uPA/qhGsbkCDQRWBP1m\n\tARAAzijkb+Sau4hAncr1JjOY+KyFEdUNxRy+hqTJdJfaYihxyaj0Ee0P0zEi35CbE6lgU0Uz\n\ttih9fiUbSV3wfsWqg1Ut3/5rTKu7kLFp15kF7eqvV4uezXRD3Qu4yjv/rMmEJbbD4cTvGCYI\n\td6MDC417f7vK3hCbCVIZSp3GXxyC1LU+UQr3fFcOyCwmP9vDUR9JV0BSqHHxRDdpUXE26Dk6\n\tmhf0V1YkspE5St814ETXpEus2urZE5yJIUROlWPIL+hm3NEWfAP06vsQUyLvr/GtbOT79vXl\n\tEn1aulcYyu20dRRxhkQ6iILaURcxIAVJJKPi8dsoMnS8pB0QW12AHWuirPF0g6DiuUfPmrA5\n\tPKe56IGlpkjc8cO51lIxHkWTpCMWigRdPDexKX+Sb+W9QWK/0JjIc4t3KBaiG8O4yRX8ml2R\n\t+rxfAVKM6V769P/hWoRGdgUMgYHFpHGSgEt80OKK5HeUPy2cngDUXzwrqiM5Sz6Od0qw5pCk\n\tNlXqI0W/who0iSVM+8+RmyY0OEkxEcci7rRLsGnM15B5PjLJjh1f2ULYkv8s4SnDwMZ/kE04\n\t/UqCMK/KnX8pwXEMCjz0h6qWNpGwJ0/tYIgQJZh6bqkvBrDogAvuhf60Sogw+mH8b+PBlx1L\n\toeTK396wc+4c3BfiC6pNtUS5GpsPMMjYMk7kVvEAEQEAAYkCPAQYAQoAJgIbDBYhBJAt15g/\n\tvSj943LUeqEeRnIQpGH9BQJdizzIBQkLSKZiAAoJEKEeRnIQpGH9eYgQAJpjaWNgqNOnMTmD\n\tMJggbwjIotypzIXfhHNCeTkG7+qCDlSaBPclcPGYrTwCt0YWPU2TgGgJrVhYT20ierN8LUvj\n\t6qOPTd+Uk7NFzL65qkh80ZKNBFddx1AabQpSVQKbdcLb8OFs85kuSvFdgqZwgxA1vl4TFhNz\n\tPZ79NAmXLackAx3sOVFhk4WQaKRshCB7cSl+RIng5S/ThOBlwNlcKG7j7W2MC06BlTbdEkUp\n\tECzuuRBv8wX4OQl+hbWbB/VKIx5HKlLu1eypen/5lNVzSqMMIYkkZcjV2SWQyUGxSwq0O/sx\n\tS0A8/atCHUXOboUsn54qdxrVDaK+6jIAuo8JiRWctP16KjzUM7MO0/+4zllM8EY57rXrj48j\n\tsbEYX0YQnzaj+jO6kJtoZsIaYR7rMMq9aUAjyiaEZpmP1qF/2sYenDx0Fg2BSlLvLvXM0vU8\n\tpQk3kgDu7kb/7PRYrZvBsr21EIQoIjXbZxDz/o7z95frkP71EaICttZ6k9q5oxxA5WC6sTXc\n\tMW8zs8avFNuA9VpXt0YupJd2ijtZy2mpZNG02fFVXhIn4G807G7+9mhuC4XG5rKlBBUXTvPU\n\tAfYnB4JBDLmLzBFavQfvonSfbitgXwCG3vS+9HEwAjU30Bar1PEOmIbiAoMzuKeRm2LVpmq4\n\tWZw01QYHU/GUV/zHJSFk","Organization":"Ideas on Board","Message-ID":"<cf9265a7-56a4-0771-2600-de9befff4736@ideasonboard.com>","Date":"Mon, 12 Apr 2021 17:56:15 +0100","User-Agent":"Mozilla/5.0 (X11; Linux x86_64; rv:68.0) Gecko/20100101\n\tThunderbird/68.10.0","MIME-Version":"1.0","In-Reply-To":"<20210330211210.194806-5-jeanmichel.hautbois@ideasonboard.com>","Content-Language":"en-GB","Subject":"Re: [libcamera-devel] [PATCH v4 4/4] ipa: ipu3: Add support for\n\tIPU3 AEC/AGC algorithm","X-BeenThere":"libcamera-devel@lists.libcamera.org","X-Mailman-Version":"2.1.29","Precedence":"list","List-Id":"<libcamera-devel.lists.libcamera.org>","List-Unsubscribe":"<https://lists.libcamera.org/options/libcamera-devel>,\n\t<mailto:libcamera-devel-request@lists.libcamera.org?subject=unsubscribe>","List-Archive":"<https://lists.libcamera.org/pipermail/libcamera-devel/>","List-Post":"<mailto:libcamera-devel@lists.libcamera.org>","List-Help":"<mailto:libcamera-devel-request@lists.libcamera.org?subject=help>","List-Subscribe":"<https://lists.libcamera.org/listinfo/libcamera-devel>,\n\t<mailto:libcamera-devel-request@lists.libcamera.org?subject=subscribe>","Reply-To":"kieran.bingham@ideasonboard.com","Content-Type":"text/plain; charset=\"us-ascii\"","Content-Transfer-Encoding":"7bit","Errors-To":"libcamera-devel-bounces@lists.libcamera.org","Sender":"\"libcamera-devel\" <libcamera-devel-bounces@lists.libcamera.org>"}},{"id":16307,"web_url":"https://patchwork.libcamera.org/comment/16307/","msgid":"<e407d860-6000-7233-97b2-ecad91e0e699@ideasonboard.com>","date":"2021-04-16T07:41:59","subject":"Re: [libcamera-devel] [PATCH v4 4/4] ipa: ipu3: Add support for\n\tIPU3 AEC/AGC algorithm","submitter":{"id":75,"url":"https://patchwork.libcamera.org/api/people/75/","name":"Jean-Michel Hautbois","email":"jeanmichel.hautbois@ideasonboard.com"},"content":"Hi Kieran,\n\nOn 12/04/2021 18:56, Kieran Bingham wrote:\n> Hi JM,\n> \n> On 30/03/2021 22:12, Jean-Michel Hautbois wrote:\n>> Inherit from the Algorithm class to implement basic auto-exposure and\n>> auto-gain functions.