{"id":26385,"url":"https://patchwork.libcamera.org/api/1.1/patches/26385/?format=json","web_url":"https://patchwork.libcamera.org/patch/26385/","project":{"id":1,"url":"https://patchwork.libcamera.org/api/1.1/projects/1/?format=json","name":"libcamera","link_name":"libcamera","list_id":"libcamera_core","list_email":"libcamera-devel@lists.libcamera.org","web_url":"","scm_url":"","webscm_url":""},"msgid":"<20260330084355.875580-1-naush@raspberrypi.com>","date":"2026-03-30T08:43:39","name":"utils: raspberrypi: Remove Raspberry Pi CTT from the source tree","commit_ref":"585c5c7a49849523e3c094fb2311c479430d240e","pull_url":null,"state":"accepted","archived":false,"hash":"8d1c5d5c0614a70f312ae7cc160f11fa1f20bab5","submitter":{"id":34,"url":"https://patchwork.libcamera.org/api/1.1/people/34/?format=json","name":"Naushir Patuck","email":"naush@raspberrypi.com"},"delegate":null,"mbox":"https://patchwork.libcamera.org/patch/26385/mbox/","series":[{"id":5857,"url":"https://patchwork.libcamera.org/api/1.1/series/5857/?format=json","web_url":"https://patchwork.libcamera.org/project/libcamera/list/?series=5857","date":"2026-03-30T08:43:39","name":"utils: raspberrypi: Remove Raspberry Pi CTT from the source tree","version":1,"mbox":"https://patchwork.libcamera.org/series/5857/mbox/"}],"comments":"https://patchwork.libcamera.org/api/patches/26385/comments/","check":"pending","checks":"https://patchwork.libcamera.org/api/patches/26385/checks/","tags":{},"headers":{"Return-Path":"<libcamera-devel-bounces@lists.libcamera.org>","X-Original-To":"parsemail@patchwork.libcamera.org","Delivered-To":"parsemail@patchwork.libcamera.org","Received":["from lancelot.ideasonboard.com (lancelot.ideasonboard.com\n\t[92.243.16.209])\n\tby patchwork.libcamera.org (Postfix) with ESMTPS id 7D461BE086\n\tfor <parsemail@patchwork.libcamera.org>;\n\tMon, 30 Mar 2026 10:24:10 +0000 (UTC)","from lancelot.ideasonboard.com (localhost [IPv6:::1])\n\tby lancelot.ideasonboard.com (Postfix) with ESMTP id A06A362CF2;\n\tMon, 30 Mar 2026 12:24:09 +0200 (CEST)","from mail-wm1-x336.google.com (mail-wm1-x336.google.com\n\t[IPv6:2a00:1450:4864:20::336])\n\tby lancelot.ideasonboard.com (Postfix) with ESMTPS id 2800762CC7\n\tfor <libcamera-devel@lists.libcamera.org>;\n\tMon, 30 Mar 2026 10:44:03 +0200 (CEST)","by mail-wm1-x336.google.com with SMTP id\n\t5b1f17b1804b1-4853a5ffc05so9073075e9.0\n\tfor <libcamera-devel@lists.libcamera.org>;\n\tMon, 30 Mar 2026 01:44:03 -0700 (PDT)","from naush-dell.pitowers.org\n\t([2a00:1098:3142:1f:229d:ae85:1244:c909])\n\tby smtp.gmail.com with ESMTPSA id\n\t5b1f17b1804b1-48725d2abb8sm82546905e9.0.2026.03.30.01.43.58\n\t(version=TLS1_3 cipher=TLS_AES_256_GCM_SHA384 bits=256/256);\n\tMon, 30 Mar 2026 01:43:58 -0700 (PDT)"],"Authentication-Results":"lancelot.ideasonboard.com; dkim=pass (2048-bit key;\n\tunprotected) header.d=raspberrypi.com header.i=@raspberrypi.com\n\theader.b=\"Q05x+9Uy\"; dkim-atps=neutral","DKIM-Signature":"v=1; a=rsa-sha256; c=relaxed/relaxed;\n\td=raspberrypi.com; s=google; t=1774860242; x=1775465042;\n\tdarn=lists.libcamera.org; \n\th=content-transfer-encoding:mime-version:message-id:date:subject:cc\n\t:to:from:from:to:cc:subject:date:message-id:reply-to;\n\tbh=pu0uZueSAV21ah7G6BStXj59+4O/92xU5pOz4pfFnXo=;\n\tb=Q05x+9UynesUD9VFz1exrSJzYkzNkIvFaxYLeElKfXfAy9stfxrx+XHbJpe/TiwzQ4\n\tYt3245qW8NtbNmEMxpmlzSDZrG+GCsjYqdLKGJCDcKzRoFWdiMoYhtvlmf9fUMNeTW1r\n\t93wnV73Sl9KFA95oCS8sqzE4FPUVME5M8D6GFJMDbEfhsiyvYHDG+fUypjjzw+CqlWlK\n\taEz6wfboURcl/U69Yoz4CAfdociEh6+X/EqXFFJ+9OAca+/rIH240mWI8spzWMoqZ7NB\n\tjfr7t/NmBoqpTvfJQV9VKhdFJJJY7XJBftXOh1aQZzLfBkVwGXitScY0BO44OGLbxP0l\n\tNIfA==","X-Google-DKIM-Signature":"v=1; a=rsa-sha256; c=relaxed/relaxed;\n\td=1e100.net; s=20251104; t=1774860242; x=1775465042;\n\th=content-transfer-encoding:mime-version:message-id:date:subject:cc\n\t:to:from:x-gm-gg:x-gm-message-state:from:to:cc:subject:date\n\t:message-id:reply-to;\n\tbh=pu0uZueSAV21ah7G6BStXj59+4O/92xU5pOz4pfFnXo=;\n\tb=jsGtttj9X5TSSGv+iKt6OCkm60FPoBoZUW208stBCAbY/PSTAPjpJrhO4vt9nkUExG\n\txVyB8iB1WJACIrqVAT1/9mzqDaCFvvGZsAdqHKcvAzGnqZDJdt+Lv/mQWQiU4bZx24az\n\tdfbA1c6wTPJw7Ep8DaLUmJGTk2Wi3XGrO6XNx6jeccOcxRtfa8MQH5cXXqUqi86R2WU9\n\tNfRiikHpGr7mEP57vGNC9v4JsoUR/HmGXfR+tIIvaEty0FsmZ8qHN9DPQManim2LzMtK\n\tlznINwGAhH8JT3X0ywMiaFra6/tcS5+Dz6L+hjgmBfpWCKfdr2CUTErT76bvjZUkwW4L\n\tZauA==","X-Gm-Message-State":"AOJu0YyFHX21no1ShP9m8rd8s2ZTC5gnBLf5+OuvxwXt+ezQquqgKcHP\n\tZ2E+AYPdRphZHeWxRvQFnErOrHjjClyk+KDV3W8LSksrTXPYC9/RXLNgbAKZI2ZdDc+JIHQFUTN\n\tlXFcv","X-Gm-Gg":"ATEYQzwxapix9bSDaLEww659hrBl9kf6Y31wjj6F8pHaAibYED63eweZxSqYn9FeCIs\n\tMmSuxIMax/7f9uwmkXXJ+RBkZBvJarha9k06dn02NAp5v1rXbMsSxsVgjwMm1WSKDPeEzKIRHOR\n\tvF6DeE65Y/fFSjwyK1djKScye4KquYOCqQqbrb53On+5gf9RI1iXYAnJzv0AH4+K7a7FHTi8tJM\n\tmOUXec4a8oSnX16rnejJT2kpxNGScWYBQgs3VLXc10yFl80mPdGLeIdwE6EnNADoQJePWpoVq58\n\t1CmxE4xnt+bM/pnD/XYFJ5dQGYTWJ1qkuL085DLyosOwYSRT9E3LkerIz6CobgqoWjKm83a7hHu\n\tYBMNS0hqx0mRnCXQbVNQiKaaEELIuIWrkY68TnKSEs3peobRO6vv33Jzqd+V7K1W66QSxVVRtvB\n\t5zNBHAjoKsId3/yytZQrKYI03PFLLHe7TWWxJRMF+IZtjQsEV9aPjj9QrX7IuJESyosceftjz0v\n\tlq+BkJotzQSryXt8Nrm5xUJY4nmu1sp","X-Received":"by 2002:a05:600c:4f91:b0:485:3fc3:e8e9 with SMTP id\n\t5b1f17b1804b1-48727ede097mr94542375e9.3.1774860239717; \n\tMon, 30 Mar 2026 01:43:59 -0700 (PDT)","From":"Naushir Patuck <naush@raspberrypi.com>","To":"libcamera-devel@lists.libcamera.org","Cc":"Naushir Patuck <naush@raspberrypi.com>","Subject":"[PATCH] utils: raspberrypi: Remove Raspberry Pi CTT from the source\n\ttree","Date":"Mon, 30 Mar 2026 09:43:39 +0100","Message-ID":"<20260330084355.875580-1-naush@raspberrypi.com>","X-Mailer":"git-send-email 2.51.0","MIME-Version":"1.0","Content-Type":"text/plain; charset=UTF-8","Content-Transfer-Encoding":"quoted-printable","X-Mailman-Approved-At":"Mon, 30 Mar 2026 12:24:07 +0200","X-BeenThere":"libcamera-devel@lists.libcamera.org","X-Mailman-Version":"2.1.29","Precedence":"list","List-Id":"<libcamera-devel.lists.libcamera.org>","List-Unsubscribe":"<https://lists.libcamera.org/options/libcamera-devel>,\n\t<mailto:libcamera-devel-request@lists.libcamera.org?subject=unsubscribe>","List-Archive":"<https://lists.libcamera.org/pipermail/libcamera-devel/>","List-Post":"<mailto:libcamera-devel@lists.libcamera.org>","List-Help":"<mailto:libcamera-devel-request@lists.libcamera.org?subject=help>","List-Subscribe":"<https://lists.libcamera.org/listinfo/libcamera-devel>,\n\t<mailto:libcamera-devel-request@lists.libcamera.org?subject=subscribe>","Errors-To":"libcamera-devel-bounces@lists.libcamera.org","Sender":"\"libcamera-devel\" <libcamera-devel-bounces@lists.libcamera.org>"},"content":"This commit removes the Raspberry Pi CTT from the libcamera source tree.\nThis change is introduced to help a number of RPi users who are not so\nfaimilar with git and cloing the libcamera tree to run the CTT. The\nlibrary is also modularised in python for our users to incorporate into\ntheir own \"tuning\" applications if needed. Licensing for our CTT tool\nremains the same.\n\nThe Raspberry Pi CTT now lives at the following repo:\nhttps://github.com/raspberrypi/ctt\n\nand a package is avilable on pypi to install:\nhttps://pypi.org/project/rpi-ctt/\n\nThis commit also removes the delayedctrls_parse.py script that has long\nsince code rotted.\n\nSigned-off-by: Naushir Patuck <naush@raspberrypi.com>\n---\n utils/raspberrypi/ctt/alsc_only.py            |  42 -\n utils/raspberrypi/ctt/cac_only.py             | 142 ---\n utils/raspberrypi/ctt/colors.py               |  30 -\n utils/raspberrypi/ctt/convert_tuning.py       | 120 ---\n utils/raspberrypi/ctt/ctt.py                  | 806 -----------------\n utils/raspberrypi/ctt/ctt_alsc.py             | 309 -------\n utils/raspberrypi/ctt/ctt_awb.py              | 377 --------\n utils/raspberrypi/ctt/ctt_cac.py              | 250 ------\n utils/raspberrypi/ctt/ctt_ccm.py              | 404 ---------\n utils/raspberrypi/ctt/ctt_config_example.json |  17 -\n utils/raspberrypi/ctt/ctt_dots_locator.py     | 118 ---\n utils/raspberrypi/ctt/ctt_geq.py              | 181 ----\n utils/raspberrypi/ctt/ctt_image_load.py       | 455 ----------\n utils/raspberrypi/ctt/ctt_lux.py              |  61 --\n utils/raspberrypi/ctt/ctt_macbeth_locator.py  | 757 ----------------\n utils/raspberrypi/ctt/ctt_noise.py            | 123 ---\n utils/raspberrypi/ctt/ctt_pisp.py             | 823 ------------------\n .../raspberrypi/ctt/ctt_pretty_print_json.py  | 130 ---\n utils/raspberrypi/ctt/ctt_ransac.py           |  71 --\n utils/raspberrypi/ctt/ctt_ref.pgm             |   5 -\n utils/raspberrypi/ctt/ctt_tools.py            | 150 ----\n utils/raspberrypi/ctt/ctt_vc4.py              | 133 ---\n utils/raspberrypi/ctt/ctt_visualise.py        |  43 -\n utils/raspberrypi/delayedctrls_parse.py       | 113 ---\n 24 files changed, 5660 deletions(-)\n delete mode 100755 utils/raspberrypi/ctt/alsc_only.py\n delete mode 100644 utils/raspberrypi/ctt/cac_only.py\n delete mode 100644 utils/raspberrypi/ctt/colors.py\n delete mode 100755 utils/raspberrypi/ctt/convert_tuning.py\n delete mode 100755 utils/raspberrypi/ctt/ctt.py\n delete mode 100644 utils/raspberrypi/ctt/ctt_alsc.py\n delete mode 100644 utils/raspberrypi/ctt/ctt_awb.py\n delete mode 100644 utils/raspberrypi/ctt/ctt_cac.py\n delete mode 100644 utils/raspberrypi/ctt/ctt_ccm.py\n delete mode 100644 utils/raspberrypi/ctt/ctt_config_example.json\n delete mode 100644 utils/raspberrypi/ctt/ctt_dots_locator.py\n delete mode 100644 utils/raspberrypi/ctt/ctt_geq.py\n delete mode 100644 utils/raspberrypi/ctt/ctt_image_load.py\n delete mode 100644 utils/raspberrypi/ctt/ctt_lux.py\n delete mode 100644 utils/raspberrypi/ctt/ctt_macbeth_locator.py\n delete mode 100644 utils/raspberrypi/ctt/ctt_noise.py\n delete mode 100755 utils/raspberrypi/ctt/ctt_pisp.py\n delete mode 100755 utils/raspberrypi/ctt/ctt_pretty_print_json.py\n delete mode 100644 utils/raspberrypi/ctt/ctt_ransac.py\n delete mode 100644 utils/raspberrypi/ctt/ctt_ref.pgm\n delete mode 100644 utils/raspberrypi/ctt/ctt_tools.py\n delete mode 100755 utils/raspberrypi/ctt/ctt_vc4.py\n delete mode 100644 utils/raspberrypi/ctt/ctt_visualise.py\n delete mode 100644 utils/raspberrypi/delayedctrls_parse.py","diff":"diff --git a/utils/raspberrypi/ctt/alsc_only.py b/utils/raspberrypi/ctt/alsc_only.py\ndeleted file mode 100755\nindex a521c4ad1d47..000000000000\n--- a/utils/raspberrypi/ctt/alsc_only.py\n+++ /dev/null\n@@ -1,42 +0,0 @@\n-#!/usr/bin/env python3\n-#\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2022, Raspberry Pi Ltd\n-#\n-# alsc tuning tool\n-\n-import sys\n-\n-from ctt import *\n-from ctt_tools import parse_input\n-\n-if __name__ == '__main__':\n-    \"\"\"\n-    initialise calibration\n-    \"\"\"\n-    if len(sys.argv) == 1:\n-        print(\"\"\"\n-    PiSP Lens Shading Camera Tuning Tool version 1.0\n-\n-    Required Arguments:\n-    '-i' : Calibration image directory.\n-    '-o' : Name of output json file.\n-\n-    Optional Arguments:\n-    '-t' : Target platform - 'pisp' or 'vc4'. Default 'vc4'\n-    '-c' : Config file for the CTT. If not passed, default parameters used.\n-    '-l' : Name of output log file. If not passed, 'ctt_log.txt' used.\n-              \"\"\")\n-        quit(0)\n-    else:\n-        \"\"\"\n-        parse input arguments\n-        \"\"\"\n-        json_output, directory, config, log_output, target = parse_input()\n-        if target == 'pisp':\n-            from ctt_pisp import json_template, grid_size\n-        elif target == 'vc4':\n-            from ctt_vc4 import json_template, grid_size\n-\n-        run_ctt(json_output, directory, config, log_output, json_template, grid_size, target, alsc_only=True)\ndiff --git a/utils/raspberrypi/ctt/cac_only.py b/utils/raspberrypi/ctt/cac_only.py\ndeleted file mode 100644\nindex 1c0a819399b9..000000000000\n--- a/utils/raspberrypi/ctt/cac_only.py\n+++ /dev/null\n@@ -1,142 +0,0 @@\n-#!/usr/bin/env python3\n-#\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2023, Raspberry Pi (Trading) Ltd.\n-#\n-# cac_only.py - cac tuning tool\n-\n-\n-# This file allows you to tune only the chromatic aberration correction\n-# Specify any number of files in the command line args, and it shall iterate through\n-# and generate an averaged cac table from all the input images, which you can then\n-# input into your tuning file.\n-\n-# Takes .dng files produced by the camera modules of the dots grid and calculates the chromatic abberation of each dot.\n-# Then takes each dot, and works out where it was in the image, and uses that to output a tables of the shifts\n-# across the whole image.\n-\n-from PIL import Image\n-import numpy as np\n-import rawpy\n-import sys\n-import getopt\n-\n-from ctt_cac import *\n-\n-\n-def cac(filelist, output_filepath, plot_results=False):\n-    np.set_printoptions(precision=3)\n-    np.set_printoptions(suppress=True)\n-\n-    # Create arrays to hold all the dots data and their colour offsets\n-    red_shift = []  # Format is: [[Dot Center X, Dot Center Y, x shift, y shift]]\n-    blue_shift = []\n-    # Iterate through the files\n-    # Multiple files is reccomended to average out the lens aberration through rotations\n-    for file in filelist:\n-        print(\"\\n Processing file \" + str(file))\n-        # Read the raw RGB values from the .dng file\n-        with rawpy.imread(file) as raw:\n-            rgb = raw.postprocess()\n-            sizes = (raw.sizes)\n-\n-        image_size = [sizes[2], sizes[3]]  # Image size, X, Y\n-        # Create a colour copy of the RGB values to use later in the calibration\n-        imout = Image.new(mode=\"RGB\", size=image_size)\n-        rgb_image = np.array(imout)\n-        # The rgb values need reshaping from a 1d array to a 3d array to be worked with easily\n-        rgb.reshape((image_size[0], image_size[1], 3))\n-        rgb_image = rgb\n-\n-        # Pass the RGB image through to the dots locating program\n-        # Returns an array of the dots (colour rectangles around the dots), and an array of their locations\n-        print(\"Finding dots\")\n-        dots, dots_locations = find_dots_locations(rgb_image)\n-\n-        # Now, analyse each dot. Work out the centroid of each colour channel, and use that to work out\n-        # by how far the chromatic aberration has shifted each channel\n-        print('Dots found: ' + str(len(dots)))\n-\n-        for dot, dot_location in zip(dots, dots_locations):\n-            if len(dot) > 0:\n-                if (dot_location[0] > 0) and (dot_location[1] > 0):\n-                    ret = analyse_dot(dot, dot_location)\n-                    red_shift.append(ret[0])\n-                    blue_shift.append(ret[1])\n-\n-    # Take our arrays of red shifts and locations, push them through to be interpolated into a 9x9 matrix\n-    # for the CAC block to handle and then store these as a .json file to be added to the camera\n-    # tuning file\n-    print(\"\\nCreating output grid\")\n-    rx, ry, bx, by = shifts_to_yaml(red_shift, blue_shift, image_size)\n-\n-    print(\"CAC correction complete!\")\n-\n-    # The json format that we then paste into the tuning file (manually)\n-    sample = '''\n-    {\n-        \"rpi.cac\" :\n-        {\n-            \"strength\": 1.0,\n-            \"lut_rx\" : [\n-                   rx_vals\n-            ],\n-            \"lut_ry\" : [\n-                   ry_vals\n-            ],\n-            \"lut_bx\" : [\n-                   bx_vals\n-            ],\n-            \"lut_by\" : [\n-                   by_vals\n-            ]\n-        }\n-    }\n-    '''\n-\n-    # Below, may look incorrect, however, the PiSP (standard) dimensions are flipped in comparison to\n-    # PIL image coordinate directions, hence why xr -> yr. Also, the shifts calculated are colour shifts,\n-    # and the PiSP block asks for the values it should shift (hence the * -1, to convert from colour shift to a pixel shift)\n-    sample = sample.replace(\"rx_vals\", pprint_array(ry * -1))\n-    sample = sample.replace(\"ry_vals\", pprint_array(rx * -1))\n-    sample = sample.replace(\"bx_vals\", pprint_array(by * -1))\n-    sample = sample.replace(\"by_vals\", pprint_array(bx * -1))\n-    print(\"Successfully converted to JSON\")\n-    f = open(str(output_filepath), \"w+\")\n-    f.write(sample)\n-    f.close()\n-    print(\"Successfully written to json file\")\n-    '''\n-    If you wish to see a plot of the colour channel shifts, add the -p or --plots option\n-    Can be a quick way of validating if the data/dots you've got are good, or if you need to\n-    change some parameters/take some better images\n-    '''\n-    if plot_results:\n-        plot_shifts(red_shift, blue_shift)\n-\n-\n-if __name__ == \"__main__\":\n-    argv = sys.argv\n-    # Detect the input and output file paths\n-    arg_output = \"output.json\"\n-    arg_help = \"{0} -i <input> -o <output> -p <plot results>\".format(argv[0])\n-    opts, args = getopt.getopt(argv[1:], \"hi:o:p\", [\"help\", \"input=\", \"output=\", \"plot\"])\n-\n-    output_location = 0\n-    input_location = 0\n-    filelist = []\n-    plot_results = False\n-    for i in range(len(argv)):\n-        if (\"-h\") in argv[i]:\n-            print(arg_help)  # print the help message\n-            sys.exit(2)\n-        if \"-o\" in argv[i]:\n-            output_location = i\n-        if \".dng\" in argv[i]:\n-            filelist.append(argv[i])\n-        if \"-p\" in argv[i]:\n-            plot_results = True\n-\n-    arg_output = argv[output_location + 1]\n-    cac(filelist, arg_output, plot_results)\ndiff --git a/utils/raspberrypi/ctt/colors.py b/utils/raspberrypi/ctt/colors.py\ndeleted file mode 100644\nindex cb4d236b04d7..000000000000\n--- a/utils/raspberrypi/ctt/colors.py\n+++ /dev/null\n@@ -1,30 +0,0 @@\n-# Program to convert from RGB to LAB color space\n-def RGB_to_LAB(RGB):  # where RGB is a 1x3 array.   e.g RGB = [100, 255, 230]\n-    num = 0\n-    XYZ = [0, 0, 0]\n-    # converted all the three R, G, B to X, Y, Z\n-    X = RGB[0] * 0.4124 + RGB[1] * 0.3576 + RGB[2] * 0.1805\n-    Y = RGB[0] * 0.2126 + RGB[1] * 0.7152 + RGB[2] * 0.0722\n-    Z = RGB[0] * 0.0193 + RGB[1] * 0.1192 + RGB[2] * 0.9505\n-\n-    XYZ[0] = X / 255 * 100\n-    XYZ[1] = Y / 255 * 100  # XYZ Must be in range 0 -> 100, so scale down from 255\n-    XYZ[2] = Z / 255 * 100\n-    XYZ[0] = XYZ[0] / 95.047  # ref_X =  95.047   Observer= 2°, Illuminant= D65\n-    XYZ[1] = XYZ[1] / 100.0  # ref_Y = 100.000\n-    XYZ[2] = XYZ[2] / 108.883  # ref_Z = 108.883\n-    num = 0\n-    for value in XYZ:\n-        if value > 0.008856:\n-            value = value ** (0.3333333333333333)\n-        else:\n-            value = (7.787 * value) + (16 / 116)\n-        XYZ[num] = value\n-        num = num + 1\n-\n-    # L, A, B, values calculated below\n-    L = (116 * XYZ[1]) - 16\n-    a = 500 * (XYZ[0] - XYZ[1])\n-    b = 200 * (XYZ[1] - XYZ[2])\n-\n-    return [L, a, b]\ndiff --git a/utils/raspberrypi/ctt/convert_tuning.py b/utils/raspberrypi/ctt/convert_tuning.py\ndeleted file mode 100755\nindex 83cf69d40ba3..000000000000\n--- a/utils/raspberrypi/ctt/convert_tuning.py\n+++ /dev/null\n@@ -1,120 +0,0 @@\n-#!/usr/bin/env python3\n-#\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Script to convert version 1.0 Raspberry Pi camera tuning files to version 2.0.\n-#\n-# Copyright 2022 Raspberry Pi Ltd\n-\n-import argparse\n-import json\n-import numpy as np\n-import sys\n-\n-from ctt_pretty_print_json import pretty_print\n-from ctt_pisp import grid_size as grid_size_pisp\n-from ctt_pisp import json_template as json_template_pisp\n-from ctt_vc4 import grid_size as grid_size_vc4\n-from ctt_vc4 import json_template as json_template_vc4\n-\n-\n-def interp_2d(in_ls, src_w, src_h, dst_w, dst_h):\n-\n-    out_ls = np.zeros((dst_h, dst_w))\n-    for i in range(src_h):\n-        out_ls[i] = np.interp(np.linspace(0, dst_w - 1, dst_w),\n-                              np.linspace(0, dst_w - 1, src_w),\n-                              in_ls[i])\n-    for i in range(dst_w):\n-        out_ls[:,i] = np.interp(np.linspace(0, dst_h - 1, dst_h),\n-                                np.linspace(0, dst_h - 1, src_h),\n-                                out_ls[:src_h, i])\n-    return out_ls\n-\n-\n-def convert_target(in_json: dict, target: str):\n-\n-    src_w, src_h = grid_size_pisp if target == 'vc4' else grid_size_vc4\n-    dst_w, dst_h = grid_size_vc4 if target == 'vc4' else grid_size_pisp\n-    json_template = json_template_vc4 if target == 'vc4' else json_template_pisp\n-\n-    # ALSC grid sizes\n-    alsc = next(algo for algo in in_json['algorithms'] if 'rpi.alsc' in algo)['rpi.alsc']\n-    for colour in ['calibrations_Cr', 'calibrations_Cb']:\n-        if colour not in alsc:\n-            continue\n-        for temperature in alsc[colour]:\n-            in_ls = np.reshape(temperature['table'], (src_h, src_w))\n-            out_ls = interp_2d(in_ls, src_w, src_h, dst_w, dst_h)\n-            temperature['table'] = np.round(out_ls.flatten(), 3).tolist()\n-\n-    if 'luminance_lut' in alsc:\n-        in_ls = np.reshape(alsc['luminance_lut'], (src_h, src_w))\n-        out_ls = interp_2d(in_ls, src_w, src_h, dst_w, dst_h)\n-        alsc['luminance_lut'] = np.round(out_ls.flatten(), 3).tolist()\n-\n-    # Denoise blocks\n-    for i, algo in enumerate(in_json['algorithms']):\n-        if list(algo.keys())[0] == 'rpi.sdn':\n-            in_json['algorithms'][i] = {'rpi.denoise': json_template['rpi.sdn'] if target == 'vc4' else json_template['rpi.denoise']}\n-            break\n-\n-    # AGC mode weights\n-    agc = next(algo for algo in in_json['algorithms'] if 'rpi.agc' in algo)['rpi.agc']\n-    if 'channels' in agc:\n-        for i, channel in enumerate(agc['channels']):\n-            target_agc_metering = json_template['rpi.agc']['channels'][i]['metering_modes']\n-            for mode, v in channel['metering_modes'].items():\n-                v['weights'] = target_agc_metering[mode]['weights']\n-    else:\n-        for mode, v in agc[\"metering_modes\"].items():\n-            target_agc_metering = json_template['rpi.agc']['channels'][0]['metering_modes']\n-            v['weights'] = target_agc_metering[mode]['weights']\n-\n-    # HDR\n-    if target == 'pisp':\n-        for i, algo in enumerate(in_json['algorithms']):\n-            if list(algo.keys())[0] == 'rpi.hdr':\n-                in_json['algorithms'][i] = {'rpi.hdr': json_template['rpi.hdr']}\n-\n-    return in_json\n-\n-\n-def convert_v2(in_json: dict, target: str) -> str:\n-\n-    if 'version' in in_json.keys() and in_json['version'] == 1.0:\n-        converted = {\n-            'version': 2.0,\n-            'target': target,\n-            'algorithms': [{algo: config} for algo, config in in_json.items()]\n-        }\n-    else:\n-        converted = in_json\n-\n-    # Convert between vc4 <-> pisp targets. This is a best effort thing.\n-    if converted['target'] != target:\n-        converted = convert_target(converted, target)\n-        converted['target'] = target\n-\n-    grid_size = grid_size_vc4[0] if target == 'vc4' else grid_size_pisp[0]\n-    return pretty_print(converted, custom_elems={'table': grid_size, 'luminance_lut': grid_size})\n-\n-\n-if __name__ == \"__main__\":\n-    parser = argparse.ArgumentParser(formatter_class=argparse.RawTextHelpFormatter, description=\n-        'Convert the format of the Raspberry Pi camera tuning file from v1.0 to v2.0 and/or the vc4 <-> pisp targets.\\n')\n-    parser.add_argument('input', type=str, help='Input tuning file.')\n-    parser.add_argument('-t', '--target', type=str, help='Target platform.',\n-                        choices=['pisp', 'vc4'], default='vc4')\n-    parser.add_argument('output', type=str, nargs='?',\n-                        help='Output converted tuning file. If not provided, the input file will be updated in-place.',\n-                        default=None)\n-    args = parser.parse_args()\n-\n-    with open(args.input, 'r') as f:\n-        in_json = json.load(f)\n-\n-    out_json = convert_v2(in_json, args.target)\n-\n-    with open(args.output if args.output is not None else args.input, 'w') as f:\n-        f.write(out_json)\ndiff --git a/utils/raspberrypi/ctt/ctt.py b/utils/raspberrypi/ctt/ctt.py\ndeleted file mode 100755\nindex 93a8e8fb1d1a..000000000000\n--- a/utils/raspberrypi/ctt/ctt.py\n+++ /dev/null\n@@ -1,806 +0,0 @@\n-#!/usr/bin/env python3\n-#\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2019, Raspberry Pi Ltd\n-#\n-# camera tuning tool\n-\n-import os\n-import sys\n-from ctt_image_load import *\n-from ctt_cac import *\n-from ctt_ccm import *\n-from ctt_awb import *\n-from ctt_alsc import *\n-from ctt_lux import *\n-from ctt_noise import *\n-from ctt_geq import *\n-from ctt_pretty_print_json import pretty_print\n-import random\n-import json\n-import re\n-\n-\"\"\"\n-This file houses the camera object, which is used to perform the calibrations.\n-The camera object houses all the calibration images as attributes in three lists:\n-    - imgs (macbeth charts)\n-    - imgs_alsc (alsc correction images)\n-    - imgs_cac (cac correction images)\n-Various calibrations are methods of the camera object, and the output is stored\n-in a dictionary called self.json.\n-Once all the caibration has been completed, the Camera.json is written into a\n-json file.\n-The camera object initialises its json dictionary by reading from a pre-written\n-blank json file. This has been done to avoid reproducing the entire json file\n-in the code here, thereby avoiding unecessary clutter.\n-\"\"\"\n-\n-\n-\"\"\"\n-Get the colour and lux values from the strings of each inidvidual image\n-\"\"\"\n-def get_col_lux(string):\n-    \"\"\"\n-    Extract colour and lux values from filename\n-    \"\"\"\n-    col = re.search(r'([0-9]+)[kK](\\.(jpg|jpeg|brcm|dng)|_.*\\.(jpg|jpeg|brcm|dng))$', string)\n-    lux = re.search(r'([0-9]+)[lL](\\.(jpg|jpeg|brcm|dng)|_.*\\.(jpg|jpeg|brcm|dng))$', string)\n-    try:\n-        col = col.group(1)\n-    except AttributeError:\n-        \"\"\"\n-        Catch error if images labelled incorrectly and pass reasonable defaults\n-        \"\"\"\n-        return None, None\n-    try:\n-        lux = lux.group(1)\n-    except AttributeError:\n-        \"\"\"\n-        Catch error if images labelled incorrectly and pass reasonable defaults\n-        Still returns colour if that has been found.\n-        \"\"\"\n-        return col, None\n-    return int(col), int(lux)\n-\n-\n-\"\"\"\n-Camera object that is the backbone of the tuning tool.\n-Input is the desired path of the output json.\n-\"\"\"\n-class Camera:\n-    def __init__(self, jfile, json):\n-        self.path = os.path.dirname(os.path.expanduser(__file__)) + '/'\n-        if self.path == '/':\n-            self.path = ''\n-        self.imgs = []\n-        self.imgs_alsc = []\n-        self.imgs_cac = []\n-        self.log = 'Log created : ' + time.asctime(time.localtime(time.time()))\n-        self.log_separator = '\\n'+'-'*70+'\\n'\n-        self.jf = jfile\n-        \"\"\"\n-        initial json dict populated by uncalibrated values\n-        \"\"\"\n-        self.json = json\n-\n-    \"\"\"\n-    Perform colour correction calibrations by comparing macbeth patch colours\n-    to standard macbeth chart colours.\n-    \"\"\"\n-    def ccm_cal(self, do_alsc_colour, grid_size):\n-        if 'rpi.ccm' in self.disable:\n-            return 1\n-        print('\\nStarting CCM calibration')\n-        self.log_new_sec('CCM')\n-        \"\"\"\n-        if image is greyscale then CCm makes no sense\n-        \"\"\"\n-        if self.grey:\n-            print('\\nERROR: Can\\'t do CCM on greyscale image!')\n-            self.log += '\\nERROR: Cannot perform CCM calibration '\n-            self.log += 'on greyscale image!\\nCCM aborted!'\n-            del self.json['rpi.ccm']\n-            return 0\n-        a = time.time()\n-        \"\"\"\n-        Check if alsc tables have been generated, if not then do ccm without\n-        alsc\n-        \"\"\"\n-        if (\"rpi.alsc\" not in self.disable) and do_alsc_colour:\n-            \"\"\"\n-            case where ALSC colour has been done, so no errors should be\n-            expected...\n-            \"\"\"\n-            try:\n-                cal_cr_list = self.json['rpi.alsc']['calibrations_Cr']\n-                cal_cb_list = self.json['rpi.alsc']['calibrations_Cb']\n-                self.log += '\\nALSC tables found successfully'\n-            except KeyError:\n-                cal_cr_list, cal_cb_list = None, None\n-                print('WARNING! No ALSC tables found for CCM!')\n-                print('Performing CCM calibrations without ALSC correction...')\n-                self.log += '\\nWARNING: No ALSC tables found.\\nCCM calibration '\n-                self.log += 'performed without ALSC correction...'\n-        else:\n-            \"\"\"\n-            case where config options result in CCM done without ALSC colour tables\n-            \"\"\"\n-            cal_cr_list, cal_cb_list = None, None\n-            self.log += '\\nWARNING: No ALSC tables found.\\nCCM calibration '\n-            self.log += 'performed without ALSC correction...'\n-\n-        \"\"\"\n-        Do CCM calibration\n-        \"\"\"\n-        try:\n-            ccms = ccm(self, cal_cr_list, cal_cb_list, grid_size)\n-        except ArithmeticError:\n-            print('ERROR: Matrix is singular!\\nTake new pictures and try again...')\n-            self.log += '\\nERROR: Singular matrix encountered during fit!'\n-            self.log += '\\nCCM aborted!'\n-            return 1\n-        \"\"\"\n-        Write output to json\n-        \"\"\"\n-        self.json['rpi.ccm']['ccms'] = ccms\n-        self.log += '\\nCCM calibration written to json file'\n-        print('Finished CCM calibration')\n-\n-    \"\"\"\n-    Perform chromatic abberation correction using multiple dots images.\n-    \"\"\"\n-    def cac_cal(self, do_alsc_colour):\n-        if 'rpi.cac' in self.disable:\n-            return 1\n-        print('\\nStarting CAC calibration')\n-        self.log_new_sec('CAC')\n-        \"\"\"\n-        check if cac images have been taken\n-        \"\"\"\n-        if len(self.imgs_cac) == 0:\n-            print('\\nError:\\nNo cac calibration images found')\n-            self.log += '\\nERROR: No CAC calibration images found!'