\n> \n> I don't think we need to explain that we inherit from the Algorithm class.\n> \n> Just that we implement a basic AE/AGC ;-)\n> \n>> Extract computeTargetExposure() and computeGain() and adapt those to the\n>> IPU3 structure.\n>> Filtering was added too as it avoids big steps when exposure changes a\n>> lot.\n> \n> This sounds like a changelog not a commit message\n> \n> \"\"\"\n> Implement a basic auto-exposure and auto-gain algorithm for the IPU3.\n> \n> The functions computeTargetExposure() and computeGain() are adapted from\n> the Raspberry Pi AGC implementation to suit the IPU3 structures, and\n> filtering is added to reduce visible stepsize when there are large\n> exposure changes.\n> \"\"\"\n> \n> But adapt as required of course ;-)\n> \nApplied, thanks :-)\n\n> \n>>\n>> Signed-off-by: Jean-Michel Hautbois <jeanmichel.hautbois@ideasonboard.com>\n>> ---\n>>  src/ipa/ipu3/ipu3.cpp     |  12 +-\n>>  src/ipa/ipu3/ipu3_agc.cpp | 228 ++++++++++++++++++++++++++++++++++++++\n>>  src/ipa/ipu3/ipu3_agc.h   |  67 +++++++++++\n>>  src/ipa/ipu3/meson.build  |   1 +\n>>  4 files changed, 307 insertions(+), 1 deletion(-)\n>>  create mode 100644 src/ipa/ipu3/ipu3_agc.cpp\n>>  create mode 100644 src/ipa/ipu3/ipu3_agc.h\n>>\n>> diff --git a/src/ipa/ipu3/ipu3.cpp b/src/ipa/ipu3/ipu3.cpp\n>> index 1cce11c9..848437b5 100644\n>> --- a/src/ipa/ipu3/ipu3.cpp\n>> +++ b/src/ipa/ipu3/ipu3.cpp\n>> @@ -21,6 +21,7 @@\n>>  #include \"libcamera/internal/buffer.h\"\n>>  #include \"libcamera/internal/log.h\"\n>>  \n>> +#include \"ipu3_agc.h\"\n>>  #include \"ipu3_awb.h\"\n>>  \n>>  static constexpr uint32_t kMaxCellWidthPerSet = 160;\n>> @@ -70,6 +71,8 @@ private:\n>>  \n>>  \t/* Interface to the AWB algorithm */\n>>  \tstd::unique_ptr<ipa::IPU3Awb> awbAlgo_;\n>> +\t/* Interface to the AEC/AGC algorithm */\n>> +\tstd::unique_ptr<ipa::IPU3Agc> agcAlgo_;\n> \n> I'm curious that these are pointers and allocated.\n> \n> Do we need to store them as pointers and call make_unique?\n> Or can we just store an instance of each in the class...\n> \n> Do we destroy and recreate them anytime?\n\nI have to be honest: I find it better to read as\nawbAlgo_->callFunction() than awbAlgo_.callFunction().\nStupid, I know :-).\n\nI don't really know which one is better, but I suspect that in a (near\n?) future we will need to instanciate the algorithms in some way and\nwithout knowing their type so we won't be able to store them as an\ninstance anymore...\n\nThey are allocated at confgure() call, so only at the pipeline start,\nand not during the execution, so it is cheap and only a matter of\npreference ?\n\n> \n>>  \t/* Local parameter storage */\n>>  \tstruct ipu3_uapi_params params_;\n>> @@ -169,6 +172,9 @@ void IPAIPU3::configure(const std::map<uint32_t, ControlInfoMap> &entityControls\n>>  \n>>  \tawbAlgo_ = std::make_unique<ipa::IPU3Awb>();\n>>  \tawbAlgo_->initialise(params_, bdsOutputSize, bdsGrid_);\n>> +\n>> +\tagcAlgo_ = std::make_unique<ipa::IPU3Agc>();\n>> +\tagcAlgo_->initialise(bdsGrid_);\n>>  }\n>>  \n>>  void IPAIPU3::mapBuffers(const std::vector<IPABuffer> &buffers)\n>> @@ -240,7 +246,8 @@ void