\n-            self.log += '\\nCAC calibration aborted!'\n-            return 1\n-        \"\"\"\n-        if image is greyscale then CAC makes no sense\n-        \"\"\"\n-        if self.grey:\n-            print('\\nERROR: Can\\'t do CAC on greyscale image!')\n-            self.log += '\\nERROR: Cannot perform CAC calibration '\n-            self.log += 'on greyscale image!\\nCAC aborted!'\n-            del self.json['rpi.cac']\n-            return 0\n-        a = time.time()\n-        \"\"\"\n-        Check if camera is greyscale or color. If not greyscale, then perform cac\n-        \"\"\"\n-        if do_alsc_colour:\n-            \"\"\"\n-            Here we have a color sensor. Perform cac\n-            \"\"\"\n-            try:\n-                cacs = cac(self)\n-            except ArithmeticError:\n-                print('ERROR: Matrix is singular!\\nTake new pictures and try again...')\n-                self.log += '\\nERROR: Singular matrix encountered during fit!'\n-                self.log += '\\nCAC aborted!'\n-                return 1\n-        else:\n-            \"\"\"\n-            case where config options suggest greyscale camera. No point in doing CAC\n-            \"\"\"\n-            cal_cr_list, cal_cb_list = None, None\n-            self.log += '\\nWARNING: No ALSC tables found.\\nCAC calibration '\n-            self.log += 'performed without ALSC correction...'\n-\n-        \"\"\"\n-        Write output to json\n-        \"\"\"\n-        if cacs:\n-            self.json['rpi.cac']['cac'] = cacs\n-            self.log += '\\nCAC calibration written to json file'\n-            print('Finished CAC calibration')\n-        else:\n-            self.log += \"\\nCAC calibration failed\"\n-\n-\n-    \"\"\"\n-    Auto white balance calibration produces a colour curve for\n-    various colour temperatures, as well as providing a maximum 'wiggle room'\n-    distance from this curve (transverse_neg/pos).\n-    \"\"\"\n-    def awb_cal(self, greyworld, do_alsc_colour, grid_size):\n-        if 'rpi.awb' in self.disable:\n-            return 1\n-        print('\\nStarting AWB calibration')\n-        self.log_new_sec('AWB')\n-        \"\"\"\n-        if image is greyscale then AWB makes no sense\n-        \"\"\"\n-        if self.grey:\n-            print('\\nERROR: Can\\'t do AWB on greyscale image!')\n-            self.log += '\\nERROR: Cannot perform AWB calibration '\n-            self.log += 'on greyscale image!\\nAWB aborted!'\n-            del self.json['rpi.awb']\n-            return 0\n-        \"\"\"\n-        optional set greyworld (e.g. for noir cameras)\n-        \"\"\"\n-        if greyworld:\n-            self.json['rpi.awb']['bayes'] = 0\n-            self.log += '\\nGreyworld set'\n-        \"\"\"\n-        Check if alsc tables have been generated, if not then do awb without\n-        alsc correction\n-        \"\"\"\n-        if (\"rpi.alsc\" not in self.disable) and do_alsc_colour:\n-            try:\n-                cal_cr_list = self.json['rpi.alsc']['calibrations_Cr']\n-                cal_cb_list = self.json['rpi.alsc']['calibrations_Cb']\n-                self.log += '\\nALSC tables found successfully'\n-            except KeyError:\n-                cal_cr_list, cal_cb_list = None, None\n-                print('ERROR, no ALSC calibrations found for AWB')\n-                print('Performing AWB without ALSC tables')\n-                self.log += '\\nWARNING: No ALSC tables found.\\nAWB calibration '\n-                self.log += 'performed without ALSC correction...'\n-        else:\n-            cal_cr_list, cal_cb_list = None, None\n-            self.log += '\\nWARNING: No ALSC tables found.\\nAWB calibration '\n-            self.log += 'performed without ALSC correction...'\n-        \"\"\"\n-        call calibration function\n-        \"\"\"\n-        plot = \"rpi.awb\" in self.plot\n-        awb_out = awb(self, cal_cr_list, cal_cb_list, plot, grid_size)\n-        ct_curve, transverse_neg, transverse_pos = awb_out\n-        \"\"\"\n-        write output to json\n-        \"\"\"\n-        self.json['rpi.awb']['ct_curve'] = ct_curve\n-        self.json['rpi.awb']['sensitivity_r'] = 1.0\n-        self.json['rpi.awb']['sensitivity_b'] = 1.0\n-        self.json['rpi.awb']['transverse_pos'] = transverse_pos\n-        self.json['rpi.awb']['transverse_neg'] = transverse_neg\n-        self.log += '\\nAWB calibration written to json file'\n-        print('Finished AWB calibration')\n-\n-    \"\"\"\n-    Auto lens shading correction completely mitigates the effects of lens shading for ech\n-    colour channel seperately, and then partially corrects for vignetting.\n-    The extent of the correction depends on the 'luminance_strength' parameter.\n-    \"\"\"\n-    def alsc_cal(self, luminance_strength, do_alsc_colour, grid_size, max_gain=8.0):\n-        if 'rpi.alsc' in self.disable:\n-            return 1\n-        print('\\nStarting ALSC calibration')\n-        self.log_new_sec('ALSC')\n-        \"\"\"\n-        check if alsc images have been taken\n-        \"\"\"\n-        if len(self.imgs_alsc) == 0:\n-            print('\\nError:\\nNo alsc calibration images found')\n-            self.log += '\\nERROR: No ALSC calibration images found!'\n-            self.log += '\\nALSC calibration aborted!'\n-            return 1\n-        self.json['rpi.alsc']['luminance_strength'] = luminance_strength\n-        if self.grey and do_alsc_colour:\n-            print('Greyscale camera so only luminance_lut calculated')\n-            do_alsc_colour = False\n-            self.log += '\\nWARNING: ALSC colour correction cannot be done on '\n-            self.log += 'greyscale image!\\nALSC colour corrections forced off!'\n-        \"\"\"\n-        call calibration function\n-        \"\"\"\n-        plot = \"rpi.alsc\" in self.plot\n-        alsc_out = alsc_all(self, do_alsc_colour, plot, grid_size, max_gain=max_gain)\n-        cal_cr_list, cal_cb_list, luminance_lut, av_corn = alsc_out\n-        \"\"\"\n-        write output to json and finish if not do_alsc_colour\n-        \"\"\"\n-        if not do_alsc_colour:\n-            self.json['rpi.alsc']['luminance_lut'] = luminance_lut\n-            self.json['rpi.alsc']['n_iter'] = 0\n-            self.log += '\\nALSC calibrations written to json file'\n-            self.log += '\\nNo colour calibrations performed'\n-            print('Finished ALSC calibrations')\n-            return 1\n-\n-        self.json['rpi.alsc']['calibrations_Cr'] = cal_cr_list\n-        self.json['rpi.alsc']['calibrations_Cb'] = cal_cb_list\n-        self.json['rpi.alsc']['luminance_lut'] = luminance_lut\n-        self.log += '\\nALSC colour and luminance tables written to json file'\n-\n-        \"\"\"\n-        The sigmas determine the strength of the adaptive algorithm, that\n-        cleans up any lens shading that has slipped through the alsc. These are\n-        determined by measuring a 'worst-case' difference between two alsc tables\n-        that are adjacent in colour space. If, however, only one colour\n-        temperature has been provided, then this difference can not be computed\n-        as only one table is available.\n-        To determine the sigmas you would have to estimate the error of an alsc\n-        table with only the image it was taken on as a check. To avoid circularity,\n-        dfault exaggerated sigmas are used, which can result in too much alsc and\n-        is therefore not advised.\n-        In general, just take another alsc picture at another colour temperature!\n-        \"\"\"\n-\n-        if len(self.imgs_alsc) == 1:\n-            self.json['rpi.alsc']['sigma'] = 0.005\n-            self.json['rpi.alsc']['sigma_Cb'] = 0.005\n-            print('\\nWarning:\\nOnly one alsc calibration found'\n-                  '\\nStandard sigmas used for adaptive algorithm.')\n-            print('Finished ALSC calibrations')\n-            self.log += '\\nWARNING: Only one colour temperature found in '\n-            self.log += 'calibration images.\\nStandard sigmas used for adaptive '\n-            self.log += 'algorithm!'\n-            return 1\n-\n-        \"\"\"\n-        obtain worst-case scenario residual sigmas\n-        \"\"\"\n-        sigma_r, sigma_b = get_sigma(self, cal_cr_list, cal_cb_list, grid_size)\n-        \"\"\"\n-        write output to json\n-        \"\"\"\n-        self.json['rpi.alsc']['sigma'] = np.round(sigma_r, 5)\n-        self.json['rpi.alsc']['sigma_Cb'] = np.round(sigma_b, 5)\n-        self.log += '\\nCalibrated sigmas written to json file'\n-        print('Finished ALSC calibrations')\n-\n-    \"\"\"\n-    Green equalisation fixes problems caused by discrepancies in green\n-    channels. This is done by measuring the effect on macbeth chart patches,\n-    which ideally would have the same green values throughout.\n-    An upper bound linear model is fit, fixing a threshold for the green\n-    differences that are corrected.\n-    \"\"\"\n-    def geq_cal(self):\n-        if 'rpi.geq' in self.disable:\n-            return 1\n-        print('\\nStarting GEQ calibrations')\n-        self.log_new_sec('GEQ')\n-        \"\"\"\n-        perform calibration\n-        \"\"\"\n-        plot = 'rpi.geq' in self.plot\n-        slope, offset = geq_fit(self, plot)\n-        \"\"\"\n-        write output to json\n-        \"\"\"\n-        self.json['rpi.geq']['offset'] = offset\n-        self.json['rpi.geq']['slope'] = slope\n-        self.log += '\\nGEQ calibrations written to json file'\n-        print('Finished GEQ calibrations')\n-\n-    \"\"\"\n-    Lux calibrations allow the lux level of a scene to be estimated by a ratio\n-    calculation. Lux values are used in the pipeline for algorithms such as AGC\n-    and AWB\n-    \"\"\"\n-    def lux_cal(self):\n-        if 'rpi.lux' in self.disable:\n-            return 1\n-        print('\\nStarting LUX calibrations')\n-        self.log_new_sec('LUX')\n-        \"\"\"\n-        The lux calibration is done on a single image. For best effects, the\n-        image with lux level closest to 1000 is chosen.\n-        \"\"\"\n-        luxes = [Img.lux for Img in self.imgs]\n-        argmax = luxes.index(min(luxes, key=lambda l: abs(1000-l)))\n-        Img = self.imgs[argmax]\n-        self.log += '\\nLux found closest to 1000: {} lx'.format(Img.lux)\n-        self.log += '\\nImage used: ' + Img.name\n-        if Img.lux < 50:\n-            self.log += '\\nWARNING: Low lux could cause inaccurate calibrations!'\n-        \"\"\"\n-        do calibration\n-        \"\"\"\n-        lux_out, shutter_speed, gain = lux(self, Img)\n-        \"\"\"\n-        write output to json\n-        \"\"\"\n-        self.json['rpi.lux']['reference_shutter_speed'] = shutter_speed\n-        self.json['rpi.lux']['reference_gain'] = gain\n-        self.json['rpi.lux']['reference_lux'] = Img.lux\n-        self.json['rpi.lux']['reference_Y'] = lux_out\n-        self.log += '\\nLUX calibrations written to json file'\n-        print('Finished LUX calibrations')\n-\n-    \"\"\"\n-    Noise alibration attempts to describe the noise profile of the sensor. The\n-    calibration is run on macbeth images and the final output is taken as the average\n-    \"\"\"\n-    def noise_cal(self):\n-        if 'rpi.noise' in self.disable:\n-            return 1\n-        print('\\nStarting NOISE calibrations')\n-        self.log_new_sec('NOISE')\n-        \"\"\"\n-        run calibration on all images and sort by slope.\n-        \"\"\"\n-        plot = \"rpi.noise\" in self.plot\n-        noise_out = sorted([noise(self, Img, plot) for Img in self.imgs], key=lambda x: x[0])\n-        self.log += '\\nFinished processing images'\n-        \"\"\"\n-        take the average of the interquartile\n-        \"\"\"\n-        length = len(noise_out)\n-        noise_out = np.mean(noise_out[length//4:1+3*length//4], axis=0)\n-        self.log += '\\nAverage noise profile: constant = {} '.format(int(noise_out[1]))\n-        self.log += 'slope = {:.3f}'.format(noise_out[0])\n-        \"\"\"\n-        write to json\n-        \"\"\"\n-        self.json['rpi.noise']['reference_constant'] = int(noise_out[1])\n-        # Results are better with about 40% higher deviation.\n-        self.json['rpi.noise']['reference_slope'] = round(1.4 * noise_out[0], 3)\n-        self.log += '\\nNOISE calibrations written to json'\n-        print('Finished NOISE calibrations')\n-\n-    \"\"\"\n-    Removes json entries that are turned off\n-    \"\"\"\n-    def json_remove(self, disable):\n-        self.log_new_sec('Disabling Options', cal=False)\n-        if len(self.disable) == 0:\n-            self.log += '\\nNothing disabled!'\n-            return 1\n-        for key in disable:\n-            try:\n-                del self.json[key]\n-                self.log += '\\nDisabled: ' + key\n-            except KeyError:\n-                self.log += '\\nERROR: ' + key + ' not found!'\n-    \"\"\"\n-    writes the json dictionary to the raw json file then make pretty\n-    \"\"\"\n-    def write_json(self, version=2.0, target='bcm2835', grid_size=(16, 12)):\n-        \"\"\"\n-        Write json dictionary to file using our version 2 format\n-        \"\"\"\n-\n-        out_json = {\n-            \"version\": version,\n-            'target': target if target != 'vc4' else 'bcm2835',\n-            \"algorithms\": [{name: data} for name, data in self.json.items()],\n-        }\n-\n-        with open(self.jf, 'w') as f:\n-            f.write(pretty_print(out_json,\n-                                 custom_elems={'table': grid_size[0], 'luminance_lut': grid_size[0]}))\n-\n-    \"\"\"\n-    add a new section to the log file\n-    \"\"\"\n-    def log_new_sec(self, section, cal=True):\n-        self.log += '\\n'+self.log_separator\n-        self.log += section\n-        if cal:\n-            self.log += ' Calibration'\n-        self.log += self.log_separator\n-\n-    \"\"\"\n-    write script arguments to log file\n-    \"\"\"\n-    def log_user_input(self, json_output, directory, config, log_output):\n-        self.log_new_sec('User Arguments', cal=False)\n-        self.log += '\\nJson file output: ' + json_output\n-        self.log += '\\nCalibration images directory: ' + directory\n-        if config is None:\n-            self.log += '\\nNo configuration file input... using default options'\n-        elif config is False:\n-            self.log += '\\nWARNING: Invalid configuration file path...'\n-            self.log += ' using default options'\n-        elif config is True:\n-            self.log += '\\nWARNING: Invalid syntax in configuration file...'\n-            self.log += ' using default options'\n-        else:\n-            self.log += '\\nConfiguration file: ' + config\n-        if log_output is None:\n-            self.log += '\\nNo log file path input... using default: ctt_log.txt'\n-        else:\n-            self.log += '\\nLog file output: ' + log_output\n-\n-        # if log_output\n-\n-    \"\"\"\n-    write log file\n-    \"\"\"\n-    def write_log(self, filename):\n-        if filename is None:\n-            filename = 'ctt_log.txt'\n-        self.log += '\\n' + self.log_separator\n-        with open(filename, 'w') as logfile:\n-            logfile.write(self.log)\n-\n-    \"\"\"\n-    Add all images from directory, pass into relevant list of images and\n-    extrace lux and temperature values.\n-    \"\"\"\n-    def add_imgs(self, directory, mac_config, blacklevel=-1):\n-        self.log_new_sec('Image Loading', cal=False)\n-        img_suc_msg = 'Image loaded successfully!'\n-        print('\\n\\nLoading images from '+directory)\n-        self.log += '\\nDirectory: ' + directory\n-        \"\"\"\n-        get list of files\n-        \"\"\"\n-        filename_list = get_photos(directory)\n-        print(\"Files found: {}\".format(len(filename_list)))\n-        self.log += '\\nFiles found: {}'.format(len(filename_list))\n-        \"\"\"\n-        iterate over files\n-        \"\"\"\n-        filename_list.sort()\n-        for filename in filename_list:\n-            address = directory + filename\n-            print('\\nLoading image: '+filename)\n-            self.log += '\\n\\nImage: ' + filename\n-            \"\"\"\n-            obtain colour and lux value\n-            \"\"\"\n-            col, lux = get_col_lux(filename)\n-            \"\"\"\n-            Check if image is an alsc calibration image\n-            \"\"\"\n-            if 'alsc' in filename:\n-                Img = load_image(self, address, mac=False)\n-                self.log += '\\nIdentified as an ALSC image'\n-                \"\"\"\n-                check if imagae data has been successfully unpacked\n-                \"\"\"\n-                if Img == 0:\n-                    print('\\nDISCARDED')\n-                    self.log += '\\nImage discarded!'\n-                    continue\n-                    \"\"\"\n-                check that image colour temperature has been successfuly obtained\n-                \"\"\"\n-                elif col is not None:\n-                    \"\"\"\n-                    if successful, append to list and continue to next image\n-                    \"\"\"\n-                    Img.col = col\n-                    Img.name = filename\n-                    self.log += '\\nColour temperature: {} K'.format(col)\n-                    self.imgs_alsc.append(Img)\n-                    if blacklevel != -1:\n-                        Img.blacklevel_16 = blacklevel\n-                    print(img_suc_msg)\n-                    continue\n-                else:\n-                    print('Error! No colour temperature found!')\n-                    self.log += '\\nWARNING: Error reading colour temperature'\n-                    self.log += '\\nImage discarded!'\n-                    print('DISCARDED')\n-            elif 'cac' in filename:\n-                Img = load_image(self, address, mac=False)\n-                self.log += '\\nIdentified as an CAC image'\n-                Img.name = filename\n-                self.log += '\\nColour temperature: {} K'.format(col)\n-                self.imgs_cac.append(Img)\n-                if blacklevel != -1:\n-                    Img.blacklevel_16 = blacklevel\n-                print(img_suc_msg)\n-                continue\n-            else:\n-                self.log += '\\nIdentified as macbeth chart image'\n-                \"\"\"\n-                if image isn't an alsc correction then it must have a lux and a\n-                colour temperature value to be useful\n-                \"\"\"\n-                if lux is None:\n-                    print('DISCARDED')\n-                    self.log += '\\nWARNING: Error reading lux value'\n-                    self.log += '\\nImage discarded!'\n-                    continue\n-                Img = load_image(self, address, mac_config)\n-                \"\"\"\n-                check that image data has been successfuly unpacked\n-                \"\"\"\n-                if Img == 0:\n-                    print('DISCARDED')\n-                    self.log += '\\nImage discarded!'\n-                    continue\n-                else:\n-                    \"\"\"\n-                    if successful, append to list and continue to next image\n-                    \"\"\"\n-                    Img.col, Img.lux = col, lux\n-                    Img.name = filename\n-                    self.log += '\\nColour temperature: {} K'.format(col)\n-                    self.log += '\\nLux value: {} lx'.format(lux)\n-                    if blacklevel != -1:\n-                        Img.blacklevel_16 = blacklevel\n-                    print(img_suc_msg)\n-                    self.imgs.append(Img)\n-\n-        print('\\nFinished loading images')\n-\n-    \"\"\"\n-    Check that usable images have been found\n-    Possible errors include:\n-        - no macbeth chart\n-        - incorrect filename/extension\n-        - images from different cameras\n-    \"\"\"\n-    def check_imgs(self, macbeth=True):\n-        self.log += '\\n\\nImages found:'\n-        self.log += '\\nMacbeth : {}'.format(len(self.imgs))\n-        self.log += '\\nALSC : {} '.format(len(self.imgs_alsc))\n-        self.log += '\\nCAC: {} '.format(len(self.imgs_cac))\n-        self.log += '\\n\\nCamera metadata'\n-        \"\"\"\n-        check usable images found\n-        \"\"\"\n-        if len(self.imgs) == 0 and macbeth:\n-            print('\\nERROR: No usable macbeth chart images found')\n-            self.log += '\\nERROR: No usable macbeth chart images found'\n-            return 0\n-        elif len(self.imgs) == 0 and len(self.imgs_alsc) == 0 and len(self.imgs_cac) == 0:\n-            print('\\nERROR: No usable images found')\n-            self.log += '\\nERROR: No usable images found'\n-            return 0\n-        \"\"\"\n-        Double check that every image has come from the same camera...\n-        \"\"\"\n-        all_imgs = self.imgs + self.imgs_alsc + self.imgs_cac\n-        camNames = list(set([Img.camName for Img in all_imgs]))\n-        patterns = list(set([Img.pattern for Img in all_imgs]))\n-        sigbitss = list(set([Img.sigbits for Img in all_imgs]))\n-        blacklevels = list(set([Img.blacklevel_16 for Img in all_imgs]))\n-        sizes = list(set([(Img.w, Img.h) for Img in all_imgs]))\n-\n-        if 1:\n-            self.grey = (patterns[0] == 128)\n-            self.blacklevel_16 = blacklevels[0]\n-            self.log += '\\nName: {}'.format(camNames[0])\n-            self.log += '\\nBayer pattern case: {}'.format(patterns[0])\n-            if self.grey:\n-                self.log += '\\nGreyscale camera identified'\n-            self.log += '\\nSignificant bits: {}'.format(sigbitss[0])\n-            self.log += '\\nBlacklevel: {}'.format(blacklevels[0])\n-            self.log += '\\nImage size: w = {} h = {}'.format(sizes[0][0], sizes[0][1])\n-            return 1\n-        else:\n-            print('\\nERROR: Images from different cameras')\n-            self.log += '\\nERROR: Images are from different cameras'\n-            return 0\n-\n-\n-def run_ctt(json_output, directory, config, log_output, json_template, grid_size, target, alsc_only=False):\n-    \"\"\"\n-    check input files are jsons\n-    \"\"\"\n-    if json_output[-5:] != '.json':\n-        raise ArgError('\\n\\nError: Output must be a json file!')\n-    if config is not None:\n-        \"\"\"\n-        check if config file is actually a json\n-        \"\"\"\n-        if config[-5:] != '.json':\n-            raise ArgError('\\n\\nError: Config file must be a json file!')\n-        \"\"\"\n-        read configurations\n-        \"\"\"\n-        try:\n-            with open(config, 'r') as config_json:\n-                configs = json.load(config_json)\n-        except FileNotFoundError:\n-            configs = {}\n-            config = False\n-        except json.decoder.JSONDecodeError:\n-            configs = {}\n-            config = True\n-\n-    else:\n-        configs = {}\n-    \"\"\"\n-    load configurations from config file, if not given then set default\n-    \"\"\"\n-    disable = get_config(configs, \"disable\", [], 'list')\n-    plot = get_config(configs, \"plot\", [], 'list')\n-    awb_d = get_config(configs, \"awb\", {}, 'dict')\n-    greyworld = get_config(awb_d, \"greyworld\", 0, 'bool')\n-    alsc_d = get_config(configs, \"alsc\", {}, 'dict')\n-    do_alsc_colour = get_config(alsc_d, \"do_alsc_colour\", 1, 'bool')\n-    luminance_strength = get_config(alsc_d, \"luminance_strength\", 0.8, 'num')\n-    lsc_max_gain = get_config(alsc_d, \"max_gain\", 8.0, 'num')\n-    blacklevel = get_config(configs, \"blacklevel\", -1, 'num')\n-    macbeth_d = get_config(configs, \"macbeth\", {}, 'dict')\n-    mac_small = get_config(macbeth_d, \"small\", 0, 'bool')\n-    mac_show = get_config(macbeth_d, \"show\", 0, 'bool')\n-    mac_config = (mac_small, mac_show)\n-    print(\"Read lsc_max_gain\", lsc_max_gain)\n-\n-    if blacklevel < -1 or blacklevel >= 2**16:\n-        print('\\nInvalid blacklevel, defaulted to 64')\n-        blacklevel = -1\n-\n-    if luminance_strength < 0 or luminance_strength > 1:\n-        print('\\nInvalid luminance_strength strength, defaulted to 0.5')\n-        luminance_strength = 0.5\n-\n-    \"\"\"\n-    sanitise directory path\n-    \"\"\"\n-    if directory[-1] != '/':\n-        directory += '/'\n-    \"\"\"\n-    initialise tuning tool and load images\n-    \"\"\"\n-    try:\n-        Cam = Camera(json_output, json=json_template)\n-        Cam.log_user_input(json_output, directory, config, log_output)\n-        if alsc_only:\n-            disable = set(Cam.json.keys()).symmetric_difference({\"rpi.alsc\"})\n-        Cam.disable = disable\n-        Cam.plot = plot\n-        Cam.add_imgs(directory, mac_config, blacklevel)\n-    except FileNotFoundError:\n-        raise ArgError('\\n\\nError: Input image directory not found!')\n-\n-    \"\"\"\n-    preform calibrations as long as check_imgs returns True\n-    If alsc is activated then it must be done before awb and ccm since the alsc\n-    tables are used in awb and ccm calibrations\n-    ccm also technically does an awb but it measures this from the macbeth\n-    chart in the image rather than using calibration data\n-    \"\"\"\n-    if Cam.check_imgs(macbeth=not alsc_only):\n-        if not alsc_only:\n-            Cam.json['rpi.black_level']['black_level'] = Cam.blacklevel_16\n-        Cam.json_remove(disable)\n-        print('\\nSTARTING CALIBRATIONS')\n-        Cam.alsc_cal(luminance_strength, do_alsc_colour, grid_size, max_gain=lsc_max_gain)\n-        Cam.geq_cal()\n-        Cam.lux_cal()\n-        Cam.noise_cal()\n-        if \"rpi.cac\" in json_template:\n-            Cam.cac_cal(do_alsc_colour)\n-        Cam.awb_cal(greyworld, do_alsc_colour, grid_size)\n-        Cam.ccm_cal(do_alsc_colour, grid_size)\n-\n-        print('\\nFINISHED CALIBRATIONS')\n-        Cam.write_json(target=target, grid_size=grid_size)\n-        Cam.write_log(log_output)\n-        print('\\nCalibrations written to: '+json_output)\n-        if log_output is None:\n-            log_output = 'ctt_log.txt'\n-        print('Log file written to: '+log_output)\n-        pass\n-    else:\n-        Cam.write_log(log_output)\n-\n-if __name__ == '__main__':\n-    \"\"\"\n-    initialise calibration\n-    \"\"\"\n-    if len(sys.argv) == 1:\n-        print(\"\"\"\n-    PiSP Tuning Tool version 1.0\n-    Required Arguments:\n-    '-i' : Calibration image directory.\n-    '-o' : Name of output json file.\n-\n-    Optional Arguments:\n-    '-t' : Target platform - 'pisp' or 'vc4'. Default 'vc4'\n-    '-c' : Config file for the CTT. If not passed, default parameters used.\n-    '-l' : Name of output log file. If not passed, 'ctt_log.txt' used.\n-              \"\"\")\n-        quit(0)\n-    else:\n-        \"\"\"\n-        parse input arguments\n-        \"\"\"\n-        json_output, directory, config, log_output, target = parse_input()\n-        if target == 'pisp':\n-            from ctt_pisp import json_template, grid_size\n-        elif target == 'vc4':\n-            from ctt_vc4 import json_template, grid_size\n-\n-        run_ctt(json_output, directory, config, log_output, json_template, grid_size, target)\ndiff --git a/utils/raspberrypi/ctt/ctt_alsc.py b/utils/raspberrypi/ctt/ctt_alsc.py\ndeleted file mode 100644\nindex 5d8b2ced9047..000000000000\n--- a/utils/raspberrypi/ctt/ctt_alsc.py\n+++ /dev/null\n@@ -1,309 +0,0 @@\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2019, Raspberry Pi Ltd\n-#\n-# camera tuning tool for ALSC (auto lens shading correction)\n-\n-from ctt_image_load import *\n-import matplotlib.pyplot as plt\n-from matplotlib import cm\n-from mpl_toolkits.mplot3d import Axes3D\n-\n-\n-\"\"\"\n-preform alsc calibration on a set of images\n-\"\"\"\n-def alsc_all(Cam, do_alsc_colour, plot, grid_size=(16, 12), max_gain=8.0):\n-    imgs_alsc = Cam.imgs_alsc\n-    grid_w, grid_h = grid_size\n-    \"\"\"\n-    create list of colour temperatures and associated calibration tables\n-    \"\"\"\n-    list_col = []\n-    list_cr = []\n-    list_cb = []\n-    list_cg = []\n-    for Img in imgs_alsc:\n-        col, cr, cb, cg, size = alsc(Cam, Img, do_alsc_colour, plot, grid_size=grid_size, max_gain=max_gain)\n-        list_col.append(col)\n-        list_cr.append(cr)\n-        list_cb.append(cb)\n-        list_cg.append(cg)\n-        Cam.log += '\\n'\n-    Cam.log += '\\nFinished processing images'\n-    w, h, dx, dy = size\n-    Cam.log += '\\nChannel dimensions: w = {}  h = {}'.format(int(w), int(h))\n-    Cam.log += '\\n16x12 grid rectangle size: w = {} h = {}'.format(dx, dy)\n-\n-    \"\"\"\n-    convert to numpy array for data manipulation\n-    \"\"\"\n-    list_col = np.array(list_col)\n-    list_cr = np.array(list_cr)\n-    list_cb = np.array(list_cb)\n-    list_cg = np.array(list_cg)\n-\n-    cal_cr_list = []\n-    cal_cb_list = []\n-\n-    \"\"\"\n-    only do colour calculations if required\n-    \"\"\"\n-    if do_alsc_colour:\n-        Cam.log += '\\nALSC colour tables'\n-        for ct in sorted(set(list_col)):\n-            Cam.log += '\\nColour temperature: {} K'.format(ct)\n-            \"\"\"\n-            average tables for the same colour temperature\n-            \"\"\"\n-            indices = np.where(list_col == ct)\n-            ct = int(ct)\n-            t_r = np.mean(list_cr[indices], axis=0)\n-            t_b = np.mean(list_cb[indices], axis=0)\n-            \"\"\"\n-            force numbers to be stored to 3dp.... :(\n-            \"\"\"\n-            t_r = np.where((100*t_r) % 1 <= 0.05, t_r+0.001, t_r)\n-            t_b = np.where((100*t_b) % 1 <= 0.05, t_b+0.001, t_b)\n-            t_r = np.where((100*t_r) % 1 >= 0.95, t_r-0.001, t_r)\n-            t_b = np.where((100*t_b) % 1 >= 0.95, t_b-0.001, t_b)\n-            t_r = np.round(t_r, 3)\n-            t_b = np.round(t_b, 3)\n-            r_corners = (t_r[0], t_r[grid_w - 1], t_r[-1], t_r[-grid_w])\n-            b_corners = (t_b[0], t_b[grid_w - 1], t_b[-1], t_b[-grid_w])\n-            middle_pos = (grid_h // 2 - 1) * grid_w + grid_w - 1\n-            r_cen = t_r[middle_pos]+t_r[middle_pos + 1]+t_r[middle_pos + grid_w]+t_r[middle_pos + grid_w + 1]\n-            r_cen = round(r_cen/4, 3)\n-            b_cen = t_b[middle_pos]+t_b[middle_pos + 1]+t_b[middle_pos + grid_w]+t_b[middle_pos + grid_w + 1]\n-            b_cen = round(b_cen/4, 3)\n-            Cam.log += '\\nRed table corners: {}'.format(r_corners)\n-            Cam.log += '\\nRed table centre: {}'.format(r_cen)\n-            Cam.log += '\\nBlue table corners: {}'.format(b_corners)\n-            Cam.log += '\\nBlue table centre: {}'.format(b_cen)\n-            cr_dict = {\n-                'ct': ct,\n-                'table': list(t_r)\n-            }\n-            cb_dict = {\n-                'ct': ct,\n-                'table': list(t_b)\n-            }\n-            cal_cr_list.append(cr_dict)\n-            cal_cb_list.append(cb_dict)\n-            Cam.log += '\\n'\n-    else:\n-        cal_cr_list, cal_cb_list = None, None\n-\n-    \"\"\"\n-    average all values for luminance shading and return one table for all temperatures\n-    \"\"\"\n-    lum_lut = np.mean(list_cg, axis=0)\n-    lum_lut = np.where((100*lum_lut) % 1 <= 0.05, lum_lut+0.001, lum_lut)\n-    lum_lut = np.where((100*lum_lut) % 1 >= 0.95, lum_lut-0.001, lum_lut)\n-    lum_lut = list(np.round(lum_lut, 3))\n-\n-    \"\"\"\n-    calculate average corner for lsc gain calculation further on\n-    \"\"\"\n-    corners = (lum_lut[0], lum_lut[15], lum_lut[-1], lum_lut[-16])\n-    Cam.log += '\\nLuminance table corners: {}'.format(corners)\n-    l_cen = lum_lut[5*16+7]+lum_lut[5*16+8]+lum_lut[6*16+7]+lum_lut[6*16+8]\n-    l_cen = round(l_cen/4, 3)\n-    Cam.log += '\\nLuminance table centre: {}'.format(l_cen)\n-    av_corn = np.sum(corners)/4\n-\n-    return cal_cr_list, cal_cb_list, lum_lut, av_corn\n-\n-\n-\"\"\"\n-calculate g/r and g/b for 32x32 points arranged in a grid for a single image\n-\"\"\"\n-def alsc(Cam, Img, do_alsc_colour, plot=False, grid_size=(16, 12), max_gain=8.0):\n-    Cam.log += '\\nProcessing image: ' + Img.name\n-    grid_w, grid_h = grid_size\n-    \"\"\"\n-    get channel in correct order\n-    \"\"\"\n-    channels = [Img.channels[i] for i in Img.order]\n-    \"\"\"\n-    calculate size of single rectangle.\n-    The divisions here must ensure the final row/column of cells has a non-zero number of\n-    pixels.\n-    \"\"\"\n-    w, h = Img.w/2, Img.h/2\n-    dx, dy = int((w - 1) // (grid_w - 1)), int((h - 1) // (grid_h - 1))\n-\n-    \"\"\"\n-    average the green channels into one\n-    \"\"\"\n-    av_ch_g = np.mean((channels[1:3]), axis=0)\n-    if do_alsc_colour:\n-        \"\"\"\n-        obtain grid_w x grid_h grid of intensities for each channel and subtract black level\n-        \"\"\"\n-        g = get_grid(av_ch_g, dx, dy, grid_size) - Img.blacklevel_16\n-        r = get_grid(channels[0], dx, dy, grid_size) - Img.blacklevel_16\n-        b = get_grid(channels[3], dx, dy, grid_size) - Img.blacklevel_16\n-        \"\"\"\n-        calculate ratios as 32 bit in order to be supported by medianBlur function\n-        \"\"\"\n-        cr = np.reshape(g/r, (grid_h, grid_w)).astype('float32')\n-        cb = np.reshape(g/b, (grid_h, grid_w)).astype('float32')\n-        cg = np.reshape(1/g, (grid_h, grid_w)).astype('float32')\n-        \"\"\"\n-        median blur to remove peaks and save as float 64\n-        \"\"\"\n-        cr = cv2.medianBlur(cr, 3).astype('float64')\n-        cr = cr/np.min(cr)  # gain tables are easier for humans to read if the minimum is 1.0\n-        cb = cv2.medianBlur(cb, 3).astype('float64')\n-        cb = cb/np.min(cb)\n-        cg = cv2.medianBlur(cg, 3).astype('float64')\n-        cg = cg/np.min(cg)\n-        cg = [min(v, max_gain) for v in cg.flatten()]  # never exceed the max luminance gain\n-\n-        \"\"\"\n-        debugging code showing 2D surface plot of vignetting. Quite useful for\n-        for sanity check\n-        \"\"\"\n-        if plot:\n-            hf = plt.figure(figsize=(8, 8))\n-            ha = hf.add_subplot(311, projection='3d')\n-            \"\"\"\n-            note Y is plotted as -Y so plot has same axes as image\n-            \"\"\"\n-            X, Y = np.meshgrid(range(grid_w), range(grid_h))\n-            ha.plot_surface(X, -Y, cr, cmap=cm.coolwarm, linewidth=0)\n-            ha.set_title('ALSC Plot\\nImg: {}\\n\\ncr'.format(Img.str))\n-            hb = hf.add_subplot(312, projection='3d')\n-            hb.plot_surface(X, -Y, cb, cmap=cm.coolwarm, linewidth=0)\n-            hb.set_title('cb')\n-            hc = hf.add_subplot(313, projection='3d')\n-            hc.plot_surface(X, -Y, cg, cmap=cm.coolwarm, linewidth=0)\n-            hc.set_title('g')\n-            # print(Img.str)\n-            plt.show()\n-\n-        return Img.col, cr.flatten(), cb.flatten(), cg, (w, h, dx, dy)\n-\n-    else:\n-        \"\"\"\n-        only perform calculations for luminance shading\n-        \"\"\"\n-        g = get_grid(av_ch_g, dx, dy, grid_size) - Img.blacklevel_16\n-        cg = np.reshape(1/g, (grid_h, grid_w)).astype('float32')\n-        cg = cv2.medianBlur(cg, 3).astype('float64')\n-        cg = cg/np.min(cg)\n-        cg = [min(v, max_gain) for v in cg.flatten()]  # never exceed the max luminance gain\n-\n-        if plot:\n-            hf = plt.figure(figssize=(8, 8))\n-            ha = hf.add_subplot(1, 1, 1, projection='3d')\n-            X, Y = np.meashgrid(range(grid_w), range(grid_h))\n-            ha.plot_surface(X, -Y, cg, cmap=cm.coolwarm, linewidth=0)\n-            ha.set_title('ALSC Plot (Luminance only!)\\nImg: {}\\n\\ncg').format(Img.str)\n-            plt.show()\n-\n-        return Img.col, None, None, cg.flatten(), (w, h, dx, dy)\n-\n-\n-\"\"\"\n-Compresses channel down to a grid of the requested size\n-\"\"\"\n-def get_grid(chan, dx, dy, grid_size):\n-    grid_w, grid_h = grid_size\n-    grid = []\n-    \"\"\"\n-    since left and bottom border will not necessarily have rectangles of\n-    dimension dx x dy, the 32nd iteration has to be handled separately.\n-    \"\"\"\n-    for i in range(grid_h - 1):\n-        for j in range(grid_w - 1):\n-            grid.append(np.mean(chan[dy*i:dy*(1+i), dx*j:dx*(1+j)]))\n-        grid.append(np.mean(chan[dy*i:dy*(1+i), (grid_w - 1)*dx:]))\n-    for j in range(grid_w - 1):\n-        grid.append(np.mean(chan[(grid_h - 1)*dy:, dx*j:dx*(1+j)]))\n-    grid.append(np.mean(chan[(grid_h - 1)*dy:, (grid_w - 1)*dx:]))\n-    \"\"\"\n-    return as np.array, ready for further manipulation\n-    \"\"\"\n-    return np.array(grid)\n-\n-\n-\"\"\"\n-obtains sigmas for red and blue, effectively a measure of the 'error'\n-\"\"\"\n-def get_sigma(Cam, cal_cr_list, cal_cb_list, grid_size):\n-    Cam.log += '\\nCalculating sigmas'\n-    \"\"\"\n-    provided colour alsc tables were generated for two different colour\n-    temperatures sigma is calculated by comparing two calibration temperatures\n-    adjacent in colour space\n-    \"\"\"\n-    \"\"\"\n-    create list of colour temperatures\n-    \"\"\"\n-    cts = [cal['ct'] for cal in cal_cr_list]\n-    # print(cts)\n-    \"\"\"\n-    calculate sigmas for each adjacent cts and return worst one\n-    \"\"\"\n-    sigma_rs = []\n-    sigma_bs = []\n-    for i in range(len(cts)-1):\n-        sigma_rs.append(calc_sigma(cal_cr_list[i]['table'], cal_cr_list[i+1]['table'], grid_size))\n-        sigma_bs.append(calc_sigma(cal_cb_list[i]['table'], cal_cb_list[i+1]['table'], grid_size))\n-        Cam.log += '\\nColour temperature interval {} - {} K'.format(cts[i], cts[i+1])\n-        Cam.log += '\\nSigma red: {}'.format(sigma_rs[-1])\n-        Cam.log += '\\nSigma blue: {}'.format(sigma_bs[-1])\n-\n-    \"\"\"\n-    return maximum sigmas, not necessarily from the same colour temperature\n-    interval\n-    \"\"\"\n-    sigma_r = max(sigma_rs) if sigma_rs else 0.005\n-    sigma_b = max(sigma_bs) if sigma_bs else 0.005\n-    Cam.log += '\\nMaximum sigmas: Red = {} Blue = {}'.format(sigma_r, sigma_b)\n-\n-    # print(sigma_rs, sigma_bs)\n-    # print(sigma_r, sigma_b)\n-    return sigma_r, sigma_b\n-\n-\n-\"\"\"\n-calculate sigma from two adjacent gain tables\n-\"\"\"\n-def calc_sigma(g1, g2, grid_size):\n-    grid_w, grid_h = grid_size\n-    \"\"\"\n-    reshape into 16x12 matrix\n-    \"\"\"\n-    g1 = np.reshape(g1, (grid_h, grid_w))\n-    g2 = np.reshape(g2, (grid_h, grid_w))\n-    \"\"\"\n-    apply gains to gain table\n-    \"\"\"\n-    gg = g1/g2\n-    if np.mean(gg) < 1:\n-        gg = 1/gg\n-    \"\"\"\n-    for each internal patch, compute average difference between it and its 4\n-    neighbours, then append to list\n-    \"\"\"\n-    diffs = []\n-    for i in range(grid_h - 2):\n-        for j in range(grid_w - 2):\n-            \"\"\"\n-            note indexing is incremented by 1 since all patches on borders are\n-            not counted\n-            \"\"\"\n-            diff = np.abs(gg[i+1][j+1]-gg[i][j+1])\n-            diff += np.abs(gg[i+1][j+1]-gg[i+2][j+1])\n-            diff += np.abs(gg[i+1][j+1]-gg[i+1][j])\n-            diff += np.abs(gg[i+1][j+1]-gg[i+1][j+2])\n-            diffs.append(diff/4)\n-\n-    \"\"\"\n-    return mean difference\n-    \"\"\"\n-    mean_diff = np.mean(diffs)\n-    return(np.round(mean_diff, 5))\ndiff --git a/utils/raspberrypi/ctt/ctt_awb.py b/utils/raspberrypi/ctt/ctt_awb.py\ndeleted file mode 100644\nindex 4af1fe411031..000000000000\n--- a/utils/raspberrypi/ctt/ctt_awb.py\n+++ /dev/null\n@@ -1,377 +0,0 @@\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2019, Raspberry Pi Ltd\n-#\n-# camera tuning tool for AWB\n-\n-from ctt_image_load import *\n-import matplotlib.pyplot as plt\n-from bisect import bisect_left\n-from scipy.optimize import fmin\n-\n-\n-\"\"\"\n-obtain piecewise linear approximation for colour curve\n-\"\"\"\n-def awb(Cam, cal_cr_list, cal_cb_list, plot, grid_size):\n-    imgs = Cam.imgs\n-    \"\"\"\n-    condense alsc calibration tables into one dictionary\n-    \"\"\"\n-    if cal_cr_list is None:\n-        colour_cals = None\n-    else:\n-        colour_cals = {}\n-        for cr, cb in zip(cal_cr_list, cal_cb_list):\n-            cr_tab = cr['table']\n-            cb_tab = cb['table']\n-            \"\"\"\n-            normalise tables so min value is 1\n-            \"\"\"\n-            cr_tab = cr_tab/np.min(cr_tab)\n-            cb_tab = cb_tab/np.min(cb_tab)\n-            colour_cals[cr['ct']] = [cr_tab, cb_tab]\n-    \"\"\"\n-    obtain data from greyscale macbeth patches\n-    \"\"\"\n-    rb_raw = []\n-    rbs_hat = []\n-    for Img in imgs:\n-        Cam.log += '\\nProcessing '+Img.name\n-        \"\"\"\n-        get greyscale patches with alsc applied if alsc enabled.\n-        Note: if alsc is disabled then colour_cals will be set to None and the\n-        function will just return the greyscale patches\n-        \"\"\"\n-        r_patchs, b_patchs, g_patchs = get_alsc_patches(Img, colour_cals, grid_size=grid_size)\n-        \"\"\"\n-        calculate ratio of r, b to g\n-        \"\"\"\n-        r_g = np.mean(r_patchs/g_patchs)\n-        b_g = np.mean(b_patchs/g_patchs)\n-        Cam.log += '\\n       r : {:.4f}       b : {:.4f}'.format(r_g, b_g)\n-        \"\"\"\n-        The curve tends to be better behaved in so-called hatspace.\n-        R, B, G represent the individual channels. The colour curve is plotted in\n-        r, b space, where:\n-            r = R/G\n-            b = B/G\n-        This will be referred to as dehatspace... (sorry)\n-        Hatspace is defined as:\n-            r_hat = R/(R+B+G)\n-            b_hat = B/(R+B+G)\n-        To convert from dehatspace to hastpace (hat operation):\n-            r_hat = r/(1+r+b)\n-            b_hat = b/(1+r+b)\n-        To convert from hatspace to dehatspace (dehat operation):\n-            r = r_hat/(1-r_hat-b_hat)\n-            b = b_hat/(1-r_hat-b_hat)\n-        Proof is left as an excercise to the reader...\n-        Throughout the code, r and b are sometimes referred to as r_g and b_g\n-        as a reminder that they are ratios\n-        \"\"\"\n-        r_g_hat = r_g/(1+r_g+b_g)\n-        b_g_hat = b_g/(1+r_g+b_g)\n-        Cam.log += '\\n   r_hat : {:.4f}   b_hat : {:.4f}'.format(r_g_hat, b_g_hat)\n-        rbs_hat.append((r_g_hat, b_g_hat, Img.col))\n-        rb_raw.append((r_g, b_g))\n-        Cam.log += '\\n'\n-\n-    Cam.log += '\\nFinished processing images'\n-    \"\"\"\n-    sort all lits simultaneously by r_hat\n-    \"\"\"\n-    rbs_zip = list(zip(rbs_hat, rb_raw))\n-    rbs_zip.sort(key=lambda x: x[0][0])\n-    rbs_hat, rb_raw = list(zip(*rbs_zip))\n-    \"\"\"\n-    unzip tuples ready for processing\n-    \"\"\"\n-    rbs_hat = list(zip(*rbs_hat))\n-    rb_raw = list(zip(*rb_raw))\n-    \"\"\"\n-    fit quadratic fit to r_g hat and b_g_hat\n-    \"\"\"\n-    a, b, c = np.polyfit(rbs_hat[0], rbs_hat[1], 2)\n-    Cam.log += '\\nFit quadratic curve in hatspace'\n-    \"\"\"\n-    the algorithm now approximates the shortest distance from each point to the\n-    curve in dehatspace. Since the fit is done in hatspace, it is easier to\n-    find the actual shortest distance in hatspace and use the projection back\n-    into dehatspace as an overestimate.\n-    The distance will be used for two things:\n-        1) In the case that colour temperature does not strictly decrease with\n-        increasing r/g, the closest point to the line will be chosen out of an\n-        increasing pair of colours.\n-\n-        2) To calculate transverse negative an dpositive, the maximum positive\n-        and negative distance from the line are chosen. This benefits from the\n-        overestimate as the transverse pos/neg are upper bound values.\n-    \"\"\"\n-    \"\"\"\n-    define fit function\n-    \"\"\"\n-    def f(x):\n-        return a*x**2 + b*x + c\n-    \"\"\"\n-    iterate over points (R, B are x and y coordinates of points) and calculate\n-    distance to line in dehatspace\n-    \"\"\"\n-    dists = []\n-    for i, (R, B) in enumerate(zip(rbs_hat[0], rbs_hat[1])):\n-        \"\"\"\n-        define function to minimise as square distance between datapoint and\n-        point on curve. Squaring is monotonic so minimising radius squared is\n-        equivalent to minimising radius\n-        \"\"\"\n-        def f_min(x):\n-            y = f(x)\n-            return((x-R)**2+(y-B)**2)\n-        \"\"\"\n-        perform optimisation with scipy.optmisie.fmin\n-        \"\"\"\n-        x_hat = fmin(f_min, R, disp=0)[0]\n-        y_hat = f(x_hat)\n-        \"\"\"\n-        dehat\n-        \"\"\"\n-        x = x_hat/(1-x_hat-y_hat)\n-        y = y_hat/(1-x_hat-y_hat)\n-        rr = R/(1-R-B)\n-        bb = B/(1-R-B)\n-        \"\"\"\n-        calculate euclidean distance in dehatspace\n-        \"\"\"\n-        dist = ((x-rr)**2+(y-bb)**2)**0.5\n-        \"\"\"\n-        return negative if point is below the fit curve\n-        \"\"\"\n-        if (x+y) > (rr+bb):\n-            dist *= -1\n-        dists.append(dist)\n-    Cam.log += '\\nFound closest point on fit line to each point in dehatspace'\n-    \"\"\"\n-    calculate wiggle factors in awb. 10% added since this is an upper bound\n-    \"\"\"\n-    transverse_neg = - np.min(dists) * 1.1\n-    transverse_pos = np.max(dists) * 1.1\n-    Cam.log += '\\nTransverse pos : {:.5f}'.format(transverse_pos)\n-    Cam.log += '\\nTransverse neg : {:.5f}'.format(transverse_neg)\n-    \"\"\"\n-    set minimum transverse wiggles to 0.1 .\n-    Wiggle factors dictate how far off of the curve the algorithm searches. 0.1\n-    is a suitable minimum that gives better results for lighting conditions not\n-    within calibration dataset. Anything less will generalise poorly.\n-    \"\"\"\n-    if transverse_pos < 0.01:\n-        transverse_pos = 0.01\n-        Cam.log += '\\nForced transverse pos to 0.01'\n-    if transverse_neg < 0.01:\n-        transverse_neg = 0.01\n-        Cam.log += '\\nForced transverse neg to 0.01'\n-\n-    \"\"\"\n-    generate new b_hat values at each r_hat according to fit\n-    \"\"\"\n-    r_hat_fit = np.array(rbs_hat[0])\n-    b_hat_fit = a*r_hat_fit**2 + b*r_hat_fit + c\n-    \"\"\"\n-    transform from hatspace to dehatspace\n-    \"\"\"\n-    r_fit = r_hat_fit/(1-r_hat_fit-b_hat_fit)\n-    b_fit = b_hat_fit/(1-r_hat_fit-b_hat_fit)\n-    c_fit = np.round(rbs_hat[2], 0)\n-    \"\"\"\n-    round to 4dp\n-    \"\"\"\n-    r_fit = np.where((1000*r_fit) % 1 <= 0.05, r_fit+0.0001, r_fit)\n-    r_fit = np.where((1000*r_fit) % 1 >= 0.95, r_fit-0.0001, r_fit)\n-    b_fit = np.where((1000*b_fit) % 1 <= 0.05, b_fit+0.0001, b_fit)\n-    b_fit = np.where((1000*b_fit) % 1 >= 0.95, b_fit-0.0001, b_fit)\n-    r_fit = np.round(r_fit, 4)\n-    b_fit = np.round(b_fit, 4)\n-    \"\"\"\n-    The following code ensures that colour temperature decreases with\n-    increasing r/g\n-    \"\"\"\n-    \"\"\"\n-    iterate backwards over list for easier indexing\n-    \"\"\"\n-    i = len(c_fit) - 1\n-    while i > 0:\n-        if c_fit[i] > c_fit[i-1]:\n-            Cam.log += '\\nColour temperature increase found\\n'\n-            Cam.log += '{} K at r = {} to '.format(c_fit[i-1], r_fit[i-1])\n-            Cam.log += '{} K at r = {}'.format(c_fit[i], r_fit[i])\n-            \"\"\"\n-            if colour temperature increases then discard point furthest from\n-            the transformed fit (dehatspace)\n-            \"\"\"\n-            error_1 = abs(dists[i-1])\n-            error_2 = abs(dists[i])\n-            Cam.log += '\\nDistances from fit:\\n'\n-            Cam.log += '{} K : {:.5f} , '.format(c_fit[i], error_1)\n-            Cam.log += '{} K : {:.5f}'.format(c_fit[i-1], error_2)\n-            \"\"\"\n-            find bad index\n-            note that in python false = 0 and true = 1\n-            \"\"\"\n-            bad = i - (error_1 < error_2)\n-            Cam.log += '\\nPoint at {} K deleted as '.format(c_fit[bad])\n-            Cam.log += 'it is furthest from fit'\n-            \"\"\"\n-            delete bad point\n-            \"\"\"\n-            r_fit = np.delete(r_fit, bad)\n-            b_fit = np.delete(b_fit, bad)\n-            c_fit = np.delete(c_fit, bad).astype(np.uint16)\n-        \"\"\"\n-        note that if a point has been discarded then the length has decreased\n-        by one, meaning that decreasing the index by one will reassess the kept\n-        point against the next point. It is therefore possible, in theory, for\n-        two adjacent points to be discarded, although probably rare\n-        \"\"\"\n-        i -= 1\n-\n-    \"\"\"\n-    return formatted ct curve, ordered by increasing colour temperature\n-    \"\"\"\n-    ct_curve = list(np.array(list(zip(b_fit, r_fit, c_fit))).flatten())[::-1]\n-    Cam.log += '\\nFinal CT curve:'\n-    for i in range(len(ct_curve)//3):\n-        j = 3*i\n-        Cam.log += '\\n  ct: {}  '.format(ct_curve[j])\n-        Cam.log += '  r: {}  '.format(ct_curve[j+1])\n-        Cam.log += '  b: {}  '.format(ct_curve[j+2])\n-\n-    \"\"\"\n-    plotting code for debug\n-    \"\"\"\n-    if plot:\n-        x = np.linspace(np.min(rbs_hat[0]), np.max(rbs_hat[0]), 100)\n-        y = a*x**2 + b*x + c\n-        plt.subplot(2, 1, 1)\n-        plt.title('hatspace')\n-        plt.plot(rbs_hat[0], rbs_hat[1], ls='--', color='blue')\n-        plt.plot(x, y, color='green', ls='-')\n-        plt.scatter(rbs_hat[0], rbs_hat[1], color='red')\n-        for i, ct in enumerate(rbs_hat[2]):\n-            plt.annotate(str(ct), (rbs_hat[0][i], rbs_hat[1][i]))\n-        plt.xlabel('$\\\\hat{r}$')\n-        plt.ylabel('$\\\\hat{b}$')\n-        \"\"\"\n-        optional set axes equal to shortest distance so line really does\n-        looks perpendicular and everybody is happy\n-        \"\"\"\n-        # ax = plt.gca()\n-        # ax.set_aspect('equal')\n-        plt.grid()\n-        plt.subplot(2, 1, 2)\n-        plt.title('dehatspace - indoors?')\n-        plt.plot(r_fit, b_fit, color='blue')\n-        plt.scatter(rb_raw[0], rb_raw[1], color='green')\n-        plt.scatter(r_fit, b_fit, color='red')\n-        for i, ct in enumerate(c_fit):\n-            plt.annotate(str(ct), (r_fit[i], b_fit[i]))\n-        plt.xlabel('$r$')\n-        plt.ylabel('$b$')\n-        \"\"\"\n-        optional set axes equal to shortest distance so line really does\n-        looks perpendicular and everybody is happy\n-        \"\"\"\n-        # ax = plt.gca()\n-        # ax.set_aspect('equal')\n-        plt.subplots_adjust(hspace=0.5)\n-        plt.grid()\n-        plt.show()\n-    \"\"\"\n-    end of plotting code\n-    \"\"\"\n-    return(ct_curve, np.round(transverse_pos, 5), np.round(transverse_neg, 5))\n-\n-\n-\"\"\"\n-obtain greyscale patches and perform alsc colour correction\n-\"\"\"\n-def get_alsc_patches(Img, colour_cals, grey=True, grid_size=(16, 12)):\n-    \"\"\"\n-    get patch centre coordinates, image colour and the actual\n-    patches for each channel, remembering to subtract blacklevel\n-    If grey then only greyscale patches considered\n-    \"\"\"\n-    grid_w, grid_h = grid_size\n-    if grey:\n-        cen_coords = Img.cen_coords[3::4]\n-        col = Img.col\n-        patches = [np.array(Img.patches[i]) for i in Img.order]\n-        r_patchs = patches[0][3::4] - Img.blacklevel_16\n-        b_patchs = patches[3][3::4] - Img.blacklevel_16\n-        \"\"\"\n-        note two green channels are averages\n-        \"\"\"\n-        g_patchs = (patches[1][3::4]+patches[2][3::4])/2 - Img.blacklevel_16\n-    else:\n-        cen_coords = Img.cen_coords\n-        col = Img.col\n-        patches = [np.array(Img.patches[i]) for i in Img.order]\n-        r_patchs = patches[0] - Img.blacklevel_16\n-        b_patchs = patches[3] - Img.blacklevel_16\n-        g_patchs = (patches[1]+patches[2])/2 - Img.blacklevel_16\n-\n-    if colour_cals is None:\n-        return r_patchs, b_patchs, g_patchs\n-    \"\"\"\n-    find where image colour fits in alsc colour calibration tables\n-    \"\"\"\n-    cts = list(colour_cals.keys())\n-    pos = bisect_left(cts, col)\n-    \"\"\"\n-    if img colour is below minimum or above maximum alsc calibration colour, simply\n-    pick extreme closest to img colour\n-    \"\"\"\n-    if pos % len(cts) == 0:\n-        \"\"\"\n-        this works because -0 = 0 = first and -1 = last index\n-        \"\"\"\n-        col_tabs = np.array(colour_cals[cts[-pos//len(cts)]])\n-        \"\"\"\n-    else, perform linear interpolation between existing alsc colour\n-    calibration tables\n-    \"\"\"\n-    else:\n-        bef = cts[pos-1]\n-        aft = cts[pos]\n-        da = col-bef\n-        db = aft-col\n-        bef_tabs = np.array(colour_cals[bef])\n-        aft_tabs = np.array(colour_cals[aft])\n-        col_tabs = (bef_tabs*db + aft_tabs*da)/(da+db)\n-    col_tabs = np.reshape(col_tabs, (2, grid_h, grid_w))\n-    \"\"\"\n-    calculate dx, dy used to calculate alsc table\n-    \"\"\"\n-    w, h = Img.w/2, Img.h/2\n-    dx, dy = int(-(-(w-1)//grid_w)), int(-(-(h-1)//grid_h))\n-    \"\"\"\n-    make list of pairs of gains for each patch by selecting the correct value\n-    in alsc colour calibration table\n-    \"\"\"\n-    patch_gains = []\n-    for cen in cen_coords:\n-        x, y = cen[0]//dx, cen[1]//dy\n-        # We could probably do with some better spatial interpolation here?\n-        col_gains = (col_tabs[0][y][x], col_tabs[1][y][x])\n-        patch_gains.append(col_gains)\n-\n-    \"\"\"\n-    multiply the r and b channels in each patch by the respective gain, finally\n-    performing the alsc colour correction\n-    \"\"\"\n-    for i, gains in enumerate(patch_gains):\n-        r_patchs[i] = r_patchs[i] * gains[0]\n-        b_patchs[i] = b_patchs[i] * gains[1]\n-\n-    \"\"\"\n-    return greyscale patches, g channel and correct r, b channels\n-    \"\"\"\n-    return r_patchs, b_patchs, g_patchs\ndiff --git a/utils/raspberrypi/ctt/ctt_cac.py b/utils/raspberrypi/ctt/ctt_cac.py\ndeleted file mode 100644\nindex a1183989cc43..000000000000\n--- a/utils/raspberrypi/ctt/ctt_cac.py\n+++ /dev/null\n@@ -1,250 +0,0 @@\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2023, Raspberry Pi Ltd\n-#\n-# ctt_cac.py - CAC (Chromatic Aberration Correction) tuning tool\n-\n-from PIL import Image\n-import numpy as np\n-import matplotlib.pyplot as plt\n-from matplotlib import cm\n-\n-from ctt_dots_locator import find_dots_locations\n-\n-\n-# This is the wrapper file that creates a JSON entry for you to append\n-# to your camera tuning file.\n-# It calculates the chromatic aberration at different points throughout\n-# the image and uses that to produce a martix that can then be used\n-# in the camera tuning files to correct this aberration.\n-\n-\n-def pprint_array(array):\n-    # Function to print the array in a tidier format\n-    array = array\n-    output = \"\"\n-    for i in range(len(array)):\n-        for j in range(len(array[0])):\n-            output += str(round(array[i, j], 2)) + \", \"\n-        # Add the necessary indentation to the array\n-        output += \"\\n                   \"\n-    # Cut off the end of the array (nicely formats it)\n-    return output[:-22]\n-\n-\n-def plot_shifts(red_shifts, blue_shifts):\n-    # If users want, they can pass a command line option to show the shifts on a graph\n-    # Can be useful to check that the functions are all working, and that the sample\n-    # images are doing the right thing\n-    Xs = np.array(red_shifts)[:, 0]\n-    Ys = np.array(red_shifts)[:, 1]\n-    Zs = np.array(red_shifts)[:, 2]\n-    Zs2 = np.array(red_shifts)[:, 3]\n-    Zs3 = np.array(blue_shifts)[:, 2]\n-    Zs4 = np.array(blue_shifts)[:, 3]\n-\n-    fig, axs = plt.subplots(2, 2)\n-    ax = fig.add_subplot(2, 2, 1, projection='3d')\n-    ax.scatter(Xs, Ys, Zs, cmap=cm.jet, linewidth=0)\n-    ax.set_title('Red X Shift')\n-    ax = fig.add_subplot(2, 2, 2, projection='3d')\n-    ax.scatter(Xs, Ys, Zs2, cmap=cm.jet, linewidth=0)\n-    ax.set_title('Red Y Shift')\n-    ax = fig.add_subplot(2, 2, 3, projection='3d')\n-    ax.scatter(Xs, Ys, Zs3, cmap=cm.jet, linewidth=0)\n-    ax.set_title('Blue X Shift')\n-    ax = fig.add_subplot(2, 2, 4, projection='3d')\n-    ax.scatter(Xs, Ys, Zs4, cmap=cm.jet, linewidth=0)\n-    ax.set_title('Blue Y Shift')\n-    fig.tight_layout()\n-    plt.show()\n-\n-\n-def shifts_to_yaml(red_shift, blue_shift, image_dimensions, output_grid_size=9):\n-    # Convert the shifts to a numpy array for easier handling and initialise other variables\n-    red_shifts = np.array(red_shift)\n-    blue_shifts = np.array(blue_shift)\n-    # create a grid that's smaller than the output grid, which we then interpolate from to get the output values\n-    xrgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))\n-    xbgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))\n-    yrgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))\n-    ybgrid = np.zeros((output_grid_size - 1, output_grid_size - 1))\n-\n-    xrsgrid = []\n-    xbsgrid = []\n-    yrsgrid = []\n-    ybsgrid = []\n-    xg = np.zeros((output_grid_size - 1, output_grid_size - 1))\n-    yg = np.zeros((output_grid_size - 1, output_grid_size - 1))\n-\n-    # Format the grids - numpy doesn't work for this, it wants a\n-    # nice uniformly spaced grid, which we don't know if we have yet, hence the rather mundane setup\n-    for x in range(output_grid_size - 1):\n-        xrsgrid.append([])\n-        yrsgrid.append([])\n-        xbsgrid.append([])\n-        ybsgrid.append([])\n-        for y in range(output_grid_size - 1):\n-            xrsgrid[x].append([])\n-            yrsgrid[x].append([])\n-            xbsgrid[x].append([])\n-            ybsgrid[x].append([])\n-\n-    image_size = (image_dimensions[0], image_dimensions[1])\n-    gridxsize = image_size[0] / (output_grid_size - 1)\n-    gridysize = image_size[1] / (output_grid_size - 1)\n-\n-    # Iterate through each dot, and it's shift values and put these into the correct grid location\n-    for red_shift in red_shifts:\n-        xgridloc = int(red_shift[0] / gridxsize)\n-        ygridloc = int(red_shift[1] / gridysize)\n-        xrsgrid[xgridloc][ygridloc].append(red_shift[2])\n-        yrsgrid[xgridloc][ygridloc].append(red_shift[3])\n-\n-    for blue_shift in blue_shifts:\n-        xgridloc = int(blue_shift[0] / gridxsize)\n-        ygridloc = int(blue_shift[1] / gridysize)\n-        xbsgrid[xgridloc][ygridloc].append(blue_shift[2])\n-        ybsgrid[xgridloc][ygridloc].append(blue_shift[3])\n-\n-    # Now calculate the average pixel shift for each square in the grid\n-    grid_incomplete = False\n-    for x in range(output_grid_size - 1):\n-        for y in range(output_grid_size - 1):\n-            if xrsgrid[x][y]:\n-                xrgrid[x, y] = np.mean(xrsgrid[x][y])\n-            else:\n-                grid_incomplete = True\n-            if yrsgrid[x][y]:\n-                yrgrid[x, y] = np.mean(yrsgrid[x][y])\n-            else:\n-                grid_incomplete = True\n-            if xbsgrid[x][y]:\n-                xbgrid[x, y] = np.mean(xbsgrid[x][y])\n-            else:\n-                grid_incomplete = True\n-            if ybsgrid[x][y]:\n-                ybgrid[x, y] = np.mean(ybsgrid[x][y])\n-            else:\n-                grid_incomplete = True\n-\n-    if grid_incomplete:\n-        raise RuntimeError(\"\\nERROR: CAC measurements do not span the image!\"\n-                           \"\\nConsider using improved CAC images, or remove them entirely.