IPAIPU3::processControls([[maybe_unused]] unsigned int frame,\n>>  \n>>  void IPAIPU3::fillParams(unsigned int frame, ipu3_uapi_params *params)\n>>  {\n>> -\tawbAlgo_->updateWbParameters(params_, 1.0);\n>> +\tif (agcAlgo_->updateControls())\n>> +\t\tawbAlgo_->updateWbParameters(params_, agcAlgo_->gamma());\n>>  \n>>  \t*params = params_;\n>>  \n>> @@ -255,7 +262,10 @@ void IPAIPU3::parseStatistics(unsigned int frame,\n>>  {\n>>  \tControlList ctrls(controls::controls);\n>>  \n>> +\tagcAlgo_->process(stats, exposure_, gain_);\n>>  \tawbAlgo_->calculateWBGains(stats);\n> \n> New line here ...\n> \n>> +\tif (agcAlgo_->updateControls())\n>> +\t\tsetControls(frame);\n>>  \n>>  \tipa::ipu3::IPU3Action op;\n>>  \top.op = ipa::ipu3::ActionMetadataReady;\n>> diff --git a/src/ipa/ipu3/ipu3_agc.cpp b/src/ipa/ipu3/ipu3_agc.cpp\n>> new file mode 100644\n>> index 00000000..6cb657b3\n>> --- /dev/null\n>> +++ b/src/ipa/ipu3/ipu3_agc.cpp\n>> @@ -0,0 +1,228 @@\n>> +/* SPDX-License-Identifier: LGPL-2.1-or-later */\n>> +/*\n>> + * Copyright (C) 2021, Ideas On Board\n>> + *\n>> + * ipu3_agc.cpp - AGC/AEC control algorithm\n>> + */\n>> +\n>> +#include \"ipu3_agc.h\"\n>> +\n>> +#include <algorithm>\n>> +#include <cmath>\n>> +#include <numeric>\n>> +\n>> +#include \"libcamera/internal/log.h\"\n>> +\n>> +#include \"libipa/histogram.h\"\n>> +\n>> +namespace libcamera {\n>> +\n>> +namespace ipa {\n>> +\n>> +LOG_DEFINE_CATEGORY(IPU3Agc)\n>> +\n>> +/* Number of frames to wait before calculating stats on minimum exposure */\n>> +static const uint32_t kInitialFrameMinAECount = 4;\n>> +/* Number of frames to wait between new gain/exposure estimations */\n>> +static const uint32_t kFrameSkipCount = 6;\n>> +\n>> +/* Maximum ISO value for analogue gain */\n>> +static const uint32_t kMinISO = 100;\n>> +static const uint32_t kMaxISO = 1500;\n>> +/* Maximum analogue gain value\n>> + * \\todo grab it from a camera helper */\n>> +static const uint32_t kMinGain = kMinISO / 100;\n>> +static const uint32_t kMaxGain = kMaxISO / 100;\n>> +/* \\todo use calculated value based on sensor */\n>> +static const uint32_t kMinExposure = 1;\n>> +static const uint32_t kMaxExposure = 1976;\n> \n> Is 1976 arbitrary?\nIt limits to one frame height on ov5693 (SGo2). So, kinda arbitrary indeed.\n\n> \n> Indeed these should come from the sensor info. Is that available to us\n> here yet? Or do we need to do something to get these in where you need them?\n\nWe could get those from the controlInfo_ in IPU3CameraData() generated\nby PipelineHandlerIPU3::initControls() but this is not the way we should\ndo it in the end, if I remember correctly. The IPA should be the one\ngetting the exposure/gains/pixelrate etc. from the sensor and calculate\nthe values it needs for the algorithms.\n\nI did not take time to do it properly and, as you mention it somewhere\nlater, there is a lack of a proper inter-algorithm communication here.\nAs a start, passing values from IPAIPU3 to the algorithms is not good.\n\n> \n>> +/* \\todo those should be get from pipeline handler ! */\n>> +/* line duration in microseconds */\n>> +static const double kLineDuration = 16.8;\n>> +static const double kMaxExposureTime = kMaxExposure * kLineDuration;\n> \n> I know some people disagree, but a new line between these distinct\n> constant blocks makes it easier for me to parse.