\\n\")\n-\n-    # Next, we start to interpolate the central points of the grid that gets passed to the tuning file\n-    input_grids = np.array([xrgrid, yrgrid, xbgrid, ybgrid])\n-    output_grids = np.zeros((4, output_grid_size, output_grid_size))\n-\n-    # Interpolate the centre of the grid\n-    output_grids[:, 1:-1, 1:-1] = (input_grids[:, 1:, :-1] + input_grids[:, 1:, 1:] + input_grids[:, :-1, 1:] + input_grids[:, :-1, :-1]) / 4\n-\n-    # Edge cases:\n-    output_grids[:, 1:-1, 0] = ((input_grids[:, :-1, 0] + input_grids[:, 1:, 0]) / 2 - output_grids[:, 1:-1, 1]) * 2 + output_grids[:, 1:-1, 1]\n-    output_grids[:, 1:-1, -1] = ((input_grids[:, :-1, 7] + input_grids[:, 1:, 7]) / 2 - output_grids[:, 1:-1, -2]) * 2 + output_grids[:, 1:-1, -2]\n-    output_grids[:, 0, 1:-1] = ((input_grids[:, 0, :-1] + input_grids[:, 0, 1:]) / 2 - output_grids[:, 1, 1:-1]) * 2 + output_grids[:, 1, 1:-1]\n-    output_grids[:, -1, 1:-1] = ((input_grids[:, 7, :-1] + input_grids[:, 7, 1:]) / 2 - output_grids[:, -2, 1:-1]) * 2 + output_grids[:, -2, 1:-1]\n-\n-    # Corner Cases:\n-    output_grids[:, 0, 0] = (output_grids[:, 0, 1] - output_grids[:, 1, 1]) + (output_grids[:, 1, 0] - output_grids[:, 1, 1]) + output_grids[:, 1, 1]\n-    output_grids[:, 0, -1] = (output_grids[:, 0, -2] - output_grids[:, 1, -2]) + (output_grids[:, 1, -1] - output_grids[:, 1, -2]) + output_grids[:, 1, -2]\n-    output_grids[:, -1, 0] = (output_grids[:, -1, 1] - output_grids[:, -2, 1]) + (output_grids[:, -2, 0] - output_grids[:, -2, 1]) + output_grids[:, -2, 1]\n-    output_grids[:, -1, -1] = (output_grids[:, -2, -1] - output_grids[:, -2, -2]) + (output_grids[:, -1, -2] - output_grids[:, -2, -2]) + output_grids[:, -2, -2]\n-\n-    # Below, we swap the x and the y coordinates, and also multiply by a factor of -1\n-    # This is due to the PiSP (standard) dimensions being flipped in comparison to\n-    # PIL image coordinate directions, hence why xr -> yr. Also, the shifts calculated are colour shifts,\n-    # and the PiSP block asks for the values it should shift by (hence the * -1, to convert from colour shift to a pixel shift)\n-\n-    output_grid_yr, output_grid_xr, output_grid_yb, output_grid_xb = output_grids * -1\n-    return output_grid_xr, output_grid_yr, output_grid_xb, output_grid_yb\n-\n-\n-def analyse_dot(dot, dot_location=[0, 0]):\n-    # Scan through the dot, calculate the centroid of each colour channel by doing:\n-    # pixel channel brightness * distance from top left corner\n-    # Sum these, and divide by the sum of each channel's brightnesses to get a centroid for each channel\n-    red_channel = np.array(dot)[:, :, 0]\n-    y_num_pixels = len(red_channel[0])\n-    x_num_pixels = len(red_channel)\n-    yred_weight = np.sum(np.dot(red_channel, np.arange(y_num_pixels)))\n-    xred_weight = np.sum(np.dot(np.arange(x_num_pixels), red_channel))\n-    red_sum = np.sum(red_channel)\n-\n-    green_channel = np.array(dot)[:, :, 1]\n-    ygreen_weight = np.sum(np.dot(green_channel, np.arange(y_num_pixels)))\n-    xgreen_weight = np.sum(np.dot(np.arange(x_num_pixels), green_channel))\n-    green_sum = np.sum(green_channel)\n-\n-    blue_channel = np.array(dot)[:, :, 2]\n-    yblue_weight = np.sum(np.dot(blue_channel, np.arange(y_num_pixels)))\n-    xblue_weight = np.sum(np.dot(np.arange(x_num_pixels), blue_channel))\n-    blue_sum = np.sum(blue_channel)\n-\n-    # We return this structure. It contains 2 arrays that contain:\n-    # the locations of the dot center, along with the channel shifts in the x and y direction:\n-    # [ [red_center_x, red_center_y, red_x_shift, red_y_shift], [blue_center_x, blue_center_y, blue_x_shift, blue_y_shift] ]\n-\n-    return [[int(dot_location[0]) + int(len(dot) / 2), int(dot_location[1]) + int(len(dot[0]) / 2), xred_weight / red_sum - xgreen_weight / green_sum, yred_weight / red_sum - ygreen_weight / green_sum], [dot_location[0] + int(len(dot) / 2), dot_location[1] + int(len(dot[0]) / 2), xblue_weight / blue_sum - xgreen_weight / green_sum, yblue_weight / blue_sum - ygreen_weight / green_sum]]\n-\n-\n-def cac(Cam):\n-    filelist = Cam.imgs_cac\n-\n-    Cam.log += '\\nCAC analysing files: {}'.format(str(filelist))\n-    np.set_printoptions(precision=3)\n-    np.set_printoptions(suppress=True)\n-\n-    # Create arrays to hold all the dots data and their colour offsets\n-    red_shift = []  # Format is: [[Dot Center X, Dot Center Y, x shift, y shift]]\n-    blue_shift = []\n-    # Iterate through the files\n-    # Multiple files is reccomended to average out the lens aberration through rotations\n-    for file in filelist:\n-        Cam.log += '\\nCAC processing file'\n-        print(\"\\n Processing file\")\n-        # Read the raw RGB values\n-        rgb = file.rgb\n-        image_size = [file.h, file.w]  # Image size, X, Y\n-        # Create a colour copy of the RGB values to use later in the calibration\n-        imout = Image.new(mode=\"RGB\", size=image_size)\n-        rgb_image = np.array(imout)\n-        # The rgb values need reshaping from a 1d array to a 3d array to be worked with easily\n-        rgb.reshape((image_size[0], image_size[1], 3))\n-        rgb_image = rgb\n-\n-        # Pass the RGB image through to the dots locating program\n-        # Returns an array of the dots (colour rectangles around the dots), and an array of their locations\n-        print(\"Finding dots\")\n-        Cam.log += '\\nFinding dots'\n-        dots, dots_locations = find_dots_locations(rgb_image)\n-\n-        # Now, analyse each dot. Work out the centroid of each colour channel, and use that to work out\n-        # by how far the chromatic aberration has shifted each channel\n-        Cam.log += '\\nDots found: {}'.format(str(len(dots)))\n-        print('Dots found: ' + str(len(dots)))\n-\n-        for dot, dot_location in zip(dots, dots_locations):\n-            if len(dot) > 0:\n-                if (dot_location[0] > 0) and (dot_location[1] > 0):\n-                    ret = analyse_dot(dot, dot_location)\n-                    red_shift.append(ret[0])\n-                    blue_shift.append(ret[1])\n-\n-    # Take our arrays of red shifts and locations, push them through to be interpolated into a 9x9 matrix\n-    # for the CAC block to handle and then store these as a .json file to be added to the camera\n-    # tuning file\n-    print(\"\\nCreating output grid\")\n-    Cam.log += '\\nCreating output grid'\n-    try:\n-        rx, ry, bx, by = shifts_to_yaml(red_shift, blue_shift, image_size)\n-    except RuntimeError as e:\n-        print(str(e))\n-        Cam.log += \"\\nCAC correction failed! CAC will not be enabled.\"\n-        return {}\n-\n-    print(\"CAC correction complete!\")\n-    Cam.log += '\\nCAC correction complete!'\n-\n-    # Give the JSON dict back to the main ctt program\n-    return {\"strength\": 1.0, \"lut_rx\": list(rx.round(2).reshape(81)), \"lut_ry\": list(ry.round(2).reshape(81)), \"lut_bx\": list(bx.round(2).reshape(81)), \"lut_by\": list(by.round(2).reshape(81))}\ndiff --git a/utils/raspberrypi/ctt/ctt_ccm.py b/utils/raspberrypi/ctt/ctt_ccm.py\ndeleted file mode 100644\nindex 07c943a8cbbb..000000000000\n--- a/utils/raspberrypi/ctt/ctt_ccm.py\n+++ /dev/null\n@@ -1,404 +0,0 @@\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2019, Raspberry Pi Ltd\n-#\n-# camera tuning tool for CCM (colour correction matrix)\n-\n-from ctt_image_load import *\n-from ctt_awb import get_alsc_patches\n-import colors\n-from scipy.optimize import minimize\n-from ctt_visualise import visualise_macbeth_chart\n-import numpy as np\n-\"\"\"\n-takes 8-bit macbeth chart values, degammas and returns 16 bit\n-\"\"\"\n-\n-'''\n-This program has many options from which to derive the color matrix from.\n-The first is average. This minimises the average delta E across all patches of\n-the macbeth chart. Testing across all cameras yeilded this as the most color\n-accurate and vivid. Other options are avalible however.\n-Maximum minimises the maximum Delta E of the patches. It iterates through till\n-a minimum maximum is found (so that there is\n-not one patch that deviates wildly.)\n-This yields generally good results but overall the colors are less accurate\n-Have a fiddle with maximum and see what you think.\n-The final option allows you to select the patches for which to average across.\n-This means that you can bias certain patches, for instance if you want the\n-reds to be more accurate.\n-'''\n-\n-matrix_selection_types = [\"average\", \"maximum\", \"patches\"]\n-typenum = 0  # select from array above, 0 = average, 1 = maximum, 2 = patches\n-test_patches = [1, 2, 5, 8, 9, 12, 14]\n-\n-'''\n-Enter patches to test for. Can also be entered twice if you\n-would like twice as much bias on one patch.\n-'''\n-\n-\n-def degamma(x):\n-    x = x / ((2 ** 8) - 1)  # takes 255 and scales it down to one\n-    x = np.where(x < 0.04045, x / 12.92, ((x + 0.055) / 1.055) ** 2.4)\n-    x = x * ((2 ** 16) - 1)  # takes one and scales up to 65535, 16 bit color\n-    return x\n-\n-\n-def gamma(x):\n-    # Take 3 long array of color values and gamma them\n-    return [((colour / 255) ** (1 / 2.4) * 1.055 - 0.055) * 255 for colour in x]\n-\n-\n-\"\"\"\n-FInds colour correction matrices for list of images\n-\"\"\"\n-\n-\n-def ccm(Cam, cal_cr_list, cal_cb_list, grid_size):\n-    global matrix_selection_types, typenum\n-    imgs = Cam.imgs\n-    \"\"\"\n-    standard macbeth chart colour values\n-    \"\"\"\n-    m_rgb = np.array([  # these are in RGB\n-        [116, 81, 67],    # dark skin\n-        [199, 147, 129],  # light skin\n-        [91, 122, 156],   # blue sky\n-        [90, 108, 64],    # foliage\n-        [130, 128, 176],  # blue flower\n-        [92, 190, 172],   # bluish green\n-        [224, 124, 47],   # orange\n-        [68, 91, 170],    # purplish blue\n-        [198, 82, 97],    # moderate red\n-        [94, 58, 106],    # purple\n-        [159, 189, 63],   # yellow green\n-        [230, 162, 39],   # orange yellow\n-        [35, 63, 147],    # blue\n-        [67, 149, 74],    # green\n-        [180, 49, 57],    # red\n-        [238, 198, 20],   # yellow\n-        [193, 84, 151],   # magenta\n-        [0, 136, 170],    # cyan (goes out of gamut)\n-        [245, 245, 243],  # white 9.5\n-        [200, 202, 202],  # neutral 8\n-        [161, 163, 163],  # neutral 6.5\n-        [121, 121, 122],  # neutral 5\n-        [82, 84, 86],     # neutral 3.5\n-        [49, 49, 51]      # black 2\n-    ])\n-    \"\"\"\n-    convert reference colours from srgb to rgb\n-    \"\"\"\n-    m_srgb = degamma(m_rgb)  # now in 16 bit color.\n-\n-    # Produce array of LAB values for ideal color chart\n-    m_lab = [colors.RGB_to_LAB(color / 256) for color in m_srgb]\n-\n-    \"\"\"\n-    reorder reference values to match how patches are ordered\n-    \"\"\"\n-    m_srgb = np.array([m_srgb[i::6] for i in range(6)]).reshape((24, 3))\n-    m_lab = np.array([m_lab[i::6] for i in range(6)]).reshape((24, 3))\n-    m_rgb = np.array([m_rgb[i::6] for i in range(6)]).reshape((24, 3))\n-    \"\"\"\n-    reformat alsc correction tables or set colour_cals to None if alsc is\n-    deactivated\n-    \"\"\"\n-    if cal_cr_list is None:\n-        colour_cals = None\n-    else:\n-        colour_cals = {}\n-        for cr, cb in zip(cal_cr_list, cal_cb_list):\n-            cr_tab = cr['table']\n-            cb_tab = cb['table']\n-            \"\"\"\n-            normalise tables so min value is 1\n-            \"\"\"\n-            cr_tab = cr_tab / np.min(cr_tab)\n-            cb_tab = cb_tab / np.min(cb_tab)\n-            colour_cals[cr['ct']] = [cr_tab, cb_tab]\n-\n-    \"\"\"\n-    for each image, perform awb and alsc corrections.\n-    Then calculate the colour correction matrix for that image, recording the\n-    ccm and the colour tempertaure.\n-    \"\"\"\n-    ccm_tab = {}\n-    for Img in imgs:\n-        Cam.log += '\\nProcessing image: ' + Img.name\n-        \"\"\"\n-        get macbeth patches with alsc applied if alsc enabled.\n-        Note: if alsc is disabled then colour_cals will be set to None and no\n-        the function will simply return the macbeth patches\n-        \"\"\"\n-        r, b, g = get_alsc_patches(Img, colour_cals, grey=False, grid_size=grid_size)\n-        \"\"\"\n-        do awb\n-        Note: awb is done by measuring the macbeth chart in the image, rather\n-        than from the awb calibration. This is done so the awb will be perfect\n-        and the ccm matrices will be more accurate.\n-        \"\"\"\n-        r_greys, b_greys, g_greys = r[3::4], b[3::4], g[3::4]\n-        r_g = np.mean(r_greys / g_greys)\n-        b_g = np.mean(b_greys / g_greys)\n-        r = r / r_g\n-        b = b / b_g\n-        \"\"\"\n-        normalise brightness wrt reference macbeth colours and then average\n-        each channel for each patch\n-        \"\"\"\n-        gain = np.mean(m_srgb) / np.mean((r, g, b))\n-        Cam.log += '\\nGain with respect to standard colours: {:.3f}'.format(gain)\n-        r = np.mean(gain * r, axis=1)\n-        b = np.mean(gain * b, axis=1)\n-        g = np.mean(gain * g, axis=1)\n-        \"\"\"\n-        calculate ccm matrix\n-        \"\"\"\n-        # ==== All of below should in sRGB ===##\n-        sumde = 0\n-        ccm = do_ccm(r, g, b, m_srgb)\n-        # This is the initial guess that our optimisation code works with.\n-        original_ccm = ccm\n-        r1 = ccm[0]\n-        r2 = ccm[1]\n-        g1 = ccm[3]\n-        g2 = ccm[4]\n-        b1 = ccm[6]\n-        b2 = ccm[7]\n-        '''\n-        COLOR MATRIX LOOKS AS BELOW\n-        R1 R2 R3   Rval     Outr\n-        G1 G2 G3  *  Gval  =  G\n-        B1 B2 B3   Bval     B\n-        Will be optimising 6 elements and working out the third element using 1-r1-r2 = r3\n-        '''\n-\n-        x0 = [r1, r2, g1, g2, b1, b2]\n-        '''\n-        We use our old CCM as the initial guess for the program to find the\n-        optimised matrix\n-        '''\n-        result = minimize(guess, x0, args=(r, g, b, m_lab), tol=0.01)\n-        '''\n-        This produces a color matrix which has the lowest delta E possible,\n-        based off the input data. Note it is impossible for this to reach\n-        zero since the input data is imperfect\n-        '''\n-\n-        Cam.log += (\"\\n \\n Optimised Matrix Below: \\n \\n\")\n-        [r1, r2, g1, g2, b1, b2] = result.x\n-        # The new, optimised color correction matrix values\n-        optimised_ccm = [r1, r2, (1 - r1 - r2), g1, g2, (1 - g1 - g2), b1, b2, (1 - b1 - b2)]\n-\n-        # This is the optimised Color Matrix (preserving greys by summing rows up to 1)\n-        Cam.log += str(optimised_ccm)\n-        Cam.log += \"\\n Old Color Correction Matrix Below \\n\"\n-        Cam.log += str(ccm)\n-\n-        formatted_ccm = np.array(original_ccm).reshape((3, 3))\n-\n-        '''\n-        below is a whole load of code that then applies the latest color\n-        matrix, and returns LAB values for color. This can then be used\n-        to calculate the final delta E\n-        '''\n-        optimised_ccm_rgb = []  # Original Color Corrected Matrix RGB / LAB\n-        optimised_ccm_lab = []\n-\n-        formatted_optimised_ccm = np.array(optimised_ccm).reshape((3, 3))\n-        after_gamma_rgb = []\n-        after_gamma_lab = []\n-\n-        for RGB in zip(r, g, b):\n-            ccm_applied_rgb = np.dot(formatted_ccm, (np.array(RGB) / 256))\n-            optimised_ccm_rgb.append(gamma(ccm_applied_rgb))\n-            optimised_ccm_lab.append(colors.RGB_to_LAB(ccm_applied_rgb))\n-\n-            optimised_ccm_applied_rgb = np.dot(formatted_optimised_ccm, np.array(RGB) / 256)\n-            after_gamma_rgb.append(gamma(optimised_ccm_applied_rgb))\n-            after_gamma_lab.append(colors.RGB_to_LAB(optimised_ccm_applied_rgb))\n-        '''\n-        Gamma After RGB / LAB - not used in calculations, only used for visualisation\n-        We now want to spit out some data that shows\n-        how the optimisation has improved the color matrices\n-        '''\n-        Cam.log += \"Here are the Improvements\"\n-\n-        # CALCULATE WORST CASE delta e\n-        old_worst_delta_e = 0\n-        before_average = transform_and_evaluate(formatted_ccm, r, g, b, m_lab)\n-        new_worst_delta_e = 0\n-        after_average = transform_and_evaluate(formatted_optimised_ccm, r, g, b, m_lab)\n-        for i in range(24):\n-            old_delta_e = deltae(optimised_ccm_lab[i], m_lab[i])  # Current Old Delta E\n-            new_delta_e = deltae(after_gamma_lab[i], m_lab[i])  # Current New Delta E\n-            if old_delta_e > old_worst_delta_e:\n-                old_worst_delta_e = old_delta_e\n-            if new_delta_e > new_worst_delta_e:\n-                new_worst_delta_e = new_delta_e\n-\n-        Cam.log += \"Before color correction matrix was optimised, we got an average delta E of \" + str(before_average) + \" and a maximum delta E of \" + str(old_worst_delta_e)\n-        Cam.log += \"After color correction matrix was optimised, we got an average delta E of \" + str(after_average) + \" and a maximum delta E of \" + str(new_worst_delta_e)\n-\n-        visualise_macbeth_chart(m_rgb, optimised_ccm_rgb, after_gamma_rgb, str(Img.col) + str(matrix_selection_types[typenum]))\n-        '''\n-        The program will also save some visualisations of improvements.\n-        Very pretty to look at. Top rectangle is ideal, Left square is\n-        before optimisation, right square is after.\n-        '''\n-\n-        \"\"\"\n-        if a ccm has already been calculated for that temperature then don't\n-        overwrite but save both. They will then be averaged later on\n-        \"\"\"  # Now going to use optimised color matrix, optimised_ccm\n-        if Img.col in ccm_tab.keys():\n-            ccm_tab[Img.col].append(optimised_ccm)\n-        else:\n-            ccm_tab[Img.col] = [optimised_ccm]\n-        Cam.log += '\\n'\n-\n-    Cam.log += '\\nFinished processing images'\n-    \"\"\"\n-    average any ccms that share a colour temperature\n-    \"\"\"\n-    for k, v in ccm_tab.items():\n-        tab = np.mean(v, axis=0)\n-        tab = np.where((10000 * tab) % 1 <= 0.05, tab + 0.00001, tab)\n-        tab = np.where((10000 * tab) % 1 >= 0.95, tab - 0.00001, tab)\n-        ccm_tab[k] = list(np.round(tab, 5))\n-        Cam.log += '\\nMatrix calculated for colour temperature of {} K'.format(k)\n-\n-    \"\"\"\n-    return all ccms with respective colour temperature in the correct format,\n-    sorted by their colour temperature\n-    \"\"\"\n-    sorted_ccms = sorted(ccm_tab.items(), key=lambda kv: kv[0])\n-    ccms = []\n-    for i in sorted_ccms:\n-        ccms.append({\n-            'ct': i[0],\n-            'ccm': i[1]\n-        })\n-    return ccms\n-\n-\n-def guess(x0, r, g, b, m_lab):       # provides a method of numerical feedback for the optimisation code\n-    [r1, r2, g1, g2, b1, b2] = x0\n-    ccm = np.array([r1, r2, (1 - r1 - r2),\n-                    g1, g2, (1 - g1 - g2),\n-                    b1, b2, (1 - b1 - b2)]).reshape((3, 3))  # format the matrix correctly\n-    return transform_and_evaluate(ccm, r, g, b, m_lab)\n-\n-\n-def transform_and_evaluate(ccm, r, g, b, m_lab):  # Transforms colors to LAB and applies the correction matrix\n-    # create list of matrix changed colors\n-    realrgb = []\n-    for RGB in zip(r, g, b):\n-        rgb_post_ccm = np.dot(ccm, np.array(RGB) / 256)  # This is RGB values after the color correction matrix has been applied\n-        realrgb.append(colors.RGB_to_LAB(rgb_post_ccm))\n-    # now compare that with m_lab and return numeric result, averaged for each patch\n-    return (sumde(realrgb, m_lab) / 24)  # returns an average result of delta E\n-\n-\n-def sumde(listA, listB):\n-    global typenum, test_patches\n-    sumde = 0\n-    maxde = 0\n-    patchde = []  # Create array of the delta E values for each patch. useful for optimisation of certain patches\n-    for listA_item, listB_item in zip(listA, listB):\n-        if maxde < (deltae(listA_item, listB_item)):\n-            maxde = deltae(listA_item, listB_item)\n-        patchde.append(deltae(listA_item, listB_item))\n-        sumde += deltae(listA_item, listB_item)\n-    '''\n-    The different options specified at the start allow for\n-    the maximum to be returned, average or specific patches\n-    '''\n-    if typenum == 0:\n-        return sumde\n-    if typenum == 1:\n-        return maxde\n-    if typenum == 2:\n-        output = sum([patchde[test_patch] for test_patch in test_patches])\n-        # Selects only certain patches and returns the output for them\n-        return output\n-\n-\n-\"\"\"\n-calculates the ccm for an individual image.\n-ccms are calculated in rgb space, and are fit by hand. Although it is a 3x3\n-matrix, each row must add up to 1 in order to conserve greyness, simplifying\n-calculation.\n-The initial CCM is calculated in RGB, and then optimised in LAB color space\n-This simplifies the initial calculation but then gets us the accuracy of\n-using LAB color space.\n-\"\"\"\n-\n-\n-def do_ccm(r, g, b, m_srgb):\n-    rb = r-b\n-    gb = g-b\n-    rb_2s = (rb * rb)\n-    rb_gbs = (rb * gb)\n-    gb_2s = (gb * gb)\n-\n-    r_rbs = rb * (m_srgb[..., 0] - b)\n-    r_gbs = gb * (m_srgb[..., 0] - b)\n-    g_rbs = rb * (m_srgb[..., 1] - b)\n-    g_gbs = gb * (m_srgb[..., 1] - b)\n-    b_rbs = rb * (m_srgb[..., 2] - b)\n-    b_gbs = gb * (m_srgb[..., 2] - b)\n-\n-    \"\"\"\n-    Obtain least squares fit\n-    \"\"\"\n-    rb_2 = np.sum(rb_2s)\n-    gb_2 = np.sum(gb_2s)\n-    rb_gb = np.sum(rb_gbs)\n-    r_rb = np.sum(r_rbs)\n-    r_gb = np.sum(r_gbs)\n-    g_rb = np.sum(g_rbs)\n-    g_gb = np.sum(g_gbs)\n-    b_rb = np.sum(b_rbs)\n-    b_gb = np.sum(b_gbs)\n-\n-    det = rb_2 * gb_2 - rb_gb * rb_gb\n-\n-    \"\"\"\n-    Raise error if matrix is singular...\n-    This shouldn't really happen with real data but if it does just take new\n-    pictures and try again, not much else to be done unfortunately...\n-    \"\"\"\n-    if det < 0.001:\n-        raise ArithmeticError\n-\n-    r_a = (gb_2 * r_rb - rb_gb * r_gb) / det\n-    r_b = (rb_2 * r_gb - rb_gb * r_rb) / det\n-    \"\"\"\n-    Last row can be calculated by knowing the sum must be 1\n-    \"\"\"\n-    r_c = 1 - r_a - r_b\n-\n-    g_a = (gb_2 * g_rb - rb_gb * g_gb) / det\n-    g_b = (rb_2 * g_gb - rb_gb * g_rb) / det\n-    g_c = 1 - g_a - g_b\n-\n-    b_a = (gb_2 * b_rb - rb_gb * b_gb) / det\n-    b_b = (rb_2 * b_gb - rb_gb * b_rb) / det\n-    b_c = 1 - b_a - b_b\n-\n-    \"\"\"\n-    format ccm\n-    \"\"\"\n-    ccm = [r_a, r_b, r_c, g_a, g_b, g_c, b_a, b_b, b_c]\n-\n-    return ccm\n-\n-\n-def deltae(colorA, colorB):\n-    return ((colorA[0] - colorB[0]) ** 2 + (colorA[1] - colorB[1]) ** 2 + (colorA[2] - colorB[2]) ** 2) ** 0.5\n-    # return ((colorA[1]-colorB[1]) *  * 2 + (colorA[2]-colorB[2]) *  * 2) *  * 0.5\n-    # UNCOMMENT IF YOU WANT TO NEGLECT LUMINANCE FROM CALCULATION OF DELTA E\ndiff --git a/utils/raspberrypi/ctt/ctt_config_example.json b/utils/raspberrypi/ctt/ctt_config_example.json\ndeleted file mode 100644\nindex 1105862c8a4b..000000000000\n--- a/utils/raspberrypi/ctt/ctt_config_example.json\n+++ /dev/null\n@@ -1,17 +0,0 @@\n-{\n-  \"disable\": [],\n-  \"plot\": [],\n-  \"alsc\": {\n-    \"do_alsc_colour\": 1,\n-    \"luminance_strength\": 0.8,\n-    \"max_gain\": 8.0\n-  },\n-  \"awb\": {\n-    \"greyworld\": 0\n-  },\n-  \"blacklevel\": -1,\n-  \"macbeth\": {\n-    \"small\": 0,\n-    \"show\": 0\n-  }\n-}\ndiff --git a/utils/raspberrypi/ctt/ctt_dots_locator.py b/utils/raspberrypi/ctt/ctt_dots_locator.py\ndeleted file mode 100644\nindex 4945c04bfebb..000000000000\n--- a/utils/raspberrypi/ctt/ctt_dots_locator.py\n+++ /dev/null\n@@ -1,118 +0,0 @@\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2023, Raspberry Pi Ltd\n-#\n-# find_dots.py - Used by CAC algorithm to convert image to set of dots\n-\n-'''\n-This file takes the black and white version of the image, along with\n-the color version. It then located the black dots on the image by\n-thresholding dark pixels.\n-In a rather fun way, the algorithm bounces around the thresholded area in a random path\n-We then use the maximum and minimum of these paths to determine the dot shape and size\n-This info is then used to return colored dots and locations back to the main file\n-'''\n-\n-import numpy as np\n-import random\n-from PIL import Image, ImageEnhance, ImageFilter\n-\n-\n-def find_dots_locations(rgb_image, color_threshold=100, dots_edge_avoid=75, image_edge_avoid=10, search_path_length=500, grid_scan_step_size=10, logfile=open(\"log.txt\", \"a+\")):\n-    # Initialise some starting variables\n-    pixels = Image.fromarray(rgb_image)\n-    pixels = pixels.convert(\"L\")\n-    enhancer = ImageEnhance.Contrast(pixels)\n-    im_output = enhancer.enhance(1.4)\n-    # We smooth it slightly to make it easier for the dot recognition program to locate the dots\n-    im_output = im_output.filter(ImageFilter.GaussianBlur(radius=2))\n-    bw_image = np.array(im_output)\n-\n-    location = [0, 0]\n-    dots = []\n-    dots_location = []\n-    # the program takes away the edges - we don't want a dot that is half a circle, the\n-    # centroids would all be wrong\n-    for x in range(dots_edge_avoid, len(bw_image) - dots_edge_avoid, grid_scan_step_size):\n-        for y in range(dots_edge_avoid, len(bw_image[0]) - dots_edge_avoid, grid_scan_step_size):\n-            location = [x, y]\n-            scrap_dot = False  # A variable used to make sure that this is a valid dot\n-            if (bw_image[location[0], location[1]] < color_threshold) and not (scrap_dot):\n-                heading = \"south\"  # Define a starting direction to move in\n-                coords = []\n-                for i in range(search_path_length):  # Creates a path of length `search_path_length`. This turns out to always be enough to work out the rough shape of the dot.\n-                    # Now make sure that the thresholded area doesn't come within 10 pixels of the edge of the image, ensures we capture all the CA\n-                    if ((image_edge_avoid < location[0] < len(bw_image) - image_edge_avoid) and (image_edge_avoid < location[1] < len(bw_image[0]) - image_edge_avoid)) and not (scrap_dot):\n-                        if heading == \"south\":\n-                            if bw_image[location[0] + 1, location[1]] < color_threshold:\n-                                # Here, notice it does not go south, but actually goes southeast\n-                                # This is crucial in ensuring that we make our way around the majority of the dot\n-                                location[0] = location[0] + 1\n-                                location[1] = location[1] + 1\n-                                heading = \"south\"\n-                            else:\n-                                # This happens when we reach a thresholded edge. We now randomly change direction and keep searching\n-                                dir = random.randint(1, 2)\n-                                if dir == 1:\n-                                    heading = \"west\"\n-                                if dir == 2:\n-                                    heading = \"east\"\n-\n-                        if heading == \"east\":\n-                            if bw_image[location[0], location[1] + 1] < color_threshold:\n-                                location[1] = location[1] + 1\n-                                heading = \"east\"\n-                            else:\n-                                dir = random.randint(1, 2)\n-                                if dir == 1:\n-                                    heading = \"north\"\n-                                if dir == 2:\n-                                    heading = \"south\"\n-\n-                        if heading == \"west\":\n-                            if bw_image[location[0], location[1] - 1] < color_threshold:\n-                                location[1] = location[1] - 1\n-                                heading = \"west\"\n-                            else:\n-                                dir = random.randint(1, 2)\n-                                if dir == 1:\n-                                    heading = \"north\"\n-                                if dir == 2:\n-                                    heading = \"south\"\n-\n-                        if heading == \"north\":\n-                            if bw_image[location[0] - 1, location[1]] < color_threshold:\n-                                location[0] = location[0] - 1\n-                                heading = \"north\"\n-                            else:\n-                                dir = random.randint(1, 2)\n-                                if dir == 1:\n-                                    heading = \"west\"\n-                                if dir == 2:\n-                                    heading = \"east\"\n-                        # Log where our particle travels across the dot\n-                        coords.append([location[0], location[1]])\n-                    else:\n-                        scrap_dot = True  # We just don't have enough space around the dot, discard this one, and move on\n-                if not scrap_dot:\n-                    # get the size of the dot surrounding the dot\n-                    x_coords = np.array(coords)[:, 0]\n-                    y_coords = np.array(coords)[:, 1]\n-                    hsquaresize = max(list(x_coords)) - min(list(x_coords))\n-                    vsquaresize = max(list(y_coords)) - min(list(y_coords))\n-                    # Create the bounding coordinates of the rectangle surrounding the dot\n-                    # Program uses the dotsize + half of the dotsize to ensure we get all that color fringing\n-                    extra_space_factor = 0.45\n-                    top_left_x = (min(list(x_coords)) - int(hsquaresize * extra_space_factor))\n-                    btm_right_x = max(list(x_coords)) + int(hsquaresize * extra_space_factor)\n-                    top_left_y = (min(list(y_coords)) - int(vsquaresize * extra_space_factor))\n-                    btm_right_y = max(list(y_coords)) + int(vsquaresize * extra_space_factor)\n-                    # Overwrite the area of the dot to ensure we don't use it again\n-                    bw_image[top_left_x:btm_right_x, top_left_y:btm_right_y] = 255\n-                    # Add the color version of the dot to the list to send off, along with some coordinates.\n-                    dots.append(rgb_image[top_left_x:btm_right_x, top_left_y:btm_right_y])\n-                    dots_location.append([top_left_x, top_left_y])\n-                else:\n-                    # Dot was too close to the image border to be useable\n-                    pass\n-    return dots, dots_location\ndiff --git a/utils/raspberrypi/ctt/ctt_geq.py b/utils/raspberrypi/ctt/ctt_geq.py\ndeleted file mode 100644\nindex 5a91ebb48fd6..000000000000\n--- a/utils/raspberrypi/ctt/ctt_geq.py\n+++ /dev/null\n@@ -1,181 +0,0 @@\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2019, Raspberry Pi Ltd\n-#\n-# camera tuning tool for GEQ (green equalisation)\n-\n-from ctt_tools import *\n-import matplotlib.pyplot as plt\n-import scipy.optimize as optimize\n-\n-\n-\"\"\"\n-Uses green differences in macbeth patches to fit green equalisation threshold\n-model. Ideally, all macbeth chart centres would fall below the threshold as\n-these should be corrected by geq.\n-\"\"\"\n-def geq_fit(Cam, plot):\n-    imgs = Cam.imgs\n-    \"\"\"\n-    green equalisation to mitigate mazing.\n-    Fits geq model by looking at difference\n-    between greens in macbeth patches\n-    \"\"\"\n-    geqs = np.array([geq(Cam, Img)*Img.againQ8_norm for Img in imgs])\n-    Cam.log += '\\nProcessed all images'\n-    geqs = geqs.reshape((-1, 2))\n-    \"\"\"\n-    data is sorted by green difference and top half is selected since higher\n-    green difference data define the decision boundary.\n-    \"\"\"\n-    geqs = np.array(sorted(geqs, key=lambda r: np.abs((r[1]-r[0])/r[0])))\n-\n-    length = len(geqs)\n-    g0 = geqs[length//2:, 0]\n-    g1 = geqs[length//2:, 1]\n-    gdiff = np.abs(g0-g1)\n-    \"\"\"\n-    find linear fit by minimising asymmetric least square errors\n-    in order to cover most of the macbeth images.\n-    the philosophy here is that every macbeth patch should fall within the\n-    threshold, hence the upper bound approach\n-    \"\"\"\n-    def f(params):\n-        m, c = params\n-        a = gdiff - (m*g0+c)\n-        \"\"\"\n-        asymmetric square error returns:\n-            1.95 * a**2 if a is positive\n-            0.05 * a**2 if a is negative\n-        \"\"\"\n-        return(np.sum(a**2+0.95*np.abs(a)*a))\n-\n-    initial_guess = [0.01, 500]\n-    \"\"\"\n-    Nelder-Mead is usually not the most desirable optimisation method\n-    but has been chosen here due to its robustness to undifferentiability\n-    (is that a word?)\n-    \"\"\"\n-    result = optimize.minimize(f, initial_guess, method='Nelder-Mead')\n-    \"\"\"\n-    need to check if the fit worked correectly\n-    \"\"\"\n-    if result.success:\n-        slope, offset = result.x\n-        Cam.log += '\\nFit result: slope = {:.5f} '.format(slope)\n-        Cam.log += 'offset = {}'.format(int(offset))\n-        \"\"\"\n-        optional plotting code\n-        \"\"\"\n-        if plot:\n-            x = np.linspace(max(g0)*1.1, 100)\n-            y = slope*x + offset\n-            plt.title('GEQ Asymmetric \\'Upper Bound\\' Fit')\n-            plt.plot(x, y, color='red', ls='--', label='fit')\n-            plt.scatter(g0, gdiff, color='b', label='data')\n-            plt.ylabel('Difference in green channels')\n-            plt.xlabel('Green value')\n-\n-        \"\"\"\n-        This upper bound asymmetric gives correct order of magnitude values.\n-        The pipeline approximates a 1st derivative of a gaussian with some\n-        linear piecewise functions, introducing arbitrary cutoffs. For\n-        pessimistic geq, the model parameters have been increased by a\n-        scaling factor/constant.\n-\n-        Feel free to tune these or edit the json files directly if you\n-        belive there are still mazing effects left (threshold too low) or if you\n-        think it is being overcorrected (threshold too high).\n-        We have gone for a one size fits most approach that will produce\n-        acceptable results in most applications.\n-        \"\"\"\n-        slope *= 1.5\n-        offset += 201\n-        Cam.log += '\\nFit after correction factors: slope = {:.5f}'.format(slope)\n-        Cam.log += ' offset = {}'.format(int(offset))\n-        \"\"\"\n-        clamp offset at 0 due to pipeline considerations\n-        \"\"\"\n-        if offset < 0:\n-            Cam.log += '\\nOffset raised to 0'\n-            offset = 0\n-        \"\"\"\n-        optional plotting code\n-        \"\"\"\n-        if plot:\n-            y2 = slope*x + offset\n-            plt.plot(x, y2, color='green', ls='--', label='scaled fit')\n-            plt.grid()\n-            plt.legend()\n-            plt.show()\n-\n-        \"\"\"\n-    the case where for some reason the fit didn't work correctly\n-\n-    Transpose data and then least squares linear fit. Transposing data\n-    makes it robust to many patches where green difference is the same\n-    since they only contribute to one error minimisation, instead of dragging\n-    the entire linear fit down.\n-    \"\"\"\n-\n-    else:\n-        print('\\nError! Couldn\\'t fit asymmetric lest squares')\n-        print(result.message)\n-        Cam.log += '\\nWARNING: Asymmetric least squares fit failed! '\n-        Cam.log += 'Standard fit used could possibly lead to worse results'\n-        fit = np.polyfit(gdiff, g0, 1)\n-        offset, slope = -fit[1]/fit[0], 1/fit[0]\n-        Cam.log += '\\nFit result: slope = {:.5f} '.format(slope)\n-        Cam.log += 'offset = {}'.format(int(offset))\n-        \"\"\"\n-        optional plotting code\n-        \"\"\"\n-        if plot:\n-            x = np.linspace(max(g0)*1.1, 100)\n-            y = slope*x + offset\n-            plt.title('GEQ Linear Fit')\n-            plt.plot(x, y, color='red', ls='--', label='fit')\n-            plt.scatter(g0, gdiff, color='b', label='data')\n-            plt.ylabel('Difference in green channels')\n-            plt.xlabel('Green value')\n-        \"\"\"\n-        Scaling factors (see previous justification)\n-        The model here will not be an upper bound so scaling factors have\n-        been increased.\n-        This method of deriving geq model parameters is extremely arbitrary\n-        and undesirable.\n-        \"\"\"\n-        slope *= 2.5\n-        offset += 301\n-        Cam.log += '\\nFit after correction factors: slope = {:.5f}'.format(slope)\n-        Cam.log += ' offset = {}'.format(int(offset))\n-\n-        if offset < 0:\n-            Cam.log += '\\nOffset raised to 0'\n-            offset = 0\n-\n-        \"\"\"\n-        optional plotting code\n-        \"\"\"\n-        if plot:\n-            y2 = slope*x + offset\n-            plt.plot(x, y2, color='green', ls='--', label='scaled fit')\n-            plt.legend()\n-            plt.grid()\n-            plt.show()\n-\n-    return round(slope, 5), int(offset)\n-\n-\n-\"\"\"\"\n-Return green channels of macbeth patches\n-returns g0, g1 where\n-> g0 is green next to red\n-> g1 is green next to blue\n-\"\"\"\n-def geq(Cam, Img):\n-    Cam.log += '\\nProcessing image {}'.format(Img.name)\n-    patches = [Img.patches[i] for i in Img.order][1:3]\n-    g_patches = np.array([(np.mean(patches[0][i]), np.mean(patches[1][i])) for i in range(24)])\n-    Cam.log += '\\n'\n-    return(g_patches)\ndiff --git a/utils/raspberrypi/ctt/ctt_image_load.py b/utils/raspberrypi/ctt/ctt_image_load.py\ndeleted file mode 100644\nindex 531de328d1b9..000000000000\n--- a/utils/raspberrypi/ctt/ctt_image_load.py\n+++ /dev/null\n@@ -1,455 +0,0 @@\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2019-2020, Raspberry Pi Ltd\n-#\n-# camera tuning tool image loading\n-\n-from ctt_tools import *\n-from ctt_macbeth_locator import *\n-import json\n-import pyexiv2 as pyexif\n-import rawpy as raw\n-\n-\n-\"\"\"\n-Image class load image from raw data and extracts metadata.\n-\n-Once image is extracted from data, it finds 24 16x16 patches for each\n-channel, centred at the macbeth chart squares\n-\"\"\"\n-class Image:\n-    def __init__(self, buf):\n-        self.buf = buf\n-        self.patches = None\n-        self.saturated = False\n-\n-    '''\n-    obtain metadata from buffer\n-    '''\n-    def get_meta(self):\n-        self.ver = ba_to_b(self.buf[4:5])\n-        self.w = ba_to_b(self.buf[0xd0:0xd2])\n-        self.h = ba_to_b(self.buf[0xd2:0xd4])\n-        self.pad = ba_to_b(self.buf[0xd4:0xd6])\n-        self.fmt = self.buf[0xf5]\n-        self.sigbits = 2*self.fmt + 4\n-        self.pattern = self.buf[0xf4]\n-        self.exposure = ba_to_b(self.buf[0x90:0x94])\n-        self.againQ8 = ba_to_b(self.buf[0x94:0x96])\n-        self.againQ8_norm = self.againQ8/256\n-        camName = self.buf[0x10:0x10+128]\n-        camName_end = camName.find(0x00)\n-        self.camName = self.buf[0x10:0x10+128][:camName_end].decode()\n-\n-        \"\"\"\n-        Channel order depending on bayer pattern\n-        \"\"\"\n-        bayer_case = {\n-            0: (0, 1, 2, 3),   # red\n-            1: (2, 0, 3, 1),   # green next to red\n-            2: (3, 2, 1, 0),   # green next to blue\n-            3: (1, 0, 3, 2),   # blue\n-            128: (0, 1, 2, 3)  # arbitrary order for greyscale casw\n-        }\n-        self.order = bayer_case[self.pattern]\n-\n-        '''\n-        manual blacklevel - not robust\n-        '''\n-        if 'ov5647' in self.camName:\n-            self.blacklevel = 16\n-        else:\n-            self.blacklevel = 64\n-        self.blacklevel_16 = self.blacklevel << (6)\n-        return 1\n-\n-    '''\n-    print metadata for debug\n-    '''\n-    def print_meta(self):\n-        print('\\nData:')\n-        print('      ver = {}'.format(self.ver))\n-        print('      w = {}'.format(self.w))\n-        print('      h = {}'.format(self.h))\n-        print('      pad = {}'.format(self.pad))\n-        print('      fmt = {}'.format(self.fmt))\n-        print('      sigbits = {}'.format(self.sigbits))\n-        print('      pattern = {}'.format(self.pattern))\n-        print('      exposure = {}'.format(self.exposure))\n-        print('      againQ8 = {}'.format(self.againQ8))\n-        print('      againQ8_norm = {}'.format(self.againQ8_norm))\n-        print('      camName = {}'.format(self.camName))\n-        print('      blacklevel = {}'.format(self.blacklevel))\n-        print('      blacklevel_16 = {}'.format(self.blacklevel_16))\n-\n-        return 1\n-\n-    \"\"\"\n-    get image from raw scanline data\n-    \"\"\"\n-    def get_image(self, raw):\n-        self.dptr = []\n-        \"\"\"\n-        check if data is 10 or 12 bits\n-        \"\"\"\n-        if self.sigbits == 10:\n-            \"\"\"\n-            calc length of scanline\n-            \"\"\"\n-            lin_len = ((((((self.w+self.pad+3)>>2)) * 5)+31)>>5) * 32\n-            \"\"\"\n-            stack scan lines into matrix\n-            \"\"\"\n-            raw = np.array(raw).reshape(-1, lin_len).astype(np.int64)[:self.h, ...]\n-            \"\"\"\n-            separate 5 bits in each package, stopping when w is satisfied\n-            \"\"\"\n-            ba0 = raw[..., 0:5*((self.w+3)>>2):5]\n-            ba1 = raw[..., 1:5*((self.w+3)>>2):5]\n-            ba2 = raw[..., 2:5*((self.w+3)>>2):5]\n-            ba3 = raw[..., 3:5*((self.w+3)>>2):5]\n-            ba4 = raw[..., 4:5*((self.w+3)>>2):5]\n-            \"\"\"\n-            assemble 10 bit numbers\n-            \"\"\"\n-            ch0 = np.left_shift((np.left_shift(ba0, 2) + (ba4 % 4)), 6)\n-            ch1 = np.left_shift((np.left_shift(ba1, 2) + (np.right_shift(ba4, 2) % 4)), 6)\n-            ch2 = np.left_shift((np.left_shift(ba2, 2) + (np.right_shift(ba4, 4) % 4)), 6)\n-            ch3 = np.left_shift((np.left_shift(ba3, 2) + (np.right_shift(ba4, 6) % 4)), 6)\n-            \"\"\"\n-            interleave bits\n-            \"\"\"\n-            mat = np.empty((self.h, self.w), dtype=ch0.dtype)\n-\n-            mat[..., 0::4] = ch0\n-            mat[..., 1::4] = ch1\n-            mat[..., 2::4] = ch2\n-            mat[..., 3::4] = ch3\n-\n-            \"\"\"\n-            There is som eleaking memory somewhere in the code. This code here\n-            seemed to make things good enough that the code would run for\n-            reasonable numbers of images, however this is techincally just a\n-            workaround. (sorry)\n-            \"\"\"\n-            ba0, ba1, ba2, ba3, ba4 = None, None, None, None, None\n-            del ba0, ba1, ba2, ba3, ba4\n-            ch0, ch1, ch2, ch3 = None, None, None, None\n-            del ch0, ch1, ch2, ch3\n-\n-            \"\"\"\n-        same as before but 12 bit case\n-        \"\"\"\n-        elif self.sigbits == 12:\n-            lin_len = ((((((self.w+self.pad+1)>>1)) * 3)+31)>>5) * 32\n-            raw = np.array(raw).reshape(-1, lin_len).astype(np.int64)[:self.h, ...]\n-            ba0 = raw[..., 0:3*((self.w+1)>>1):3]\n-            ba1 = raw[..., 1:3*((self.w+1)>>1):3]\n-            ba2 = raw[..., 2:3*((self.w+1)>>1):3]\n-            ch0 = np.left_shift((np.left_shift(ba0, 4) + ba2 % 16), 4)\n-            ch1 = np.left_shift((np.left_shift(ba1, 4) + (np.right_shift(ba2, 4)) % 16), 4)\n-            mat = np.empty((self.h, self.w), dtype=ch0.dtype)\n-            mat[..., 0::2] = ch0\n-            mat[..., 1::2] = ch1\n-\n-        else:\n-            \"\"\"\n-            data is neither 10 nor 12 or incorrect data\n-            \"\"\"\n-            print('ERROR: wrong bit format, only 10 or 12 bit supported')\n-            return 0\n-\n-        \"\"\"\n-        separate bayer channels\n-        \"\"\"\n-        c0 = mat[0::2, 0::2]\n-        c1 = mat[0::2, 1::2]\n-        c2 = mat[1::2, 0::2]\n-        c3 = mat[1::2, 1::2]\n-        self.channels = [c0, c1, c2, c3]\n-        return 1\n-\n-    \"\"\"\n-    obtain 16x16 patch centred at macbeth square centre for each channel\n-    \"\"\"\n-    def get_patches(self, cen_coords, size=16):\n-        \"\"\"\n-        obtain channel widths and heights\n-        \"\"\"\n-        ch_w, ch_h = self.w, self.h\n-        cen_coords = list(np.array((cen_coords[0])).astype(np.int32))\n-        self.cen_coords = cen_coords\n-        \"\"\"\n-        squares are ordered by stacking macbeth chart columns from\n-        left to right. Some useful patch indices:\n-            white = 3\n-            black = 23\n-            'reds' = 9, 10\n-            'blues' = 2, 5, 8, 20, 22\n-            'greens' = 6, 12, 17\n-            greyscale = 3, 7, 11, 15, 19, 23\n-        \"\"\"\n-        all_patches = []\n-        for ch in self.channels:\n-            ch_patches = []\n-            for cen in cen_coords:\n-                '''\n-                macbeth centre is placed at top left of central 2x2 patch\n-                to account for rounding\n-                Patch pixels are sorted by pixel brightness so spatial\n-                information is lost.\n-                '''\n-                patch = ch[cen[1]-7:cen[1]+9, cen[0]-7:cen[0]+9].flatten()\n-                patch.sort()\n-                if patch[-5] == (2**self.sigbits-1)*2**(16-self.sigbits):\n-                    self.saturated = True\n-                ch_patches.append(patch)\n-                # print('\\nNew Patch\\n')\n-            all_patches.append(ch_patches)\n-            # print('\\n\\nNew Channel\\n\\n')\n-        self.patches = all_patches\n-        return 1\n-\n-\n-def brcm_load_image(Cam, im_str):\n-    \"\"\"\n-    Load image where raw data and metadata is in the BRCM format\n-    \"\"\"\n-    try:\n-        \"\"\"\n-        create byte array\n-        \"\"\"\n-        with open(im_str, 'rb') as image:\n-            f = image.read()\n-            b = bytearray(f)\n-        \"\"\"\n-        return error if incorrect image address\n-        \"\"\"\n-    except FileNotFoundError:\n-        print('\\nERROR:\\nInvalid image address')\n-        Cam.log += '\\nWARNING: Invalid image address'\n-        return 0\n-\n-    \"\"\"\n-    return error if problem reading file\n-    \"\"\"\n-    if f is None:\n-        print('\\nERROR:\\nProblem reading file')\n-        Cam.log += '\\nWARNING: Problem readin file'\n-        return 0\n-\n-    # print('\\nLooking for EOI and BRCM header')\n-    \"\"\"\n-    find end of image followed by BRCM header by turning\n-    bytearray into hex string and string matching with regexp\n-    \"\"\"\n-    start = -1\n-    match = bytearray(b'\\xff\\xd9@BRCM')\n-    match_str = binascii.hexlify(match)\n-    b_str = binascii.hexlify(b)\n-    \"\"\"\n-    note index is divided by two to go from string to hex\n-    \"\"\"\n-    indices = [m.start()//2 for m in re.finditer(match_str, b_str)]\n-    # print(indices)\n-    try:\n-        start = indices[0] + 3\n-    except IndexError:\n-        print('\\nERROR:\\nNo Broadcom header found')\n-        Cam.log += '\\nWARNING: No Broadcom header found!'\n-        return 0\n-    \"\"\"\n-    extract data after header\n-    \"\"\"\n-    # print('\\nExtracting data after header')\n-    buf = b[start:start+32768]\n-    Img = Image(buf)\n-    Img.str = im_str\n-    # print('Data found successfully')\n-\n-    \"\"\"\n-    obtain metadata\n-    \"\"\"\n-    # print('\\nReading metadata')\n-    Img.get_meta()\n-    Cam.log += '\\nExposure : {} us'.format(Img.exposure)\n-    Cam.log += '\\nNormalised gain : {}'.format(Img.againQ8_norm)\n-    # print('Metadata read successfully')\n-\n-    \"\"\"\n-    obtain raw image data\n-    \"\"\"\n-    # print('\\nObtaining raw image data')\n-    raw = b[start+32768:]\n-    Img.get_image(raw)\n-    \"\"\"\n-    delete raw to stop memory errors\n-    \"\"\"\n-    raw = None\n-    del raw\n-    # print('Raw image data obtained successfully')\n-\n-    return Img\n-\n-\n-def dng_load_image(Cam, im_str):\n-    try:\n-        Img = Image(None)\n-\n-        # RawPy doesn't load all the image tags that we need, so we use py3exiv2\n-        metadata = pyexif.ImageMetadata(im_str)\n-        metadata.read()\n-\n-        Img.ver = 100  # random value\n-        \"\"\"\n-        The DNG and TIFF/EP specifications use different IFDs to store the raw\n-        image data and the Exif tags. DNG stores them in a SubIFD and in an Exif\n-        IFD respectively (named \"SubImage1\" and \"Photo\" by pyexiv2), while\n-        TIFF/EP stores them both in IFD0 (name \"Image\"). Both are used in \"DNG\"\n-        files, with libcamera-apps following the DNG recommendation and\n-        applications based on picamera2 following TIFF/EP.\n-\n-        This code detects which tags are being used, and therefore extracts the\n-        correct values.\n-        \"\"\"\n-        try:\n-            Img.w = metadata['Exif.SubImage1.ImageWidth'].value\n-            subimage = \"SubImage1\"\n-            photo = \"Photo\"\n-        except KeyError:\n-            Img.w = metadata['Exif.Image.ImageWidth'].value\n-            subimage = \"Image\"\n-            photo = \"Image\"\n-        Img.pad = 0\n-        Img.h = metadata[f'Exif.{subimage}.ImageLength'].value\n-        white = metadata[f'Exif.{subimage}.WhiteLevel'].value\n-        Img.sigbits = int(white).bit_length()\n-        Img.fmt = (Img.sigbits - 4) // 2\n-        Img.exposure = int(metadata[f'Exif.{photo}.ExposureTime'].value * 1000000)\n-        Img.againQ8 = metadata[f'Exif.{photo}.ISOSpeedRatings'].value * 256 / 100\n-        Img.againQ8_norm = Img.againQ8 / 256\n-        Img.camName = metadata['Exif.Image.Model'].value\n-        Img.blacklevel = int(metadata[f'Exif.{subimage}.BlackLevel'].value[0])\n-        Img.blacklevel_16 = Img.blacklevel << (16 - Img.sigbits)\n-        bayer_case = {\n-            '0 1 1 2': (0, (0, 1, 2, 3)),\n-            '1 2 0 1': (1, (2, 0, 3, 1)),\n-            '2 1 1 0': (2, (3, 2, 1, 0)),\n-            '1 0 2 1': (3, (1, 0, 3, 2))\n-        }\n-        cfa_pattern = metadata[f'Exif.{subimage}.CFAPattern'].value\n-        Img.pattern = bayer_case[cfa_pattern][0]\n-        Img.order = bayer_case[cfa_pattern][1]\n-\n-        # Now use RawPy tp get the raw Bayer pixels\n-        raw_im = raw.imread(im_str)\n-        raw_data = raw_im.raw_image\n-        shift = 16 - Img.sigbits\n-        c0 = np.left_shift(raw_data[0::2, 0::2].astype(np.int64), shift)\n-        c1 = np.left_shift(raw_data[0::2, 1::2].astype(np.int64), shift)\n-        c2 = np.left_shift(raw_data[1::2, 0::2].astype(np.int64), shift)\n-        c3 = np.left_shift(raw_data[1::2, 1::2].astype(np.int64), shift)\n-        Img.channels = [c0, c1, c2, c3]\n-        Img.rgb = raw_im.postprocess()\n-\n-    except Exception:\n-        print(\"\\nERROR: failed to load DNG file\", im_str)\n-        print(\"Either file does not exist or is incompatible\")\n-        Cam.log += '\\nERROR: DNG file does not exist or is incompatible'\n-        raise\n-\n-    return Img\n-\n-\n-'''\n-load image from file location and perform calibration\n-check correct filetype\n-\n-mac boolean is true if image is expected to contain macbeth chart and false\n-if not (alsc images don't have macbeth charts)\n-'''\n-def load_image(Cam, im_str, mac_config=None, show=False, mac=True, show_meta=False):\n-    \"\"\"\n-    check image is correct filetype\n-    \"\"\"\n-    if '.jpg' in im_str or '.jpeg' in im_str or '.brcm' in im_str or '.dng' in im_str:\n-        if '.dng' in im_str:\n-            Img = dng_load_image(Cam, im_str)\n-        else:\n-            Img = brcm_load_image(Cam, im_str)\n-        \"\"\"\n-        handle errors smoothly if loading image failed\n-        \"\"\"\n-        if Img == 0:\n-            return 0\n-        if show_meta:\n-            Img.print_meta()\n-\n-        if mac:\n-            \"\"\"\n-            find macbeth centres, discarding images that are too dark or light\n-            \"\"\"\n-            av_chan = (np.mean(np.array(Img.channels), axis=0)/(2**16))\n-            av_val = np.mean(av_chan)\n-            # print(av_val)\n-            if av_val < Img.blacklevel_16/(2**16)+1/64:\n-                macbeth = None\n-                print('\\nError: Image too dark!')\n-                Cam.log += '\\nWARNING: Image too dark!'\n-            else:\n-                macbeth = find_macbeth(Cam, av_chan, mac_config)\n-\n-            \"\"\"\n-            if no macbeth found return error\n-            \"\"\"\n-            if macbeth is None:\n-                print('\\nERROR: No macbeth chart found')\n-                return 0\n-            mac_cen_coords = macbeth[1]\n-            # print('\\nMacbeth centres located successfully')\n-\n-            \"\"\"\n-            obtain image patches\n-            \"\"\"\n-            # print('\\nObtaining image patches')\n-            Img.get_patches(mac_cen_coords)\n-            if Img.saturated:\n-                print('\\nERROR: Macbeth patches have saturated')\n-                Cam.log += '\\nWARNING: Macbeth patches have saturated!'\n-                return 0\n-\n-        \"\"\"\n-        clear memory\n-        \"\"\"\n-        Img.buf = None\n-        del Img.buf\n-\n-        # print('Image patches obtained successfully')\n-\n-        \"\"\"\n-        optional debug\n-        \"\"\"\n-        if show and __name__ == '__main__':\n-            copy = sum(Img.channels)/2**18\n-            copy = np.reshape(copy, (Img.h//2, Img.w//2)).astype(np.float64)\n-            copy, _ = reshape(copy, 800)\n-            represent(copy)\n-\n-        return Img\n-\n-        \"\"\"\n-    return error if incorrect filetype\n-    \"\"\"\n-    else:\n-        # print('\\nERROR:\\nInvalid file extension')\n-        return 0\n-\n-\n-\"\"\"\n-bytearray splice to number little endian\n-\"\"\"\n-def ba_to_b(b):\n-    total = 0\n-    for i in range(len(b)):\n-        total += 256**i * b[i]\n-    return total\ndiff --git a/utils/raspberrypi/ctt/ctt_lux.py b/utils/raspberrypi/ctt/ctt_lux.py\ndeleted file mode 100644\nindex 46be15125d2f..000000000000\n--- a/utils/raspberrypi/ctt/ctt_lux.py\n+++ /dev/null\n@@ -1,61 +0,0 @@\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2019, Raspberry Pi Ltd\n-#\n-# camera tuning tool for lux level\n-\n-from ctt_tools import *\n-\n-\n-\"\"\"\n-Find lux values from metadata and calculate Y\n-\"\"\"\n-def lux(Cam, Img):\n-    shutter_speed = Img.exposure\n-    gain = Img.againQ8_norm\n-    aperture = 1\n-    Cam.log += '\\nShutter speed = {}'.format(shutter_speed)\n-    Cam.log += '\\nGain = {}'.format(gain)\n-    Cam.log += '\\nAperture = {}'.format(aperture)\n-    patches = [Img.patches[i] for i in Img.order]\n-    channels = [Img.channels[i] for i in Img.order]\n-    return lux_calc(Cam, Img, patches, channels), shutter_speed, gain\n-\n-\n-\"\"\"\n-perform lux calibration on bayer channels\n-\"\"\"\n-def lux_calc(Cam, Img, patches, channels):\n-    \"\"\"\n-    find means color channels on grey patches\n-    \"\"\"\n-    ap_r = np.mean(patches[0][3::4])\n-    ap_g = (np.mean(patches[1][3::4])+np.mean(patches[2][3::4]))/2\n-    ap_b = np.mean(patches[3][3::4])\n-    Cam.log += '\\nAverage channel values on grey patches:'\n-    Cam.log += '\\nRed = {:.0f} Green = {:.0f} Blue = {:.0f}'.format(ap_r, ap_b, ap_g)\n-    # print(ap_r, ap_g, ap_b)\n-    \"\"\"\n-    calculate channel gains\n-    \"\"\"\n-    gr = ap_g/ap_r\n-    gb = ap_g/ap_b\n-    Cam.log += '\\nChannel gains: Red = {:.3f} Blue = {:.3f}'.format(gr, gb)\n-\n-    \"\"\"\n-    find means color channels on image and scale by gain\n-    note greens are averaged together (treated as one channel)\n-    \"\"\"\n-    a_r = np.mean(channels[0])*gr\n-    a_g = (np.mean(channels[1])+np.mean(channels[2]))/2\n-    a_b = np.mean(channels[3])*gb\n-    Cam.log += '\\nAverage channel values over entire image scaled by channel gains:'\n-    Cam.log += '\\nRed = {:.0f} Green = {:.0f} Blue = {:.0f}'.format(a_r, a_b, a_g)\n-    # print(a_r, a_g, a_b)\n-    \"\"\"\n-    Calculate y with top row of yuv matrix\n-    \"\"\"\n-    y = 0.299*a_r + 0.587*a_g + 0.114*a_b\n-    Cam.log += '\\nY value calculated: {}'.format(int(y))\n-    # print(y)\n-    return int(y)\ndiff --git a/utils/raspberrypi/ctt/ctt_macbeth_locator.py b/utils/raspberrypi/ctt/ctt_macbeth_locator.py\ndeleted file mode 100644\nindex f22dbf319a34..000000000000\n--- a/utils/raspberrypi/ctt/ctt_macbeth_locator.py\n+++ /dev/null\n@@ -1,757 +0,0 @@\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2019, Raspberry Pi Ltd\n-#\n-# camera tuning tool Macbeth chart locator\n-\n-from ctt_ransac import *\n-from ctt_tools import *\n-import warnings\n-\n-\"\"\"\n-NOTE: some custom functions have been used here to make the code more readable.\n-These are defined in tools.py if they are needed for reference.\n-\"\"\"\n-\n-\n-\"\"\"\n-Some inconsistencies between packages cause runtime warnings when running\n-the clustering algorithm. This catches these warnings so they don't flood the\n-output to the console\n-\"\"\"\n-def fxn():\n-    warnings.warn(\"runtime\", RuntimeWarning)\n-\n-\n-\"\"\"\n-Define the success message\n-\"\"\"\n-success_msg = 'Macbeth chart located successfully'\n-\n-def find_macbeth(Cam, img, mac_config=(0, 0)):\n-    small_chart, show = mac_config\n-    print('Locating macbeth chart')\n-    Cam.log += '\\nLocating macbeth chart'\n-    \"\"\"\n-    catch the warnings\n-    \"\"\"\n-    warnings.simplefilter(\"ignore\")\n-    fxn()\n-\n-    \"\"\"\n-    Reference macbeth chart is created that will be correlated with the located\n-    macbeth chart guess to produce a confidence value for the match.\n-    \"\"\"\n-    ref = cv2.imread(Cam.path + 'ctt_ref.pgm', flags=cv2.IMREAD_GRAYSCALE)\n-    ref_w = 120\n-    ref_h = 80\n-    rc1 = (0, 0)\n-    rc2 = (0, ref_h)\n-    rc3 = (ref_w, ref_h)\n-    rc4 = (ref_w, 0)\n-    ref_corns = np.array((rc1, rc2, rc3, rc4), np.float32)\n-    ref_data = (ref, ref_w, ref_h, ref_corns)\n-\n-    \"\"\"\n-    locate macbeth chart\n-    \"\"\"\n-    cor, mac, coords, msg = get_macbeth_chart(img, ref_data)\n-\n-    # Keep a list that will include this and any brightened up versions of\n-    # the image for reuse.\n-    all_images = [img]\n-\n-    \"\"\"\n-    following bits of code tries to fix common problems with simple\n-    techniques.\n-    If now or at any point the best correlation is of above 0.75, then\n-    nothing more is tried as this is a high enough confidence to ensure\n-    reliable macbeth square centre placement.\n-    \"\"\"\n-\n-    \"\"\"\n-    brighten image 2x\n-    \"\"\"\n-    if cor < 0.75:\n-        a = 2\n-        img_br = cv2.convertScaleAbs(img, alpha=a, beta=0)\n-        all_images.append(img_br)\n-        cor_b, mac_b, coords_b, msg_b = get_macbeth_chart(img_br, ref_data)\n-        if cor_b > cor:\n-            cor, mac, coords, msg = cor_b, mac_b, coords_b, msg_b\n-\n-    \"\"\"\n-    brighten image 4x\n-    \"\"\"\n-    if cor < 0.75:\n-        a = 4\n-        img_br = cv2.convertScaleAbs(img, alpha=a, beta=0)\n-        all_images.append(img_br)\n-        cor_b, mac_b, coords_b, msg_b = get_macbeth_chart(img_br, ref_data)\n-        if cor_b > cor:\n-            cor, mac, coords, msg = cor_b, mac_b, coords_b, msg_b\n-\n-    \"\"\"\n-    In case macbeth chart is too small, take a selection of the image and\n-    attempt to locate macbeth chart within that. The scale increment is\n-    root 2\n-    \"\"\"\n-    \"\"\"\n-    These variables will be used to transform the found coordinates at smaller\n-    scales back into the original. If ii is still -1 after this section that\n-    means it was not successful\n-    \"\"\"\n-    ii = -1\n-    w_best = 0\n-    h_best = 0\n-    d_best = 100\n-    \"\"\"\n-    d_best records the scale of the best match. Macbeth charts are only looked\n-    for at one scale increment smaller than the current best match in order to avoid\n-    unecessarily searching for macbeth charts at small scales.