\n> \n>> +/* Histogram constants */\n>> +static const uint32_t knumHistogramBins = 256;\n>> +static const double kEvGainTarget = 0.5;\n> \n> And I know you've told me not to say s/const/constexpr/ already ;)\n> \n>> +\n>> +IPU3Agc::IPU3Agc()\n>> +\t: frameCount_(0), lastFrame_(0),\n>> +\t  converged_(false), updateControls_(false)\n>> +{\n>> +\tiqMean_ = 0.0;\n>> +\tgamma_ = 1.0;\n>> +\thistLow_ = 0;\n>> +\thistHigh_ = 255;\n>> +\tprevTotalExposure_ = 0.0;\n>> +\tprevTotalExposureNoDg_ = 0.0;\n>> +\tcurrentTotalExposure_ = 0.0;\n>> +\tcurrentTotalExposureNoDg_ = 0.0;\n> \n> Should these all go in the constructor initialiser list?\n> Could the Prev/current total types be wrapped to simplify them?\n>  (If it doesn't make sense to do that then its' a no)\n> \n> \n>> +}\n>> +\n>> +IPU3Agc::~IPU3Agc()\n>> +{\n>> +}\n> \n> Does this need to be defined if it doesn't do anything?\n> Or is it a placeholder?\n> \n>> +\n>> +void IPU3Agc::initialise(struct ipu3_uapi_grid_config &bdsGrid)\n>> +{\n>> +\taeGrid_ = bdsGrid;\n>> +}\n> \n> Newline missing here.\n> \n> \n>> +void IPU3Agc::processBrightness(const ipu3_uapi_stats_3a *stats)\n>> +{\n>> +\tconst struct ipu3_uapi_grid_config statsAeGrid = stats->stats_4a_config.awb_config.grid;\n>> +\tRectangle aeRegion = { statsAeGrid.x_start,\n>> +\t\t\t       statsAeGrid.y_start,\n>> +\t\t\t       static_cast<unsigned int>(statsAeGrid.x_end - statsAeGrid.x_start) + 1,\n>> +\t\t\t       static_cast<unsigned int>(statsAeGrid.y_end - statsAeGrid.y_start) + 1 };\n>> +\tPoint topleft = aeRegion.topLeft();\n>> +\tuint32_t startY = (topleft.y >> aeGrid_.block_height_log2) * aeGrid_.width << aeGrid_.block_width_log2;\n>> +\tuint32_t startX = (topleft.x >> aeGrid_.block_width_log2) << aeGrid_.block_width_log2;\n> \n> X before Y ?\n> \n>> +\tuint32_t endX = (startX + (aeRegion.size().width >> aeGrid_.block_width_log2)) << aeGrid_.block_width_log2;\n> \n> We don't need endY I guess?\n> \n>> +\tuint32_t i, j;\n>> +\tuint32_t count = 0;\n>> +\n>> +\tcellsBrightness_.clear();\n>> +\n>> +\tfor (j = (topleft.y >> aeGrid_.block_height_log2);\n>> +\t     j < (topleft.y >> aeGrid_.block_height_log2) + (aeRegion.size().height >> aeGrid_.block_height_log2);\n> \n> topleft.{x,y} >> block_{width,height}... is used a lot here.\n> Would it help readability to cache it in a descriptive local variable?\n> \n> \n> \n>> +\t     j++) {\n>> +\t\tfor (i = startX + startY; i < endX + startY; i += 8) {\n> \n> is += 8 a hardcode of the block/grid size? If so - should it be stored\n> in the class as a constant so it will be updated when it is variable?\n> \n> \n>> +\t\t\t/* grid width (and maybe height) is not reliable.\n>> +\t\t\t * We observed a bit shift which makes the value 160 to be 32 in the stats grid.\n>> +\t\t\t * Use the one passed at init time. */\n> \n> /*\n>  * Multiline comment style has the start and end on their own lines\n>  * like this.\n>  */\n> \n> \n> \n>> +\t\t\tif (stats->awb_raw_buffer.meta_data[i + 4 + j * aeGrid_.width] == 0) {\n>> +\t\t\t\tuint8_t Gr = stats->awb_raw_buffer.meta_data[i + j * aeGrid_.width];\n> \n> I'd be tempted to put a + 0 + j in here to keep alignment with the\n> others below...\n> \n>> +\t\t\t\tuint8_t R = stats->awb_raw_buffer.meta_data[i + 1 + j * aeGrid_.width];\n>> +\t\t\t\tuint8_t B = stats->awb_raw_buffer.meta_data[i + 2 + j * aeGrid_.width];\n>> +\t\t\t\tuint8_t Gb = stats->awb_raw_buffer.meta_data[i + 3 + j * aeGrid_.width];\n>> +\n>> +\t\t\t\tcellsBrightness_.push_back(static_cast<uint32_t>(0.2125 * R + 0.7154 * (Gr + Gb) / 2 + 0.0722 * B));\n> \n> Where is this calculation from?