\n-    If a macbeth chart ha already been found then set d_best to 0\n-    \"\"\"\n-    if cor != 0:\n-        d_best = 0\n-\n-    \"\"\"\n-    scale 3/2 (approx root2)\n-    \"\"\"\n-    if cor < 0.75:\n-        imgs = []\n-        \"\"\"\n-        get size of image\n-        \"\"\"\n-        shape = list(img.shape[:2])\n-        w, h = shape\n-        \"\"\"\n-        set dimensions of the subselection and the step along each axis between\n-        selections\n-        \"\"\"\n-        w_sel = int(2*w/3)\n-        h_sel = int(2*h/3)\n-        w_inc = int(w/6)\n-        h_inc = int(h/6)\n-        \"\"\"\n-        for each subselection, look for a macbeth chart\n-        loop over this and any brightened up images that we made to increase the\n-        likelihood of success\n-        \"\"\"\n-        for img_br in all_images:\n-            for i in range(3):\n-                for j in range(3):\n-                    w_s, h_s = i*w_inc, j*h_inc\n-                    img_sel = img_br[w_s:w_s+w_sel, h_s:h_s+h_sel]\n-                    cor_ij, mac_ij, coords_ij, msg_ij = get_macbeth_chart(img_sel, ref_data)\n-                    \"\"\"\n-                    if the correlation is better than the best then record the\n-                    scale and current subselection at which macbeth chart was\n-                    found. Also record the coordinates, macbeth chart and message.\n-                    \"\"\"\n-                    if cor_ij > cor:\n-                        cor = cor_ij\n-                        mac, coords, msg = mac_ij, coords_ij, msg_ij\n-                        ii, jj = i, j\n-                        w_best, h_best = w_inc, h_inc\n-                        d_best = 1\n-\n-    \"\"\"\n-    scale 2\n-    \"\"\"\n-    if cor < 0.75:\n-        imgs = []\n-        shape = list(img.shape[:2])\n-        w, h = shape\n-        w_sel = int(w/2)\n-        h_sel = int(h/2)\n-        w_inc = int(w/8)\n-        h_inc = int(h/8)\n-        # Again, loop over any brightened up images as well\n-        for img_br in all_images:\n-            for i in range(5):\n-                for j in range(5):\n-                    w_s, h_s = i*w_inc, j*h_inc\n-                    img_sel = img_br[w_s:w_s+w_sel, h_s:h_s+h_sel]\n-                    cor_ij, mac_ij, coords_ij, msg_ij = get_macbeth_chart(img_sel, ref_data)\n-                    if cor_ij > cor:\n-                        cor = cor_ij\n-                        mac, coords, msg = mac_ij, coords_ij, msg_ij\n-                        ii, jj = i, j\n-                        w_best, h_best = w_inc, h_inc\n-                        d_best = 2\n-\n-    \"\"\"\n-    The following code checks for macbeth charts at even smaller scales. This\n-    slows the code down significantly and has therefore been omitted by default,\n-    however it is not unusably slow so might be useful if the macbeth chart\n-    is too small to be picked up to by the current subselections.\n-    Use this for macbeth charts with side lengths around 1/5 image dimensions\n-    (and smaller...?) it is, however, recommended that macbeth charts take up as\n-    large as possible a proportion of the image.\n-    \"\"\"\n-\n-    if small_chart:\n-\n-        if cor < 0.75 and d_best > 1:\n-            imgs = []\n-            shape = list(img.shape[:2])\n-            w, h = shape\n-            w_sel = int(w/3)\n-            h_sel = int(h/3)\n-            w_inc = int(w/12)\n-            h_inc = int(h/12)\n-            for i in range(9):\n-                for j in range(9):\n-                    w_s, h_s = i*w_inc, j*h_inc\n-                    img_sel = img[w_s:w_s+w_sel, h_s:h_s+h_sel]\n-                    cor_ij, mac_ij, coords_ij, msg_ij = get_macbeth_chart(img_sel, ref_data)\n-                    if cor_ij > cor:\n-                        cor = cor_ij\n-                        mac, coords, msg = mac_ij, coords_ij, msg_ij\n-                        ii, jj = i, j\n-                        w_best, h_best = w_inc, h_inc\n-                        d_best = 3\n-\n-        if cor < 0.75 and d_best > 2:\n-            imgs = []\n-            shape = list(img.shape[:2])\n-            w, h = shape\n-            w_sel = int(w/4)\n-            h_sel = int(h/4)\n-            w_inc = int(w/16)\n-            h_inc = int(h/16)\n-            for i in range(13):\n-                for j in range(13):\n-                    w_s, h_s = i*w_inc, j*h_inc\n-                    img_sel = img[w_s:w_s+w_sel, h_s:h_s+h_sel]\n-                    cor_ij, mac_ij, coords_ij, msg_ij = get_macbeth_chart(img_sel, ref_data)\n-                    if cor_ij > cor:\n-                        cor = cor_ij\n-                        mac, coords, msg = mac_ij, coords_ij, msg_ij\n-                        ii, jj = i, j\n-                        w_best, h_best = w_inc, h_inc\n-\n-    \"\"\"\n-    Transform coordinates from subselection to original image\n-    \"\"\"\n-    if ii != -1:\n-        for a in range(len(coords)):\n-            for b in range(len(coords[a][0])):\n-                coords[a][0][b][1] += ii*w_best\n-                coords[a][0][b][0] += jj*h_best\n-\n-    \"\"\"\n-    initialise coords_fit variable\n-    \"\"\"\n-    coords_fit = None\n-    # print('correlation: {}'.format(cor))\n-    \"\"\"\n-    print error or success message\n-    \"\"\"\n-    print(msg)\n-    Cam.log += '\\n' + str(msg)\n-    if msg == success_msg:\n-        coords_fit = coords\n-        Cam.log += '\\nMacbeth chart vertices:\\n'\n-        Cam.log += '{}'.format(2*np.round(coords_fit[0][0]), 0)\n-        \"\"\"\n-        if correlation is lower than 0.75 there may be a risk of macbeth chart\n-        corners not having been located properly. It might be worth running\n-        with show set to true to check where the macbeth chart centres have\n-        been located.\n-        \"\"\"\n-        print('Confidence: {:.3f}'.format(cor))\n-        Cam.log += '\\nConfidence: {:.3f}'.format(cor)\n-        if cor < 0.75:\n-            print('Caution: Low confidence guess!')\n-            Cam.log += 'WARNING: Low confidence guess!'\n-        # cv2.imshow('MacBeth', mac)\n-        # represent(mac, 'MacBeth chart')\n-\n-    \"\"\"\n-    extract data from coords_fit and plot on original image\n-    \"\"\"\n-    if show and coords_fit is not None:\n-        copy = img.copy()\n-        verts = coords_fit[0][0]\n-        cents = coords_fit[1][0]\n-\n-        \"\"\"\n-        draw circles at vertices of macbeth chart\n-        \"\"\"\n-        for vert in verts:\n-            p = tuple(np.round(vert).astype(np.int32))\n-            cv2.circle(copy, p, 10, 1, -1)\n-        \"\"\"\n-        draw circles at centres of squares\n-        \"\"\"\n-        for i in range(len(cents)):\n-            cent = cents[i]\n-            p = tuple(np.round(cent).astype(np.int32))\n-            \"\"\"\n-            draw black circle on white square, white circle on black square an\n-            grey circle everywhere else.\n-            \"\"\"\n-            if i == 3:\n-                cv2.circle(copy, p, 8, 0, -1)\n-            elif i == 23:\n-                cv2.circle(copy, p, 8, 1, -1)\n-            else:\n-                cv2.circle(copy, p, 8, 0.5, -1)\n-        copy, _ = reshape(copy, 400)\n-        represent(copy)\n-\n-    return(coords_fit)\n-\n-\n-def get_macbeth_chart(img, ref_data):\n-    \"\"\"\n-    function returns coordinates of macbeth chart vertices and square centres,\n-    along with an error/success message for debugging purposes. Additionally,\n-    it scores the match with a confidence value.\n-\n-    Brief explanation of the macbeth chart locating algorithm:\n-    - Find rectangles within image\n-    - Take rectangles within percentage offset of median perimeter. The\n-        assumption is that these will be the macbeth squares\n-    - For each potential square, find the 24 possible macbeth centre locations\n-        that would produce a square in that location\n-    - Find clusters of potential macbeth chart centres to find the potential\n-        macbeth centres with the most votes, i.e. the most likely ones\n-    - For each potential macbeth centre, use the centres of the squares that\n-        voted for it to find macbeth chart corners\n-    - For each set of corners, transform the possible match into normalised\n-        space and correlate with a reference chart to evaluate the match\n-    - Select the highest correlation as the macbeth chart match, returning the\n-        correlation as the confidence score\n-    \"\"\"\n-\n-    \"\"\"\n-    get reference macbeth chart data\n-    \"\"\"\n-    (ref, ref_w, ref_h, ref_corns) = ref_data\n-\n-    \"\"\"\n-    the code will raise and catch a MacbethError in case of a problem, trying\n-    to give some likely reasons why the problem occred, hence the try/except\n-    \"\"\"\n-    try:\n-        \"\"\"\n-        obtain image, convert to grayscale and normalise\n-        \"\"\"\n-        src = img\n-        src, factor = reshape(src, 200)\n-        original = src.copy()\n-        a = 125/np.average(src)\n-        src_norm = cv2.convertScaleAbs(src, alpha=a, beta=0)\n-        \"\"\"\n-        This code checks if there are seperate colour channels. In the past the\n-        macbeth locator ran on jpgs and this makes it robust to different\n-        filetypes. Note that running it on a jpg has 4x the pixels of the\n-        average bayer channel so coordinates must be doubled.\n-\n-        This is best done in img_load.py in the get_patches method. The\n-        coordinates and image width, height must be divided by two if the\n-        macbeth locator has been run on a demosaicked image.\n-        \"\"\"\n-        if len(src_norm.shape) == 3:\n-            src_bw = cv2.cvtColor(src_norm, cv2.COLOR_BGR2GRAY)\n-        else:\n-            src_bw = src_norm\n-        original_bw = src_bw.copy()\n-        \"\"\"\n-        obtain image edges\n-        \"\"\"\n-        sigma = 2\n-        src_bw = cv2.GaussianBlur(src_bw, (0, 0), sigma)\n-        t1, t2 = 50, 100\n-        edges = cv2.Canny(src_bw, t1, t2)\n-        \"\"\"\n-        dilate edges to prevent self-intersections in contours\n-        \"\"\"\n-        k_size = 2\n-        kernel = np.ones((k_size, k_size))\n-        its = 1\n-        edges = cv2.dilate(edges, kernel, iterations=its)\n-        \"\"\"\n-        find Contours in image\n-        \"\"\"\n-        conts, _ = cv2.findContours(edges, cv2.RETR_TREE,\n-                                    cv2.CHAIN_APPROX_NONE)\n-        if len(conts) == 0:\n-            raise MacbethError(\n-                '\\nWARNING: No macbeth chart found!'\n-                '\\nNo contours found in image\\n'\n-                'Possible problems:\\n'\n-                '- Macbeth chart is too dark or bright\\n'\n-                '- Macbeth chart is occluded\\n'\n-            )\n-        \"\"\"\n-        find quadrilateral contours\n-        \"\"\"\n-        epsilon = 0.07\n-        conts_per = []\n-        for i in range(len(conts)):\n-            per = cv2.arcLength(conts[i], True)\n-            poly = cv2.approxPolyDP(conts[i], epsilon*per, True)\n-            if len(poly) == 4 and cv2.isContourConvex(poly):\n-                conts_per.append((poly, per))\n-\n-        if len(conts_per) == 0:\n-            raise MacbethError(\n-                '\\nWARNING: No macbeth chart found!'\n-                '\\nNo quadrilateral contours found'\n-                '\\nPossible problems:\\n'\n-                '- Macbeth chart is too dark or bright\\n'\n-                '- Macbeth chart is occluded\\n'\n-                '- Macbeth chart is out of camera plane\\n'\n-            )\n-\n-        \"\"\"\n-        sort contours by perimeter and get perimeters within percent of median\n-        \"\"\"\n-        conts_per = sorted(conts_per, key=lambda x: x[1])\n-        med_per = conts_per[int(len(conts_per)/2)][1]\n-        side = med_per/4\n-        perc = 0.1\n-        med_low, med_high = med_per*(1-perc), med_per*(1+perc)\n-        squares = []\n-        for i in conts_per:\n-            if med_low <= i[1] and med_high >= i[1]:\n-                squares.append(i[0])\n-\n-        \"\"\"\n-        obtain coordinates of nomralised macbeth and squares\n-        \"\"\"\n-        square_verts, mac_norm = get_square_verts(0.06)\n-        \"\"\"\n-        for each square guess, find 24 possible macbeth chart centres\n-        \"\"\"\n-        mac_mids = []\n-        squares_raw = []\n-        for i in range(len(squares)):\n-            square = squares[i]\n-            squares_raw.append(square)\n-            \"\"\"\n-            convert quads to rotated rectangles. This is required as the\n-            'squares' are usually quite irregular quadrilaterls, so performing\n-            a transform would result in exaggerated warping and inaccurate\n-            macbeth chart centre placement\n-            \"\"\"\n-            rect = cv2.minAreaRect(square)\n-            square = cv2.boxPoints(rect).astype(np.float32)\n-            \"\"\"\n-            reorder vertices to prevent 'hourglass shape'\n-            \"\"\"\n-            square = sorted(square, key=lambda x: x[0])\n-            square_1 = sorted(square[:2], key=lambda x: x[1])\n-            square_2 = sorted(square[2:], key=lambda x: -x[1])\n-            square = np.array(np.concatenate((square_1, square_2)), np.float32)\n-            square = np.reshape(square, (4, 2)).astype(np.float32)\n-            squares[i] = square\n-            \"\"\"\n-            find 24 possible macbeth chart centres by trasnforming normalised\n-            macbeth square vertices onto candidate square vertices found in image\n-            \"\"\"\n-            for j in range(len(square_verts)):\n-                verts = square_verts[j]\n-                p_mat = cv2.getPerspectiveTransform(verts, square)\n-                mac_guess = cv2.perspectiveTransform(mac_norm, p_mat)\n-                mac_guess = np.round(mac_guess).astype(np.int32)\n-                \"\"\"\n-                keep only if candidate macbeth is within image border\n-                (deprecated)\n-                \"\"\"\n-                in_border = True\n-                # for p in mac_guess[0]:\n-                #     pptest = cv2.pointPolygonTest(\n-                #         img_con,\n-                #         tuple(p),\n-                #         False\n-                #     )\n-                #     if pptest == -1:\n-                #         in_border = False\n-                #         break\n-\n-                if in_border:\n-                    mac_mid = np.mean(mac_guess,\n-                                      axis=1)\n-                    mac_mids.append([mac_mid, (i, j)])\n-\n-        if len(mac_mids) == 0:\n-            raise MacbethError(\n-                '\\nWARNING: No macbeth chart found!'\n-                '\\nNo possible macbeth charts found within image'\n-                '\\nPossible problems:\\n'\n-                '- Part of the macbeth chart is outside the image\\n'\n-                '- Quadrilaterals in image background\\n'\n-            )\n-\n-        \"\"\"\n-        reshape data\n-        \"\"\"\n-        for i in range(len(mac_mids)):\n-            mac_mids[i][0] = mac_mids[i][0][0]\n-\n-        \"\"\"\n-        find where midpoints cluster to identify most likely macbeth centres\n-        \"\"\"\n-        clustering = cluster.AgglomerativeClustering(\n-            n_clusters=None,\n-            compute_full_tree=True,\n-            distance_threshold=side*2\n-        )\n-        mac_mids_list = [x[0] for x in mac_mids]\n-\n-        if len(mac_mids_list) == 1:\n-            \"\"\"\n-            special case of only one valid centre found (probably not needed)\n-            \"\"\"\n-            clus_list = []\n-            clus_list.append([mac_mids, len(mac_mids)])\n-\n-        else:\n-            clustering.fit(mac_mids_list)\n-            # try:\n-            #     clustering.fit(mac_mids_list)\n-            # except RuntimeWarning as error:\n-            #     return(0, None, None, error)\n-\n-            \"\"\"\n-            create list of all clusters\n-            \"\"\"\n-            clus_list = []\n-            if clustering.n_clusters_ > 1:\n-                for i in range(clustering.labels_.max()+1):\n-                    indices = [j for j, x in enumerate(clustering.labels_) if x == i]\n-                    clus = []\n-                    for index in indices:\n-                        clus.append(mac_mids[index])\n-                    clus_list.append([clus, len(clus)])\n-                clus_list.sort(key=lambda x: -x[1])\n-\n-            elif clustering.n_clusters_ == 1:\n-                \"\"\"\n-                special case of only one cluster found\n-                \"\"\"\n-                # print('only 1 cluster')\n-                clus_list.append([mac_mids, len(mac_mids)])\n-            else:\n-                raise MacbethError(\n-                    '\\nWARNING: No macebth chart found!'\n-                    '\\nNo clusters found'\n-                    '\\nPossible problems:\\n'\n-                    '- NA\\n'\n-                )\n-\n-        \"\"\"\n-        keep only clusters with enough votes\n-        \"\"\"\n-        clus_len_max = clus_list[0][1]\n-        clus_tol = 0.7\n-        for i in range(len(clus_list)):\n-            if clus_list[i][1] < clus_len_max * clus_tol:\n-                clus_list = clus_list[:i]\n-                break\n-            cent = np.mean(clus_list[i][0], axis=0)[0]\n-            clus_list[i].append(cent)\n-\n-        \"\"\"\n-        represent most popular cluster centroids\n-        \"\"\"\n-        # copy = original_bw.copy()\n-        # copy = cv2.cvtColor(copy, cv2.COLOR_GRAY2RGB)\n-        # copy = cv2.resize(copy, None, fx=2, fy=2)\n-        # for clus in clus_list:\n-        #     centroid = tuple(2*np.round(clus[2]).astype(np.int32))\n-        #     cv2.circle(copy, centroid, 7, (255, 0, 0), -1)\n-        #     cv2.circle(copy, centroid, 2, (0, 0, 255), -1)\n-        # represent(copy)\n-\n-        \"\"\"\n-        get centres of each normalised square\n-        \"\"\"\n-        reference = get_square_centres(0.06)\n-\n-        \"\"\"\n-        for each possible macbeth chart, transform image into\n-        normalised space and find correlation with reference\n-        \"\"\"\n-        max_cor = 0\n-        best_map = None\n-        best_fit = None\n-        best_cen_fit = None\n-        best_ref_mat = None\n-\n-        for clus in clus_list:\n-            clus = clus[0]\n-            sq_cents = []\n-            ref_cents = []\n-            i_list = [p[1][0] for p in clus]\n-            for point in clus:\n-                i, j = point[1]\n-                \"\"\"\n-                remove any square that voted for two different points within\n-                the same cluster. This causes the same point in the image to be\n-                mapped to two different reference square centres, resulting in\n-                a very distorted perspective transform since cv2.findHomography\n-                simply minimises error.\n-                This phenomenon is not particularly likely to occur due to the\n-                enforced distance threshold in the clustering fit but it is\n-                best to keep this in just in case.\n-                \"\"\"\n-                if i_list.count(i) == 1:\n-                    square = squares_raw[i]\n-                    sq_cent = np.mean(square, axis=0)\n-                    ref_cent = reference[j]\n-                    sq_cents.append(sq_cent)\n-                    ref_cents.append(ref_cent)\n-\n-                    \"\"\"\n-                    At least four squares need to have voted for a centre in\n-                    order for a transform to be found\n-                    \"\"\"\n-            if len(sq_cents) < 4:\n-                raise MacbethError(\n-                    '\\nWARNING: No macbeth chart found!'\n-                    '\\nNot enough squares found'\n-                    '\\nPossible problems:\\n'\n-                    '- Macbeth chart is occluded\\n'\n-                    '- Macbeth chart is too dark or bright\\n'\n-                )\n-\n-            ref_cents = np.array(ref_cents)\n-            sq_cents = np.array(sq_cents)\n-            \"\"\"\n-            find best fit transform from normalised centres to image\n-            \"\"\"\n-            h_mat, mask = cv2.findHomography(ref_cents, sq_cents)\n-            if 'None' in str(type(h_mat)):\n-                raise MacbethError(\n-                    '\\nERROR\\n'\n-                )\n-\n-            \"\"\"\n-            transform normalised corners and centres into image space\n-            \"\"\"\n-            mac_fit = cv2.perspectiveTransform(mac_norm, h_mat)\n-            mac_cen_fit = cv2.perspectiveTransform(np.array([reference]), h_mat)\n-            \"\"\"\n-            transform located corners into reference space\n-            \"\"\"\n-            ref_mat = cv2.getPerspectiveTransform(\n-                mac_fit,\n-                np.array([ref_corns])\n-            )\n-            map_to_ref = cv2.warpPerspective(\n-                original_bw, ref_mat,\n-                (ref_w, ref_h)\n-            )\n-            \"\"\"\n-            normalise brigthness\n-            \"\"\"\n-            a = 125/np.average(map_to_ref)\n-            map_to_ref = cv2.convertScaleAbs(map_to_ref, alpha=a, beta=0)\n-            \"\"\"\n-            find correlation with bw reference macbeth\n-            \"\"\"\n-            cor = correlate(map_to_ref, ref)\n-            \"\"\"\n-            keep only if best correlation\n-            \"\"\"\n-            if cor > max_cor:\n-                max_cor = cor\n-                best_map = map_to_ref\n-                best_fit = mac_fit\n-                best_cen_fit = mac_cen_fit\n-                best_ref_mat = ref_mat\n-\n-            \"\"\"\n-            rotate macbeth by pi and recorrelate in case macbeth chart is\n-            upside-down\n-            \"\"\"\n-            mac_fit_inv = np.array(\n-                ([[mac_fit[0][2], mac_fit[0][3],\n-                  mac_fit[0][0], mac_fit[0][1]]])\n-            )\n-            mac_cen_fit_inv = np.flip(mac_cen_fit, axis=1)\n-            ref_mat = cv2.getPerspectiveTransform(\n-                mac_fit_inv,\n-                np.array([ref_corns])\n-            )\n-            map_to_ref = cv2.warpPerspective(\n-                original_bw, ref_mat,\n-                (ref_w, ref_h)\n-            )\n-            a = 125/np.average(map_to_ref)\n-            map_to_ref = cv2.convertScaleAbs(map_to_ref, alpha=a, beta=0)\n-            cor = correlate(map_to_ref, ref)\n-            if cor > max_cor:\n-                max_cor = cor\n-                best_map = map_to_ref\n-                best_fit = mac_fit_inv\n-                best_cen_fit = mac_cen_fit_inv\n-                best_ref_mat = ref_mat\n-\n-        \"\"\"\n-        Check best match is above threshold\n-        \"\"\"\n-        cor_thresh = 0.6\n-        if max_cor < cor_thresh:\n-            raise MacbethError(\n-                '\\nWARNING: Correlation too low'\n-                '\\nPossible problems:\\n'\n-                '- Bad lighting conditions\\n'\n-                '- Macbeth chart is occluded\\n'\n-                '- Background is too noisy\\n'\n-                '- Macbeth chart is out of camera plane\\n'\n-            )\n-            \"\"\"\n-            Following code is mostly representation for debugging purposes\n-            \"\"\"\n-\n-        \"\"\"\n-        draw macbeth corners and centres on image\n-        \"\"\"\n-        copy = original.copy()\n-        copy = cv2.resize(original, None, fx=2, fy=2)\n-        # print('correlation = {}'.format(round(max_cor, 2)))\n-        for point in best_fit[0]:\n-            point = np.array(point, np.float32)\n-            point = tuple(2*np.round(point).astype(np.int32))\n-            cv2.circle(copy, point, 4, (255, 0, 0), -1)\n-        for point in best_cen_fit[0]:\n-            point = np.array(point, np.float32)\n-            point = tuple(2*np.round(point).astype(np.int32))\n-            cv2.circle(copy, point, 4, (0, 0, 255), -1)\n-            copy = copy.copy()\n-            cv2.circle(copy, point, 4, (0, 0, 255), -1)\n-\n-        \"\"\"\n-        represent coloured macbeth in reference space\n-        \"\"\"\n-        best_map_col = cv2.warpPerspective(\n-            original, best_ref_mat, (ref_w, ref_h)\n-        )\n-        best_map_col = cv2.resize(\n-            best_map_col, None, fx=4, fy=4\n-        )\n-        a = 125/np.average(best_map_col)\n-        best_map_col_norm = cv2.convertScaleAbs(\n-            best_map_col, alpha=a, beta=0\n-        )\n-        # cv2.imshow('Macbeth', best_map_col)\n-        # represent(copy)\n-\n-        \"\"\"\n-        rescale coordinates to original image size\n-        \"\"\"\n-        fit_coords = (best_fit/factor, best_cen_fit/factor)\n-\n-        return(max_cor, best_map_col_norm, fit_coords, success_msg)\n-\n-        \"\"\"\n-    catch macbeth errors and continue with code\n-    \"\"\"\n-    except MacbethError as error:\n-        return(0, None, None, error)\ndiff --git a/utils/raspberrypi/ctt/ctt_noise.py b/utils/raspberrypi/ctt/ctt_noise.py\ndeleted file mode 100644\nindex 0b18d83fe67f..000000000000\n--- a/utils/raspberrypi/ctt/ctt_noise.py\n+++ /dev/null\n@@ -1,123 +0,0 @@\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2019, Raspberry Pi Ltd\n-#\n-# camera tuning tool noise calibration\n-\n-from ctt_image_load import *\n-import matplotlib.pyplot as plt\n-\n-\n-\"\"\"\n-Find noise standard deviation and fit to model:\n-\n-    noise std = a + b*sqrt(pixel mean)\n-\"\"\"\n-def noise(Cam, Img, plot):\n-    Cam.log += '\\nProcessing image: {}'.format(Img.name)\n-    stds = []\n-    means = []\n-    \"\"\"\n-    iterate through macbeth square patches\n-    \"\"\"\n-    for ch_patches in Img.patches:\n-        for patch in ch_patches:\n-            \"\"\"\n-            renormalise patch\n-            \"\"\"\n-            patch = np.array(patch)\n-            patch = (patch-Img.blacklevel_16)/Img.againQ8_norm\n-            std = np.std(patch)\n-            mean = np.mean(patch)\n-            stds.append(std)\n-            means.append(mean)\n-\n-    \"\"\"\n-    clean data and ensure all means are above 0\n-    \"\"\"\n-    stds = np.array(stds)\n-    means = np.array(means)\n-    means = np.clip(np.array(means), 0, None)\n-    sq_means = np.sqrt(means)\n-\n-    \"\"\"\n-    least squares fit model\n-    \"\"\"\n-    fit = np.polyfit(sq_means, stds, 1)\n-    Cam.log += '\\nBlack level = {}'.format(Img.blacklevel_16)\n-    Cam.log += '\\nNoise profile: offset = {}'.format(int(fit[1]))\n-    Cam.log += ' slope = {:.3f}'.format(fit[0])\n-    \"\"\"\n-    remove any values further than std from the fit\n-\n-    anomalies most likely caused by:\n-    > ucharacteristically noisy white patch\n-    > saturation in the white patch\n-    \"\"\"\n-    fit_score = np.abs(stds - fit[0]*sq_means - fit[1])\n-    fit_std = np.std(stds)\n-    fit_score_norm = fit_score - fit_std\n-    anom_ind = np.where(fit_score_norm > 1)\n-    fit_score_norm.sort()\n-    sq_means_clean = np.delete(sq_means, anom_ind)\n-    stds_clean = np.delete(stds, anom_ind)\n-    removed = len(stds) - len(stds_clean)\n-    if removed != 0:\n-        Cam.log += '\\nIdentified and removed {} anomalies.'.format(removed)\n-        Cam.log += '\\nRecalculating fit'\n-        \"\"\"\n-        recalculate fit with outliers removed\n-        \"\"\"\n-        fit = np.polyfit(sq_means_clean, stds_clean, 1)\n-        Cam.log += '\\nNoise profile: offset = {}'.format(int(fit[1]))\n-        Cam.log += ' slope = {:.3f}'.format(fit[0])\n-\n-    \"\"\"\n-    if fit const is < 0 then force through 0 by\n-    dividing by sq_means and fitting poly order 0\n-    \"\"\"\n-    corrected = 0\n-    if fit[1] < 0:\n-        corrected = 1\n-        ones = np.ones(len(means))\n-        y_data = stds/sq_means\n-        fit2 = np.polyfit(ones, y_data, 0)\n-        Cam.log += '\\nOffset below zero. Fit recalculated with zero offset'\n-        Cam.log += '\\nNoise profile: offset = 0'\n-        Cam.log += ' slope = {:.3f}'.format(fit2[0])\n-        # print('new fit')\n-        # print(fit2)\n-\n-    \"\"\"\n-    plot fit for debug\n-    \"\"\"\n-    if plot:\n-        x = np.arange(sq_means.max()//0.88)\n-        fit_plot = x*fit[0] + fit[1]\n-        plt.scatter(sq_means, stds, label='data', color='blue')\n-        plt.scatter(sq_means[anom_ind], stds[anom_ind], color='orange', label='anomalies')\n-        plt.plot(x, fit_plot, label='fit', color='red', ls=':')\n-        if fit[1] < 0:\n-            fit_plot_2 = x*fit2[0]\n-            plt.plot(x, fit_plot_2, label='fit 0 intercept', color='green', ls='--')\n-        plt.plot(0, 0)\n-        plt.title('Noise Plot\\nImg: {}'.format(Img.str))\n-        plt.legend(loc='upper left')\n-        plt.xlabel('Sqrt Pixel Value')\n-        plt.ylabel('Noise Standard Deviation')\n-        plt.grid()\n-        plt.show()\n-    \"\"\"\n-    End of plotting code\n-    \"\"\"\n-\n-    \"\"\"\n-    format output to include forced 0 constant\n-    \"\"\"\n-    Cam.log += '\\n'\n-    if corrected:\n-        fit = [fit2[0], 0]\n-        return fit\n-\n-    else:\n-        return fit\ndiff --git a/utils/raspberrypi/ctt/ctt_pisp.py b/utils/raspberrypi/ctt/ctt_pisp.py\ndeleted file mode 100755\nindex 8a5fc03f0215..000000000000\n--- a/utils/raspberrypi/ctt/ctt_pisp.py\n+++ /dev/null\n@@ -1,823 +0,0 @@\n-#!/usr/bin/env python3\n-#\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2019, Raspberry Pi Ltd\n-#\n-# ctt_pisp.py - camera tuning tool data for PiSP platforms\n-\n-\n-json_template = {\n-    \"rpi.black_level\": {\n-        \"black_level\": 4096\n-    },\n-    \"rpi.lux\": {\n-        \"reference_shutter_speed\": 10000,\n-        \"reference_gain\": 1,\n-        \"reference_aperture\": 1.0\n-    },\n-    \"rpi.dpc\": {\n-\t\"strength\": 1\n-    },\n-    \"rpi.noise\": {\n-    },\n-    \"rpi.geq\": {\n-    },\n-    \"rpi.denoise\":\n-    {\n-        \"normal\":\n-        {\n-            \"sdn\":\n-            {\n-                \"deviation\": 0.6,\n-                \"strength\": 0.95,\n-                \"deviation2\": 3.2,\n-                \"deviation_no_tdn\": 3.2,\n-                \"strength_no_tdn\": 0.95\n-            },\n-            \"cdn\":\n-            {\n-                \"deviation\": 200,\n-                \"strength\": 0.3\n-            },\n-            \"tdn\":\n-            {\n-                \"deviation\": 1.0,\n-                \"threshold\": 0.05\n-            }\n-        },\n-        \"hdr\":\n-        {\n-            \"sdn\":\n-            {\n-                \"deviation\": 0.6,\n-                \"strength\": 0.95,\n-                \"deviation2\": 3.2,\n-                \"deviation_no_tdn\": 3.2,\n-                \"strength_no_tdn\": 0.95\n-            },\n-            \"cdn\":\n-            {\n-                \"deviation\": 200,\n-                \"strength\": 0.3\n-            },\n-            \"tdn\":\n-            {\n-                \"deviation\": 1.3,\n-                \"threshold\": 0.1\n-            }\n-        },\n-        \"night\":\n-        {\n-            \"sdn\":\n-            {\n-                \"deviation\": 0.6,\n-                \"strength\": 0.95,\n-                \"deviation2\": 3.2,\n-                \"deviation_no_tdn\": 3.2,\n-                \"strength_no_tdn\": 0.95\n-            },\n-            \"cdn\":\n-            {\n-                \"deviation\": 200,\n-                \"strength\": 0.3\n-            },\n-            \"tdn\":\n-            {\n-                \"deviation\": 1.3,\n-                \"threshold\": 0.1\n-            }\n-        }\n-    },\n-    \"rpi.awb\": {\n-        \"priors\": [\n-            {\"lux\": 0, \"prior\": [2000, 1.0, 3000, 0.0, 13000, 0.0]},\n-            {\"lux\": 800, \"prior\": [2000, 0.0, 6000, 2.0, 13000, 2.0]},\n-            {\"lux\": 1500, \"prior\": [2000, 0.0, 4000, 1.0, 6000, 6.0, 6500, 7.0, 7000, 1.0, 13000, 1.0]}\n-        ],\n-        \"modes\": {\n-            \"auto\": {\"lo\": 2500, \"hi\": 7700},\n-            \"incandescent\": {\"lo\": 2500, \"hi\": 3000},\n-            \"tungsten\": {\"lo\": 3000, \"hi\": 3500},\n-            \"fluorescent\": {\"lo\": 4000, \"hi\": 4700},\n-            \"indoor\": {\"lo\": 3000, \"hi\": 5000},\n-            \"daylight\": {\"lo\": 5500, \"hi\": 6500},\n-            \"cloudy\": {\"lo\": 7000, \"hi\": 8000}\n-        },\n-        \"bayes\": 1\n-    },\n-    \"rpi.agc\":\n-    {\n-        \"channels\":\n-        [\n-            {\n-                \"comment\": \"Channel 0 is normal AGC\",\n-                \"metering_modes\":\n-                {\n-                    \"centre-weighted\":\n-                    {\n-                        \"weights\":\n-                        [\n-                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,\n-                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,\n-                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,\n-                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,\n-                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,\n-                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,\n-                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0\n-                        ]\n-                    },\n-                    \"spot\":\n-                    {\n-                        \"weights\":\n-                        [\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0\n-                        ]\n-                    },\n-                    \"matrix\":\n-                    {\n-                        \"weights\":\n-                        [\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1\n-                        ]\n-                    }\n-                },\n-                \"exposure_modes\":\n-                {\n-                    \"normal\":\n-                    {\n-                        \"shutter\": [ 100, 10000, 30000, 60000, 66666 ],\n-                        \"gain\": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]\n-                    },\n-                    \"short\":\n-                    {\n-                        \"shutter\": [ 100, 5000, 10000, 20000, 60000 ],\n-                        \"gain\": [ 1.0, 1.5, 2.0, 4.0, 8.0 ]\n-                    },\n-                    \"long\":\n-                    {\n-                        \"shutter\": [ 100, 10000, 30000, 60000, 90000, 120000 ],\n-                        \"gain\": [ 1.0, 1.5, 2.0, 4.0, 8.0, 12.0 ]\n-                    }\n-                },\n-                \"constraint_modes\":\n-                {\n-                    \"normal\": [\n-                        {\n-                            \"bound\": \"LOWER\",\n-                            \"q_lo\": 0.98,\n-                            \"q_hi\": 1.0,\n-                            \"y_target\":\n-                            [\n-                                0, 0.5,\n-                                1000, 0.5\n-                            ]\n-                        }\n-                    ],\n-                    \"highlight\": [\n-                        {\n-                            \"bound\": \"LOWER\",\n-                            \"q_lo\": 0.98,\n-                            \"q_hi\": 1.0,\n-                            \"y_target\":\n-                            [\n-                                0, 0.5,\n-                                1000, 0.5\n-                            ]\n-                        },\n-                        {\n-                            \"bound\": \"UPPER\",\n-                            \"q_lo\": 0.98,\n-                            \"q_hi\": 1.0,\n-                            \"y_target\":\n-                            [\n-                                0, 0.8,\n-                                1000, 0.8\n-                            ]\n-                        },\n-                    ],\n-                    \"shadows\": [\n-                        {\n-                            \"bound\": \"LOWER\",\n-                            \"q_lo\": 0.0,\n-                            \"q_hi\": 0.5,\n-                            \"y_target\":\n-                            [\n-                                0, 0.17,\n-                                1000, 0.17\n-                            ]\n-                        }\n-                    ]\n-                },\n-                \"y_target\":\n-                [\n-                    0, 0.16,\n-                    1000, 0.165,\n-                    10000, 0.17\n-                ]\n-            },\n-            {\n-                \"comment\": \"Channel 1 is the HDR short channel\",\n-                \"desaturate\": 0,\n-                \"metering_modes\":\n-                {\n-                    \"centre-weighted\":\n-                    {\n-                        \"weights\":\n-                        [\n-                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,\n-                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,\n-                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,\n-                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,\n-                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,\n-                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,\n-                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0\n-                        ]\n-                    },\n-                    \"spot\":\n-                    {\n-                        \"weights\":\n-                        [\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0\n-                        ]\n-                    },\n-                    \"matrix\":\n-                    {\n-                        \"weights\":\n-                        [\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1\n-                        ]\n-                    }\n-                },\n-                \"exposure_modes\":\n-                {\n-                    \"normal\":\n-                    {\n-                        \"shutter\": [ 100, 20000, 60000 ],\n-                        \"gain\": [ 1.0, 1.0, 1.0 ]\n-                    },\n-                    \"short\":\n-                    {\n-                        \"shutter\": [ 100, 20000, 60000 ],\n-                        \"gain\": [ 1.0, 1.0, 1.0 ]\n-                    },\n-                    \"long\":\n-                    {\n-                        \"shutter\": [ 100, 20000, 60000 ],\n-                        \"gain\": [ 1.0, 1.0, 1.0 ]\n-                    }\n-                },\n-                \"constraint_modes\":\n-                {\n-                    \"normal\": [\n-                        {\n-                            \"bound\": \"LOWER\",\n-                            \"q_lo\": 0.95,\n-                            \"q_hi\": 1.0,\n-                            \"y_target\":\n-                            [\n-                                0, 0.5,\n-                                1000, 0.5\n-                            ]\n-                        },\n-                        {\n-                            \"bound\": \"UPPER\",\n-                            \"q_lo\": 0.95,\n-                            \"q_hi\": 1.0,\n-                            \"y_target\":\n-                            [\n-                                0, 0.7,\n-                                1000, 0.7\n-                            ]\n-                        },\n-                        {\n-                            \"bound\": \"LOWER\",\n-                            \"q_lo\": 0.0,\n-                            \"q_hi\": 0.2,\n-                            \"y_target\":\n-                            [\n-                                0, 0.002,\n-                                1000, 0.002\n-                            ]\n-                        }\n-                    ],\n-                    \"highlight\": [\n-                        {\n-                            \"bound\": \"LOWER\",\n-                            \"q_lo\": 0.95,\n-                            \"q_hi\": 1.0,\n-                            \"y_target\":\n-                            [\n-                                0, 0.5,\n-                                1000, 0.5\n-                            ]\n-                        },\n-                        {\n-                            \"bound\": \"UPPER\",\n-                            \"q_lo\": 0.95,\n-                            \"q_hi\": 1.0,\n-                            \"y_target\":\n-                            [\n-                                0, 0.7,\n-                                1000, 0.7\n-                            ]\n-                        },\n-                        {\n-                            \"bound\": \"LOWER\",\n-                            \"q_lo\": 0.0,\n-                            \"q_hi\": 0.2,\n-                            \"y_target\":\n-                            [\n-                                0, 0.002,\n-                                1000, 0.002\n-                            ]\n-                        }\n-                    ],\n-                    \"shadows\": [\n-                        {\n-                            \"bound\": \"LOWER\",\n-                            \"q_lo\": 0.95,\n-                            \"q_hi\": 1.0,\n-                            \"y_target\":\n-                            [\n-                                0, 0.5,\n-                                1000, 0.5\n-                            ]\n-                        },\n-                        {\n-                            \"bound\": \"UPPER\",\n-                            \"q_lo\": 0.95,\n-                            \"q_hi\": 1.0,\n-                            \"y_target\":\n-                            [\n-                                0, 0.7,\n-                                1000, 0.7\n-                            ]\n-                        },\n-                        {\n-                            \"bound\": \"LOWER\",\n-                            \"q_lo\": 0.0,\n-                            \"q_hi\": 0.2,\n-                            \"y_target\":\n-                            [\n-                                0, 0.002,\n-                                1000, 0.002\n-                            ]\n-                        }\n-                    ]\n-                },\n-                \"y_target\":\n-                [\n-                    0, 0.16,\n-                    1000, 0.165,\n-                    10000, 0.17\n-                ]\n-            },\n-            {\n-                \"comment\": \"Channel 2 is the HDR long channel\",\n-                \"desaturate\": 0,\n-                \"metering_modes\":\n-                {\n-                    \"centre-weighted\":\n-                    {\n-                        \"weights\":\n-                        [\n-                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,\n-                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,\n-                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,\n-                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,\n-                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,\n-                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,\n-                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0\n-                        ]\n-                    },\n-                    \"spot\":\n-                    {\n-                        \"weights\":\n-                        [\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0\n-                        ]\n-                    },\n-                    \"matrix\":\n-                    {\n-                        \"weights\":\n-                        [\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1\n-                        ]\n-                    }\n-                },\n-                \"exposure_modes\":\n-                {\n-                    \"normal\":\n-                    {\n-                        \"shutter\": [ 100, 20000, 30000, 60000 ],\n-                        \"gain\": [ 1.0, 2.0, 4.0, 8.0 ]\n-                    },\n-                    \"short\":\n-                    {\n-                        \"shutter\": [ 100, 20000, 30000, 60000 ],\n-                        \"gain\": [ 1.0, 2.0, 4.0, 8.0 ]\n-                    },\n-                    \"long\":\n-                    {\n-                        \"shutter\": [ 100, 20000, 30000, 60000 ],\n-                        \"gain\": [ 1.0, 2.0, 4.0, 8.0 ]\n-                    }\n-                },\n-                \"constraint_modes\":\n-                {\n-                    \"normal\": [\n-                    ],\n-                    \"highlight\": [\n-                    ],\n-                    \"shadows\": [\n-                    ]\n-                },\n-                \"channel_constraints\":\n-                [\n-                    {\n-                        \"bound\": \"UPPER\",\n-                        \"channel\": 4,\n-                        \"factor\": 8\n-                    },\n-                    {\n-                        \"bound\": \"LOWER\",\n-                        \"channel\": 4,\n-                        \"factor\": 2\n-                    }\n-                ],\n-                \"y_target\":\n-                [\n-                    0, 0.16,\n-                    1000, 0.165,\n-                    10000, 0.17\n-                ]\n-            },\n-            {\n-                \"comment\": \"Channel 3 is the night mode channel\",\n-                \"base_ev\": 0.33,\n-                \"metering_modes\":\n-                {\n-                    \"centre-weighted\":\n-                    {\n-                        \"weights\":\n-                        [\n-                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0,\n-                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,\n-                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,\n-                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 3, 3, 4, 4, 4, 3, 3, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 3, 3, 3, 4, 3, 3, 3, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 3, 3, 3, 3, 3, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 2, 3, 3, 3, 2, 2, 2, 2, 1, 1,\n-                            1, 1, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 2, 1, 1,\n-                            1, 1, 1, 1, 2, 2, 2, 2, 2, 2, 2, 1, 1, 1, 1,\n-                            0, 1, 1, 1, 1, 1, 2, 2, 2, 1, 1, 1, 1, 1, 0,\n-                            0, 0, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 0, 0\n-                        ]\n-                    },\n-                    \"spot\":\n-                    {\n-                        \"weights\":\n-                        [\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 1, 2, 3, 2, 1, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 1, 2, 1, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0,\n-                            0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0\n-                        ]\n-                    },\n-                    \"matrix\":\n-                    {\n-                        \"weights\":\n-                        [\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1,\n-                            1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1\n-                        ]\n-                    }\n-                },\n-                \"exposure_modes\":\n-                {\n-                    \"normal\":\n-                    {\n-                        \"shutter\": [ 100, 20000, 66666 ],\n-                        \"gain\": [ 1.0, 2.0, 4.0 ]\n-                    },\n-                    \"short\":\n-                    {\n-                        \"shutter\": [ 100, 20000, 33333 ],\n-                        \"gain\": [ 1.0, 2.0, 4.0 ]\n-                    },\n-                    \"long\":\n-                    {\n-                        \"shutter\": [ 100, 20000, 66666, 120000 ],\n-                        \"gain\": [ 1.0, 2.0, 4.0, 4.0 ]\n-                    }\n-                },\n-                \"constraint_modes\":\n-                {\n-                    \"normal\": [\n-                        {\n-                            \"bound\": \"LOWER\",\n-                            \"q_lo\": 0.98,\n-                            \"q_hi\": 1.0,\n-                            \"y_target\":\n-                            [\n-                                0, 0.5,\n-                                1000, 0.5\n-                            ]\n-                        }\n-                    ],\n-                    \"highlight\": [\n-                        {\n-                            \"bound\": \"LOWER\",\n-                            \"q_lo\": 0.98,\n-                            \"q_hi\": 1.0,\n-                            \"y_target\":\n-                            [\n-                                0, 0.5,\n-                                1000, 0.5\n-                            ]\n-                        },\n-                        {\n-                            \"bound\": \"UPPER\",\n-                            \"q_lo\": 0.98,\n-                            \"q_hi\": 1.0,\n-                            \"y_target\":\n-                            [\n-                                0, 0.8,\n-                                1000, 0.8\n-                            ]\n-                        }\n-                    ],\n-                    \"shadows\": [\n-                        {\n-                            \"bound\": \"LOWER\",\n-                            \"q_lo\": 0.98,\n-                            \"q_hi\": 1.0,\n-                            \"y_target\":\n-                            [\n-                                0, 0.5,\n-                                1000, 0.5\n-                            ]\n-                        }\n-                    ]\n-                },\n-                \"y_target\":\n-                [\n-                    0, 0.16,\n-                    1000, 0.16,\n-                    10000, 0.17\n-                ]\n-            }\n-        ]\n-    },\n-    \"rpi.alsc\": {\n-        'omega': 1.3,\n-        'n_iter': 100,\n-        'luminance_strength': 0.8,\n-    },\n-    \"rpi.contrast\": {\n-        \"ce_enable\": 1,\n-        \"gamma_curve\": [\n-            0, 0,\n-            512, 2518,\n-            1024, 5033,\n-            1536, 7175,\n-            2048, 9309,\n-            2560, 10814,\n-            3072, 12312,\n-            3584, 13773,\n-            4096, 15225,\n-            4608, 16566,\n-            5120, 17899,\n-            5632, 19221,\n-            6144, 20534,\n-            6656, 21684,\n-            7168, 22826,\n-            7680, 24024,\n-            8192, 25212,\n-            9216, 27251,\n-            10240, 29167,\n-            11264, 30947,\n-            12288, 32696,\n-            13312, 34309,\n-            14336, 35849,\n-            15360, 37194,\n-            16384, 38445,\n-            17408, 39598,\n-            18432, 40732,\n-            19456, 41717,\n-            20480, 42687,\n-            22528, 44343,\n-            24576, 45871,\n-            26624, 47222,\n-            28672, 48441,\n-            30720, 49460,\n-            32768, 50470,\n-            34816, 51476,\n-            36864, 52480,\n-            38912, 53382,\n-            40960, 54294,\n-            43008, 55155,\n-            45056, 56035,\n-            47104, 56920,\n-            49152, 57824,\n-            51200, 58737,\n-            53248, 59666,\n-            55296, 60604,\n-            57344, 61558,\n-            59392, 62529,\n-            61440, 63516,\n-            63488, 64519,\n-            65535, 65535\n-        ]\n-    },\n-    \"rpi.ccm\": {\n-    },\n-    \"rpi.cac\": {\n-    },\n-    \"rpi.sharpen\": {\n-\t\"threshold\": 0.75,\n-\t\"limit\": 0.5,\n-\t\"strength\": 1.0\n-    },\n-    \"rpi.hdr\":\n-    {\n-        \"Off\":\n-        {\n-            \"cadence\": [ 0 ]\n-        },\n-        \"MultiExposureUnmerged\":\n-        {\n-            \"cadence\": [ 1, 2 ],\n-            \"channel_map\": { \"short\": 1, \"long\": 2 }\n-        },\n-        \"SingleExposure\":\n-        {\n-            \"cadence\": [1],\n-            \"channel_map\": { \"short\": 1 },\n-            \"spatial_gain\": 2.0,\n-            \"tonemap_enable\": 1\n-        },\n-        \"MultiExposure\":\n-        {\n-            \"cadence\": [1, 2],\n-            \"channel_map\": { \"short\": 1, \"long\": 2 },\n-            \"stitch_enable\": 1,\n-            \"spatial_gain\": 2.0,\n-            \"tonemap_enable\": 1\n-        },\n-        \"Night\":\n-        {\n-            \"cadence\": [ 3 ],\n-            \"channel_map\": { \"night\": 3 },\n-            \"tonemap_enable\": 1,\n-            \"tonemap\":\n-            [\n-                0, 0,\n-                5000, 20000,\n-                10000, 30000,\n-                20000, 47000,\n-                30000, 55000,\n-                65535, 65535\n-            ]\n-        }\n-    }\n-}\n-\n-grid_size = (32, 32)\ndiff --git a/utils/raspberrypi/ctt/ctt_pretty_print_json.py b/utils/raspberrypi/ctt/ctt_pretty_print_json.py\ndeleted file mode 100755\nindex a4cae62d824f..000000000000\n--- a/utils/raspberrypi/ctt/ctt_pretty_print_json.py\n+++ /dev/null\n@@ -1,130 +0,0 @@\n-#!/usr/bin/env python3\n-#\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright 2022 Raspberry Pi Ltd\n-#\n-# Script to pretty print a Raspberry Pi tuning config JSON structure in\n-# version 2.0 and later formats.\n-\n-import argparse\n-import json\n-import textwrap\n-\n-\n-class Encoder(json.JSONEncoder):\n-\n-    def __init__(self, *args, **kwargs):\n-        super().__init__(*args, **kwargs)\n-        self.indentation_level = 0\n-        self.hard_break = 120\n-        self.custom_elems = {\n-            'weights': 15,\n-            'table': 16,\n-            'luminance_lut': 16,\n-            'ct_curve': 3,\n-            'ccm': 3,\n-            'lut_rx': 9,\n-            'lut_bx': 9,\n-            'lut_by': 9,\n-            'lut_ry': 9,\n-            'gamma_curve': 2,\n-            'y_target': 2,\n-            'prior': 2,\n-            'tonemap': 2\n-        }\n-\n-    def encode(self, o, node_key=None):\n-        if isinstance(o, (list, tuple)):\n-            # Check if we are a flat list of numbers.\n-            if not any(isinstance(el, (list, tuple, dict)) for el in o):\n-                s = ', '.join(json.dumps(el) for el in o)\n-                if node_key in self.custom_elems.keys():\n-                    # Special case handling to specify number of elements in a row for tables, ccm, etc.\n-                    self.indentation_level += 1\n-                    sl = s.split(', ')\n-                    num = self.custom_elems[node_key]\n-                    chunk = [self.indent_str + ', '.join(sl[x:x + num]) for x in range(0, len(sl), num)]\n-                    t = ',\\n'.join(chunk)\n-                    self.indentation_level -= 1\n-                    output = f'\\n{self.indent_str}[\\n{t}\\n{self.indent_str}]'\n-                elif len(s) > self.hard_break - len(self.indent_str):\n-                    # Break a long list with wraps.\n-                    self.indentation_level += 1\n-                    t = textwrap.fill(s, self.hard_break, break_long_words=False,\n-                                      initial_indent=self.indent_str, subsequent_indent=self.indent_str)\n-                    self.indentation_level -= 1\n-                    output = f'\\n{self.indent_str}[\\n{t}\\n{self.indent_str}]'\n-                else:\n-                    # Smaller lists can remain on a single line.\n-                    output = f' [ {s} ]'\n-                return output\n-            else:\n-                # Sub-structures in the list case.\n-                self.indentation_level += 1\n-                output = [self.indent_str + self.encode(el) for el in o]\n-                self.indentation_level -= 1\n-                output = ',\\n'.join(output)\n-                return f' [\\n{output}\\n{self.indent_str}]'\n-\n-        elif isinstance(o, dict):\n-            self.indentation_level += 1\n-            output = []\n-            for k, v in o.items():\n-                if isinstance(v, dict) and len(v) == 0:\n-                    # Empty config block special case.\n-                    output.append(self.indent_str + f'{json.dumps(k)}: {{ }}')\n-                else:\n-                    # Only linebreak if the next node is a config block.\n-                    sep = f'\\n{self.indent_str}' if isinstance(v, dict) else ''\n-                    output.append(self.indent_str + f'{json.dumps(k)}:{sep}{self.encode(v, k)}')\n-            output = ',\\n'.join(output)\n-            self.indentation_level -= 1\n-            return f'{{\\n{output}\\n{self.indent_str}}}'\n-\n-        else:\n-            return ' ' + json.dumps(o)\n-\n-    @property\n-    def indent_str(self) -> str:\n-        return ' ' * self.indentation_level * self.indent\n-\n-    def iterencode(self, o, **kwargs):\n-        return self.encode(o)\n-\n-\n-def pretty_print(in_json: dict, custom_elems={}) -> str:\n-\n-    if 'version' not in in_json or \\\n-       'target' not in in_json or \\\n-       'algorithms' not in in_json or \\\n-       in_json['version'] < 2.0:\n-        raise RuntimeError('Incompatible JSON dictionary has been provided')\n-\n-    encoder = Encoder(indent=4, sort_keys=False)\n-    encoder.custom_elems |= custom_elems\n-    return encoder.encode(in_json) #json.dumps(in_json, cls=Encoder, indent=4, sort_keys=False)\n-\n-\n-if __name__ == \"__main__\":\n-    parser = argparse.ArgumentParser(formatter_class=argparse.RawTextHelpFormatter, description=\n-                    'Prettify a version 2.0 camera tuning config JSON file.')\n-    parser.add_argument('-t', '--target', type=str, help='Target platform', choices=['pisp', 'vc4'], default='vc4')\n-    parser.add_argument('input', type=str, help='Input tuning file.')\n-    parser.add_argument('output', type=str, nargs='?',\n-                        help='Output converted tuning file. If not provided, the input file will be updated in-place.',\n-                        default=None)\n-    args = parser.parse_args()\n-\n-    with open(args.input, 'r') as f:\n-        in_json = json.load(f)\n-\n-    if args.target == 'pisp':\n-        from ctt_pisp import grid_size\n-    elif args.target == 'vc4':\n-        from ctt_vc4 import grid_size\n-\n-    out_json = pretty_print(in_json, custom_elems={'table': grid_size[0], 'luminance_lut': grid_size[0]})\n-\n-    with open(args.output if args.output is not None else args.input, 'w') as f:\n-        f.write(out_json)\ndiff --git a/utils/raspberrypi/ctt/ctt_ransac.py b/utils/raspberrypi/ctt/ctt_ransac.py\ndeleted file mode 100644\nindex 01bba3022ef0..000000000000\n--- a/utils/raspberrypi/ctt/ctt_ransac.py\n+++ /dev/null\n@@ -1,71 +0,0 @@\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2019, Raspberry Pi Ltd\n-#\n-# camera tuning tool RANSAC selector for Macbeth chart locator\n-\n-import numpy as np\n-\n-scale = 2\n-\n-\n-\"\"\"\n-constructs normalised macbeth chart corners for ransac algorithm\n-\"\"\"\n-def get_square_verts(c_err=0.05, scale=scale):\n-    \"\"\"\n-    define macbeth chart corners\n-    \"\"\"\n-    b_bord_x, b_bord_y = scale*8.5, scale*13\n-    s_bord = 6*scale\n-    side = 41*scale\n-    x_max = side*6 + 5*s_bord + 2*b_bord_x\n-    y_max = side*4 + 3*s_bord + 2*b_bord_y\n-    c1 = (0, 0)\n-    c2 = (0, y_max)\n-    c3 = (x_max, y_max)\n-    c4 = (x_max, 0)\n-    mac_norm = np.array((c1, c2, c3, c4), np.float32)\n-    mac_norm = np.array([mac_norm])\n-\n-    square_verts = []\n-    square_0 = np.array(((0, 0), (0, side),\n-                         (side, side), (side, 0)), np.float32)\n-    offset_0 = np.array((b_bord_x, b_bord_y), np.float32)\n-    c_off = side * c_err\n-    offset_cont = np.array(((c_off, c_off), (c_off, -c_off),\n-                            (-c_off, -c_off), (-c_off, c_off)), np.float32)\n-    square_0 += offset_0\n-    square_0 += offset_cont\n-    \"\"\"\n-    define macbeth square corners\n-    \"\"\"\n-    for i in range(6):\n-        shift_i = np.array(((i*side, 0), (i*side, 0),\n-                            (i*side, 0), (i*side, 0)), np.float32)\n-        shift_bord = np.array(((i*s_bord, 0), (i*s_bord, 0),\n-                               (i*s_bord, 0), (i*s_bord, 0)), np.float32)\n-        square_i = square_0 + shift_i + shift_bord\n-        for j in range(4):\n-            shift_j = np.array(((0, j*side), (0, j*side),\n-                                (0, j*side), (0, j*side)), np.float32)\n-            shift_bord = np.array(((0, j*s_bord),\n-                                   (0, j*s_bord), (0, j*s_bord),\n-                                   (0, j*s_bord)), np.float32)\n-            square_j = square_i + shift_j + shift_bord\n-            square_verts.append(square_j)\n-    # print('square_verts')\n-    # print(square_verts)\n-    return np.array(square_verts, np.float32), mac_norm\n-\n-\n-def get_square_centres(c_err=0.05, scale=scale):\n-    \"\"\"\n-    define macbeth square centres\n-    \"\"\"\n-    verts, mac_norm = get_square_verts(c_err, scale=scale)\n-\n-    centres = np.mean(verts, axis=1)\n-    # print('centres')\n-    # print(centres)\n-    return np.array(centres, np.float32)\ndiff --git a/utils/raspberrypi/ctt/ctt_ref.pgm b/utils/raspberrypi/ctt/ctt_ref.pgm\ndeleted file mode 100644\nindex 9b9f4920629c..000000000000\n--- a/utils/raspberrypi/ctt/ctt_ref.pgm\n+++ /dev/null\n@@ -1,5 +0,0 @@\n-P5\n-# Reference macbeth chart\n-120 80\n-255\n-    \u001f  !