\n> is it a specific color space etc again?\n> \n> \n>> +\t\t\t\tcount++;\n>> +\t\t\t}\n>> +\t\t}\n>> +\t}\n>> +\tstd::vector<uint32_t>::iterator maxIntensity = std::max_element(cellsBrightness_.begin(), cellsBrightness_.end());\n>> +\tLOG(IPU3Agc, Debug) << \"Most frequent intensity is \" << *maxIntensity << \" at \" << std::distance(cellsBrightness_.begin(), maxIntensity);\n>> +\n>> +\t/* \\todo create a class to generate histograms ! */\n> \n> I presume this comment is distinct from the Histogram class you add in\n> this series?\n> \n> Would some of these operations below go into the Histogram class?\n> \n> \n>> +\tuint32_t hist[knumHistogramBins] = { 0 };\n>> +\tfor (uint32_t const &val : cellsBrightness_)\n>> +\t\thist[val]++;\n>> +\n>> +\tdouble mean = 0.0;\n>> +\tfor (i = 0; i < knumHistogramBins; i++) {\n>> +\t\tmean += hist[i] * i;\n>> +\t}\n>> +\tmean /= count;\n>> +\n>> +\tdouble variance = 0.0;\n>> +\tfor (i = 0; i < knumHistogramBins; i++) {\n>> +\t\tvariance += ((i - mean) * (i - mean)) * hist[i];\n>> +\t}\n> \n> single line statement with for doesn't need { }\n> \n> \n>> +\tvariance /= count;\n>> +\tvariance = std::sqrt(variance);\n>> +\n>> +\tLOG(IPU3Agc, Debug) << \"mean value is: \" << mean << \" and variance is \" << variance;\n> \n> New line here ...\n> \n>> +\t/* Limit the gamma effect for now */\n>> +\tgamma_ = 1.1;\n>> +\n>> +\tconst auto [minBrightness, maxBrightness] = std::minmax_element(cellsBrightness_.begin(), cellsBrightness_.end());\n>> +\thistLow_ = *minBrightness;\n>> +\thistHigh_ = *maxBrightness;\n>> +\n>> +\tiqMean_ = Histogram(Span<uint32_t>(hist)).interQuantileMean(0.98, 1.0);\n> \n> Is there a definition for using 0.98 ... 1.0 ?\n> \n>> +}\n>> +\n>> +void IPU3Agc::filterExposure(bool desaturate)\n>> +{\n>> +\tdouble speed = 0.2;\n>> +\tif (prevTotalExposure_ == 0.0) {\n>> +\t\tprevTotalExposure_ = currentTotalExposure_;\n>> +\t\tprevTotalExposureNoDg_ = currentTotalExposureNoDg_;\n> \n> what is NoDg here?\n> \n>> +\t} else {\n>> +\t\t/* If close to the result go faster, to save making so many\n>> +\t\t * micro-adjustments on the way.\n>> +\t\t * \\ todo: Make this customisable? */\n> \n> Comment style should be fixed.\n> \n> Also the comment doesn't make much sense at the minute I'm afraid.\n> Perhaps:\n> \n> \"\"\"\n> If we are close to the desired result, go faster to avoid making\n> multiple micro-adjustments.\n> \"\"\"\n> \n>> +\t\tif (prevTotalExposure_ < 1.2 * currentTotalExposure_ &&\n>> +\t\t    prevTotalExposure_ > 0.8 * currentTotalExposure_)\n>> +\t\t\tspeed = sqrt(speed);\n>> +\t\tprevTotalExposure_ = speed * currentTotalExposure_ +\n>> +\t\t\t\t     prevTotalExposure_ * (1.0 - speed);\n>> +\t\t/* When desaturing, take a big jump down in exposure_no_dg,\n>> +\t\t * which we'll hide with digital gain. */\n>> +\t\tif (desaturate)\n>> +\t\t\tprevTotalExposureNoDg_ =\n>> +\t\t\t\tcurrentTotalExposureNoDg_;\n>> +\t\telse\n>> +\t\t\tprevTotalExposureNoDg_ =\n>> +\t\t\t\tspeed * currentTotalExposureNoDg_ +\n>> +\t\t\t\tprevTotalExposureNoDg_ * (1.0 - speed);\n>> +\t}\n>> +\t/* We can't let the no_dg exposure deviate too far below the\n>> +\t * total exposure, as there might not be enough digital gain available\n>> +\t * in the ISP to hide it (which will cause nasty oscillation). */\n>> +\tdouble fastReduceThreshold = 0.4;\n>> +\tif (prevTotalExposureNoDg_ <\n>> +\t    prevTotalExposure_ * fastReduceThreshold)\n>> +\t\tprevTotalExposureNoDg_ = prevTotalExposure_ * fastReduceThreshold;\n>> +\tLOG(IPU3Agc, Debug) << \"After filtering, total_exposure \" << prevTotalExposure_;\n>> +}\n>> +\n>> +void IPU3Agc::lockExposureGain(uint32_t &exposure, uint32_t &gain)> +{\n>> +\tupdateControls_ = false;\n>> +\n>> +\t/* Algorithm initialization wait for first valid frames */\n> \n> Does this comment mean \"should wait for the first valid frames\" or\n> something else?\n> \n>> +\t/* \\todo - have a number of frames given by DelayedControls ?\n>> +\t * - implement a function for IIR */\n> \n> \n> Yes, I suspect a Filter class would be helpful/useful in other places.\n> But perhaps it might be on top/later unless it's easy to abstract.\n> \n> \n> \n>> +\tif ((frameCount_ == kInitialFrameMinAECount) || (frameCount_ - lastFrame_ >= kFrameSkipCount)) {\n> \n> If you invert this condition(s), and return early, the large code block\n> below can be pulled in one indentation level...\n> \n> \n> \n>> +\t\t/* Are we correctly exposed ? */\n>> +\t\tdouble newGain = kEvGainTarget * knumHistogramBins / iqMean_;\n> \n> newGain only seems to be used in the else case below, should it be\n> determined down there?\n> \n>> +\n>> +\t\tif (std::abs(iqMean_ - kEvGainTarget * knumHistogramBins) <= 1) {\n>> +\t\t\tLOG(IPU3Agc, Debug) << \"!!! Good exposure with iqMean = \" << iqMean_;\n>> +\t\t\tconverged_ = true;\n>> +\t\t} else {\n>> +\t\t\t/* extracted from Rpi::Agc::computeTargetExposure */\n>> +\t\t\tdouble currentShutter = exposure * kLineDuration;\n>> +\t\t\tcurrentTotalExposureNoDg_ = currentShutter * gain;\n>> +\t\t\tLOG(IPU3Agc, Debug) << \"Actual total exposure \" << currentTotalExposureNoDg_\n>> +\t\t\t\t\t    << \" Shutter speed \" << currentShutter\n>> +\t\t\t\t\t    << \" Gain \" << gain;\n>> +\t\t\tcurrentTotalExposure_ = currentTotalExposureNoDg_ * newGain;\n>> +\t\t\tdouble maxTotalExposure = kMaxExposureTime * kMaxGain;\n>> +\t\t\tcurrentTotalExposure_ = std::min(currentTotalExposure_, maxTotalExposure);\n>> +\t\t\tLOG(IPU3Agc, Debug) << \"Target total exposure \" << currentTotalExposure_;\n>> +\n>> +\t\t\t/* \\todo: estimate if we need to desaturate */\n>> +\t\t\tfilterExposure(false);\n>> +\n>> +\t\t\tdouble newExposure = 0.0;\n>> +\t\t\tif (currentShutter < kMaxExposureTime) {\n>> +\t\t\t\texposure = std::clamp(static_cast<uint32_t>(exposure * currentTotalExposure_ / currentTotalExposureNoDg_), kMinExposure, kMaxExposure);\n>> +\t\t\t\tnewExposure = currentTotalExposure_ / exposure;\n>> +\t\t\t\tgain = std::clamp(static_cast<uint32_t>(gain * currentTotalExposure_ / newExposure), kMinGain, kMaxGain);\n>> +\t\t\t\tupdateControls_ = true;\n>> +\t\t\t} else if (currentShutter >= kMaxExposureTime) {\n>> +\t\t\t\tgain = std::clamp(static_cast<uint32_t>(gain * currentTotalExposure_ / currentTotalExposureNoDg_), kMinGain, kMaxGain);\n>> +\t\t\t\tnewExposure = currentTotalExposure_ / gain;\n>> +\t\t\t\texposure = std::clamp(static_cast<uint32_t>(exposure * currentTotalExposure_ / newExposure), kMinExposure, kMaxExposure);\n>> +\t\t\t\tupdateControls_ = true;\n>> +\t\t\t}\n>> +\t\t\tLOG(IPU3Agc, Debug) << \"Adjust exposure \" << exposure * kLineDuration << \" and gain \" << gain;\n>> +\t\t}\n>> +\t\tlastFrame_ = frameCount_;\n>> +\t} else {\n>> +\t\tupdateControls_ = false;\n> \n> This was already set at the entry to the function.