#!\"\u001e #!\"&&$#$#'\"%&#+2///..../.........-()))))))))))))))))))(((-,*)'(&)#($%(%\"###\"\"!%\"\"&\"&&!$\" #!$ \u001f!\"! $&**\"\u001f\u001f\u001f\u001f  !#\u001d5.,%\u001c+,-5\"0<HBAA54\" %##((()*+,---.........+*)))))))))))))))-.,,--+))('((''('%'%##\"!\"\"!\"!\"\"\"\"#! \u001f\u001f\u001f\u001f \u001d\u001f\u001f\u001f   !\u001f\u001f\u001f\u001f\u001f\u001f\u001f  %�/v��z:����L�����c�,!#\"\"%%''')**+)-../..../.-*)))))))))))))**,,)**'(''&'((&&%%##$! !!!! \u001f!\u001f \u001f!  \u001f\u001d   \u001f\u001d\u001f\u001d\u001d!\u001f\u001f\u001c\u001d\u001e\u001d \u001f\u001f  \u001f5*\"-)&\u00197(1.75Rnge`\\`$ \"\"!\"%%%'')())++--/---,-..,-.,++**))))())*)*)''%'%&%&'&%%\"\"\"\"\"   \u001f \u001f\u001f\u001f  \u001f   \u001f\u001f\u001e   \u001f \u001f\u001d \u001d\u001f\u001f\u001d\u001d\u001e\u001f\u001f\u001f \u001e\u001d\u001b!\u001e\u001e\u001f  \u001f\u001f !!\u001f$&$$&##(+*,,/10122126545./66402006486869650*.1.***)*+)()&((('('##)('&%%&%$$$#$%$%$\u001f (((*))('((('('(&%V\u001f\u001f\u001f\u001d\u001f0;>>;@@>@AAAACBCB=&<�����������������<5x���������������|64RYVTSRRRMMNLKJJLH+&0gijgdeffmmnpnkji`#3����������������bY!\u001f \u001c\u001e3FHHIIIHIJIIJHIII@#?�����������������=7}����������������:5Wcbcbdcb`^^`^^_^Y,'6����������������r'<����������������l%\u001d\u001e\u001f\u001b\u001d2FHHIIHJJJJJJIIJI?%;�����������������>7|����������������;8Xfeeegeccb`^aba]Z+)<����������������r)>����������������q#\u001c\u001c\u001b\u001b\u001d3GHIIIIJIIJJIHIJI@&5�����������������=8~����������������;8Zgghggedbdcbda^\\Z+(;����������������y)9����������������z\"\u001b\u001c\u001c\u001c\u001d3GIIJJJJJKJJJJJJJ@'4�����������������>9|����������������=8Zhighgeeeedeca__[/)B����������������v&:����������������|#\u001d\u001d\u001d\u001c\u001e3GJJIIJKKKJJJKKJK@&6�����������������>9~����������������<8Yghegggffihccab^\\/*C����������������z'9�����������������$\u001d \u001d\u001f 6IKJJMMMKMKKMKKMLC&2�����������������@9�����������������<9Yghhhhijiegdcebc^0)G����������������(7�����������������%\u001f\u001f   6JLMMNMMKMMNMMMMMD&2�����������������@:~����������������=9Xfghhjiigdgddedc`1)M����������������}(:��������������¾�&\u001c\u001d  \"8LNOONNOMONNMMNOND'3�����������������@;����������������=:Ziiigheegegegggdc1,Q����������������~)8�����������������%\u001d\u001f# \"9NNNPPPQOOOOONNOOD'0�����������������?;����������������=;[iigeeegghgdedgea0-P����������������(8���������������Ý'\u001d \"#$:NNOQPPRPQPOOPQPPD*1�����������������A;�����������������;:Yfghgghgghghhdggc3.\\����������������~);���������������¤(\u001f\u001f&%%;OQQQRSSRPQQQQSQQF)3�����������������B<�����������������=:Wfhghhhihggghfhee4/f�����������������*:���������������ä&\u001c\u001f%%%?RSSSSSTTTTSSSTTRE)5�����������������B=�����������������@:Ygiihhiiiihihiiif72p����������������}(9���������������Ʃ'\u001c\u001f#%&?TUTTTUUQSTTTTTVSF*3�����������������F>�����������������A;[ghjiihiiiihihije50r�����������������)6���������������ƫ&\u001d &#%?SVVVUUUUUTUUVVUUG*5�����������������F=�����������������A;Yhijiiijjiiiiijje81t����������������~)5���������������ư'\u001f '$$=OQRRQQPRSRSSSSSSG+6�����������������D@�����������������?;Wefgggggfffgeeefc41x����������������{*5�����������������(\u001d &&&'++++,,*-,-00-0100*-SUX\\]]`_ffgiooopo=;X\\bedbadbca`]\\]ZZ;;<::8:;9983433110/-,...1//12410/..--+)\"\",---,-./,,.-/-0-(\u001f\u001d &&%+/0103322011223233)(34534767::;;==:=B9;BFGEEGIKJKIJGIJCD=<:76566554111/0/1.*+00233300/00//..,+*#\")(*)++,++))*++**'!\u001f!&$*w����¼�����������1-_addc`ceccdccedbb?A|����������������B>=>?@@?====;<:;:<:11r�����������������+.�����������������( !'%*z���������������ɠ42gjmllklomooonpopmHG�����������������D>AEDEFEECEECCCDDEC46����������������׿0:���������������Ѿ,!!&&,|���������������ʡ61inknnoopoppoqqrqoEE�����������������FACGFFFFFFDFDDDDDDC57������������������09�����������������+!\"%%-~���������������ʡ42inopppppoqqqrrsrnAB�����������������C?DGGGGFFFFDFFDDEDC48������������������1;�����������������+!!\"#*|���������������ʡ62imoppppqqqqrtrqtrGD�����������������H?CGGGGGGGGFFFFFFDB38������������������1<���������������Խ,  \u001f!)}���������������ˢ63mooppqqqqqqrrtvtoDH�����������������JACHHGGHGGFFFDDGGFD29������������������3>���������������׽, \u001f\u001e$){���������������ˢ53jpppqprqrrrttuvuo>H�����������������JAFHHHHHGGHGGFGGFFE28������������������3:���������������ڽ- \u001f\u001a\"*{���������������̣53loqpqsqrrrtrutsvrAH�����������������HCGHIHHHHHHGFGHGGGD5;������������������28�����������������,\u001e\u001f\u001d +}���������������ʡ52mqoqpqrttttttuurpFI�����������������OCEHHIHHHHGHGGFFIGF8<������������������48���������������ۿ,\u001e\u001f \u001e(|���������������ʢ41krqpqqqrrtrtuvtuoEH�����������������PBHHIIIHIIHIHGHGHHE7<������������������58�����������������*\u001f\u001f  (z���������������ʡ63kpqprqqstttutrvvoFO�����������������LEHHIIHIHHHIGHGIHGF4=������������������5<�����������������*\u001f\u001f  'z���������������ȡ62lppqrqrrrtttuttvpAG�����������������MGHIIIIHIIIHHIIJHHG4<������������������4<�����������������+\u001f\u001f !){���������������Ƞ62jopqqqqqrtttutttrEH�����������������OHFIIIIIJIIIIHIHIHI7>������������������5;�����������������,\u001f\u001f !)z���������������Ɵ53lppqqrqrtttuuuutsFI�����������������RHGJIJHJKJJJIIIIIIH9>������������������5;�����������������+ \u001f !({���������������Ŝ41joppprqrrrutttvvrIH�����������������THCJJJJJIJIJJIJJJIH7=������������������5;�����������������+\u001f\u001f  (u�����������������65gjlmmmnoopnpprpqoIH�����������������OIBIJJJIJJJJIIIHHHG89������������������29���������������ʾ'\u001f\u001f  \"&,-*)-01/,0/12102-+04448789<>>??AFAD@DBCIJNRWTSUXT[WUQUOKFEBBABA?>>=<<;;67942:<<<>9999864565363&(13335422./1/-+..+\u001f\u001f\u001f  !\"&$$\"\"$\"&$%'()(''*+-0124688:<>>??A>?EBCHKOLJLNOSQOXQQVMLACGHGHIGFHGDCCBB@??7432233210111.,++,++%(++)*(''%%%$$#%&$#\u001d\u001e\u001f  \")0/001120024455520+-U]`addcdhefeekecYGFJRXYYVWWZWVXXVZTOBF}����������������K7Ybccddfeg`^]^]\\[Z[*)OTTPPQPOKOLLJJLIK \u001d\u001f  !1;:9:<<===;=???A@9*/�����������������FJmxyxwyzzzxyzzz{zxLO�����������������]=������������������.-���������������y#\u001d\u001f !!2><=;==>=<<>@@@@A9-0�����������������IKnz||{|{||{}}~}}{zLO�����������������]>������������������..����������������~%\u001c\u001e  $2==;<>>?===>@A@AB;+1�����������������JJo{|y{||}{||}}}}}yMT�����������������_>������������������-.����������������}#\u001c\u001f  %2<=;=<@?>==>?A@AA9+3�����������������FMlz{{y|}}}}||}|}}{MT�����������������d>������������������-,����������������#\u001c\u001d\u001d %1<<<;==<<=>?A?@AA:,3�����������������INo{{y{||||}|}}|~}{RT�����������������d=������������������/-����������������}#\u001d\u001d\u001c!$0<<<=<<==>A@@>@AA:-2�����������������HInzz{{||{{}~~}}|}zMR�����������������d=������������������++����������������~#\u001c\u001f \"$/;<==>;===@@@@>AA:+2�����������������KHn||y|||||{}~}|}|xMS�����������������d=������������������+,����������������}#\u001d ! \"/:<=>@<<>=@@@@@AA;-3�����������������MFs||{{{y}z}}|}|}}yMW�����������������c>������������������,)����������������|!\u001c\u001f\u001e !1;>?>><<>@>>=>ABB;,0�����������������LHr{|{|}|y|}}}}}zNX�����������������c?������������������()����������������z#\u001c\u001d  $/;;<=;<>>=>>>@@BB:,1�����������������IInyz||||||{||}{~|{NV�����������������c;�����������������('����������������}#\u001c\u001d\u001f $0:<==<;>@>>>>@ABB:,/�����������������HLlx|}y{y{|y{|}}}}yMR�����������������d>~�����������������*(���������������y\"\u001c\u001c !&3:;<<;==@@=>AABBA;-3�����������������KLqz{|||y{}|}{}|~{zRQ�����������������c9w�����������������)'����������������y\"\u001c\u001b !%1<<;=>===<=@@ABBC<.5�����������������IIlz{|}~~~|}{||~}}zMU�����������������d;p�����������������)$���������������x\"\u001a\u001d  $2===<==@=<>=ABBBC?/0�����������������IGkz}}{||}{||y||}zyOV�����������������c7o�����������������'&~����������~�z\"\u001c\u001c#\"#/;<:<<?>;===@?AAA>07�����������������GGgwxz{yyxyzzyz{yuuHO�����������������\\8v�����������������'$w~~}|||{~|{zxxxxv!\u001c\u001d\"\"\"'*+(+)*))()+,,.../0398;=<=>DCCDDCBBDHBCJMMLMPNPOJPKPSJDICCNMPONMNNOKHIFDBHE3/46433323.....*+,)( \u001c!##!!!!!$#$$#$#&\"\u001d\u001b\u001c!!\"(+**,,*+.//1478:<:33ACDFGGIIHIJLPKNMQFIPTTRVXVUXUUTXUSTNEGGFDEFAA>==;94877520-,))*(((('&$#!!\"  \u001c\u001d\u001c\u001b\u001a\u001b\u001c\u001b\u001b\u001b\u001b\u001b\u001c\u001c\u001d\u001c\u001c\u001d\u001b\u001b\u001b\u001c&%'FQPQR]dq����������=F�����������������QN�����������������LE����znki^[YTPUOS;.%-/12322221/10//,/\u001d\u001c\u001c\u001b\u001b\u001c\u001c\u001b\u001b\u001b\u001b\u001c\u001c\u001d\u001d\u001d\u001d\u001d\u001c\u001b\u001b\u001c%#0������������������@Q�����������������QM�����������������KE�����������������H01NNQOQQOOMNNLKLJGB\u001f\u001c\u001b\u001c\u001a\u001a\u001b\u001a\u001a\u001b\u001b\u001b\u001b\u001c\u001c\u001c\u001c\u001b\u001b\u001a\u001b\u001b'&/������������������AW�����������������OL�����������������KE�����������������F-,PQQPQPPQPOONMNNKE\u001f\u001a\u001a\u001c\u001a\u001b\u001a\u001a\u001a\u001b\u001b\u001a\u001a\u001b\u001c\u001b\u001b\u001b\u001c\u001b\u001a\u001b''0������������������CZ�����������������RM�����������������JE�����������������F,*NSQPPQOOOOMNNMKID\u001f\u001b\u001b\u001b\u001a\u0018\u001a\u001a\u001a\u001b\u001b\u001a\u001a\u001b\u001b\u001b\u001c\u001c\u001c\u001a\u001a\u001b('2������������������D[�����������������QK�����������������IF�����������������F,*NPPPPPPNOONMMMJIF!\u001a\u0019\u001b\u001a\u001a\u0019\u001a\u001a\u001a\u001a\u001a\u001b\u0019\u001b\u001b\u001b\u001c\u001b\u001c\u001a\u001a'(2������������������F]�����������������RL�����������������HD����������������F+%MPPPPOOONONNMMKID\u001f\u001b\u001a\u001a\u0019\u001a\u001a\u001a\u001a\u0019\u001a\u001a\u001a\u0019\u001a\u001b\u001b\u001b\u001b\u001b\u001a\u001b)*4������������������D^�����������������PL�����������������IC�����������������F+&NPOOOPPOONMMKMKHD\u001e\u001b\u001a\u001b\u001a\u001b\u0019\u001b\u001b\u001b\u001a\u001b\u001a\u001b\u001a\u001b\u001b\u001b\u001b\u001b\u001a\u001b**6������������������D_�����������������QJ�����������������FC~����������������F,'MPOOOOONONNKKIIIG\u001f\u001b\u0019\u001b\u001b\u001a\u001a\u001a\u001a\u001b\u0019\u001a\u001a\u001b\u001b\u001c\u001b\u001b\u001b\u0019\u0019\u001b,+7������������������D^�����������������QI�����������������EB|����������������E+&MONOOONNNNKMJKJHH\u001f\u001c\u001b\u001a\u001a\u001a\u001a\u0019\u001a\u0019\u0019\u001a\u001a\u001b\u001c\u001a\u001a\u001b\u0019\u001a\u001a\u001a,-8������������������D]�����������������PI�����������������HE����������������C,#LOOOONONNNKKKMKJF\u001f\u001c\u001a\u001a\u001b\u001a\u001a\u001a\u0019\u001a\u001b\u001a\u0019\u0019\u001a\u001b\u001c\u001a\u001a\u001b\u001a\u001a,*6������������������Ca�����������������MH�����������������IF�����������������D*%KONOMNMMKMKJJJIJE\u001f\u001c\u001a\u001a\u001b\u001a\u001a\u001a\u001a\u0019\u0019\u001b\u001b\u001b\u001a\u001a\u001c\u001a\u001a\u001c\u001b\u001a,,6������������������B^�����������������MG�����������������HB}����������������D+&LONOOONNMMMMKLKIA\u001e\u001b\u001b\u001c\u001b\u001b\u001b\u0019\u001a\u001a\u001a\u0019\u001a\u001a\u001b\u001a\u001b\u001c\u001c\u001b\u001a\u001c,,6������������������A\\�����������������MF�����������������IE����������������E+&LNNMONNMMKKKKKIHF \u001d\u001b\u001c\u001b\u001a\u001a\u001b\u001b\u001b\u001b\u001a\u001a\u001b\u001a\u0019\u0019\u001a\u001a\u001a\u001b\u001a--6������������������A[�����������������KF�����������������JC����������������F*&LMONMNMNKKJMKJJIF \u001d\u001b\u001a\u001b\u001a\u001b\u001b\u001c\u001b\u001b\u001a\u001c\u001b\u001a\u001c\u001d\u001c\u001c\u001b\u001b\u001c**5������������������>W�����������������KE�����������������F?}����������������C*%KONNNJKKKMKJKJKID\u001e\u001d\u001c\u001a\u001b\u001a\u001b\u001c\u001b\u001d\u001c\u001c\u001a\u001b\u001b\u001c\u001b\u001a\u001c\u0019\u001b\u001c,*4������������������<W�����������������MA�����������������GCx����������������B)%HKLKKJJJKIHIHHFGC!\u001d\u001c\u001a\u001b\u001c\u001b\u001b\u001c\u001a\u0019\u001a\u001b\u001c\u001b\u001a\u001b\u001c\u001c\u0019\u001b\u001c()*q����������������o39v|}wwwwwwrqtuspn=9^gadcfgce`dbUY[\\^>;DIJDB?FEGE=7>8634.(&&(%&*&%%'+*)+*#%(\u001e\u001f\u001c\u0019\u001a\u001c\u001b\u001b\u001b\u001b\u001b\u001c\u001c\u001c\u001c\u001e\u001c\u001b\u001b\u0018\u001b\u001c)''03364443233222243/-+133423333423766645789:><<<;<;<?=?;<<:78673/001113--.-+*)&&#\"&$#%&\"\"$!!\u001f\u001f\u001f\u001f \u001f\u001d\u001d\u001b\u001d\u001c\u001b\u001c\u001c\u001b\u001b\u001d\u001b\u001c\u001c\u001d\u001c\u001c\u001c\u0017\u001c\u001c))+rbPpAD9-*******+*++)++--.//./.0/21453469:=;98<;<>=;><7766666741012.-13/-+-/(''&&&%%&$.%0()-%-#-#' \u001e#\u001f&\u001c(\u001c%\u001c \u001b\u001c\u001d\u001d\u001d\u001c\u001d\u001c\u001c)))h�n�YQg�7(*))))*)**,--....../0/0001357666::;;>?>AA866666666656565300/20/.-*)(('((&&%)d=yoP�<�?�F�QFx;�2�1�0\u001e\u001e\u001c\u001d\u001f\u001c\u001d\u001c\u001c\u001c))*RQ.0*,,5*(*))))*,**,+/.../...02/22224456468;:>BB;>;:76666666666755303033/,.-*(())('&')#)\"##(+$+\u001f*\u001d\u001f#\u001f)\u001f) &\u001b\u001f\u001f\u001f \u001f\u001f\u001c\u001c\u001c\u001c\ndiff --git a/utils/raspberrypi/ctt/ctt_tools.py b/utils/raspberrypi/ctt/ctt_tools.py\ndeleted file mode 100644\nindex 50b01ecfe94b..000000000000\n--- a/utils/raspberrypi/ctt/ctt_tools.py\n+++ /dev/null\n@@ -1,150 +0,0 @@\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2019, Raspberry Pi Ltd\n-#\n-# camera tuning tool miscellaneous\n-\n-import time\n-import re\n-import binascii\n-import os\n-import cv2\n-import numpy as np\n-import imutils\n-import sys\n-import matplotlib.pyplot as plt\n-from sklearn import cluster as cluster\n-from sklearn.neighbors import NearestCentroid as get_centroids\n-\n-\"\"\"\n-This file contains some useful tools, the details of which aren't important to\n-understanding of the code. They ar collated here to attempt to improve code\n-readability in the main files.\n-\"\"\"\n-\n-\n-\"\"\"\n-obtain config values, unless it doesnt exist, in which case pick default\n-Furthermore, it can check if the input is the correct type\n-\"\"\"\n-def get_config(dictt, key, default, ttype):\n-    try:\n-        val = dictt[key]\n-        if ttype == 'string':\n-            val = str(val)\n-        elif ttype == 'num':\n-            if 'int' not in str(type(val)):\n-                if 'float' not in str(type(val)):\n-                    raise ValueError\n-        elif ttype == 'dict':\n-            if not isinstance(val, dict):\n-                raise ValueError\n-        elif ttype == 'list':\n-            if not isinstance(val, list):\n-                raise ValueError\n-        elif ttype == 'bool':\n-            ttype = int(bool(ttype))\n-        else:\n-            val = dictt[key]\n-    except (KeyError, ValueError):\n-        val = default\n-    return val\n-\n-\n-\"\"\"\n-argument parser\n-\"\"\"\n-def parse_input():\n-    arguments = sys.argv[1:]\n-    if len(arguments) % 2 != 0:\n-        raise ArgError('\\n\\nERROR! Enter value for each arguent passed.')\n-    params = arguments[0::2]\n-    vals = arguments[1::2]\n-    args_dict = dict(zip(params, vals))\n-    json_output = get_config(args_dict, '-o', None, 'string')\n-    directory = get_config(args_dict, '-i', None, 'string')\n-    config = get_config(args_dict, '-c', None, 'string')\n-    log_path = get_config(args_dict, '-l', None, 'string')\n-    target = get_config(args_dict, '-t', \"vc4\", 'string')\n-    if directory is None:\n-        raise ArgError('\\n\\nERROR! No input directory given.')\n-    if json_output is None:\n-        raise ArgError('\\n\\nERROR! No output json given.')\n-    return json_output, directory, config, log_path, target\n-\n-\n-\"\"\"\n-custom arg and macbeth error class\n-\"\"\"\n-class ArgError(Exception):\n-    pass\n-class MacbethError(Exception):\n-    pass\n-\n-\n-\"\"\"\n-correlation function to quantify match\n-\"\"\"\n-def correlate(im1, im2):\n-    f1 = im1.flatten()\n-    f2 = im2.flatten()\n-    cor = np.corrcoef(f1, f2)\n-    return cor[0][1]\n-\n-\n-\"\"\"\n-get list of files from directory\n-\"\"\"\n-def get_photos(directory='photos'):\n-    filename_list = []\n-    for filename in os.listdir(directory):\n-        if 'jp' in filename or '.dng' in filename:\n-            filename_list.append(filename)\n-    return filename_list\n-\n-\n-\"\"\"\n-display image for debugging... read at your own risk...\n-\"\"\"\n-def represent(img, name='image'):\n-    # if type(img) == tuple or type(img) == list:\n-    #     for i in range(len(img)):\n-    #         name = 'image {}'.format(i)\n-    #         cv2.imshow(name, img[i])\n-    # else:\n-    #     cv2.imshow(name, img)\n-    # cv2.waitKey(0)\n-    # cv2.destroyAllWindows()\n-    # return 0\n-    \"\"\"\n-    code above displays using opencv, but this doesn't catch users pressing 'x'\n-    with their mouse to close the window....  therefore matplotlib is used....\n-    (thanks a lot opencv)\n-    \"\"\"\n-    grid = plt.GridSpec(22, 1)\n-    plt.subplot(grid[:19, 0])\n-    plt.imshow(img, cmap='gray')\n-    plt.axis('off')\n-    plt.subplot(grid[21, 0])\n-    plt.title('press \\'q\\' to continue')\n-    plt.axis('off')\n-    plt.show()\n-\n-    # f = plt.figure()\n-    # ax = f.add_subplot(211)\n-    # ax2 = f.add_subplot(122)\n-    # ax.imshow(img, cmap='gray')\n-    # ax.axis('off')\n-    # ax2.set_figheight(2)\n-    # ax2.title('press \\'q\\' to continue')\n-    # ax2.axis('off')\n-    # plt.show()\n-\n-\n-\"\"\"\n-reshape image to fixed width without distorting\n-returns image and scale factor\n-\"\"\"\n-def reshape(img, width):\n-    factor = width/img.shape[0]\n-    return cv2.resize(img, None, fx=factor, fy=factor), factor\ndiff --git a/utils/raspberrypi/ctt/ctt_vc4.py b/utils/raspberrypi/ctt/ctt_vc4.py\ndeleted file mode 100755\nindex dd0c541494a9..000000000000\n--- a/utils/raspberrypi/ctt/ctt_vc4.py\n+++ /dev/null\n@@ -1,133 +0,0 @@\n-#!/usr/bin/env python3\n-#\n-# SPDX-License-Identifier: BSD-2-Clause\n-#\n-# Copyright (C) 2019, Raspberry Pi Ltd\n-#\n-# ctt_vc4.py - camera tuning tool data for VC4 platforms\n-\n-\n-json_template = {\n-    \"rpi.black_level\": {\n-        \"black_level\": 4096\n-    },\n-    \"rpi.dpc\": {\n-    },\n-    \"rpi.lux\": {\n-        \"reference_shutter_speed\": 10000,\n-        \"reference_gain\": 1,\n-        \"reference_aperture\": 1.0\n-    },\n-    \"rpi.noise\": {\n-    },\n-    \"rpi.geq\": {\n-    },\n-    \"rpi.sdn\": {\n-    },\n-    \"rpi.awb\": {\n-        \"priors\": [\n-            {\"lux\": 0, \"prior\": [2000, 1.0, 3000, 0.0, 13000, 0.0]},\n-            {\"lux\": 800, \"prior\": [2000, 0.0, 6000, 2.0, 13000, 2.0]},\n-            {\"lux\": 1500, \"prior\": [2000, 0.0, 4000, 1.0, 6000, 6.0, 6500, 7.0, 7000, 1.0, 13000, 1.0]}\n-        ],\n-        \"modes\": {\n-            \"auto\": {\"lo\": 2500, \"hi\": 8000},\n-            \"incandescent\": {\"lo\": 2500, \"hi\": 3000},\n-            \"tungsten\": {\"lo\": 3000, \"hi\": 3500},\n-            \"fluorescent\": {\"lo\": 4000, \"hi\": 4700},\n-            \"indoor\": {\"lo\": 3000, \"hi\": 5000},\n-            \"daylight\": {\"lo\": 5500, \"hi\": 6500},\n-            \"cloudy\": {\"lo\": 7000, \"hi\": 8600}\n-        },\n-        \"bayes\": 1\n-    },\n-    \"rpi.agc\": {\n-        \"metering_modes\": {\n-            \"centre-weighted\": {\n-                \"weights\": [3, 3, 3, 2, 2, 2, 2, 1, 1, 1, 1, 0, 0, 0, 0]\n-            },\n-            \"spot\": {\n-                \"weights\": [2, 1, 1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0]\n-            },\n-            \"matrix\": {\n-                \"weights\": [1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1, 1]\n-            }\n-        },\n-        \"exposure_modes\": {\n-            \"normal\": {\n-                \"shutter\": [100, 10000, 30000, 60000, 66666],\n-                \"gain\": [1.0, 2.0, 4.0, 6.0, 8.0]\n-            },\n-            \"short\": {\n-                \"shutter\": [100, 5000, 10000, 20000, 66666],\n-                \"gain\": [1.0, 2.0, 4.0, 6.0, 8.0]\n-            },\n-            \"long\": {\n-                \"shutter\": [ 100, 10000, 30000, 60000, 120000 ],\n-                \"gain\": [ 1.0, 2.0, 4.0, 6.0, 8.0 ]\n-            }\n-        },\n-        \"constraint_modes\": {\n-            \"normal\": [\n-                {\"bound\": \"LOWER\", \"q_lo\": 0.98, \"q_hi\": 1.0, \"y_target\": [0, 0.5, 1000, 0.5]}\n-            ],\n-            \"highlight\": [\n-                {\"bound\": \"LOWER\", \"q_lo\": 0.98, \"q_hi\": 1.0, \"y_target\": [0, 0.5, 1000, 0.5]},\n-                {\"bound\": \"UPPER\", \"q_lo\": 0.98, \"q_hi\": 1.0, \"y_target\": [0, 0.8, 1000, 0.8]}\n-            ]\n-        },\n-        \"y_target\": [0, 0.16, 1000, 0.165, 10000, 0.17]\n-    },\n-    \"rpi.alsc\": {\n-        'omega': 1.3,\n-        'n_iter': 100,\n-        'luminance_strength': 0.7,\n-    },\n-    \"rpi.contrast\": {\n-        \"ce_enable\": 1,\n-        \"gamma_curve\": [\n-            0,     0,\n-            1024,  5040,\n-            2048,  9338,\n-            3072,  12356,\n-            4096,  15312,\n-            5120,  18051,\n-            6144,  20790,\n-            7168,  23193,\n-            8192,  25744,\n-            9216,  27942,\n-            10240, 30035,\n-            11264, 32005,\n-            12288, 33975,\n-            13312, 35815,\n-            14336, 37600,\n-            15360, 39168,\n-            16384, 40642,\n-            18432, 43379,\n-            20480, 45749,\n-            22528, 47753,\n-            24576, 49621,\n-            26624, 51253,\n-            28672, 52698,\n-            30720, 53796,\n-            32768, 54876,\n-            36864, 57012,\n-            40960, 58656,\n-            45056, 59954,\n-            49152, 61183,\n-            53248, 62355,\n-            57344, 63419,\n-            61440, 64476,\n-            65535, 65535\n-        ]\n-    },\n-    \"rpi.ccm\": {\n-    },\n-    \"rpi.sharpen\": {\n-        \"threshold\": 0.75,\n-        \"limit\": 0.5,\n-        \"strength\": 1.0\n-    }\n-}\n-\n-grid_size = (16, 12)\ndiff --git a/utils/raspberrypi/ctt/ctt_visualise.py b/utils/raspberrypi/ctt/ctt_visualise.py\ndeleted file mode 100644\nindex ed2339fd1369..000000000000\n--- a/utils/raspberrypi/ctt/ctt_visualise.py\n+++ /dev/null\n@@ -1,43 +0,0 @@\n-\"\"\"\n-Some code that will save virtual macbeth charts that show the difference between optimised matrices and non optimised matrices\n-\n-The function creates an image that is 1550 by 1050 pixels wide, and fills it with patches which are 200x200 pixels in size\n-Each patch contains the ideal color, the color from the original matrix, and the color from the final matrix\n-_________________\n-|               |\n-|  Ideal Color  |\n-|_______________|\n-|  Old  |  new  |\n-| Color | Color |\n-|_______|_______|\n-\n-Nice way of showing how the optimisation helps change the colors and the color matricies\n-\"\"\"\n-import numpy as np\n-from PIL import Image\n-\n-\n-def visualise_macbeth_chart(macbeth_rgb, original_rgb, new_rgb, output_filename):\n-    image = np.zeros((1050, 1550, 3), dtype=np.uint8)\n-    colorindex = -1\n-    for y in range(6):\n-        for x in range(4):  # Creates 6 x 4 grid of macbeth chart\n-            colorindex += 1\n-            xlocation = 50 + 250 * x  # Means there is 50px of black gap between each square, more like the real macbeth chart.\n-            ylocation = 50 + 250 * y\n-            for g in range(200):\n-                for i in range(100):\n-                    image[xlocation + i, ylocation + g] = macbeth_rgb[colorindex]\n-            xlocation = 150 + 250 * x\n-            ylocation = 50 + 250 * y\n-            for i in range(100):\n-                for g in range(100):\n-                    image[xlocation + i, ylocation + g] = original_rgb[colorindex]  # Smaller squares below to compare the old colors with the new ones\n-            xlocation = 150 + 250 * x\n-            ylocation = 150 + 250 * y\n-            for i in range(100):\n-                for g in range(100):\n-                    image[xlocation + i, ylocation + g] = new_rgb[colorindex]\n-\n-    img = Image.fromarray(image, 'RGB')\n-    img.save(str(output_filename) + 'Generated Macbeth Chart.png')\ndiff --git a/utils/raspberrypi/delayedctrls_parse.py b/utils/raspberrypi/delayedctrls_parse.py\ndeleted file mode 100644\nindex 1decf73f0906..000000000000\n--- a/utils/raspberrypi/delayedctrls_parse.py\n+++ /dev/null\n@@ -1,113 +0,0 @@\n-# SPDX-License-Identifier: BSD-2-Clause\n-\n-import re\n-import sys\n-import os\n-\n-if len(sys.argv) != 2:\n-    print(\"Usage: {} <infile>\".format(sys.argv[0]))\n-    sys.exit()\n-\n-infile = sys.argv[1]\n-insplit = os.path.splitext(infile)\n-outfile = insplit[0] + '_parsed' + insplit[1]\n-\n-frame_re = re.compile(r'frame (\\d+) started')\n-\n-delays = {\n-    'Analogue Gain': 1,\n-    'Exposure': 2,\n-    'Vertical Blanking': 2\n-}\n-\n-ctrl_action = {\n-    'Write': {},\n-    'Get': {},\n-    'Queue': {},\n-    'No-op': {}\n-}\n-\n-ctrl_re = {\n-    'Write': re.compile(r'Setting (.*?) to (\\d+) at index (\\d+)'),\n-    'No-op': re.compile(r'Queue is empty, (.*?) (.*?) (.*?)'),\n-    'Get': re.compile(r'Reading (.*?) to (\\d+) at index (\\d+)'),\n-    'Queue': re.compile(r'Queuing (.*?) to (\\d+) at index (\\d+)')\n-}\n-\n-frame_num = -1\n-\n-max_delay = 0\n-for k, d in delays.items():\n-    if max_delay < d:\n-        max_delay = d\n-\n-with open(infile) as f:\n-    lines = f.readlines()\n-\n-for line in lines:\n-    r = frame_re.search(line)\n-    if r:\n-        frame_num = int(r.group(1))\n-\n-    for (key, re) in ctrl_re.items():\n-        r = re.search(line)\n-        if r:\n-            ctrl_action[key][(frame_num, r.group(1))] = (r.group(2), r.group(3))\n-\n-with open(outfile, 'wt') as f:\n-    queueIndex = 1\n-    f.write('{:<10}{:<15}{:<12}{:<18}{}\\n'.format('Frame', 'Action', 'Gain', 'Exposure', 'Vblank'))\n-    for frame in range(0, frame_num + 1):\n-        for (k, a) in ctrl_action.items():\n-            str = '{:<10}{:<10}'.format(frame, k)\n-\n-            for c in delays.keys():\n-                # Tabulate all results\n-                str += '{:>5} {:<10}'.format(a[(frame, c)][0] if (frame, c) in a.keys() else '---',\n-                                             '[' + (a[(frame, c)][1] if (frame, c) in a.keys() else '-') + ']')\n-\n-            f.write(str.strip() + '\\n')\n-\n-# Test the write -> get matches the set delay.\n-for (frame, c) in ctrl_action['Write'].keys():\n-    set_value = ctrl_action['Write'][(frame, c)][0]\n-    delay_frame = frame + delays[c]\n-    if (delay_frame <= frame_num):\n-        if (delay_frame, c) in ctrl_action['Get']:\n-            get_value = ctrl_action['Get'][(delay_frame, c)][0]\n-            if get_value != set_value:\n-                print('Error: {} written at frame {} to value {} != {} at frame {}'\n-                      .format(c, frame, set_value, get_value, delay_frame))\n-        else:\n-            print('Warning: {} written at frame {} to value {} did not get logged on frame {} - dropped frame?'\n-                  .format(c, frame, set_value, delay_frame))\n-\n-# Test the queue -> write matches the set delay.\n-for (frame, c) in ctrl_action['Queue'].keys():\n-    set_value = ctrl_action['Queue'][(frame, c)][0]\n-    delay_frame = frame + max_delay - delays[c] + 1\n-    if (delay_frame <= frame_num):\n-        if (delay_frame, c) in ctrl_action['Write']:\n-            write_value = ctrl_action['Write'][(delay_frame, c)][0]\n-            if write_value != set_value:\n-                print('Info: {} queued at frame {} to value {} != {} written at frame {}'\n-                      ' - lagging behind or double queue on a single frame!'\n-                      .format(c, frame, set_value, write_value, delay_frame))\n-        else:\n-            print('Warning: {} queued at frame {} to value {} did not get logged on frame {} - dropped frame?'\n-                  .format(c, frame, set_value, delay_frame))\n-\n-# Test the get -> write matches the set delay going backwards.\n-for (frame, c) in ctrl_action['Get'].keys():\n-    get_value = ctrl_action['Get'][(frame, c)][0]\n-    delay_frame = frame - delays[c]\n-    if (delay_frame >= 6):\n-        if (delay_frame, c) in ctrl_action['Write']:\n-            write_value = ctrl_action['Write'][(delay_frame, c)][0]\n-            if get_value != write_value:\n-                print('Info: {} got at frame {} to value {} != {} written at frame {}'\n-                      ' - lagging behind or double queue on a single frame!'\n-                      .format(c, frame, get_value, write_value, delay_frame))\n-        else:\n-            print('Warning: {} got at frame {} to value {} did not get written on frame {}'\n-                  .format(c, frame, get_value, delay_frame))\n","prefixes":[]}