\n> \n>> +\t}\n>> +}\n>> +\n>> +void IPU3Agc::process(const ipu3_uapi_stats_3a *stats, uint32_t &exposure, uint32_t &gain)\n>> +{\n>> +\tprocessBrightness(stats);\n>> +\tlockExposureGain(exposure, gain);\n>> +\tframeCount_++;\n> \n> do we need to keep a frameCount?\n> I thought the IPA's were given the frame number ...\n\nYes, in IPAIPU3, not in the algorithms yet...\n\n> \n>> +}\n>> +\n>> +} /* namespace ipa */\n>> +\n>> +} /* namespace libcamera */\n>> diff --git a/src/ipa/ipu3/ipu3_agc.h b/src/ipa/ipu3/ipu3_agc.h\n>> new file mode 100644\n>> index 00000000..d4657a81\n>> --- /dev/null\n>> +++ b/src/ipa/ipu3/ipu3_agc.h\n>> @@ -0,0 +1,67 @@\n>> +/* SPDX-License-Identifier: LGPL-2.1-or-later */\n>> +/*\n>> + * Copyright (C) 2021, Ideas On Board\n>> + *\n>> + * ipu3_agc.h - IPU3 AGC/AEC control algorithm\n>> + */\n>> +#ifndef __LIBCAMERA_IPU3_AGC_H__\n>> +#define __LIBCAMERA_IPU3_AGC_H__\n>> +\n>> +#include <unordered_map>\n>> +#include <vector>\n>> +\n>> +#include <linux/intel-ipu3.h>\n>> +\n>> +#include <libcamera/geometry.h>\n>> +\n>> +#include \"libipa/algorithm.h\"\n>> +\n>> +namespace libcamera {\n>> +\n>> +namespace ipa {\n>> +\n>> +class IPU3Agc : public Algorithm\n>> +{\n>> +public:\n>> +\tIPU3Agc();\n>> +\t~IPU3Agc();\n>> +\n>> +\tvoid initialise(struct ipu3_uapi_grid_config &bdsGrid);\n>> +\tvoid process(const ipu3_uapi_stats_3a *stats, uint32_t &exposure, uint32_t &gain);\n>> +\tbool converged() { return converged_; }\n>> +\tbool updateControls() { return updateControls_; }\n>> +\t/* \\todo Use a metadata exchange between IPAs */\n>> +\tdouble gamma() { return gamma_; }\n> \n> Have you looked at how RPi exchange metadata between algorithms along\n> the pipeline?\n> \n> (src/ipa/raspberrypi/controller/metadata.hpp)\n\nYes, but I don't think Laurent is happy with that exact method ?\nMaybe could it be a first step to have it in libipa too, but would it\nstay ? I am not fixed yet...\n\n> \n>> +\n>> +private:\n>> +\tvoid processBrightness(const ipu3_uapi_stats_3a *stats);\n>> +\tvoid filterExposure(bool desaturate);\n>> +\tvoid lockExposureGain(uint32_t &exposure, uint32_t &gain);\n>> +\n>> +\tstruct ipu3_uapi_grid_config aeGrid_;\n>> +\n>> +\tuint64_t frameCount_;\n>> +\tuint64_t lastFrame_;\n>> +\n>> +\t/* Vector of calculated brightness for each cell */\n>> +\tstd::vector<uint32_t> cellsBrightness_;\n>> +\n>> +\tbool converged_;\n>> +\tbool updateControls_;\n>> +\n>> +\tdouble iqMean_;\n>> +\tdouble gamma_;\n>> +\tuint32_t histLow_;\n>> +\tuint32_t histHigh_;\n>> +\n>> +\tdouble prevTotalExposure_;\n>> +\tdouble prevTotalExposureNoDg_;\n>> +\tdouble currentTotalExposure_;\n>> +\tdouble currentTotalExposureNoDg_;\n>> +};\n>> +\n>> +} /* namespace ipa */\n>> +\n>> +} /* namespace libcamera */\n>> +\n>> +#endif /* __LIBCAMERA_IPU3_AGC_H__ */\n>> diff --git a/src/ipa/ipu3/meson.build b/src/ipa/ipu3/meson.build\n>> index 1040698e..adeae28b 100644\n>> --- a/src/ipa/ipu3/meson.build\n>> +++ b/src/ipa/ipu3/meson.build\n>> @@ -5,6 +5,7 @@ ipa_name = 'ipa_ipu3'\n>>  ipu3_ipa_sources = files([\n>>      'ipu3.cpp',\n>>      'ipu3_awb.cpp',\n>> +    'ipu3_agc.cpp',\n>>  ])\n>>  \n>>  mod = shared_module(ipa_name,\n>>\n>","headers":{"Return-Path":"<libcamera-devel-bounces@lists.libcamera.org>","X-Original-To":"parsemail@patchwork.libcamera.org","Delivered-To":"parsemail@patchwork.libcamera.org","Received":["from lancelot.ideasonboard.com (lancelot.ideasonboard.com\n\t[92.243.16.209])\n\tby patchwork.libcamera.org (Postfix) with ESMTPS id 02A19BD233\n\tfor <parsemail@patchwork.libcamera.org>;\n\tFri, 16 Apr 2021 07:42:03 +0000 (UTC)","from lancelot.ideasonboard.com (localhost [IPv6:::1])\n\tby lancelot.ideasonboard.com (Postfix) with ESMTP id 488606880C;\n\tFri, 16 Apr 2021 09:42:02 +0200 (CEST)","from perceval.ideasonboard.com (perceval.ideasonboard.com\n\t[213.167.242.64])\n\tby lancelot.ideasonboard.com (Postfix) with ESMTPS id C0991605AE\n\tfor <libcamera-devel@lists.libcamera.org>;\n\tFri, 16 Apr 2021 09:42:00 +0200 (CEST)","from [IPv6:2a01:e0a:169:7140:5b63:445c:7960:347a] (unknown\n\t[IPv6:2a01:e0a:169:7140:5b63:445c:7960:347a])\n\tby perceval.ideasonboard.com (Postfix) with ESMTPSA id 3FB4F5A5;\n\tFri, 16 Apr 2021 09:42:00 +0200 (CEST)"],"Authentication-Results":"lancelot.ideasonboard.com;\n\tdkim=fail reason=\"signature verification failed\" (1024-bit key;\n\tunprotected) header.d=ideasonboard.com header.i=@ideasonboard.com\n\theader.b=\"tiwFRfXH\"; dkim-atps=neutral","DKIM-Signature":"v=1; a=rsa-sha256; c=relaxed/simple; d=ideasonboard.com;\n\ts=mail; t=1618558920;\n\tbh=9nER7t66faOhd9bQrvBy5G1361zyJI/yIrzx8cUTsAo=;\n\th=Subject:To:References:From:Date:In-Reply-To:From;\n\tb=tiwFRfXHCIrELJ+Cj1trt3/Oz7SSkBggZFClAdOMW7DPM4wWDD66FPKYiHheTC9Fd\n\tKCov4hLEZCyKJkljZl+or4mEqotqPIgSX3jWEGtcepL806Zs5NoCiDLnfFFumwdAoh\n\trlApzTZbifxQfVRmh+LeNM2B3y3RPleTUZECJcME=","To":"kieran.bingham@ideasonboard.com,\n\tJean-Michel Hautbois <jeanmichel.hautbois@ideasonboard.com>,\n\tlibcamera-devel@lists.libcamera.org","References":"<20210330211210.194806-1-jeanmichel.hautbois@ideasonboard.com>\n\t<20210330211210.194806-5-jeanmichel.hautbois@ideasonboard.com>\n\t<cf9265a7-56a4-0771-2600-de9befff4736@ideasonboard.com>","From":"Jean-Michel Hautbois <jeanmichel.hautbois@ideasonboard.com>","Message-ID":"<e407d860-6000-7233-97b2-ecad91e0e699@ideasonboard.com>","Date":"Fri, 16 Apr 2021 09:41:59 +0200","User-Agent":"Mozilla/5.0 (X11; Linux x86_64; rv:78.0) Gecko/20100101\n\tThunderbird/78.7.1","MIME-Version":"1.0","In-Reply-To":"<cf9265a7-56a4-0771-2600-de9befff4736@ideasonboard.com>","Content-Language":"en-US","Subject":"Re: [libcamera-devel] [PATCH v4 4/4] ipa: ipu3: Add support for\n\tIPU3 AEC/AGC algorithm","X-BeenThere":"libcamera-devel@lists.libcamera.org","X-Mailman-Version":"2.1.29","Precedence":"list","List-Id":"<libcamera-devel.lists.libcamera.org>","List-Unsubscribe":"<https://lists.libcamera.org/options/libcamera-devel>,\n\t<mailto:libcamera-devel-request@lists.libcamera.org?subject=unsubscribe>","List-Archive":"<https://lists.libcamera.org/pipermail/libcamera-devel/>","List-Post":"<mailto:libcamera-devel@lists.libcamera.org>","List-Help":"<mailto:libcamera-devel-request@lists.libcamera.org?subject=help>","List-Subscribe":"<https://lists.libcamera.org/listinfo/libcamera-devel>,\n\t<mailto:libcamera-devel-request@lists.libcamera.org?subject=subscribe>","Content-Type":"text/plain; charset=\"us-ascii\"","Content-Transfer-Encoding":"7bit","Errors-To":"libcamera-devel-bounces@lists.libcamera.org","Sender":"\"libcamera-devel\" <libcamera-devel-bounces@lists.libcamera.org>"}}]